IE52019B1 - Process for the preparation of heterocyclylalkyl guanidines;intermediates and their preparation - Google Patents
Process for the preparation of heterocyclylalkyl guanidines;intermediates and their preparationInfo
- Publication number
- IE52019B1 IE52019B1 IE1202/81A IE120281A IE52019B1 IE 52019 B1 IE52019 B1 IE 52019B1 IE 1202/81 A IE1202/81 A IE 1202/81A IE 120281 A IE120281 A IE 120281A IE 52019 B1 IE52019 B1 IE 52019B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- compound
- group
- hydrogen
- imidazolyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 24
- -1 heterocyclylalkyl guanidines Chemical class 0.000 title claims description 37
- 239000000543 intermediate Substances 0.000 title abstract description 10
- 238000002360 preparation method Methods 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 47
- 239000001257 hydrogen Substances 0.000 claims abstract description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 15
- 239000002253 acid Substances 0.000 claims abstract description 11
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 11
- 150000002367 halogens Chemical class 0.000 claims abstract description 11
- 238000004519 manufacturing process Methods 0.000 claims abstract description 10
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 6
- 125000000547 substituted alkyl group Chemical group 0.000 claims abstract description 6
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 3
- 150000001721 carbon Chemical group 0.000 claims abstract description 3
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 20
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 10
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 10
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 238000011065 in-situ storage Methods 0.000 claims description 9
- 239000003495 polar organic solvent Substances 0.000 claims description 7
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 6
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical group [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- LYDZWSXSMWJVKR-UHFFFAOYSA-N n-(5h-imidazo[1,5-c][1,3]diazepin-8-yl)benzamide Chemical compound C=1C2=CN=CN2CN=CC=1NC(=O)C1=CC=CC=C1 LYDZWSXSMWJVKR-UHFFFAOYSA-N 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 239000012312 sodium hydride Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 230000000269 nucleophilic effect Effects 0.000 claims description 3
- GJYZVIAFOIUOHE-UHFFFAOYSA-N n-(3,5,6,7-tetrahydroimidazo[1,5-c][1,3]diazocin-9-yl)benzamide Chemical compound C=1CNCN2CN=CC2=CC=1NC(=O)C1=CC=CC=C1 GJYZVIAFOIUOHE-UHFFFAOYSA-N 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- UVDNQCJTLKYZME-UHFFFAOYSA-N 2-[(5-methyl-1h-imidazol-2-yl)methylsulfanyl]ethanamine Chemical compound CC1=CN=C(CSCCN)N1 UVDNQCJTLKYZME-UHFFFAOYSA-N 0.000 claims 1
- 230000003301 hydrolyzing effect Effects 0.000 claims 1
- MURRAGMMNAYLNA-UHFFFAOYSA-N impromidine Chemical compound N1C=NC(CSCCNC(N)=NCCCC=2NC=NC=2)=C1C MURRAGMMNAYLNA-UHFFFAOYSA-N 0.000 abstract description 3
- 229950005073 impromidine Drugs 0.000 abstract description 3
- 125000002883 imidazolyl group Chemical group 0.000 abstract description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 70
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 238000003756 stirring Methods 0.000 description 13
- 239000000203 mixture Substances 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229960004198 guanidine Drugs 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229960004132 diethyl ether Drugs 0.000 description 5
- 229960001340 histamine Drugs 0.000 description 5
- IHDFTEVCMVTMSP-UHFFFAOYSA-N 3-(1h-imidazol-5-yl)propan-1-amine Chemical compound NCCCC1=CN=CN1 IHDFTEVCMVTMSP-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 239000005864 Sulphur Chemical group 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 235000010290 biphenyl Nutrition 0.000 description 4
- 239000004305 biphenyl Substances 0.000 description 4
- 125000006267 biphenyl group Chemical group 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- JEOZNMMOIBLWLV-UHFFFAOYSA-N 2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethanamine Chemical compound CC=1N=CNC=1CSCCN JEOZNMMOIBLWLV-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- VJSUMPPMFYQOMP-UHFFFAOYSA-N 4-(1h-imidazol-5-yl)butan-1-amine Chemical compound NCCCCC1=CNC=N1 VJSUMPPMFYQOMP-UHFFFAOYSA-N 0.000 description 2
- UGYXPZQILZRKJJ-UHFFFAOYSA-N 4-methylhistamine Chemical compound CC=1NC=NC=1CCN UGYXPZQILZRKJJ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- QMEQRAVKGMJJIU-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]thiophen-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=C(CSCCN)S1 QMEQRAVKGMJJIU-UHFFFAOYSA-N 0.000 description 1
- MSRJJSCOWHWGGX-UHFFFAOYSA-N 2h-1,3-diazepine Chemical compound C1N=CC=CC=N1 MSRJJSCOWHWGGX-UHFFFAOYSA-N 0.000 description 1
- PVHCPYBTLMDBNH-UHFFFAOYSA-N 3-(4-bromo-1h-imidazol-5-yl)propan-1-amine Chemical compound NCCCC=1NC=NC=1Br PVHCPYBTLMDBNH-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- LHGHPXXMKYMMKB-UHFFFAOYSA-N 5h-imidazo[1,5-c][1,3]diazepine Chemical compound C1N=CC=CC2=CN=CN12 LHGHPXXMKYMMKB-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 235000019439 ethyl acetate Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- BDSVELRAKXNYGM-UHFFFAOYSA-N phenyl carbamimidate Chemical compound NC(=N)OC1=CC=CC=C1 BDSVELRAKXNYGM-UHFFFAOYSA-N 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- ZVUUCUFDAHKLKT-UHFFFAOYSA-M sodium;2,4,6-trinitrophenolate Chemical compound [Na+].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O ZVUUCUFDAHKLKT-UHFFFAOYSA-M 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/64—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms, e.g. histidine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/68—Halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8017881 | 1980-05-31 | ||
| AU71026/81A AU542270B2 (en) | 1980-05-31 | 1981-05-26 | Imidazolylalkylguanidine derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE811202L IE811202L (en) | 1981-11-30 |
| IE52019B1 true IE52019B1 (en) | 1987-05-27 |
Family
ID=36782531
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1202/81A IE52019B1 (en) | 1980-05-31 | 1981-05-29 | Process for the preparation of heterocyclylalkyl guanidines;intermediates and their preparation |
Country Status (9)
| Country | Link |
|---|---|
| EP (1) | EP0041359B1 (esLanguage) |
| JP (1) | JPS5724387A (esLanguage) |
| AT (1) | ATE10277T1 (esLanguage) |
| AU (1) | AU542270B2 (esLanguage) |
| DE (1) | DE3167163D1 (esLanguage) |
| DK (1) | DK221081A (esLanguage) |
| GR (1) | GR75661B (esLanguage) |
| IE (1) | IE52019B1 (esLanguage) |
| ZA (1) | ZA813659B (esLanguage) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58157768A (ja) * | 1982-03-16 | 1983-09-19 | Takeda Chem Ind Ltd | 4−クロロ−2−フエニルイミダゾ−ル−5−酢酸誘導体 |
| DE3579000D1 (de) * | 1985-04-02 | 1990-09-06 | Heumann Pharma Gmbh & Co | Imidazolylalkylguanidinderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel. |
| DE3621104A1 (de) * | 1986-06-24 | 1988-01-07 | Heumann Pharma Gmbh & Co | 1,4-dihydropyridinderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DE3631334A1 (de) * | 1986-09-15 | 1988-03-17 | Heumann Pharma Gmbh & Co | Neue imidazolylguanidinderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| AU662135B2 (en) * | 1991-02-27 | 1995-08-24 | Seed Capital Investments (Sci) B.V. | Imidazole-derivatives having agonistic or antagonistic activity on the histamine H3-receptor |
| NL9100365A (nl) * | 1991-02-27 | 1992-09-16 | Seed Capital Investments | Imidazoolderivaten met agonistische of antagonistische activiteit op de histamine h3-receptor. |
| USRE37303E1 (en) * | 1992-01-10 | 2001-07-31 | Institut National Del La Sante Et De La Recherche Medicale | Imidazole compounds and their therapeutic applications |
| FR2686084B1 (fr) * | 1992-01-10 | 1995-12-22 | Bioprojet Soc Civ | Nouveaux derives de l'imidazole, leur preparation et leurs applications therapeutiques. |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3763179A (en) * | 1972-05-05 | 1973-10-02 | Upjohn Co | 2-imidazol-1-yl benzophenones |
| FR2254311A1 (en) * | 1973-12-13 | 1975-07-11 | Smith Kline French Lab | 4-Alkyl-5-(2-aminoethyl)imidazole compsns - for diagnosing secretory activity of the stomach, prepd eg from 4-methylhistamine or hex-3-yne-1-ol |
-
1981
- 1981-05-20 DK DK221081A patent/DK221081A/da not_active Application Discontinuation
- 1981-05-26 AU AU71026/81A patent/AU542270B2/en not_active Ceased
- 1981-05-27 AT AT81302336T patent/ATE10277T1/de active
- 1981-05-27 EP EP81302336A patent/EP0041359B1/en not_active Expired
- 1981-05-27 DE DE8181302336T patent/DE3167163D1/de not_active Expired
- 1981-05-28 GR GR65097A patent/GR75661B/el unknown
- 1981-05-29 IE IE1202/81A patent/IE52019B1/en unknown
- 1981-05-30 JP JP8369081A patent/JPS5724387A/ja active Pending
- 1981-06-02 ZA ZA00813659A patent/ZA813659B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE3167163D1 (en) | 1984-12-20 |
| GR75661B (esLanguage) | 1984-08-02 |
| ZA813659B (en) | 1982-08-25 |
| EP0041359A1 (en) | 1981-12-09 |
| AU7102681A (en) | 1981-12-10 |
| DK221081A (da) | 1981-12-01 |
| IE811202L (en) | 1981-11-30 |
| EP0041359B1 (en) | 1984-11-14 |
| AU542270B2 (en) | 1985-02-14 |
| JPS5724387A (en) | 1982-02-08 |
| ATE10277T1 (de) | 1984-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0548532B1 (en) | 5,6-Disubstituted-3-pyridylmethyl ammonium halide compounds useful for the preparation of 5-(substituted methyl)-2,3-pyridinedicarboxylic acids | |
| SK283895B6 (sk) | Spôsob výroby 5[2-etoxy-5-(4-metylpiperazinu-1-ylsulfonyl)- fenyl]-1-metyl-3-n-propyl-1,6-dihydro-7H-pyrazolo[4,3- d]pyrimidin-7-ónu | |
| KR20190013553A (ko) | 아미노피리미딘 유도체의 개선된 제조방법 | |
| US5726324A (en) | 1-(nitroaryl)pyrrole intermediates to pesticidal 1-(haloaryl)pyrroles | |
| EP0365030B1 (en) | Imidazole compound and process for preparing the same | |
| SK138599A3 (en) | Process for the preparation of pyrazolo[4,3-d] pyrimidin-7-ones and their intermaediates | |
| US6667398B2 (en) | Process for the preparation of pyrazolopyrimidinones | |
| EP0041359B1 (en) | Process for the preparation of heterocyclylalkyl guanidines; intermediates and their preparation | |
| HU204812B (en) | Process for producing imidazole derivatives | |
| FI76578C (fi) | Analogifoerfarande foer framstaellning av nya, terapeutiskt anvaendbara 5-(3-pyridyl)-1h,3h-pyrrolo/1,2-c/ tiazol-7-karboxi- och karbotioamider. | |
| KR100525698B1 (ko) | 피라졸로피리미디논의 제조 방법 | |
| CA2083790C (en) | Process for the production of 2-substituted 4,6-dialkoxypyrimidines | |
| US4841068A (en) | 3-hydroxy pyrazole derivatives | |
| US4375435A (en) | 3-,4-Dihydroimidazo (3,4-c)-1,3-pyrimidines and 4,5-dihydroimidazo (3,4-c)-1,3-diazepines | |
| JP4042164B2 (ja) | 1−(ヘテロ)アリール−3−ヒドロキシピラゾールの製造方法 | |
| US4443375A (en) | Tetrahydroimidazo(3,4-c)-1,3-diazocine intermediates for production of guanidines | |
| CA2245080C (en) | Process for the preparation of heteroarylcarboxylic amides and esters | |
| EA003145B1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ПИРАЗОЛО[4,3-d]ПИРИМИДИН-7-ОН-3- ПИРИДИЛСУЛЬФОНИЛЬНЫХ СОЕДИНЕНИЙ И ИХ ПРОМЕЖУТОЧНЫХ СОЕДИНЕНИЙ | |
| EP0081859A2 (en) | Process for preparing cimetidine | |
| US4292431A (en) | Process for the production of hydroxymethylimidazoles | |
| US4701556A (en) | Substituted cyanamide compounds useful for the manufacture of cephalosporin derivatives | |
| JPH0613477B2 (ja) | 5−ヒドラジノ−1h−ピラゾ−ル系化合物 | |
| FI75342C (fi) | Ett nytt foerfarande foer framstaellning av piroxicam och mellanprodukter laempliga foer dess framstaellning. | |
| JP2024505177A (ja) | 2-[2-(2-クロロチアゾール-5-イル)-2-オキソ-エチル]スルファニル-6-ヒドロキシ-3-メチル-5-フェニル-ピリミジン-4-オンを調製するための方法 | |
| US4692526A (en) | Process for preparing benzopyrano (2,3-d) triazoles |