IE51476B1 - 6(r)-(2-(8'-etherified-hydroxy-2',6'-dimethylpolyhydro-naphthyl-1')-ethyl)-4(r)-hydroxy-3,4,5,6-tetrahydro-2h-pyran-2-ones,the hydroxy acid form of said pyranones,the salts of said acid form,process for preparing the same and an antihypercholesterolemic pharmaceutical composition containing the same - Google Patents
6(r)-(2-(8'-etherified-hydroxy-2',6'-dimethylpolyhydro-naphthyl-1')-ethyl)-4(r)-hydroxy-3,4,5,6-tetrahydro-2h-pyran-2-ones,the hydroxy acid form of said pyranones,the salts of said acid form,process for preparing the same and an antihypercholesterolemic pharmaceutical composition containing the sameInfo
- Publication number
- IE51476B1 IE51476B1 IE167/81A IE16781A IE51476B1 IE 51476 B1 IE51476 B1 IE 51476B1 IE 167/81 A IE167/81 A IE 167/81A IE 16781 A IE16781 A IE 16781A IE 51476 B1 IE51476 B1 IE 51476B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- hydroxy
- acid
- product
- pharmaceutical composition
- Prior art date
Links
- 150000001261 hydroxy acids Chemical group 0.000 title claims description 14
- 150000003839 salts Chemical class 0.000 title claims description 9
- 239000002253 acid Substances 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 title claims 4
- 230000000326 anti-hypercholesterolaemic effect Effects 0.000 title claims 3
- 150000001875 compounds Chemical class 0.000 claims description 66
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 229910001868 water Inorganic materials 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 11
- -1 CF 3 or CN Inorganic materials 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 238000003756 stirring Methods 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 230000003197 catalytic effect Effects 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 claims description 4
- ZXSQEZNORDWBGZ-UHFFFAOYSA-N 1,3-dihydropyrrolo[2,3-b]pyridin-2-one Chemical compound C1=CN=C2NC(=O)CC2=C1 ZXSQEZNORDWBGZ-UHFFFAOYSA-N 0.000 claims description 3
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 claims description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 3
- 239000003153 chemical reaction reagent Substances 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 claims description 3
- ZDYVRSLAEXCVBX-UHFFFAOYSA-N pyridinium p-toluenesulfonate Chemical compound C1=CC=[NH+]C=C1.CC1=CC=C(S([O-])(=O)=O)C=C1 ZDYVRSLAEXCVBX-UHFFFAOYSA-N 0.000 claims description 3
- 229910001958 silver carbonate Inorganic materials 0.000 claims description 3
- LKZMBDSASOBTPN-UHFFFAOYSA-L silver carbonate Substances [Ag].[O-]C([O-])=O LKZMBDSASOBTPN-UHFFFAOYSA-L 0.000 claims description 3
- 239000012312 sodium hydride Substances 0.000 claims description 3
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 3
- 201000001320 Atherosclerosis Diseases 0.000 claims description 2
- 239000005909 Kieselgur Substances 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- 201000005577 familial hyperlipidemia Diseases 0.000 claims description 2
- 125000004175 fluorobenzyl group Chemical group 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 claims 1
- 229940121375 antifungal agent Drugs 0.000 claims 1
- 239000003429 antifungal agent Substances 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 125000000686 lactone group Chemical group 0.000 claims 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical compound C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 claims 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims 1
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 abstract description 8
- 230000015572 biosynthetic process Effects 0.000 abstract description 5
- 235000012000 cholesterol Nutrition 0.000 abstract description 4
- 230000002829 reductive effect Effects 0.000 abstract description 3
- 125000006239 protecting group Chemical group 0.000 abstract description 2
- 238000006266 etherification reaction Methods 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 70
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 51
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- 239000000741 silica gel Substances 0.000 description 22
- 229910002027 silica gel Inorganic materials 0.000 description 22
- 238000002360 preparation method Methods 0.000 description 20
- 239000000243 solution Substances 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000000706 filtrate Substances 0.000 description 13
- 239000003921 oil Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000012298 atmosphere Substances 0.000 description 8
- 238000010828 elution Methods 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 238000000855 fermentation Methods 0.000 description 8
- 230000004151 fermentation Effects 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000012299 nitrogen atmosphere Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 150000002596 lactones Chemical group 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical class O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000003389 potentiating effect Effects 0.000 description 3
- 238000012746 preparative thin layer chromatography Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- FIWILGQIZHDAQG-UHFFFAOYSA-N NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F Chemical compound NC1=C(C(=O)NCC2=CC=C(C=C2)OCC(F)(F)F)C=C(C(=N1)N)N1N=C(N=C1)C1(CC1)C(F)(F)F FIWILGQIZHDAQG-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- WBKFWQBXFREOFH-UHFFFAOYSA-N dichloromethane;ethyl acetate Chemical compound ClCCl.CCOC(C)=O WBKFWQBXFREOFH-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- QBERHIJABFXGRZ-UHFFFAOYSA-M rhodium;triphenylphosphane;chloride Chemical compound [Cl-].[Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QBERHIJABFXGRZ-UHFFFAOYSA-M 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VEPTXBCIDSFGBF-UHFFFAOYSA-M tetrabutylazanium;fluoride;trihydrate Chemical compound O.O.O.[F-].CCCC[N+](CCCC)(CCCC)CCCC VEPTXBCIDSFGBF-UHFFFAOYSA-M 0.000 description 2
- 235000013619 trace mineral Nutrition 0.000 description 2
- 239000011573 trace mineral Substances 0.000 description 2
- CABVTRNMFUVUDM-VRHQGPGLSA-N (3S)-3-hydroxy-3-methylglutaryl-CoA Chemical compound O[C@@H]1[C@H](OP(O)(O)=O)[C@@H](COP(O)(=O)OP(O)(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C[C@@](O)(CC(O)=O)C)O[C@H]1N1C2=NC=NC(N)=C2N=C1 CABVTRNMFUVUDM-VRHQGPGLSA-N 0.000 description 1
- FHSAZOGISLHXPK-SCSAIBSYSA-N (3r)-3-hydroxyoxan-2-one Chemical compound O[C@@H]1CCCOC1=O FHSAZOGISLHXPK-SCSAIBSYSA-N 0.000 description 1
- 125000006546 (C4-C10) cycloalkyl group Chemical group 0.000 description 1
- KJTLQQUUPVSXIM-ZCFIWIBFSA-N (R)-mevalonic acid Chemical class OCC[C@](O)(C)CC(O)=O KJTLQQUUPVSXIM-ZCFIWIBFSA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- FHSAZOGISLHXPK-UHFFFAOYSA-N 3-hydroxyoxan-2-one Chemical compound OC1CCCOC1=O FHSAZOGISLHXPK-UHFFFAOYSA-N 0.000 description 1
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241001465318 Aspergillus terreus Species 0.000 description 1
- 241001450781 Bipolaris oryzae Species 0.000 description 1
- OPMVFGOLCLJBOT-UHFFFAOYSA-N C(C1=CC=CC=C1)Cl.C(C#CC)Br Chemical compound C(C1=CC=CC=C1)Cl.C(C#CC)Br OPMVFGOLCLJBOT-UHFFFAOYSA-N 0.000 description 1
- HYNFHYVPFFLKJY-UHFFFAOYSA-N CSCCl.COCCl Chemical compound CSCCl.COCCl HYNFHYVPFFLKJY-UHFFFAOYSA-N 0.000 description 1
- 241001207508 Cladosporium sp. Species 0.000 description 1
- VGMFHMLQOYWYHN-UHFFFAOYSA-N Compactin Natural products OCC1OC(OC2C(O)C(O)C(CO)OC2Oc3cc(O)c4C(=O)C(=COc4c3)c5ccc(O)c(O)c5)C(O)C(O)C1O VGMFHMLQOYWYHN-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 241000755710 Eilica Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241000228168 Penicillium sp. Species 0.000 description 1
- JYVXNLLUYHCIIH-ZCFIWIBFSA-N R-mevalonolactone, (-)- Chemical group C[C@@]1(O)CCOC(=O)C1 JYVXNLLUYHCIIH-ZCFIWIBFSA-N 0.000 description 1
- AJLFOPYRIVGYMJ-UHFFFAOYSA-N SJ000287055 Natural products C12C(OC(=O)C(C)CC)CCC=C2C=CC(C)C1CCC1CC(O)CC(=O)O1 AJLFOPYRIVGYMJ-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 230000000843 anti-fungal effect Effects 0.000 description 1
- 239000003529 anticholesteremic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000007273 lactonization reaction Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- AJLFOPYRIVGYMJ-INTXDZFKSA-N mevastatin Chemical compound C([C@H]1[C@@H](C)C=CC2=CCC[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 AJLFOPYRIVGYMJ-INTXDZFKSA-N 0.000 description 1
- BOZILQFLQYBIIY-UHFFFAOYSA-N mevastatin hydroxy acid Natural products C1=CC(C)C(CCC(O)CC(O)CC(O)=O)C2C(OC(=O)C(C)CC)CCC=C21 BOZILQFLQYBIIY-UHFFFAOYSA-N 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 229930014626 natural product Natural products 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 238000001448 refractive index detection Methods 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 235000015113 tomato pastes and purées Nutrition 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/16—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D309/28—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/30—Oxygen atoms, e.g. delta-lactones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/62—Unsaturated compounds containing ether groups, groups, groups, or groups containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Steroid Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11804880A | 1980-02-04 | 1980-02-04 | |
| US06/175,459 US4282155A (en) | 1980-02-04 | 1980-08-05 | Antihypercholesterolemic compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE810167L IE810167L (en) | 1981-08-04 |
| IE51476B1 true IE51476B1 (en) | 1987-01-07 |
Family
ID=26815915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE167/81A IE51476B1 (en) | 1980-02-04 | 1981-01-29 | 6(r)-(2-(8'-etherified-hydroxy-2',6'-dimethylpolyhydro-naphthyl-1')-ethyl)-4(r)-hydroxy-3,4,5,6-tetrahydro-2h-pyran-2-ones,the hydroxy acid form of said pyranones,the salts of said acid form,process for preparing the same and an antihypercholesterolemic pharmaceutical composition containing the same |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4282155A (OSRAM) |
| EP (1) | EP0033536B1 (OSRAM) |
| DE (1) | DE3165894D1 (OSRAM) |
| DK (1) | DK46081A (OSRAM) |
| ES (1) | ES499077A0 (OSRAM) |
| GR (1) | GR73078B (OSRAM) |
| IE (1) | IE51476B1 (OSRAM) |
| PT (1) | PT72393B (OSRAM) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4444784A (en) * | 1980-08-05 | 1984-04-24 | Merck & Co., Inc. | Antihypercholesterolemic compounds |
| US4351844A (en) * | 1980-02-04 | 1982-09-28 | Merck & Co., Inc. | Hypocholesterolemic hydrogenation products and process of preparation |
| JPH0692381B2 (ja) * | 1980-03-31 | 1994-11-16 | 三共株式会社 | Mb−530a誘導体 |
| JPS56150037A (en) * | 1980-04-22 | 1981-11-20 | Sankyo Co Ltd | Hydronaphthalene compound |
| US4343814A (en) * | 1980-11-17 | 1982-08-10 | Merck & Co., Inc. | Hypocholesterolemic fermentation products |
| US4440927A (en) * | 1981-06-19 | 1984-04-03 | Merck & Co., Inc. | Process for preparing inhibitors of 3-hydroxy-3-methylglutaryl coenzyme A reductase via a chiral synthon |
| US4490546A (en) * | 1982-03-25 | 1984-12-25 | Merck & Co., Inc. | Process for 4a'(R),5'-dihydromevinolin |
| US4499289A (en) * | 1982-12-03 | 1985-02-12 | G. D. Searle & Co. | Octahydronapthalenes |
| US4503072A (en) * | 1982-12-22 | 1985-03-05 | Merck & Co., Inc. | Antihypercholesterolemic compounds |
| US5208258A (en) * | 1985-10-11 | 1993-05-04 | The Regents Of The University Of California | Antihypercholesterolemic compounds and synthesis thereof |
| US4950775A (en) * | 1985-10-11 | 1990-08-21 | University Of California | Antihypercholesterolemic compounds and synthesis thereof |
| US4841074A (en) * | 1987-12-11 | 1989-06-20 | Merck & Co., Inc. | Intermediates and processes for 6-carboxy HMG-CoA reductase inhibitors |
| US4904691A (en) * | 1987-12-21 | 1990-02-27 | Rorer Pharmaceutical Corporation | Novel HMG-CoA reductase inhibitors |
| US5001144A (en) * | 1987-12-21 | 1991-03-19 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted cyclohexene derivatives as HMG-CoA reductase inhibitors |
| US4863957A (en) * | 1987-12-21 | 1989-09-05 | Rorer Pharmaceutical Corporation | Novel HMG-CoA reductase inhibitors |
| US4900754A (en) * | 1987-12-21 | 1990-02-13 | Rorer Pharmaceutical Corp. | HMG-COA reductase inhibitors |
| US4994494A (en) * | 1987-12-21 | 1991-02-19 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | HMG-COA reductase inhibitors |
| US4904692A (en) * | 1987-12-21 | 1990-02-27 | Rorer Pharmaceutical Corporation | Novel HMG-CoA reductase inhibitors |
| US4939143A (en) * | 1987-12-21 | 1990-07-03 | Rorer Pharmaceutical Corporation | Substituted cyclohexene derivatives as HMG-CoA reductase inhibitors |
| US5001128A (en) * | 1987-12-21 | 1991-03-19 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | HMG-COA reductase inhibitors |
| US5132312A (en) * | 1989-03-27 | 1992-07-21 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Substituted cyclohexene derivatives as HMG-CoA reductase inhibitors |
| FI94339C (fi) | 1989-07-21 | 1995-08-25 | Warner Lambert Co | Menetelmä farmaseuttisesti käyttökelpoisen /R-(R*,R*)/-2-(4-fluorifenyyli)- , -dihydroksi-5-(1-metyylietyyli)-3-fenyyli-4-/(fenyyliamino)karbonyyli/-1H-pyrroli-1-heptaanihapon ja sen farmaseuttisesti hyväksyttävien suolojen valmistamiseksi |
| US4992429A (en) * | 1989-08-24 | 1991-02-12 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Novel HMG-COA reductase inhibitors |
| US4946860A (en) * | 1989-11-03 | 1990-08-07 | Rorer Pharmaceutical Corporation | Benzothiopyranyl derivatives as HMG-CoA reductase inhibitors |
| WO1991013616A1 (en) * | 1990-03-08 | 1991-09-19 | Rorer International (Overseas) Inc. | NOVEL HMG-CoA REDUCTASE INHIBITORS |
| US5443771A (en) * | 1992-09-15 | 1995-08-22 | Gupta; Sankar D. | Ceramic fibre and process therefor |
| SI9300303A (en) * | 1993-06-08 | 1994-12-31 | Krka Tovarna Zdravil | Process for isolation of hypolipemic effective substance |
| US6391583B1 (en) * | 1998-12-18 | 2002-05-21 | Wisconsin Alumni Research Foundation | Method of producing antihypercholesterolemic agents |
| SK282679B6 (sk) * | 1999-04-16 | 2002-11-06 | Biotika, A. S. | Spôsob izolácie lovastatínu z vyfermentovanej pôdy |
| IN192861B (OSRAM) | 2000-06-30 | 2004-05-22 | Ranbaxy Lab Ltd | |
| NZ534821A (en) * | 2002-02-25 | 2006-07-28 | Kudos Pharm Ltd | Pyranones useful as ATM inhibitors |
| CN103012344B (zh) * | 2011-09-28 | 2014-11-12 | 北大方正集团有限公司 | 从洛伐他汀结晶母液中回收洛伐他汀的方法 |
| CN102875505B (zh) * | 2012-08-02 | 2015-08-05 | 丽珠集团新北江制药股份有限公司 | 一种美伐他汀的提取精制工艺 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5612114B2 (OSRAM) * | 1974-06-07 | 1981-03-18 | ||
| US4049495A (en) * | 1974-06-07 | 1977-09-20 | Sankyo Company Limited | Physiologically active substances and fermentative process for producing the same |
| US4137322A (en) * | 1976-11-02 | 1979-01-30 | Sankyo Company Limited | ML-236B carboxylic acid derivatives and their use as antihyperlipemic agents |
| AU535944B2 (en) * | 1979-06-15 | 1984-04-12 | Merck & Co., Inc. | Hypocholestermic fermentation products from aspergillus |
| US4231938A (en) * | 1979-06-15 | 1980-11-04 | Merck & Co., Inc. | Hypocholesteremic fermentation products and process of preparation |
-
1980
- 1980-08-05 US US06/175,459 patent/US4282155A/en not_active Expired - Lifetime
-
1981
- 1981-01-23 PT PT72393A patent/PT72393B/pt unknown
- 1981-01-29 IE IE167/81A patent/IE51476B1/en unknown
- 1981-02-02 DE DE8181100727T patent/DE3165894D1/de not_active Expired
- 1981-02-02 GR GR64030A patent/GR73078B/el unknown
- 1981-02-02 EP EP81100727A patent/EP0033536B1/en not_active Expired
- 1981-02-03 ES ES499077A patent/ES499077A0/es active Granted
- 1981-02-03 DK DK46081A patent/DK46081A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| US4282155A (en) | 1981-08-04 |
| EP0033536A3 (en) | 1982-02-24 |
| EP0033536B1 (en) | 1984-09-12 |
| ES8202549A1 (es) | 1982-02-01 |
| DK46081A (da) | 1981-08-05 |
| GR73078B (OSRAM) | 1984-01-31 |
| ES499077A0 (es) | 1982-02-01 |
| PT72393A (en) | 1981-02-01 |
| IE810167L (en) | 1981-08-04 |
| PT72393B (en) | 1982-09-06 |
| EP0033536A2 (en) | 1981-08-12 |
| DE3165894D1 (en) | 1984-10-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4282155A (en) | Antihypercholesterolemic compounds | |
| US4293496A (en) | 6(R)-[2-(8-Hydroxy-2,6-dimethylpolyhydronaphthyl-1)-ethyl]-4(R)-hydroxy-3,4,5,6-tetrahydro-2H-pyran-2-ones | |
| US4444784A (en) | Antihypercholesterolemic compounds | |
| US4351844A (en) | Hypocholesterolemic hydrogenation products and process of preparation | |
| US4450171A (en) | Antihypercholesterolemic compounds | |
| EP0033538B1 (en) | 6(r)-(2-(8'-acyloxy-2'-methyl-6'-methyl (or hydrogen)-polyhydronaphthyl-1')-ethyl)-4(r)-hydroxy-3,4,5,6-tetrahydro-2h-pyran-2-ones, the hydroxy acid form of said pyranones, the pharmaceutically acceptable salts of said hydroxy acids, and the lower alkyl, and phenyl, dimethylamino or acetylamino substituted lower alkyl esters of said hydroxy acid, processes for preparing the same, and a pharmaceutical antihypercholesterolemic composition containing the same | |
| USRE36520E (en) | HMG-CoA reductase inhibitors | |
| US5116870A (en) | HMG-CoA reductase inhibitors | |
| US5021453A (en) | 3-keto HMG-CoA reductase inhibitors | |
| NO177004B (no) | Analogifremgangsmåte for fremstilling av 7-substituerte derivater av 3,5-dihydroksyhept-6-ynsyre | |
| EP0325817B1 (en) | Novel hmg-coa reductase inhibitors | |
| CA2018483A1 (en) | 4-substituted hmg-coa reductase inhibitors | |
| EP0033537B1 (en) | Hydrogenation products of mevinolin and dihydromevinolin, a process for preparing the same and an antihypercholesterolemic pharmaceutical composition containing the same | |
| JPS641476B2 (OSRAM) | ||
| AU619563B2 (en) | 5-oxygenated HMG-CoA reductase inhibitors | |
| EP0306264A2 (en) | Novel HMG-COA reductase inhibitors | |
| EP0113881B1 (en) | Antihypercholesterolemic compounds | |
| US5089523A (en) | Fluorinated derivatives of mevinic acids | |
| JPH0592966A (ja) | 5−酸素化HMG−CoAレダクターゼ阻害剤の製造方法及び中間体 | |
| EP0428094A1 (en) | Mevinic acid derivatives | |
| EP0409399B1 (en) | 3-keto HMG-COA reductase inhibitors | |
| KR850000669B1 (ko) | 항 과콜레스테린 혈증성 화합물의 제법 | |
| JPH0368537A (ja) | 抗高コレステロール血症化合物 | |
| US5041562A (en) | 3-keto HMG-CoA reductase inhibitors | |
| AU618106B2 (en) | 3-keto-naphtylethyl substituted pyran-2-ones and equilavent hydroxy acids |