IE49908B1 - Ethanamine derivatives their preparation and use in pharmaceutical compositions - Google Patents
Ethanamine derivatives their preparation and use in pharmaceutical compositionsInfo
- Publication number
- IE49908B1 IE49908B1 IE1223/80A IE122380A IE49908B1 IE 49908 B1 IE49908 B1 IE 49908B1 IE 1223/80 A IE1223/80 A IE 1223/80A IE 122380 A IE122380 A IE 122380A IE 49908 B1 IE49908 B1 IE 49908B1
- Authority
- IE
- Ireland
- Prior art keywords
- formula
- group
- compound
- hydrogen
- ester
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical class CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 142
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 30
- -1 amino, formamido, acetamido Chemical group 0.000 claims abstract description 27
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 24
- 239000001257 hydrogen Substances 0.000 claims abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 17
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 16
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract description 13
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 13
- 239000011737 fluorine Chemical group 0.000 claims abstract description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000000460 chlorine Chemical group 0.000 claims abstract description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 7
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 6
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 5
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000004450 alkenylene group Chemical group 0.000 claims abstract description 4
- 125000004419 alkynylene group Chemical group 0.000 claims abstract description 4
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 claims abstract description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical group ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims abstract 7
- 239000000203 mixture Substances 0.000 claims description 40
- 150000002148 esters Chemical class 0.000 claims description 25
- 150000001408 amides Chemical class 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 230000009467 reduction Effects 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 238000005984 hydrogenation reaction Methods 0.000 claims description 10
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 229910052727 yttrium Inorganic materials 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 150000002373 hemiacetals Chemical class 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 239000002552 dosage form Substances 0.000 claims 1
- 239000006187 pill Substances 0.000 claims 1
- 239000003826 tablet Substances 0.000 claims 1
- 230000003579 anti-obesity Effects 0.000 abstract description 9
- 230000002058 anti-hyperglycaemic effect Effects 0.000 abstract description 5
- 125000004430 oxygen atom Chemical group O* 0.000 abstract description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- 239000000243 solution Substances 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 24
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 241000699670 Mus sp. Species 0.000 description 15
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- 239000002253 acid Substances 0.000 description 14
- 238000006722 reduction reaction Methods 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000008103 glucose Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 239000008280 blood Substances 0.000 description 10
- 210000004369 blood Anatomy 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 230000000694 effects Effects 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- DEWJKPKXTLAZOE-UHFFFAOYSA-N 4-(2-amino-1-hydroxyethyl)-2-(hydroxymethyl)phenol Chemical compound NCC(O)C1=CC=C(O)C(CO)=C1 DEWJKPKXTLAZOE-UHFFFAOYSA-N 0.000 description 5
- 101150041968 CDC13 gene Proteins 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 238000010533 azeotropic distillation Methods 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000037406 food intake Effects 0.000 description 5
- 235000012631 food intake Nutrition 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 4
- 208000008589 Obesity Diseases 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- KJJNJVDJDVXQTI-UHFFFAOYSA-N methyl 2-[4-(2-oxopropyl)phenoxy]acetate Chemical compound COC(=O)COC1=CC=C(CC(C)=O)C=C1 KJJNJVDJDVXQTI-UHFFFAOYSA-N 0.000 description 4
- 235000020824 obesity Nutrition 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- ULSIYEODSMZIPX-UHFFFAOYSA-N phenylethanolamine Chemical compound NCC(O)C1=CC=CC=C1 ULSIYEODSMZIPX-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 241000699666 Mus <mouse, genus> Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- NNFOTEQKNPUXGR-UHFFFAOYSA-N 1-(4-phenylmethoxyphenyl)propan-2-one Chemical compound C1=CC(CC(=O)C)=CC=C1OCC1=CC=CC=C1 NNFOTEQKNPUXGR-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- YQBLQKZERMAVDO-UHFFFAOYSA-N 2-oxo-2-phenylacetaldehyde;hydrate Chemical compound O.O=CC(=O)C1=CC=CC=C1 YQBLQKZERMAVDO-UHFFFAOYSA-N 0.000 description 2
- JAJIUWBRJAQOHS-UHFFFAOYSA-N 4-[(2-methyl-1,3-dioxolan-2-yl)methyl]phenol Chemical compound C=1C=C(O)C=CC=1CC1(C)OCCO1 JAJIUWBRJAQOHS-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- KRKJIPZPWKHQSG-UHFFFAOYSA-N ethene;1-(4-hydroxyphenyl)propan-2-one Chemical group C=C.CC(=O)CC1=CC=C(O)C=C1 KRKJIPZPWKHQSG-UHFFFAOYSA-N 0.000 description 2
- GRUQAEFNSYSKTQ-UHFFFAOYSA-N ethene;1-(4-phenylmethoxyphenyl)propan-2-one Chemical group C=C.C1=CC(CC(=O)C)=CC=C1OCC1=CC=CC=C1 GRUQAEFNSYSKTQ-UHFFFAOYSA-N 0.000 description 2
- XJZRFOYMCUFZDI-UHFFFAOYSA-N ethyl 2-[4-(2-oxopropyl)phenoxy]propanoate Chemical compound CCOC(=O)C(C)OC1=CC=C(CC(C)=O)C=C1 XJZRFOYMCUFZDI-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- 201000001421 hyperglycemia Diseases 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- NJWMEESIBUCMIW-UHFFFAOYSA-N methyl 2-[3-(2-oxopropyl)phenoxy]acetate Chemical compound COC(=O)COC1=CC=CC(CC(C)=O)=C1 NJWMEESIBUCMIW-UHFFFAOYSA-N 0.000 description 2
- HYVWVZLLFMCCAX-UHFFFAOYSA-N methyl 2-[4-(2-hydroxyiminopropyl)phenoxy]acetate Chemical compound COC(=O)COC1=CC=C(CC(C)=NO)C=C1 HYVWVZLLFMCCAX-UHFFFAOYSA-N 0.000 description 2
- VHRZSSOLZBAVTD-UHFFFAOYSA-N methyl 2-[4-(3-oxobutyl)phenoxy]acetate Chemical compound COC(=O)COC1=CC=C(CCC(C)=O)C=C1 VHRZSSOLZBAVTD-UHFFFAOYSA-N 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 230000000707 stereoselective effect Effects 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- ZGYOAKJRIOGEBC-UHFFFAOYSA-N 1-(2-nitroprop-1-enyl)-4-phenylmethoxybenzene Chemical compound C1=CC(C=C(C)[N+]([O-])=O)=CC=C1OCC1=CC=CC=C1 ZGYOAKJRIOGEBC-UHFFFAOYSA-N 0.000 description 1
- CKYGVPXAIHHPBD-UHFFFAOYSA-N 1-(2-nitroprop-2-enyl)-4-phenylmethoxybenzene Chemical compound C1=CC(CC(=C)[N+](=O)[O-])=CC=C1OCC1=CC=CC=C1 CKYGVPXAIHHPBD-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- STJIXOUDTUPEEL-UHFFFAOYSA-N 2-amino-1-(3-chlorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC(Cl)=C1 STJIXOUDTUPEEL-UHFFFAOYSA-N 0.000 description 1
- QPHAZZJNYDEVHL-UHFFFAOYSA-N 2-amino-1-(4-chlorophenyl)ethanol Chemical compound NCC(O)C1=CC=C(Cl)C=C1 QPHAZZJNYDEVHL-UHFFFAOYSA-N 0.000 description 1
- RRBRWAPWPGAJMA-UHFFFAOYSA-N 2-amino-1-[3-(trifluoromethyl)phenyl]ethanol Chemical compound NCC(O)C1=CC=CC(C(F)(F)F)=C1 RRBRWAPWPGAJMA-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- PWVYGCHRAHNBFI-UHFFFAOYSA-N 4-(2-nitroprop-1-enyl)phenol Chemical compound [O-][N+](=O)C(C)=CC1=CC=C(O)C=C1 PWVYGCHRAHNBFI-UHFFFAOYSA-N 0.000 description 1
- ZVTWZSXLLMNMQC-UHFFFAOYSA-N 4-phenylmethoxybenzaldehyde Chemical compound C1=CC(C=O)=CC=C1OCC1=CC=CC=C1 ZVTWZSXLLMNMQC-UHFFFAOYSA-N 0.000 description 1
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010020710 Hyperphagia Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- HYSOPXHRAHXSFM-MRVPVSSYSA-N [(1s)-1-methylcyclohexa-2,4-dien-1-yl]methanamine Chemical compound NC[C@@]1(C)CC=CC=C1 HYSOPXHRAHXSFM-MRVPVSSYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- PXAJQJMDEXJWFB-UHFFFAOYSA-N acetone oxime Chemical compound CC(C)=NO PXAJQJMDEXJWFB-UHFFFAOYSA-N 0.000 description 1
- 239000000048 adrenergic agonist Substances 0.000 description 1
- NDAUXUAQIAJITI-UHFFFAOYSA-N albuterol Chemical compound CC(C)(C)NCC(O)C1=CC=C(O)C(CO)=C1 NDAUXUAQIAJITI-UHFFFAOYSA-N 0.000 description 1
- 125000006307 alkoxy benzyl group Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000001088 anti-asthma Effects 0.000 description 1
- 239000000883 anti-obesity agent Substances 0.000 description 1
- 229940125710 antiobesity agent Drugs 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 102000015005 beta-adrenergic receptor activity proteins Human genes 0.000 description 1
- 108040006818 beta-adrenergic receptor activity proteins Proteins 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- IPZJQDSFZGZEOY-UHFFFAOYSA-N dimethylmethylene Chemical group C[C]C IPZJQDSFZGZEOY-UHFFFAOYSA-N 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- IOLQWGVDEFWYNP-UHFFFAOYSA-N ethyl 2-bromo-2-methylpropanoate Chemical compound CCOC(=O)C(C)(C)Br IOLQWGVDEFWYNP-UHFFFAOYSA-N 0.000 description 1
- ARFLASKVLJTEJD-UHFFFAOYSA-N ethyl 2-bromopropanoate Chemical compound CCOC(=O)C(C)Br ARFLASKVLJTEJD-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000003976 glyceryl group Chemical group [H]C([*])([H])C(O[H])([H])C(O[H])([H])[H] 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- 230000002218 hypoglycaemic effect Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 229960002523 mercuric chloride Drugs 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- RWIKCBHOVNDESJ-NSCUHMNNSA-N methyl (e)-4-bromobut-2-enoate Chemical compound COC(=O)\C=C\CBr RWIKCBHOVNDESJ-NSCUHMNNSA-N 0.000 description 1
- AYMQCLGUHSIDFY-UHFFFAOYSA-N methyl 2-(3-formylphenoxy)acetate Chemical compound COC(=O)COC1=CC=CC(C=O)=C1 AYMQCLGUHSIDFY-UHFFFAOYSA-N 0.000 description 1
- XSAQAIZPDMURCG-UHFFFAOYSA-N methyl 2-[3-(2-hydroxyiminopropyl)phenoxy]acetate Chemical compound COC(=O)COC1=CC=CC(CC(C)=NO)=C1 XSAQAIZPDMURCG-UHFFFAOYSA-N 0.000 description 1
- GXFCRQJYXXVBNO-UHFFFAOYSA-N methyl 2-[3-(2-nitroprop-1-enyl)phenoxy]acetate Chemical compound COC(=O)COC1=CC=CC(C=C(C)[N+]([O-])=O)=C1 GXFCRQJYXXVBNO-UHFFFAOYSA-N 0.000 description 1
- WPTKMYNQLXJDMX-UHFFFAOYSA-N methyl 2-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propyl]phenoxy]acetate Chemical compound C1=CC(OCC(=O)OC)=CC=C1CC(C)NCC(O)C1=CC=CC=C1 WPTKMYNQLXJDMX-UHFFFAOYSA-N 0.000 description 1
- YDCHPLOFQATIDS-UHFFFAOYSA-N methyl 2-bromoacetate Chemical compound COC(=O)CBr YDCHPLOFQATIDS-UHFFFAOYSA-N 0.000 description 1
- FYSSKKKZJLHGRA-UHFFFAOYSA-N methyl 4-[4-(2-oxopropyl)phenoxy]but-2-enoate Chemical compound COC(=O)C=CCOC1=CC=C(CC(C)=O)C=C1 FYSSKKKZJLHGRA-UHFFFAOYSA-N 0.000 description 1
- IWXZHJSAXANMTO-UHFFFAOYSA-N methyl 4-[4-(2-oxopropyl)phenoxy]butanoate Chemical compound COC(=O)CCCOC1=CC=C(CC(C)=O)C=C1 IWXZHJSAXANMTO-UHFFFAOYSA-N 0.000 description 1
- VXEZMWMUGPAEQU-UHFFFAOYSA-N methyl 4-[4-[2-[[2-(4-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]but-2-enoate Chemical compound C1=CC(OCC=CC(=O)OC)=CC=C1CC(C)NCC(O)C1=CC=C(Cl)C=C1 VXEZMWMUGPAEQU-UHFFFAOYSA-N 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- ZVUAPSWBMGFIRU-UHFFFAOYSA-N n-[1-(4-phenylmethoxyphenyl)propan-2-ylidene]hydroxylamine Chemical compound C1=CC(CC(C)=NO)=CC=C1OCC1=CC=CC=C1 ZVUAPSWBMGFIRU-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 238000013116 obese mouse model Methods 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 238000003305 oral gavage Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- VWMVAQHMFFZQGD-UHFFFAOYSA-N p-Hydroxybenzyl acetone Natural products CC(=O)CC1=CC=C(O)C=C1 VWMVAQHMFFZQGD-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 208000022530 polyphagia Diseases 0.000 description 1
- 239000001253 polyvinylpolypyrrolidone Substances 0.000 description 1
- 235000013809 polyvinylpolypyrrolidone Nutrition 0.000 description 1
- 229920000523 polyvinylpolypyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- JUJWROOIHBZHMG-RALIUCGRSA-N pyridine-d5 Chemical compound [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] JUJWROOIHBZHMG-RALIUCGRSA-N 0.000 description 1
- NJGBTKGETPDVIK-UHFFFAOYSA-N raspberry ketone Chemical compound CC(=O)CCC1=CC=C(O)C=C1 NJGBTKGETPDVIK-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229960002052 salbutamol Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 229940080313 sodium starch Drugs 0.000 description 1
- JNTJZNSONHRRGT-UHFFFAOYSA-M sodium;2-[4-[2-[(2-hydroxy-2-phenylethyl)amino]propyl]phenoxy]acetate Chemical compound [Na+].C=1C=CC=CC=1C(O)CNC(C)CC1=CC=C(OCC([O-])=O)C=C1 JNTJZNSONHRRGT-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 208000001072 type 2 diabetes mellitus Diseases 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/20—Free hydroxyl or mercaptan
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/17—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups bound to acyclic carbon atoms and hydroxy groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/32—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups bound to acyclic carbon atoms and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/48—Preparation of compounds having groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/48—Preparation of compounds having groups
- C07C41/50—Preparation of compounds having groups by reactions producing groups
- C07C41/56—Preparation of compounds having groups by reactions producing groups by condensation of aldehydes, paraformaldehyde, or ketones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/30—Compounds having groups
- C07C43/315—Compounds having groups containing oxygen atoms singly bound to carbon atoms not being acetal carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/42—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by hydrolysis
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Diabetes (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Obesity (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Hematology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Emergency Medicine (AREA)
- Endocrinology (AREA)
- Child & Adolescent Psychology (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7921038 | 1979-06-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE801223L IE801223L (en) | 1980-12-16 |
| IE49908B1 true IE49908B1 (en) | 1986-01-08 |
Family
ID=10505899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1223/80A IE49908B1 (en) | 1979-06-16 | 1980-06-13 | Ethanamine derivatives their preparation and use in pharmaceutical compositions |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4338333A (online.php) |
| EP (1) | EP0023385B1 (online.php) |
| JP (1) | JPS565444A (online.php) |
| AT (1) | ATE1994T1 (online.php) |
| AU (1) | AU533432B2 (online.php) |
| CA (1) | CA1150297A (online.php) |
| DE (1) | DE3061334D1 (online.php) |
| DK (1) | DK256580A (online.php) |
| ES (2) | ES492489A0 (online.php) |
| IE (1) | IE49908B1 (online.php) |
| IL (1) | IL60288A0 (online.php) |
| MY (1) | MY8500997A (online.php) |
| NZ (1) | NZ193988A (online.php) |
| ZA (1) | ZA803576B (online.php) |
Families Citing this family (88)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56112903A (en) * | 1980-02-12 | 1981-09-05 | Shin Etsu Chem Co Ltd | Polymerization of vinyl monomer |
| DE3264364D1 (en) * | 1981-03-06 | 1985-08-01 | Beecham Group Plc | Arylethanol amine derivatives, their preparation and use in pharmaceutical compositions |
| EP0070134B1 (en) * | 1981-07-11 | 1985-11-13 | Beecham Group Plc | Secondary phenyl ethanol amines and their pharmaceutical use |
| DE3271132D1 (en) * | 1981-07-11 | 1986-06-19 | Beecham Group Plc | Secondary phenylethanol amines, processes for their preparation and their pharmaceutical application |
| US4652681A (en) * | 1982-04-15 | 1987-03-24 | Drug Science Foundation | Aminoalkoxy derivatives of propranolol for immunoassay applications |
| CA1219865A (en) * | 1982-05-14 | 1987-03-31 | Leo Alig | Aziridine phenethanolamine derivatives |
| EP0099707B1 (en) * | 1982-07-16 | 1986-12-10 | Beecham Group Plc | 2-aminoethyl ether derivatives, processes for their preparation and pharmaceutical compositions containing them |
| CA1258454A (en) * | 1982-08-10 | 1989-08-15 | Leo Alig | Phenethanolamines |
| WO1984000956A1 (en) * | 1982-08-27 | 1984-03-15 | Beecham Group Plc | Secondary arylethanolamines |
| US4849453A (en) * | 1983-01-31 | 1989-07-18 | Eli Lilly And Company | Growth promotion |
| US4690951A (en) * | 1983-01-31 | 1987-09-01 | Eli Lilly And Company | Growth promotion |
| GB8310556D0 (en) * | 1983-04-19 | 1983-05-25 | Beecham Group Plc | Compounds |
| DE3462789D1 (en) * | 1983-08-17 | 1987-04-30 | Beecham Group Plc | 2-phenylethylamine derivatives |
| EP0142102B1 (en) * | 1983-11-04 | 1987-09-23 | Beecham Group Plc | Tertiary amines |
| JPS60233103A (ja) * | 1984-05-07 | 1985-11-19 | Shin Etsu Chem Co Ltd | ビニル系単量体の重合方法 |
| GB8415377D0 (en) * | 1984-06-15 | 1984-07-18 | Beecham Group Plc | Compounds |
| IN165525B (online.php) | 1984-07-23 | 1989-11-04 | Shinetsu Chemical Co | |
| GB8420837D0 (en) * | 1984-08-16 | 1984-09-19 | Beecham Group Plc | Compounds |
| GB8519154D0 (en) * | 1985-07-30 | 1985-09-04 | Ici Plc | Aromatic ethers |
| EP0244062A3 (en) * | 1986-03-03 | 1990-06-20 | Beecham Group Plc | Use of aryl ethanol amine derivatives in the treatment of atherosclerosis |
| IT1204416B (it) * | 1986-06-27 | 1989-03-01 | Midy Spa | Medicamenti a base di analoghi di feniletanolammine per il trattamento di disturbi gastro-intestinali ed uterini |
| CA1287061C (en) * | 1986-06-27 | 1991-07-30 | Roche Holding Ltd. | Pyridine ethanolamine derivatives |
| DE3623940A1 (de) * | 1986-07-16 | 1988-01-21 | Bayer Ag | Arylethanolhydroxylamine, verfahren zu ihrer herstellung und ihre verwendung zur leistungsfoerderung |
| GB8620951D0 (en) * | 1986-08-29 | 1986-10-08 | Beecham Group Plc | Compounds |
| DE3631009A1 (de) * | 1986-09-12 | 1988-03-24 | Bayer Ag | Arylethanolamine, verfahren zu ihrer herstellung und ihre verwendung zur leistungsfoerderung |
| DE3866984D1 (en) * | 1987-07-21 | 1992-01-30 | Hoffmann La Roche | Phenoxypropanolamine. |
| FR2619379B1 (fr) * | 1987-08-12 | 1990-01-12 | Midy Spa | Procede pour la o-alkylation de n-(hydroxy) aralkyl-phenylethanolamines |
| US4927955A (en) * | 1987-08-12 | 1990-05-22 | Sanofi | Process for the O-alkylation of N-(hydroxy)aralkylphenylethanolamines |
| GB8925032D0 (en) * | 1989-11-06 | 1989-12-28 | Ici Plc | Chemical compounds |
| JP2818958B2 (ja) * | 1990-02-23 | 1998-10-30 | 塩野義製薬株式会社 | 4―(4―アルコキシフェニル)―2―ブチルアミン誘導体およびその製造法 |
| US5245053A (en) * | 1990-05-04 | 1993-09-14 | American Cyanamid Company | Substituted 5-(2-(2-aryl-2-hydroxyethyl)-amino)propyl)-1,3-benzodioxoles |
| US5151439A (en) * | 1990-05-04 | 1992-09-29 | American Cyanamid Company | Substituted 5-(2-((2-aryl-2-hydroxyethyl)amino)propyl)-1,3-benzodioxoles |
| US5106867A (en) * | 1990-05-04 | 1992-04-21 | American Cyanamid Company | Method of increasing lean meat in edible animals |
| US5061727A (en) | 1990-05-04 | 1991-10-29 | American Cyanamid Company | Substituted 5-(2-((2-aryl-2-hydroxyethyl)amino)propyl)-1,3-benzodioxoles |
| GB9111426D0 (en) * | 1991-05-28 | 1991-07-17 | Ici Plc | Chemical compounds |
| US5502078A (en) * | 1991-05-28 | 1996-03-26 | Zeneca Limited | Chemical compounds |
| US6001884A (en) * | 1991-08-23 | 1999-12-14 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| US5858684A (en) * | 1991-08-23 | 1999-01-12 | The Brigham And Women's Hospital, Inc. | Method of screening calcium receptor-active molecules |
| US6031003A (en) * | 1991-08-23 | 2000-02-29 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| US5688938A (en) * | 1991-08-23 | 1997-11-18 | The Brigham & Women's Hospital, Inc. | Calcium receptor-active molecules |
| US6313146B1 (en) | 1991-08-23 | 2001-11-06 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| US6011068A (en) * | 1991-08-23 | 2000-01-04 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| US5763569A (en) * | 1991-08-23 | 1998-06-09 | The Brigham And Women's Hospital, Inc | Calcium receptor-active molecules |
| GB9124512D0 (en) * | 1991-11-19 | 1992-01-08 | Smithkline Beecham Plc | Novel compounds |
| NO179246C (no) * | 1991-11-20 | 1996-09-04 | Sankyo Co | Aromatiske amino-alkoholderivater og mellomprodukter til fremstilling derav |
| US5962314A (en) * | 1993-02-23 | 1999-10-05 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| GB9308178D0 (en) * | 1993-04-21 | 1993-06-02 | Smithkline Beecham Plc | Novel compounds |
| JPH08509491A (ja) * | 1993-04-26 | 1996-10-08 | 藤沢薬品工業株式会社 | 胃腸疾患の治療に有用なエタノールアミン誘導体 |
| EP0711284A1 (en) * | 1993-07-31 | 1996-05-15 | Smithkline Beecham Plc | 2-benzoheterocyclyloxy or thiopropanolamine derivatives with adreno receptor agonist activity |
| US5563171A (en) * | 1993-11-05 | 1996-10-08 | American Cyanamid Company | Treatment of glaucoma and ocular hypertension with β3-adrenergic agonists |
| US5578638A (en) * | 1993-11-05 | 1996-11-26 | American Cyanamid Company | Treatment of glaucoma and ocular hypertension with β3 -adrenergic agonists |
| US5480908A (en) * | 1993-12-13 | 1996-01-02 | American Cyanamid Company | β3 -adrenergic agents benzodioxole dicarboxylates and their use in pharmaceutical compositions |
| US5776983A (en) * | 1993-12-21 | 1998-07-07 | Bristol-Myers Squibb Company | Catecholamine surrogates useful as β3 agonists |
| US5488064A (en) * | 1994-05-02 | 1996-01-30 | Bristol-Myers Squibb Company | Benzo 1,3 dioxole derivatives |
| US5491134A (en) * | 1994-09-16 | 1996-02-13 | Bristol-Myers Squibb Company | Sulfonic, phosphonic or phosphiniic acid β3 agonist derivatives |
| US6211244B1 (en) | 1994-10-21 | 2001-04-03 | Nps Pharmaceuticals, Inc. | Calcium receptor-active compounds |
| RO118426B1 (ro) * | 1994-11-29 | 2003-05-30 | Dainippon Pharmaceutical Co | Derivati de indol utilizati pentru tratarea diabetului zaharat si a obezitatii |
| US5541204A (en) * | 1994-12-02 | 1996-07-30 | Bristol-Myers Squibb Company | Aryloxypropanolamine β 3 adrenergic agonists |
| CA2220759C (en) * | 1995-05-12 | 2009-01-20 | Nisshin Flour Milling Co. Ltd. | 1,4-benzodioxin derivatives |
| ZA967892B (en) * | 1995-09-21 | 1998-03-18 | Lilly Co Eli | Selective β3 adrenergic agonists. |
| PT882707E (pt) | 1996-01-10 | 2004-02-27 | Asahi Chemical Ind | Novos compostos trciclicos e composicoes medicamentosas contendo os mesmos |
| US5770615A (en) * | 1996-04-04 | 1998-06-23 | Bristol-Myers Squibb Company | Catecholamine surrogates useful as β3 agonists |
| DK0907631T3 (da) * | 1996-05-01 | 2003-09-22 | Nps Pharma Inc | Uorganiske ionreceptoraktive forbindelser |
| US5808080A (en) * | 1996-09-05 | 1998-09-15 | Eli Lilly And Company | Selective β3 adrenergic agonists |
| ATE215369T1 (de) | 1996-09-05 | 2002-04-15 | Lilly Co Eli | Carbazolanaloge als selektive beta3-adrenergische agonisten |
| WO1998013333A1 (en) * | 1996-09-26 | 1998-04-02 | Kissei Pharmaceutical Co., Ltd. | 2-amino-1-(4-hydroxy-2-methylphenyl)propanol derivatives |
| WO1999001431A1 (en) | 1997-07-03 | 1999-01-14 | Asahi Kasei Kogyo Kabushiki Kaisha | Novel tricyclic compounds having saturated rings and medicinal compositions containing the same |
| ID24062A (id) * | 1997-07-25 | 2000-07-06 | Kissei Pharmaceutical | Turunan-turunan asam aminoetilfenoksiasetat dan obat untuk mengurangi nyeri dan membantu penyingkiran dalam litiasis saluran air kencing |
| CO5011072A1 (es) * | 1997-12-05 | 2001-02-28 | Lilly Co Eli | Etanolaminas pirazinil substituidas como agfonistas de los receptores |
| US6495546B1 (en) * | 1998-04-06 | 2002-12-17 | Fujisawa Pharmaceutical Co., Ltd. | Propanolamine derivatives |
| CA2328348C (en) | 1998-04-14 | 2009-03-03 | Kissei Pharmaceutical Co., Ltd. | 2-methylpropionic acid derivatives and medicinal compositions containing the same |
| MY126489A (en) * | 1998-07-08 | 2006-10-31 | Kissei Pharmaceutical | Phenoxyacetic acid derivatives and medicinal compositions containing the same |
| ATE369337T1 (de) * | 2000-04-28 | 2007-08-15 | Asahi Kasei Pharma Corp | Neue bizyklische verbindungen |
| JP2002053574A (ja) * | 2000-08-10 | 2002-02-19 | Nisshin Pharma Inc | 1,4−ベンゾジオキサン環を有するプロパノールアミン誘導体 |
| ES2309200T3 (es) | 2001-10-25 | 2008-12-16 | Asahi Kasei Pharma Corporation | Compuesto biciclico. |
| UA79498C2 (en) * | 2002-09-05 | 2007-06-25 | Kissei Pharmaceutical | Intermediates for preparation of phenoxy-acetic derivates and processes of their preparation |
| EP1806335A4 (en) * | 2004-10-20 | 2008-12-03 | Mitsubishi Tanabe Pharma Corp | METHOD FOR PRODUCING A PHENYLETHANOLAMINE COMPOUND AND INTERMEDIATE PRODUCTS THEREFOR |
| CN102171192A (zh) | 2008-10-09 | 2011-08-31 | 旭化成制药株式会社 | 吲唑化合物 |
| EP2351742A4 (en) | 2008-10-09 | 2012-03-28 | Asahi Kasei Pharma Corp | indazole |
| CN102584609B (zh) * | 2011-01-06 | 2015-05-27 | 上海医药工业研究院 | 一种沙美特罗的制备方法 |
| ES2394349B1 (es) | 2012-08-29 | 2013-11-04 | Fundación Centro Nacional De Investigaciones Cardiovasculares Carlos Iii | Uso de agonistas selectivos de receptores beta-3 adrenérgicos para el tratamiento de hipertensión pulmonar |
| WO2014108449A1 (en) | 2013-01-08 | 2014-07-17 | Atrogi Ab | A screening method, a kit, a method of treatment and a compound for use in a method of treatment |
| GB201714734D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| GB201714736D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| GB201714745D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| GB201714740D0 (en) | 2017-09-13 | 2017-10-25 | Atrogi Ab | New compounds and uses |
| GB201903832D0 (en) | 2019-03-20 | 2019-05-01 | Atrogi Ab | New compounds and methods |
| GB202205895D0 (en) | 2022-04-22 | 2022-06-08 | Atrogi Ab | New medical uses |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4012444A (en) * | 1969-07-08 | 1977-03-15 | Allen & Hanburys Limited | 5-[1-Hydroxy-2-(1-methyl-3-phenylpropyl)aminoethyl] salicylamide and physiologically acceptable acid addition salts thereof |
| DE2034277A1 (en) * | 1970-07-10 | 1972-01-20 | Troponwerke Dinklage & Co, 5000 Köln Mulheim | 1-(3-hydroxyphenyl)-2-(1-(4-(2-hydroxy or ethoxy)-phenyl) - propyl-2-amino)-ethanol-(1)-with bronchodilatory action |
| JPS5310974B2 (online.php) * | 1974-06-10 | 1978-04-18 | ||
| US4146638A (en) * | 1976-02-17 | 1979-03-27 | Boehringer Ingelheim Gmbh | N-(3-phenoxy-2-hydroxy-propyl)-n-(2-phenyl-2-hydroxy-ethyl)-amines |
| JPS52113934A (en) * | 1976-03-19 | 1977-09-24 | Eisai Co Ltd | Phenethylamine derivatives and bronchodilator containing the same |
| JPS53149940A (en) * | 1977-06-02 | 1978-12-27 | Tanabe Seiyaku Co Ltd | Novel benzyl alcohol derivatives and their preparation |
-
1980
- 1980-06-09 US US06/157,555 patent/US4338333A/en not_active Expired - Lifetime
- 1980-06-09 EP EP80301927A patent/EP0023385B1/en not_active Expired
- 1980-06-09 AT AT80301927T patent/ATE1994T1/de active
- 1980-06-09 DE DE8080301927T patent/DE3061334D1/de not_active Expired
- 1980-06-10 IL IL60288A patent/IL60288A0/xx unknown
- 1980-06-10 NZ NZ193988A patent/NZ193988A/en unknown
- 1980-06-11 CA CA000353754A patent/CA1150297A/en not_active Expired
- 1980-06-13 AU AU59307/80A patent/AU533432B2/en not_active Ceased
- 1980-06-13 DK DK256580A patent/DK256580A/da unknown
- 1980-06-13 IE IE1223/80A patent/IE49908B1/en not_active IP Right Cessation
- 1980-06-16 JP JP8126880A patent/JPS565444A/ja active Granted
- 1980-06-16 ZA ZA00803576A patent/ZA803576B/xx unknown
- 1980-06-16 ES ES492489A patent/ES492489A0/es active Granted
-
1981
- 1981-02-19 ES ES499604A patent/ES499604A0/es active Granted
-
1985
- 1985-12-30 MY MY997/85A patent/MY8500997A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES8106274A1 (es) | 1981-08-01 |
| EP0023385A1 (en) | 1981-02-04 |
| ATE1994T1 (de) | 1982-12-15 |
| AU533432B2 (en) | 1983-11-24 |
| EP0023385B1 (en) | 1982-12-15 |
| AU5930780A (en) | 1981-01-08 |
| ES492489A0 (es) | 1981-08-01 |
| CA1150297A (en) | 1983-07-19 |
| NZ193988A (en) | 1984-11-09 |
| US4338333A (en) | 1982-07-06 |
| ES8202533A1 (es) | 1982-02-01 |
| IL60288A0 (en) | 1980-09-16 |
| IE801223L (en) | 1980-12-16 |
| JPS6326744B2 (online.php) | 1988-05-31 |
| DK256580A (da) | 1980-12-17 |
| DE3061334D1 (en) | 1983-01-20 |
| JPS565444A (en) | 1981-01-20 |
| ES499604A0 (es) | 1982-02-01 |
| ZA803576B (en) | 1981-06-24 |
| MY8500997A (en) | 1985-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE49908B1 (en) | Ethanamine derivatives their preparation and use in pharmaceutical compositions | |
| US4396627A (en) | Secondary amines, their preparation and use in pharmaceutical compositions | |
| US4654371A (en) | Secondary amines, their preparation and use in pharmaceutical compositions | |
| US4629737A (en) | Secondary amines and use in pharmaceutical compositions | |
| NZ198884A (en) | N-(4-(omega-hydroxyalkoxy)phenalkyl)-2-phenylethan-2-olamines | |
| US4385066A (en) | Arylethanolamine derivatives, their preparation and use in pharmaceutical compositions | |
| US4309443A (en) | Cinnamic acid derivatives, their preparation, and pharmaceutical compositions containing them | |
| US4329358A (en) | 3-Chlorophenyl anti-obesity agents | |
| US4341793A (en) | Secondary amines and their use in pharmaceutical compositions | |
| EP0051917B1 (en) | Benzofuran ethanolamine derivatives, processes for their preparation, and their use in medicine | |
| EP0061907B1 (en) | Secondary amines, their preparation, pharmaceutical compositions containing them and their use | |
| EP0063004A1 (en) | Secondary amines, processes for their preparation, and pharmaceutical compositions containing them | |
| EP0070133B1 (en) | Secondary phenylethanol amines, processes for their preparation and their pharmaceutical application | |
| EP0066351B1 (en) | Arylethanol amine derivatives, their preparation and use in pharmaceutical compositions | |
| US4803293A (en) | Tertiary amines | |
| WO1984000956A1 (en) | Secondary arylethanolamines | |
| US4692465A (en) | 2-phenylethylamine derivatives | |
| WO1984004091A1 (en) | Pharmaceutically active 2-phenylethylamine derivatives | |
| US4665072A (en) | Morpholine derivatives, compositions and method of use |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |