IE48257B1 - Detergent bleach composition and process - Google Patents
Detergent bleach composition and processInfo
- Publication number
- IE48257B1 IE48257B1 IE564/79A IE56479A IE48257B1 IE 48257 B1 IE48257 B1 IE 48257B1 IE 564/79 A IE564/79 A IE 564/79A IE 56479 A IE56479 A IE 56479A IE 48257 B1 IE48257 B1 IE 48257B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- bleach
- composition
- porphine
- groups
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 132
- 239000007844 bleaching agent Substances 0.000 title claims abstract description 74
- 239000003599 detergent Substances 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 12
- JZRYQZJSTWVBBD-UHFFFAOYSA-N pentaporphyrin i Chemical compound N1C(C=C2NC(=CC3=NC(=C4)C=C3)C=C2)=CC=C1C=C1C=CC4=N1 JZRYQZJSTWVBBD-UHFFFAOYSA-N 0.000 claims abstract description 57
- 125000000864 peroxy group Chemical group O(O*)* 0.000 claims abstract description 41
- 125000000129 anionic group Chemical group 0.000 claims abstract description 25
- 239000004744 fabric Substances 0.000 claims abstract description 21
- 239000004094 surface-active agent Substances 0.000 claims abstract description 21
- 125000002091 cationic group Chemical group 0.000 claims abstract description 19
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000001424 substituent group Chemical group 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- 150000003839 salts Chemical class 0.000 claims description 34
- -1 alkali metal salt Chemical class 0.000 claims description 33
- 239000011701 zinc Substances 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 22
- 230000003381 solubilizing effect Effects 0.000 claims description 22
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 claims description 21
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 19
- 229910052725 zinc Inorganic materials 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 17
- 229920000742 Cotton Polymers 0.000 claims description 16
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 16
- 239000001301 oxygen Substances 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 16
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 16
- 125000004429 atom Chemical group 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 9
- 238000001035 drying Methods 0.000 claims description 9
- 239000007864 aqueous solution Substances 0.000 claims description 8
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 7
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Chemical group C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 229910019142 PO4 Inorganic materials 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 5
- RRDBXTBGGXLZHD-UHFFFAOYSA-N benzene-1,4-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(C(=O)OO)C=C1 RRDBXTBGGXLZHD-UHFFFAOYSA-N 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 235000021317 phosphate Nutrition 0.000 claims description 5
- 229920000642 polymer Polymers 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 229920001577 copolymer Polymers 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 4
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 4
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 claims description 4
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 claims description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 claims description 3
- ZJAFQAPHWPSKRZ-UHFFFAOYSA-N 4-nitrobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=C([N+]([O-])=O)C=C1 ZJAFQAPHWPSKRZ-UHFFFAOYSA-N 0.000 claims description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 125000001072 heteroaryl group Chemical group 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- 235000002949 phytic acid Nutrition 0.000 claims description 3
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 claims description 3
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical class OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 claims description 2
- IMQLKJBTEOYOSI-UHFFFAOYSA-N Phytic acid Natural products OP(O)(=O)OC1C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C(OP(O)(O)=O)C1OP(O)(O)=O IMQLKJBTEOYOSI-UHFFFAOYSA-N 0.000 claims description 2
- 229920000388 Polyphosphate Polymers 0.000 claims description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 150000001642 boronic acid derivatives Chemical class 0.000 claims description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-L peroxydisulfate Chemical compound [O-]S(=O)(=O)OOS([O-])(=O)=O JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 claims description 2
- 125000005342 perphosphate group Chemical group 0.000 claims description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 2
- 239000000467 phytic acid Substances 0.000 claims description 2
- 229940068041 phytic acid Drugs 0.000 claims description 2
- 229920005646 polycarboxylate Polymers 0.000 claims description 2
- 239000001205 polyphosphate Substances 0.000 claims description 2
- 235000011176 polyphosphates Nutrition 0.000 claims description 2
- 150000004760 silicates Chemical class 0.000 claims description 2
- VNWKTOKETHGBQD-AKLPVKDBSA-N carbane Chemical group [15CH4] VNWKTOKETHGBQD-AKLPVKDBSA-N 0.000 claims 1
- 238000005406 washing Methods 0.000 abstract description 24
- 238000004061 bleaching Methods 0.000 abstract description 7
- 229910052751 metal Inorganic materials 0.000 abstract description 4
- 239000002184 metal Substances 0.000 abstract description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 23
- 238000012360 testing method Methods 0.000 description 16
- 241001122767 Theaceae Species 0.000 description 14
- 239000011734 sodium Substances 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 11
- 235000013305 food Nutrition 0.000 description 11
- 239000000463 material Substances 0.000 description 11
- 239000012190 activator Substances 0.000 description 8
- 125000001931 aliphatic group Chemical group 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229940077388 benzenesulfonate Drugs 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 150000004996 alkyl benzenes Chemical class 0.000 description 6
- 239000011575 calcium Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 150000004967 organic peroxy acids Chemical class 0.000 description 6
- 238000002791 soaking Methods 0.000 description 6
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 6
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000003093 cationic surfactant Substances 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000005342 ion exchange Methods 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000002304 perfume Substances 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 150000008051 alkyl sulfates Chemical class 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 4
- 229910003002 lithium salt Inorganic materials 0.000 description 4
- 159000000002 lithium salts Chemical class 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- 150000003751 zinc Chemical class 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 244000299461 Theobroma cacao Species 0.000 description 3
- 235000009470 Theobroma cacao Nutrition 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 3
- 229940105329 carboxymethylcellulose Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000011068 loading method Methods 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- 235000013336 milk Nutrition 0.000 description 3
- 239000008267 milk Substances 0.000 description 3
- 210000004080 milk Anatomy 0.000 description 3
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- ROSDSFDQCJNGOL-UHFFFAOYSA-N protonated dimethyl amine Natural products CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 235000019832 sodium triphosphate Nutrition 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 239000003760 tallow Substances 0.000 description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- LNKRCPCURWJUAY-UHFFFAOYSA-N 2-(2-chloroacetyl)peroxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OOC(=O)CCl LNKRCPCURWJUAY-UHFFFAOYSA-N 0.000 description 2
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical group OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 108091005804 Peptidases Proteins 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 229910001424 calcium ion Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 235000011180 diphosphates Nutrition 0.000 description 2
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 2
- 230000005281 excited state Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- VPVSTMAPERLKKM-UHFFFAOYSA-N glycoluril Chemical compound N1C(=O)NC2NC(=O)NC21 VPVSTMAPERLKKM-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000004519 grease Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000005286 illumination Methods 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 125000000963 oxybis(methylene) group Chemical group [H]C([H])(*)OC([H])([H])* 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- ZOXDYIUULNHTCM-UHFFFAOYSA-N phenoxymethylbenzene;sodium Chemical compound [Na].C=1C=CC=CC=1COC1=CC=CC=C1 ZOXDYIUULNHTCM-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- CYIDZMCFTVVTJO-UHFFFAOYSA-N pyromellitic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=C1C(O)=O CYIDZMCFTVVTJO-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229960001922 sodium perborate Drugs 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- NWPMTMCXJZTLSO-UHFFFAOYSA-M sodium;4-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 NWPMTMCXJZTLSO-UHFFFAOYSA-M 0.000 description 2
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical compound OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 150000004685 tetrahydrates Chemical class 0.000 description 2
- SYRHIZPPCHMRIT-UHFFFAOYSA-N tin(4+) Chemical compound [Sn+4] SYRHIZPPCHMRIT-UHFFFAOYSA-N 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- RKHMZKDESOMZLE-UHFFFAOYSA-N (1,3-diacetyl-5-acetyloxyimidazolidin-4-yl) acetate Chemical compound CC(=O)OC1C(OC(C)=O)N(C(C)=O)CN1C(C)=O RKHMZKDESOMZLE-UHFFFAOYSA-N 0.000 description 1
- IQVLXQGNLCPZCL-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate Chemical compound CC(C)(C)OC(=O)NCCCCC(NC(=O)OC(C)(C)C)C(=O)ON1C(=O)CCC1=O IQVLXQGNLCPZCL-UHFFFAOYSA-N 0.000 description 1
- NIHKFGMYMWGERR-UHFFFAOYSA-N (3-chlorobenzoyl) 3-chlorobenzoate Chemical compound ClC1=CC=CC(C(=O)OC(=O)C=2C=C(Cl)C=CC=2)=C1 NIHKFGMYMWGERR-UHFFFAOYSA-N 0.000 description 1
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical group C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- VAVZXZURPCYUHS-RQOWECAXSA-N (z)-3-(hydrazinecarbonyl)-4-oxopent-2-enoic acid Chemical compound OC(=O)/C=C(C(=O)C)\C(=O)NN VAVZXZURPCYUHS-RQOWECAXSA-N 0.000 description 1
- XBRSMICTSWBNTP-UHFFFAOYSA-N 1,1,3-triphosphonopropan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)P(O)(O)=O XBRSMICTSWBNTP-UHFFFAOYSA-N 0.000 description 1
- OGTPNDHOHCFDTK-UHFFFAOYSA-N 1,2,3-triphosphonopropan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)(P(O)(O)=O)CP(O)(O)=O OGTPNDHOHCFDTK-UHFFFAOYSA-N 0.000 description 1
- YVPHSTVRTGSOSK-UHFFFAOYSA-N 1,3,3-triphosphonopropylphosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)CC(P(O)(O)=O)P(O)(O)=O YVPHSTVRTGSOSK-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- DFUGJTBMQKRCPI-UHFFFAOYSA-N 2,4,6-trimethoxy-1,3,5-triazine Chemical compound COC1=NC(OC)=NC(OC)=N1 DFUGJTBMQKRCPI-UHFFFAOYSA-N 0.000 description 1
- PSZAEHPBBUYICS-UHFFFAOYSA-N 2-methylidenepropanedioic acid Chemical compound OC(=O)C(=C)C(O)=O PSZAEHPBBUYICS-UHFFFAOYSA-N 0.000 description 1
- XYJLPCAKKYOLGU-UHFFFAOYSA-N 2-phosphonoethylphosphonic acid Chemical class OP(O)(=O)CCP(O)(O)=O XYJLPCAKKYOLGU-UHFFFAOYSA-N 0.000 description 1
- KJFWZPRHQXKKLP-UHFFFAOYSA-N 4-[10,15,20-tris(4-sulfophenyl)-21,23-dihydroporphyrin-5-yl]benzenesulfonic acid zinc Chemical compound [Zn].S(=O)(=O)(O)C1=CC=C(C=C1)C1=C2C=CC(C(=C3C=CC(=C(C=4C=CC(=C(C5=CC=C1N5)C5=CC=C(C=C5)S(=O)(=O)O)N4)C4=CC=C(C=C4)S(=O)(=O)O)N3)C3=CC=C(C=C3)S(=O)(=O)O)=N2 KJFWZPRHQXKKLP-UHFFFAOYSA-N 0.000 description 1
- ZUGHSJIRMAZPBK-UHFFFAOYSA-N 4-chlorobenzene-1,2-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(Cl)C=C1C(=O)OO ZUGHSJIRMAZPBK-UHFFFAOYSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- QEVGZEDELICMKH-UHFFFAOYSA-N Diglycolic acid Chemical compound OC(=O)COCC(O)=O QEVGZEDELICMKH-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- QZXSMBBFBXPQHI-UHFFFAOYSA-N N-(dodecanoyl)ethanolamine Chemical compound CCCCCCCCCCCC(=O)NCCO QZXSMBBFBXPQHI-UHFFFAOYSA-N 0.000 description 1
- VIHYIVKEECZGOU-UHFFFAOYSA-N N-acetylimidazole Chemical compound CC(=O)N1C=CN=C1 VIHYIVKEECZGOU-UHFFFAOYSA-N 0.000 description 1
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 description 1
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical group NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 1
- FZQSLXQPHPOTHG-UHFFFAOYSA-N [K+].[K+].O1B([O-])OB2OB([O-])OB1O2 Chemical compound [K+].[K+].O1B([O-])OB2OB([O-])OB1O2 FZQSLXQPHPOTHG-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005211 alkyl trimethyl ammonium group Chemical group 0.000 description 1
- REDXJYDRNCIFBQ-UHFFFAOYSA-N aluminium(3+) Chemical compound [Al+3] REDXJYDRNCIFBQ-UHFFFAOYSA-N 0.000 description 1
- HUVXQFBFIFIDDU-UHFFFAOYSA-N aluminum phthalocyanine Chemical compound [Al+3].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 HUVXQFBFIFIDDU-UHFFFAOYSA-N 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000000477 aza group Chemical group 0.000 description 1
- 125000002648 azanetriyl group Chemical group *N(*)* 0.000 description 1
- 229960002319 barbital Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- QNSOHXTZPUMONC-UHFFFAOYSA-N benzene pentacarboxylic acid Natural products OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O QNSOHXTZPUMONC-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- PBHVCRIXMXQXPD-UHFFFAOYSA-N chembl2369102 Chemical compound C1=CC(S(=O)(=O)O)=CC=C1C(C1=CC=C(N1)C(C=1C=CC(=CC=1)S(O)(=O)=O)=C1C=CC(=N1)C(C=1C=CC(=CC=1)S(O)(=O)=O)=C1C=CC(N1)=C1C=2C=CC(=CC=2)S(O)(=O)=O)=C2N=C1C=C2 PBHVCRIXMXQXPD-UHFFFAOYSA-N 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- BHDAXLOEFWJKTL-UHFFFAOYSA-L dipotassium;carboxylatooxy carbonate Chemical compound [K+].[K+].[O-]C(=O)OOC([O-])=O BHDAXLOEFWJKTL-UHFFFAOYSA-L 0.000 description 1
- JMGZBMRVDHKMKB-UHFFFAOYSA-L disodium;2-sulfobutanedioate Chemical compound [Na+].[Na+].OS(=O)(=O)C(C([O-])=O)CC([O-])=O JMGZBMRVDHKMKB-UHFFFAOYSA-L 0.000 description 1
- KRHIGIYZRJWEGL-UHFFFAOYSA-N dodecapotassium;tetraborate Chemical class [K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[K+].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-].[O-]B([O-])[O-] KRHIGIYZRJWEGL-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000007046 ethoxylation reaction Methods 0.000 description 1
- ZWXLNENRXIYAJG-UHFFFAOYSA-N ethyl 2-(3-benzoyl-2,4-dioxoimidazolidin-1-yl)acetate Chemical compound O=C1N(CC(=O)OCC)CC(=O)N1C(=O)C1=CC=CC=C1 ZWXLNENRXIYAJG-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 235000021323 fish oil Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000001046 glycoluril group Chemical group [H]C12N(*)C(=O)N(*)C1([H])N(*)C(=O)N2* 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 230000005283 ground state Effects 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- JEGIFBGJZPYMJS-UHFFFAOYSA-N imidazol-1-yl(phenyl)methanone Chemical compound C1=CN=CN1C(=O)C1=CC=CC=C1 JEGIFBGJZPYMJS-UHFFFAOYSA-N 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 235000021539 instant coffee Nutrition 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical class OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 description 1
- HNEGQIOMVPPMNR-NSCUHMNNSA-N mesaconic acid Chemical compound OC(=O)C(/C)=C/C(O)=O HNEGQIOMVPPMNR-NSCUHMNNSA-N 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- HNEGQIOMVPPMNR-UHFFFAOYSA-N methylfumaric acid Natural products OC(=O)C(C)=CC(O)=O HNEGQIOMVPPMNR-UHFFFAOYSA-N 0.000 description 1
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 1
- 239000010705 motor oil Substances 0.000 description 1
- UJPCOKISUIXFFR-UHFFFAOYSA-N n-acetyl-n-(4-methylphenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(C)C=C1 UJPCOKISUIXFFR-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- HJZKOAYDRQLPME-UHFFFAOYSA-N oxidronic acid Chemical compound OP(=O)(O)C(O)P(O)(O)=O HJZKOAYDRQLPME-UHFFFAOYSA-N 0.000 description 1
- 229960004230 oxidronic acid Drugs 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- HJKYXKSLRZKNSI-UHFFFAOYSA-I pentapotassium;hydrogen sulfate;oxido sulfate;sulfuric acid Chemical compound [K+].[K+].[K+].[K+].[K+].OS([O-])(=O)=O.[O-]S([O-])(=O)=O.OS(=O)(=O)O[O-].OS(=O)(=O)O[O-] HJKYXKSLRZKNSI-UHFFFAOYSA-I 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- YNFAEFZZHQSSDP-UHFFFAOYSA-N phenyl acetate;sodium Chemical compound [Na].CC(=O)OC1=CC=CC=C1 YNFAEFZZHQSSDP-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- XYORSKKUGAGNPC-UHFFFAOYSA-N phosphonocarbonylphosphonic acid Chemical compound OP(O)(=O)C(=O)P(O)(O)=O XYORSKKUGAGNPC-UHFFFAOYSA-N 0.000 description 1
- 239000003504 photosensitizing agent Substances 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical class C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical compound N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 description 1
- 229920006391 phthalonitrile polymer Polymers 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- GHKGUEZUGFJUEJ-UHFFFAOYSA-M potassium;4-methylbenzenesulfonate Chemical compound [K+].CC1=CC=C(S([O-])(=O)=O)C=C1 GHKGUEZUGFJUEJ-UHFFFAOYSA-M 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 229940048084 pyrophosphate Drugs 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 235000020095 red wine Nutrition 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- CFPVQGQJRGIWSP-UHFFFAOYSA-N scandium(3+) Chemical compound [Sc+3] CFPVQGQJRGIWSP-UHFFFAOYSA-N 0.000 description 1
- 239000000429 sodium aluminium silicate Substances 0.000 description 1
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- UGJCNRLBGKEGEH-UHFFFAOYSA-N sodium-binding benzofuran isophthalate Chemical compound COC1=CC=2C=C(C=3C(=CC(=CC=3)C(O)=O)C(O)=O)OC=2C=C1N(CCOCC1)CCOCCOCCN1C(C(=CC=1C=2)OC)=CC=1OC=2C1=CC=C(C(O)=O)C=C1C(O)=O UGJCNRLBGKEGEH-UHFFFAOYSA-N 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- JZBRFIUYUGTUGG-UHFFFAOYSA-J tetrapotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical class [K+].[K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O JZBRFIUYUGTUGG-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- 229910009112 xH2O Inorganic materials 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- 239000002888 zwitterionic surfactant Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0063—Photo- activating compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA297,842A CA1104451A (en) | 1978-02-28 | 1978-02-28 | Detergent bleach composition and process |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE790564L IE790564L (en) | 1979-08-28 |
| IE48257B1 true IE48257B1 (en) | 1984-11-14 |
Family
ID=4110871
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE564/79A IE48257B1 (en) | 1978-02-28 | 1979-08-08 | Detergent bleach composition and process |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4240920A (enExample) |
| EP (1) | EP0003861A1 (enExample) |
| JP (2) | JPS5858394B2 (enExample) |
| AU (1) | AU524329B2 (enExample) |
| BE (1) | BE51T1 (enExample) |
| BR (1) | BR7901212A (enExample) |
| CA (1) | CA1104451A (enExample) |
| DE (1) | DE2948923A1 (enExample) |
| FR (1) | FR2443500A1 (enExample) |
| GB (1) | GB2042005B (enExample) |
| IE (1) | IE48257B1 (enExample) |
| IT (1) | IT1148214B (enExample) |
| NL (1) | NL187494C (enExample) |
| PH (1) | PH15828A (enExample) |
| SE (1) | SE437533B (enExample) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX155643A (es) * | 1980-02-29 | 1988-04-11 | Ciba Geigy Ag | Composicion blanqueadora de telas |
| US4325828A (en) * | 1980-03-27 | 1982-04-20 | Lever Brothers Company | Detergent bleach compositions |
| US4394125A (en) * | 1980-09-09 | 1983-07-19 | Ciba-Geigy Corporation | Process for bleaching textiles and for combating micro-organisms with sulfonated phthalocyanine of aluminum or zinc and containing halogen or cyano substituents as photoactivator |
| EP0054992B1 (en) * | 1980-12-22 | 1985-03-20 | Unilever N.V. | Composition containing a photo-activator for improved bleaching |
| US4417994A (en) * | 1981-01-24 | 1983-11-29 | The Procter & Gamble Company | Particulate detergent additive compositions |
| US4391723A (en) * | 1981-07-13 | 1983-07-05 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4391724A (en) * | 1981-10-21 | 1983-07-05 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4391725A (en) * | 1981-10-21 | 1983-07-05 | The Procter & Gamble Company | Controlled release laundry bleach product |
| US4566874A (en) * | 1981-12-09 | 1986-01-28 | Ciba-Geigy Corporation | Water-soluble zinc and aluminium phthalocyanines and use thereof as photoactivators |
| US4497741A (en) * | 1981-12-09 | 1985-02-05 | Ciba-Geigy Corporation | Water-soluble zinc and aluminium phthalocyanines |
| GR78065B (enExample) * | 1982-02-19 | 1984-09-26 | Unilever Nv | |
| ZA831045B (en) * | 1982-02-19 | 1984-09-26 | Unilever Plc | Photobleach system,composition and process |
| US4529534A (en) * | 1982-08-19 | 1985-07-16 | The Procter & Gamble Company | Peroxyacid bleach compositions |
| GB8311865D0 (en) * | 1983-04-29 | 1983-06-02 | Procter & Gamble Ltd | Bleach compositions |
| CH657864A5 (de) * | 1984-02-17 | 1986-09-30 | Ciba Geigy Ag | Wasserloesliche phthalocyaninverbindungen und deren verwendung als photoaktivatoren. |
| ZA851897B (en) * | 1984-04-02 | 1986-10-29 | Colgate Palmolive Co | Non-caking bleaching detergent composition containing a lower hydrate of sodium perborate |
| CH658771A5 (de) * | 1984-05-28 | 1986-12-15 | Ciba Geigy Ag | Azaphthalocyanine und deren verwendung als photoaktivatoren. |
| US5250212A (en) * | 1987-05-27 | 1993-10-05 | The Procter & Gamble Company | Liquid detergent containing solid peroxygen bleach and solvent system comprising water and lower aliphatic monoalcohol |
| GB8900496D0 (en) * | 1989-01-10 | 1989-03-08 | Procter & Gamble | Liquid detergent composition containing enzyme and enzyme stabilization system |
| US5275753A (en) * | 1989-01-10 | 1994-01-04 | The Procter & Gamble Company | Stabilized alkaline liquid detergent compositions containing enzyme and peroxygen bleach |
| DE69027774T2 (de) * | 1990-10-22 | 1997-02-20 | Procter & Gamble | Stabile, flüssige Reinigungsmittel enthaltend ein Bleichmittel |
| TW230784B (enExample) * | 1990-10-22 | 1994-09-21 | Procter & Gamble | |
| ES2094795T3 (es) * | 1990-11-02 | 1997-02-01 | Ici Plc | Ftalocianinas polisustituidas. |
| DE69129150T2 (de) * | 1991-10-14 | 1998-10-08 | The Procter & Gamble Co., Cincinnati, Ohio | Waschmittelzusammensetzungen mit Zusätzen zur Verhinderung der Farbstoffübertragung |
| US5560858A (en) * | 1992-07-15 | 1996-10-01 | The Procter & Gamble Company | Dye transfer inhibiting compositions containing a metallocatalyst, a bleach and polyamine N-oxide polymer |
| EP0596184B1 (en) * | 1992-11-06 | 1998-04-15 | The Procter & Gamble Company | Detergent compositions inhibiting dye transfer |
| EP0596186A1 (en) * | 1992-11-06 | 1994-05-11 | The Procter & Gamble Company | Detergent compositions inhibiting dye transfer in washing |
| EP0596187A1 (en) * | 1992-11-06 | 1994-05-11 | The Procter & Gamble Company | Detergent compositions inhibiting dye transfer in washing |
| EP0692947A4 (en) * | 1993-04-09 | 1996-03-13 | Procter & Gamble | WASHING METHOD IN A DISHWASHER USING A METAL CATALYST AND ENZYME THAT PRODUCES HYDROGEN PEROXIDE |
| US5670468A (en) * | 1993-04-09 | 1997-09-23 | The Procter & Gamble Company | Machine dishwashing method employing a metallo catalyst and enzymatic source of hydrogen peroxide |
| GB9324129D0 (en) * | 1993-11-24 | 1994-01-12 | Unilever Plc | Detergent compositions and process for preparing them |
| US5908821A (en) * | 1994-05-11 | 1999-06-01 | Procter & Gamble Company | Dye transfer inhibiting compositions with specifically selected metallo catalysts |
| US5968892A (en) * | 1994-06-17 | 1999-10-19 | Hutchins; James Peyton | Non-brittle laundry bars comprising coconut alkyl sulfate and polyethylene glycol |
| US5460747A (en) * | 1994-08-31 | 1995-10-24 | The Procter & Gamble Co. | Multiple-substituted bleach activators |
| US5584888A (en) * | 1994-08-31 | 1996-12-17 | Miracle; Gregory S. | Perhydrolysis-selective bleach activators |
| US5916481A (en) * | 1995-07-25 | 1999-06-29 | The Procter & Gamble Company | Low hue photobleaches |
| US5679661A (en) * | 1995-07-25 | 1997-10-21 | The Procter & Gamble Company | Low hue photodisinfectants |
| WO1997029636A1 (en) * | 1996-02-19 | 1997-08-21 | Schaffer, Moshe | Photosensitive composition |
| WO1997043366A1 (en) * | 1996-05-17 | 1997-11-20 | The Procter & Gamble Company | Detergent composition |
| EP0906382A4 (en) * | 1996-05-17 | 1999-11-24 | Procter & Gamble | Detergent composition |
| ATE264902T1 (de) * | 1996-05-17 | 2004-05-15 | Procter & Gamble | Waschmittelzusammensetzung |
| MA25183A1 (fr) * | 1996-05-17 | 2001-07-02 | Arthur Jacques Kami Christiaan | Compositions detergentes |
| ZA974226B (en) * | 1996-05-17 | 1998-12-28 | Procter & Gamble | Detergent composition |
| US6191100B1 (en) | 1996-05-17 | 2001-02-20 | The Procter & Gamble Company | Detergent composition having effervescent generating ingredients |
| EP0808892A1 (en) * | 1996-05-21 | 1997-11-26 | The Procter & Gamble Company | Acidic cleaning compositions |
| EP0808891A1 (en) * | 1996-05-21 | 1997-11-26 | The Procter & Gamble Company | Acidic cleaning compositions |
| GB2313603A (en) * | 1996-05-31 | 1997-12-03 | Procter & Gamble | Detergent compositions |
| GB2313602A (en) * | 1996-05-31 | 1997-12-03 | Procter & Gamble | Detergent compositions |
| EP0960183A2 (en) | 1997-01-24 | 1999-12-01 | The Procter & Gamble Company | Photochemical singlet oxygen generators having enhanced singlet oxygen yields |
| US6225273B1 (en) | 1997-01-24 | 2001-05-01 | Case Western Reserve University | Photochemical superoxide generators |
| ZA98524B (en) | 1997-01-24 | 1998-07-29 | Procter & Gamble | Low hue photobleaches |
| CA2277934A1 (en) | 1997-01-24 | 1998-07-30 | The Procter & Gamble Company | Photobleaching compositions comprising mixed metallocyanines |
| BR9807086A (pt) | 1997-01-24 | 2000-04-18 | Procter & Gamble | Geradores fotoquìmicos de oxigênio singleto contendo modificadores catiÈnicos de substantividade |
| EP0960182A2 (en) | 1997-01-24 | 1999-12-01 | The Procter & Gamble Company | Singlet oxygen generators having enhanced heavy atom effect |
| BR9807536A (pt) | 1997-01-24 | 2000-03-21 | Procter & Gamble | Composições de fotoalvejamento eficazes em tecido com mancha escura. |
| US20040055965A1 (en) * | 1997-06-13 | 2004-03-25 | Hubig Stephan M. | Recreational water treatment employing singlet oxygen |
| US20030194433A1 (en) * | 2002-03-12 | 2003-10-16 | Ecolab | Antimicrobial compositions, methods and articles employing singlet oxygen- generating agent |
| NZ331196A (en) * | 1997-08-15 | 2000-01-28 | Ciba Sc Holding Ag | Water soluble fabric softener compositions comprising phthalocyanine, a quaternary ammonium compound and a photobleaching agent |
| GB2329397A (en) * | 1997-09-18 | 1999-03-24 | Procter & Gamble | Photo-bleaching agent |
| US6180589B1 (en) * | 1999-01-05 | 2001-01-30 | National Starch And Chemical Investment Holding Corporation | Polyether hydroxycarboxylate copolymers |
| US6541437B2 (en) | 2000-04-05 | 2003-04-01 | The Procter & Gamble Company | Speckled detergent composition |
| US20070020300A1 (en) * | 2002-03-12 | 2007-01-25 | Ecolab Inc. | Recreational water treatment employing singlet oxygen |
| US20050288200A1 (en) * | 2004-06-24 | 2005-12-29 | Willey Alan D | Photo Bleach Compositions |
| US20060019854A1 (en) * | 2004-07-21 | 2006-01-26 | Johnsondiversey. Inc. | Paper mill cleaner with taed |
| US20120324655A1 (en) | 2011-06-23 | 2012-12-27 | Nalini Chawla | Product for pre-treatment and laundering of stained fabric |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1408144A (en) * | 1972-06-02 | 1975-10-01 | Procter & Gamble Ltd | Bleaching process |
| IE37879B1 (en) * | 1972-07-10 | 1977-11-09 | Procter & Gamble | Bleaching process |
| US4033718A (en) * | 1973-11-27 | 1977-07-05 | The Procter & Gamble Company | Photoactivated bleaching process |
| PH15875A (en) * | 1973-11-27 | 1983-04-13 | Procter & Gamble | Photoactivated bleaching process |
| CA1064797A (en) * | 1975-04-03 | 1979-10-23 | Brandon H. Wiers | Photoactivated bleach-compositions and process |
| GB1541576A (en) * | 1975-06-20 | 1979-03-07 | Procter & Gamble Ltd | Inhibiting dye ltransfer in washing |
| DE2651254A1 (de) * | 1975-11-17 | 1977-05-18 | Procter & Gamble Europ | Durch peroxybleiche aktivierte detergens-komposition |
| FI763593A7 (enExample) * | 1975-12-18 | 1977-06-19 | Unilever Nv | |
| US4087369A (en) * | 1976-11-08 | 1978-05-02 | The Procter & Gamble Company | Peroxybleach activated detergent composition |
| CH630127A5 (de) | 1977-03-25 | 1982-05-28 | Ciba Geigy Ag | Verfahren zum bleichen von textilien. |
-
1978
- 1978-02-28 CA CA297,842A patent/CA1104451A/en not_active Expired
-
1979
- 1979-02-13 PH PH22189A patent/PH15828A/en unknown
- 1979-02-19 BE BEBTR51A patent/BE51T1/xx not_active IP Right Cessation
- 1979-02-19 NL NLAANVRAGE7915006,A patent/NL187494C/xx not_active IP Right Cessation
- 1979-02-19 DE DE19792948923 patent/DE2948923A1/de active Granted
- 1979-02-19 EP EP79200082A patent/EP0003861A1/en not_active Withdrawn
- 1979-02-19 GB GB8008028A patent/GB2042005B/en not_active Expired
- 1979-02-23 BR BR7901212A patent/BR7901212A/pt unknown
- 1979-02-27 US US06/015,677 patent/US4240920A/en not_active Expired - Lifetime
- 1979-02-27 AU AU44613/79A patent/AU524329B2/en not_active Expired
- 1979-02-28 JP JP54023282A patent/JPS5858394B2/ja not_active Expired
- 1979-08-08 IE IE564/79A patent/IE48257B1/en not_active IP Right Cessation
-
1980
- 1980-01-02 FR FR8000103A patent/FR2443500A1/fr active Granted
- 1980-02-19 SE SE8001309A patent/SE437533B/sv not_active IP Right Cessation
- 1980-03-05 IT IT86212/80A patent/IT1148214B/it active
-
1983
- 1983-02-04 JP JP58017295A patent/JPS594479B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PH15828A (en) | 1983-04-08 |
| AU4461379A (en) | 1979-09-06 |
| JPS594479B2 (ja) | 1984-01-30 |
| FR2443500A1 (fr) | 1980-07-04 |
| JPS5858394B2 (ja) | 1983-12-24 |
| JPS58150000A (ja) | 1983-09-06 |
| FR2443500B1 (enExample) | 1983-11-25 |
| IT1148214B (it) | 1986-11-26 |
| US4240920A (en) | 1980-12-23 |
| CA1104451A (en) | 1981-07-07 |
| BR7901212A (pt) | 1979-10-02 |
| SE437533B (sv) | 1985-03-04 |
| GB2042005B (en) | 1982-08-18 |
| EP0003861A1 (en) | 1979-09-05 |
| NL187494C (nl) | 1991-10-16 |
| DE2948923A1 (de) | 1980-05-29 |
| JPS54160403A (en) | 1979-12-19 |
| AU524329B2 (en) | 1982-09-09 |
| BE51T1 (fr) | 1980-04-11 |
| IE790564L (en) | 1979-08-28 |
| IT8086212A0 (it) | 1980-03-05 |
| DE2948923C2 (enExample) | 1988-09-01 |
| NL7915006A (nl) | 1980-05-30 |
| GB2042005A (en) | 1980-09-17 |
| SE8001309L (sv) | 1980-02-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE48257B1 (en) | Detergent bleach composition and process | |
| CA1075405A (en) | Photoactivated bleach-compositions and process | |
| ES2221665T3 (es) | Composicion de blanqueo de tejidos. | |
| KR930009821B1 (ko) | 4급 암모늄 또는 포스포늄 페록시탄산의 전구물질 및 이를 함유하는 세제표백조성물 | |
| US4671891A (en) | Bleaching compositions | |
| AU671739B2 (en) | Inhibition of re-absorption of migrating dyes in the wash liquor | |
| EP0201943A1 (en) | Bleach compositions | |
| US4892555A (en) | Method for conditioning fabrics | |
| US4786421A (en) | Fabric conditioning composition | |
| IE55721B1 (en) | Bleaching compositions | |
| EP0087833A1 (en) | Photobleach system, composition and process | |
| US4828722A (en) | Through the wash fabric conditioning compositions | |
| GB2307250A (en) | Fabric bleaching composition | |
| JP2001511198A (ja) | 混合メタロシアニンを含んだ光漂白組成物 | |
| EP0105690A1 (en) | Bleaching compositions | |
| GB2110259A (en) | Peroxyacid bleaching and laundering composition | |
| EP0693116B1 (en) | Composition and process for inhibiting dye transfer | |
| EP0123400A2 (en) | Fabric conditioning agents, compositions and processes | |
| GB2192909A (en) | Through-the-wash fabric conditioning compositions | |
| JPH089836B2 (ja) | 繊維製品の処理方法及び処理用組成物 | |
| GB2129454A (en) | Peroxyacid bleaching and laundering composition | |
| CA1208852A (en) | Low temperature bleaching composition | |
| KR20020019068A (ko) | 형광 증백제로 처리된 섬유재료의 형광을 억제하기 위한uv 흡수제의 용도 | |
| JPH0388898A (ja) | 漂白洗浄剤組成物 | |
| KR20050004309A (ko) | 4급 암모늄 유도체계 표백활성화 화합물을 함유하는 표백조성물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Patent lapsed |