IE46090B1 - Piperidine derivatives - Google Patents
Piperidine derivativesInfo
- Publication number
- IE46090B1 IE46090B1 IE2329/77A IE232977A IE46090B1 IE 46090 B1 IE46090 B1 IE 46090B1 IE 2329/77 A IE2329/77 A IE 2329/77A IE 232977 A IE232977 A IE 232977A IE 46090 B1 IE46090 B1 IE 46090B1
- Authority
- IE
- Ireland
- Prior art keywords
- group
- general formula
- amino
- methoxy
- piperidine
- Prior art date
Links
- 150000003053 piperidines Chemical class 0.000 title claims abstract description 41
- -1 N-substituted piperidine Chemical class 0.000 claims abstract description 52
- 238000000034 method Methods 0.000 claims abstract description 40
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 32
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 30
- 239000002253 acid Substances 0.000 claims description 24
- 230000008569 process Effects 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 14
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 13
- 125000002252 acyl group Chemical group 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- 150000001204 N-oxides Chemical class 0.000 claims description 11
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 11
- 235000010233 benzoic acid Nutrition 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 11
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 9
- 239000005711 Benzoic acid Substances 0.000 claims description 7
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- 150000008064 anhydrides Chemical class 0.000 claims description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- 239000004480 active ingredient Substances 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 238000005903 acid hydrolysis reaction Methods 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 238000005904 alkaline hydrolysis reaction Methods 0.000 claims description 4
- 125000005336 allyloxy group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 125000004450 alkenylene group Chemical group 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
- 239000012024 dehydrating agents Substances 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- SVHHDDJAIZGKKW-UHFFFAOYSA-N 4-amino-n-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;iodomethane Chemical compound IC.COC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 SVHHDDJAIZGKKW-UHFFFAOYSA-N 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 2
- 125000005133 alkynyloxy group Chemical group 0.000 claims description 2
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 claims description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 239000013067 intermediate product Substances 0.000 claims description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 239000000047 product Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 150000003863 ammonium salts Chemical class 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 239000000376 reactant Substances 0.000 claims 1
- 208000018522 Gastrointestinal disease Diseases 0.000 abstract description 4
- 230000001225 therapeutic effect Effects 0.000 abstract description 3
- 206010047700 Vomiting Diseases 0.000 abstract description 2
- 210000003169 central nervous system Anatomy 0.000 abstract description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical class NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 abstract 1
- 239000000155 melt Substances 0.000 description 46
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 34
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 31
- 239000000203 mixture Substances 0.000 description 30
- 239000000243 solution Substances 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 13
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000007787 solid Substances 0.000 description 7
- FKRMDUAHRGGQNA-UHFFFAOYSA-N 4-amino-n-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;hydrochloride Chemical compound Cl.COC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 FKRMDUAHRGGQNA-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 5
- 239000012047 saturated solution Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- SOBQOVZAFJDEJI-UHFFFAOYSA-N 2-amino-5-nitrobenzamide Chemical compound NC(=O)C1=CC([N+]([O-])=O)=CC=C1N SOBQOVZAFJDEJI-UHFFFAOYSA-N 0.000 description 4
- 150000001559 benzoic acids Chemical class 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 239000000796 flavoring agent Substances 0.000 description 4
- 235000013355 food flavoring agent Nutrition 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- YUBDLZGUSSWQSS-UHFFFAOYSA-N 1-benzylpiperidin-4-amine Chemical compound C1CC(N)CCN1CC1=CC=CC=C1 YUBDLZGUSSWQSS-UHFFFAOYSA-N 0.000 description 3
- CDWQMIOUFSJYIL-UHFFFAOYSA-N 4-acetamido-n-(1-benzylpiperidin-4-yl)-2-hydroxy-5-nitrobenzamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC(O)=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 CDWQMIOUFSJYIL-UHFFFAOYSA-N 0.000 description 3
- WQWOIVVJQLQJPE-UHFFFAOYSA-N 4-amino-2-methoxy-5-nitrobenzamide Chemical compound COC1=CC(N)=C([N+]([O-])=O)C=C1C(N)=O WQWOIVVJQLQJPE-UHFFFAOYSA-N 0.000 description 3
- LNNCGYPKQBFDSP-UHFFFAOYSA-N 4-amino-n-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide Chemical compound COC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 LNNCGYPKQBFDSP-UHFFFAOYSA-N 0.000 description 3
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- YNGWUTJVTBAJBD-UHFFFAOYSA-N [5-acetamido-2-[(1-benzylpiperidin-4-yl)carbamoyl]-4-nitrophenyl] acetate Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC(OC(C)=O)=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 YNGWUTJVTBAJBD-UHFFFAOYSA-N 0.000 description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000001530 fumaric acid Substances 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000002295 serotoninergic effect Effects 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 2
- VMXFSXQUZNXWLM-UHFFFAOYSA-N 2-acetamido-5-nitrobenzamide Chemical compound C(C)(=O)NC1=C(C(=O)N)C=C(C=C1)[N+](=O)[O-] VMXFSXQUZNXWLM-UHFFFAOYSA-N 0.000 description 2
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 description 2
- NWPWVHLNOYTUFW-UHFFFAOYSA-N 4-acetamido-n-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide Chemical compound COC1=CC(NC(C)=O)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 NWPWVHLNOYTUFW-UHFFFAOYSA-N 0.000 description 2
- UPPPNKBPESUVOB-UHFFFAOYSA-N 4-amino-n-(1-benzylpiperidin-4-yl)-2-hydroxy-5-nitrobenzamide;hydrochloride Chemical compound Cl.C1=C([N+]([O-])=O)C(N)=CC(O)=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 UPPPNKBPESUVOB-UHFFFAOYSA-N 0.000 description 2
- 208000008589 Obesity Diseases 0.000 description 2
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 239000004141 Sodium laurylsulphate Substances 0.000 description 2
- 241000219161 Theobroma Species 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 description 2
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 2
- 229940005501 dopaminergic agent Drugs 0.000 description 2
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 235000020824 obesity Nutrition 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920001993 poloxamer 188 Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000004334 sorbic acid Substances 0.000 description 2
- 235000010199 sorbic acid Nutrition 0.000 description 2
- 229940075582 sorbic acid Drugs 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 230000000638 stimulation Effects 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- HSOQDPYTTOKEHI-UHFFFAOYSA-N 2-methylsulfanylbenzamide Chemical compound CSC1=CC=CC=C1C(N)=O HSOQDPYTTOKEHI-UHFFFAOYSA-N 0.000 description 1
- KWAYEPXDGHYGRW-UHFFFAOYSA-N 3-nitrobenzamide Chemical compound NC(=O)C1=CC=CC([N+]([O-])=O)=C1 KWAYEPXDGHYGRW-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- GEHILIYJUKFLNC-UHFFFAOYSA-N 4-acetamido-2-methoxy-5-nitrobenzoic acid Chemical compound COC1=CC(NC(C)=O)=C([N+]([O-])=O)C=C1C(O)=O GEHILIYJUKFLNC-UHFFFAOYSA-N 0.000 description 1
- CNHPODBJQHZAIY-UHFFFAOYSA-N 4-acetamido-2-methoxy-5-nitrobenzoyl chloride Chemical compound COC1=CC(NC(C)=O)=C([N+]([O-])=O)C=C1C(Cl)=O CNHPODBJQHZAIY-UHFFFAOYSA-N 0.000 description 1
- PCUXMSSHWJXYMG-UHFFFAOYSA-N 4-acetamido-N-[1-[(5-chloro-2-methoxyphenyl)methyl]piperidin-4-yl]-2-methoxy-5-nitrobenzamide Chemical compound COC1=CC=C(Cl)C=C1CN1CCC(NC(=O)C=2C(=CC(NC(C)=O)=C(C=2)[N+]([O-])=O)OC)CC1 PCUXMSSHWJXYMG-UHFFFAOYSA-N 0.000 description 1
- HTXBBVIRTRZSND-WLHGVMLRSA-N 4-acetamido-n-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.COC1=CC(NC(C)=O)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 HTXBBVIRTRZSND-WLHGVMLRSA-N 0.000 description 1
- MXFMHKUSWWVSBU-UHFFFAOYSA-N 4-acetamido-n-(1-benzylpiperidin-4-yl)-2-methoxy-n-methyl-5-nitrobenzamide Chemical compound COC1=CC(NC(C)=O)=C([N+]([O-])=O)C=C1C(=O)N(C)C1CCN(CC=2C=CC=CC=2)CC1 MXFMHKUSWWVSBU-UHFFFAOYSA-N 0.000 description 1
- KNKNVWHPXPXREP-UHFFFAOYSA-N 4-amino-2-methoxy-5-nitrobenzamide;hydrochloride Chemical compound Cl.COC1=CC(N)=C([N+]([O-])=O)C=C1C(N)=O KNKNVWHPXPXREP-UHFFFAOYSA-N 0.000 description 1
- BMTMSQUCWHMSBJ-UHFFFAOYSA-N 4-amino-2-methoxy-n-[1-[(3-methylphenyl)methyl]piperidin-4-yl]-5-nitrobenzamide Chemical compound COC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=C(C)C=CC=2)CC1 BMTMSQUCWHMSBJ-UHFFFAOYSA-N 0.000 description 1
- YLKLDLKLEXDSJY-UHFFFAOYSA-N 4-amino-3-nitrobenzamide Chemical compound NC(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 YLKLDLKLEXDSJY-UHFFFAOYSA-N 0.000 description 1
- NCTZJLYPMWKRJA-UHFFFAOYSA-N 4-amino-n-(1-benzhydrylpiperidin-4-yl)-2-methoxy-n-methyl-5-nitrobenzamide Chemical compound COC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)N(C)C1CCN(C(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 NCTZJLYPMWKRJA-UHFFFAOYSA-N 0.000 description 1
- GFOOTUAHCYYIRX-UHFFFAOYSA-N 4-amino-n-(1-benzylpiperidin-4-yl)-2-ethoxy-5-nitrobenzamide Chemical compound CCOC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 GFOOTUAHCYYIRX-UHFFFAOYSA-N 0.000 description 1
- WECDSSFQZDCFHG-UHFFFAOYSA-N 4-amino-n-(1-benzylpiperidin-4-yl)-2-hydroxy-5-nitrobenzamide Chemical compound C1=C([N+]([O-])=O)C(N)=CC(O)=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 WECDSSFQZDCFHG-UHFFFAOYSA-N 0.000 description 1
- AGXSAPPIJHDORX-UHFFFAOYSA-N 4-amino-n-(1-benzylpiperidin-4-yl)-2-methoxy-n-methyl-5-nitrobenzamide Chemical compound COC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)N(C)C1CCN(CC=2C=CC=CC=2)CC1 AGXSAPPIJHDORX-UHFFFAOYSA-N 0.000 description 1
- TUOYWRGPTFEMJW-UHFFFAOYSA-N 4-amino-n-[1-(cyclohexylmethyl)-3-methylpiperidin-4-yl]-2-methoxy-5-nitrobenzamide Chemical compound COC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)NC1C(C)CN(CC2CCCCC2)CC1 TUOYWRGPTFEMJW-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 206010007559 Cardiac failure congestive Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- PCWWYPWFZWLQFM-UHFFFAOYSA-N Cl.NC1=C(C(=O)N)C=C(C=C1)[N+](=O)[O-] Chemical compound Cl.NC1=C(C(=O)N)C=C(C=C1)[N+](=O)[O-] PCWWYPWFZWLQFM-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 208000007882 Gastritis Diseases 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 208000034991 Hiatal Hernia Diseases 0.000 description 1
- 206010020028 Hiatus hernia Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 206010026749 Mania Diseases 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 229940121948 Muscarinic receptor antagonist Drugs 0.000 description 1
- 206010030216 Oesophagitis Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 206010067171 Regurgitation Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical class 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 238000001949 anaesthesia Methods 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000001458 anti-acid effect Effects 0.000 description 1
- 230000001090 anti-dopaminergic effect Effects 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 229960004046 apomorphine Drugs 0.000 description 1
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- DALDUXIBIKGWTK-UHFFFAOYSA-N benzene;toluene Chemical compound C1=CC=CC=C1.CC1=CC=CC=C1 DALDUXIBIKGWTK-UHFFFAOYSA-N 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 230000008512 biological response Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 206010007776 catatonia Diseases 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- 201000001883 cholelithiasis Diseases 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229960003638 dopamine Drugs 0.000 description 1
- 239000002804 dopamine agent Substances 0.000 description 1
- 230000003291 dopaminomimetic effect Effects 0.000 description 1
- 206010013864 duodenitis Diseases 0.000 description 1
- 201000006549 dyspepsia Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 230000007257 malfunction Effects 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- SMALVOWJHUAQQT-UHFFFAOYSA-N n-(1-benzylpiperidin-4-yl)-2-methoxy-5-nitrobenzamide Chemical compound COC1=CC=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC=2C=CC=CC=2)CC1 SMALVOWJHUAQQT-UHFFFAOYSA-N 0.000 description 1
- ZCVVGZIOKJNIAH-UHFFFAOYSA-N n-(1-benzylpiperidin-4-yl)-5-methylsulfinyl-2-phenylmethoxybenzamide Chemical compound C1CN(CC=2C=CC=CC=2)CCC1NC(=O)C1=CC(S(=O)C)=CC=C1OCC1=CC=CC=C1 ZCVVGZIOKJNIAH-UHFFFAOYSA-N 0.000 description 1
- NIQKLXVPGCDKQP-UHFFFAOYSA-N n-(1-benzylpiperidin-4-yl)-n-ethyl-2-methoxy-5-nitrobenzamide Chemical compound C=1C([N+]([O-])=O)=CC=C(OC)C=1C(=O)N(CC)C(CC1)CCN1CC1=CC=CC=C1 NIQKLXVPGCDKQP-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 208000011906 peptic ulcer disease Diseases 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 238000012797 qualification Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000003033 spasmogenic effect Effects 0.000 description 1
- 230000002048 spasmolytic effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/08—Drugs for disorders of the alimentary tract or the digestive system for nausea, cinetosis or vertigo; Antiemetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Pain & Pain Management (AREA)
- Anesthesiology (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Child & Adolescent Psychology (AREA)
- Psychiatry (AREA)
- Rheumatology (AREA)
- Hospice & Palliative Care (AREA)
- Otolaryngology (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB47739/76A GB1574418A (en) | 1976-11-16 | 1976-11-16 | Piperidine derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE46090L IE46090L (en) | 1978-05-16 |
| IE46090B1 true IE46090B1 (en) | 1983-02-23 |
Family
ID=10446086
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2329/77A IE46090B1 (en) | 1976-11-16 | 1977-11-16 | Piperidine derivatives |
| IE2330/77A IE45989B1 (en) | 1976-11-16 | 1977-11-16 | Piperidine compounds |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE2330/77A IE45989B1 (en) | 1976-11-16 | 1977-11-16 | Piperidine compounds |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US5026858A (Direct) |
| JP (2) | JPS5387365A (Direct) |
| AT (2) | AT360013B (Direct) |
| AU (2) | AU517830B2 (Direct) |
| BE (2) | BE860737A (Direct) |
| CA (2) | CA1094072A (Direct) |
| DE (2) | DE2751138A1 (Direct) |
| ES (4) | ES464147A1 (Direct) |
| FR (2) | FR2370733A1 (Direct) |
| GB (1) | GB1574418A (Direct) |
| IE (2) | IE46090B1 (Direct) |
| NL (2) | NL7712570A (Direct) |
| ZA (2) | ZA776588B (Direct) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1574418A (en) * | 1976-11-16 | 1980-09-03 | Anphar Sa | Piperidine derivatives |
| FR2546169B1 (fr) * | 1983-05-20 | 1986-03-21 | Delalande Sa | N-oxydes de derives aminocycliques, leur procede de preparation et leur application en therapeutique |
| US4808624A (en) * | 1984-06-28 | 1989-02-28 | Bristol-Myers Company | Pharmacologically active substituted benzamides |
| US5011992A (en) * | 1984-06-28 | 1991-04-30 | Bristol-Myers Squibb Company | Pharmacologically active substituted benzamides |
| US4820715A (en) * | 1984-06-28 | 1989-04-11 | Bristol-Myers Company | Anti-emetic quinuclidinyl benzamides |
| GB8519707D0 (en) * | 1985-08-06 | 1985-09-11 | Fordonal Sa | Chemical compounds |
| EP1114823A3 (en) * | 1992-08-19 | 2001-07-18 | Pfizer Inc. | Substituted benzylamino nitrogen containing non-aromatic heterocycles |
| US5739135A (en) * | 1993-09-03 | 1998-04-14 | Bristol-Myers Squibb Company | Inhibitors of microsomal triglyceride transfer protein and method |
| US5885983A (en) * | 1996-05-10 | 1999-03-23 | Bristol-Myers Squibb Company | Inhibitors of microsomal triglyceride transfer protein and method |
| US5827875A (en) * | 1996-05-10 | 1998-10-27 | Bristol-Myers Squibb Company | Inhibitors of microsomal triglyceride transfer protein and method |
| US5883109A (en) * | 1996-07-24 | 1999-03-16 | Bristol-Myers Squibb Company | Method for lowering serum lipid levels employing an MTP inhibitor in combination with another cholesterol lowering drug |
| US6339087B1 (en) | 1997-08-18 | 2002-01-15 | Syntex (U.S.A.) Llc | Cyclic amine derivatives-CCR-3 receptor antagonists |
| IL125658A0 (en) | 1997-08-18 | 1999-04-11 | Hoffmann La Roche | Ccr-3 receptor antagonists |
| CN1326440A (zh) * | 1998-11-20 | 2001-12-12 | 霍夫曼-拉罗奇有限公司 | 哌啶ccr-3受体拮抗剂 |
| FR2802206B1 (fr) | 1999-12-14 | 2005-04-22 | Sod Conseils Rech Applic | Derives de 4-aminopiperidine et leur utilisation en tant que medicament |
| TW200800953A (en) * | 2002-10-30 | 2008-01-01 | Theravance Inc | Intermediates for preparing substituted 4-amino-1-(pyridylmethyl) piperidine |
| JP2007524641A (ja) * | 2003-07-11 | 2007-08-30 | セラヴァンス, インコーポレーテッド | 置換4−アミノ−1−ベンジルピペリジン化合物 |
| WO2005053663A2 (en) * | 2003-11-24 | 2005-06-16 | Eli Lilly And Company | Norepinephrine reuptake inhibitors useful for treatment of cognitive failure |
| WO2006128803A1 (en) * | 2005-06-02 | 2006-12-07 | F. Hoffmann-La Roche Ag | Piperidin-4-yl-amide derivatives and their use as sst receptor subtype 5 antagonists |
| JP2009264436A (ja) | 2008-04-23 | 2009-11-12 | Funai Electric Co Ltd | トルクリミッタ装置、トルクリミッタ装置を備えた表示画面旋回装置およびトルクリミッタ装置を含むテレビジョン装置 |
| CN119679732B (zh) * | 2024-12-11 | 2025-10-10 | 北京阳光诺和药物研究股份有限公司 | 一种胃肠促动力片剂及其制备方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1019781A (Direct) * | 1963-03-05 | |||
| FR1407055A (fr) * | 1963-03-05 | 1965-07-30 | Ile De France | Nouveau procédé de préparation de benzamides substitués |
| US3342826A (en) * | 1964-01-13 | 1967-09-19 | Ile De France | Heterocyclic aminoalkyl benzamides |
| FR5916M (Direct) * | 1966-01-21 | 1968-05-06 | ||
| US3577440A (en) * | 1968-12-23 | 1971-05-04 | Robins Co Inc A H | 1-substituted-3-amido-pyrrolidines |
| GB1345872A (en) * | 1970-09-03 | 1974-02-06 | Wyeth John & Brother Ltd | Amino-and acylamino-pyridine and hydropyridine derivatives |
| US3963745A (en) * | 1972-04-03 | 1976-06-15 | A. H. Robins Company, Incorporated | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides |
| DE2513136C3 (de) * | 1974-03-21 | 1981-04-30 | Anphar S.A., Madrid | N-(1-Benzylpiperid-4-yl)-benzamide, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate |
| US4163789A (en) * | 1976-02-17 | 1979-08-07 | Anphar, S.A. | Anti-psychotic (cycloalkenylalkylpiperidino) benzamides |
| GB1513631A (en) * | 1976-02-17 | 1978-06-07 | Gallardo Antonio Sa | Piperidine derivatives |
| GB1574418A (en) * | 1976-11-16 | 1980-09-03 | Anphar Sa | Piperidine derivatives |
-
1976
- 1976-11-16 GB GB47739/76A patent/GB1574418A/en not_active Expired
-
1977
- 1977-11-04 ZA ZA00776588A patent/ZA776588B/xx unknown
- 1977-11-04 ZA ZA00776587A patent/ZA776587B/xx unknown
- 1977-11-10 BE BE182559A patent/BE860737A/xx not_active IP Right Cessation
- 1977-11-10 BE BE182558A patent/BE860736A/xx not_active IP Right Cessation
- 1977-11-15 AT AT817077A patent/AT360013B/de not_active IP Right Cessation
- 1977-11-15 AU AU30673/77A patent/AU517830B2/en not_active Expired
- 1977-11-15 ES ES464147A patent/ES464147A1/es not_active Expired
- 1977-11-15 ES ES464146A patent/ES464146A1/es not_active Expired
- 1977-11-15 ES ES464145A patent/ES464145A1/es not_active Expired
- 1977-11-15 AU AU30672/77A patent/AU517004B2/en not_active Expired
- 1977-11-15 NL NL7712570A patent/NL7712570A/xx not_active Application Discontinuation
- 1977-11-15 CA CA290,870A patent/CA1094072A/en not_active Expired
- 1977-11-15 AT AT817177A patent/AT360014B/de not_active IP Right Cessation
- 1977-11-15 ES ES464144A patent/ES464144A1/es not_active Expired
- 1977-11-15 NL NL7712559A patent/NL7712559A/xx unknown
- 1977-11-15 CA CA290,966A patent/CA1095046A/en not_active Expired
- 1977-11-16 DE DE19772751138 patent/DE2751138A1/de not_active Withdrawn
- 1977-11-16 FR FR7735116A patent/FR2370733A1/fr active Granted
- 1977-11-16 IE IE2329/77A patent/IE46090B1/en unknown
- 1977-11-16 DE DE19772751139 patent/DE2751139A1/de active Granted
- 1977-11-16 IE IE2330/77A patent/IE45989B1/en not_active IP Right Cessation
- 1977-11-16 FR FR7735115A patent/FR2370732A1/fr active Granted
- 1977-11-16 JP JP13773677A patent/JPS5387365A/ja active Granted
- 1977-11-16 JP JP13773777A patent/JPS5390267A/ja active Granted
-
1985
- 1985-04-05 US US06/720,295 patent/US5026858A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AT360013B (de) | 1980-12-10 |
| ATA817177A (de) | 1980-05-15 |
| ES464147A1 (es) | 1978-09-01 |
| BE860736A (fr) | 1978-03-01 |
| DE2751139A1 (de) | 1978-05-24 |
| JPS5390267A (en) | 1978-08-08 |
| FR2370733B1 (Direct) | 1980-07-04 |
| BE860737A (fr) | 1978-03-01 |
| IE45989L (en) | 1978-05-16 |
| AU517830B2 (en) | 1981-08-27 |
| CA1095046A (en) | 1981-02-03 |
| NL7712559A (nl) | 1978-05-18 |
| IE46090L (en) | 1978-05-16 |
| AU517004B2 (en) | 1981-07-02 |
| ES464144A1 (es) | 1978-09-01 |
| AT360014B (de) | 1980-12-10 |
| FR2370732B1 (Direct) | 1980-07-04 |
| AU3067377A (en) | 1979-05-24 |
| ES464146A1 (es) | 1978-09-01 |
| US5026858A (en) | 1991-06-25 |
| JPS6127388B2 (Direct) | 1986-06-25 |
| IE45989B1 (en) | 1983-01-26 |
| FR2370732A1 (fr) | 1978-06-09 |
| ZA776587B (en) | 1978-09-27 |
| DE2751138A1 (de) | 1978-05-24 |
| AU3067277A (en) | 1979-05-24 |
| ZA776588B (en) | 1978-08-30 |
| CA1094072A (en) | 1981-01-20 |
| ES464145A1 (es) | 1978-09-01 |
| NL7712570A (nl) | 1978-05-18 |
| JPS6126782B2 (Direct) | 1986-06-21 |
| FR2370733A1 (fr) | 1978-06-09 |
| ATA817077A (de) | 1980-05-15 |
| JPS5387365A (en) | 1978-08-01 |
| GB1574418A (en) | 1980-09-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE46090B1 (en) | Piperidine derivatives | |
| US4367232A (en) | Piperidine derivatives | |
| GB1575310A (en) | Piperidine derivatives | |
| US4138492A (en) | Aromatic amides of heterocyclic compounds and therapeutic compositions containing same | |
| US3341538A (en) | Certain 2, 6-methano-3-benzazocines | |
| US4937236A (en) | Anxiolytic N-substituted benzamides | |
| JPS62126168A (ja) | 新規化合物、その製法及びそれを含む医薬組成物 | |
| US3666764A (en) | Spiroindenylpiperidines | |
| AU615323B2 (en) | Antischizophrenic-s-n-(1-azabicyclo(2.2.2)oct-3-yl) benzamides and thiobenzamides | |
| JP2574591B2 (ja) | 新規シクロヘキシルベンズアミド誘導体、それらの調製法及びそれらの医薬への適用 | |
| CA1300154C (en) | N-substituted piperid-4-yl benzamide compounds and 1-substituted-4-amino-piperidine compounds | |
| CA1086742A (en) | Preparation of 1-substituted-4-aroyl-4-hydroxy and -4- acyloxypiperidines | |
| US4163789A (en) | Anti-psychotic (cycloalkenylalkylpiperidino) benzamides | |
| JPS584019B2 (ja) | フクソカンシキカゴウブツノ ホウコウゾクアミドノセイホウ | |
| IE44610B1 (en) | Piperidine derivatives | |
| GB1574419A (en) | Piperidine compounds | |
| US3396168A (en) | Dibenzocycloheptane derivatives | |
| CH628885A5 (en) | Piperidine derivative | |
| US4279822A (en) | N-(1-Substituted-3-pyrrolidinyl)benzamides | |
| US4143150A (en) | Derivatives of oxanilic acid | |
| US3859290A (en) | 3-(1-(4-phenyl-4-oxobutyl)-4-hydroxy-4-piperidyl)dihydro-2(3h) furanones | |
| CA1082710A (en) | Preparation of aromatic amides | |
| IE47430B1 (en) | N-(4-pyrazolidinyl)benzamides,pharmaceutical compositions containing them,and intermediates for preparing them | |
| US3454580A (en) | Certain 3-gamma-tropanyl oximino derivatives of dibenzocycloheptenes and dibenzocyclooctenes | |
| US3565891A (en) | Mannich bases of 3-tropanyl 2-(hydroxyphenyl) acrylates |