IE43662B1 - 3-alkoxy-benzo-1,2,4-triazines, process for their preparation and their use as fungicides and bactericides - Google Patents
3-alkoxy-benzo-1,2,4-triazines, process for their preparation and their use as fungicides and bactericidesInfo
- Publication number
- IE43662B1 IE43662B1 IE1905/76A IE190576A IE43662B1 IE 43662 B1 IE43662 B1 IE 43662B1 IE 1905/76 A IE1905/76 A IE 1905/76A IE 190576 A IE190576 A IE 190576A IE 43662 B1 IE43662 B1 IE 43662B1
- Authority
- IE
- Ireland
- Prior art keywords
- benzo
- alkoxy
- formula
- triazine
- process according
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 44
- 230000000844 anti-bacterial effect Effects 0.000 title claims abstract description 5
- 238000002360 preparation method Methods 0.000 title description 18
- 239000000417 fungicide Substances 0.000 title description 3
- 239000003899 bactericide agent Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 79
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 35
- 239000000460 chlorine Substances 0.000 claims abstract description 16
- 239000002253 acid Substances 0.000 claims abstract description 11
- 239000003638 chemical reducing agent Substances 0.000 claims abstract description 11
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 10
- 229910052751 metal Inorganic materials 0.000 claims abstract description 9
- 239000002184 metal Substances 0.000 claims abstract description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 7
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 7
- 150000002367 halogens Chemical group 0.000 claims abstract description 7
- 239000007800 oxidant agent Substances 0.000 claims abstract description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000011230 binding agent Substances 0.000 claims abstract description 6
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 6
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 5
- 230000000855 fungicidal effect Effects 0.000 claims abstract description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 239000000203 mixture Substances 0.000 claims description 17
- 239000003085 diluting agent Substances 0.000 claims description 15
- 241000233866 Fungi Species 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 241000894006 Bacteria Species 0.000 claims description 9
- 239000002689 soil Substances 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 6
- 239000007787 solid Substances 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 241000607479 Yersinia pestis Species 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 239000004094 surface-active agent Substances 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- -1 CF 3 Chemical group 0.000 abstract description 17
- 239000003795 chemical substances by application Substances 0.000 abstract description 8
- 150000002431 hydrogen Chemical class 0.000 abstract description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 10
- 208000015181 infectious disease Diseases 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- YXKCIEQPVVUHJS-UHFFFAOYSA-N 3-chloro-1-oxido-1,2,4-benzotriazin-1-ium Chemical class C1=CC=C2[N+]([O-])=NC(Cl)=NC2=C1 YXKCIEQPVVUHJS-UHFFFAOYSA-N 0.000 description 8
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 235000015097 nutrients Nutrition 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- GGZDOSFUDVOCBS-UHFFFAOYSA-N 3-chloro-1,2,4-benzotriazine Chemical compound C1=CC=CC2=NC(Cl)=NN=C21 GGZDOSFUDVOCBS-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 150000001555 benzenes Chemical class 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 235000013339 cereals Nutrition 0.000 description 5
- 239000002243 precursor Substances 0.000 description 5
- 239000011877 solvent mixture Substances 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- 240000005979 Hordeum vulgare Species 0.000 description 4
- 235000007340 Hordeum vulgare Nutrition 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 4
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- 241000371644 Curvularia ravenelii Species 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- 230000000895 acaricidal effect Effects 0.000 description 3
- 235000010419 agar Nutrition 0.000 description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000002877 alkyl aryl group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 3
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 230000017066 negative regulation of growth Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- GDAXJBDYNVDMDF-UHFFFAOYSA-N 1,2,4-benzotriazine Chemical compound N1=NC=NC2=CC=CC=C21 GDAXJBDYNVDMDF-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- GXEKFJODJPFJPG-UHFFFAOYSA-N 1-oxido-2h-1,2,4-benzotriazin-1-ium-3-one Chemical compound C1=CC=CC2=NC(O)=N[N+]([O-])=C21 GXEKFJODJPFJPG-UHFFFAOYSA-N 0.000 description 2
- LHDZLYASAVFIJM-UHFFFAOYSA-N 3,7-dichloro-1,2,4-benzotriazine Chemical compound N1=C(Cl)N=NC2=CC(Cl)=CC=C21 LHDZLYASAVFIJM-UHFFFAOYSA-N 0.000 description 2
- ZMSWTQQQVGHRRJ-UHFFFAOYSA-N 3,7-dichloro-1-oxido-1,2,4-benzotriazin-1-ium Chemical compound C1=C(Cl)C=C2[N+]([O-])=NC(Cl)=NC2=C1 ZMSWTQQQVGHRRJ-UHFFFAOYSA-N 0.000 description 2
- HNVRRHSXBLFLIG-UHFFFAOYSA-N 3-hydroxy-3-methylbut-1-ene Chemical compound CC(C)(O)C=C HNVRRHSXBLFLIG-UHFFFAOYSA-N 0.000 description 2
- FSUAEHJACMGVCR-UHFFFAOYSA-N 7-chloro-3-methoxy-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OC)=NN=C21 FSUAEHJACMGVCR-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- 206010017533 Fungal infection Diseases 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 241000209140 Triticum Species 0.000 description 2
- 241000589652 Xanthomonas oryzae Species 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 235000021186 dishes Nutrition 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 208000024386 fungal infectious disease Diseases 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- KPSSIOMAKSHJJG-UHFFFAOYSA-N neopentyl alcohol Chemical compound CC(C)(C)CO KPSSIOMAKSHJJG-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- FYADHXFMURLYQI-UHFFFAOYSA-N 1,2,4-triazine Chemical compound C1=CN=NC=N1 FYADHXFMURLYQI-UHFFFAOYSA-N 0.000 description 1
- BMSGNGPCJCDOGE-UHFFFAOYSA-N 1,2-dihydro-1,2,4-benzotriazin-3-amine Chemical class C1=CC=C2NNC(N)=NC2=C1 BMSGNGPCJCDOGE-UHFFFAOYSA-N 0.000 description 1
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 description 1
- YYTSGNJTASLUOY-UHFFFAOYSA-N 1-chloropropan-2-ol Chemical compound CC(O)CCl YYTSGNJTASLUOY-UHFFFAOYSA-N 0.000 description 1
- QWVCIORZLNBIIC-UHFFFAOYSA-N 2,3-dibromopropan-1-ol Chemical compound OCC(Br)CBr QWVCIORZLNBIIC-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- SZIFAVKTNFCBPC-UHFFFAOYSA-N 2-chloroethanol Chemical compound OCCCl SZIFAVKTNFCBPC-UHFFFAOYSA-N 0.000 description 1
- TZYRSLHNPKPEFV-UHFFFAOYSA-N 2-ethyl-1-butanol Chemical compound CCC(CC)CO TZYRSLHNPKPEFV-UHFFFAOYSA-N 0.000 description 1
- KEKCQXQAPNKMLX-UHFFFAOYSA-N 2h-1,2,4-benzotriazin-3-one Chemical compound C1=CC=CC2=NC(O)=NN=C21 KEKCQXQAPNKMLX-UHFFFAOYSA-N 0.000 description 1
- HOFIOKVVXPJUCT-UHFFFAOYSA-N 3-(2-butoxyethoxy)-7-chloro-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OCCOCCCC)=NN=C21 HOFIOKVVXPJUCT-UHFFFAOYSA-N 0.000 description 1
- VMZDTMXGANHCJG-UHFFFAOYSA-N 3-butoxy-1-oxido-1,2,4-benzotriazin-1-ium Chemical class C1=CC=CC2=NC(OCCCC)=N[N+]([O-])=C21 VMZDTMXGANHCJG-UHFFFAOYSA-N 0.000 description 1
- FHPVCEPQUZAPIJ-UHFFFAOYSA-N 3-butoxy-7-chloro-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OCCCC)=NN=C21 FHPVCEPQUZAPIJ-UHFFFAOYSA-N 0.000 description 1
- SIEMDIHYXXSDGO-UHFFFAOYSA-N 3-chloro-7-(trifluoromethyl)-1,2,4-benzotriazine Chemical compound N1=C(Cl)N=NC2=CC(C(F)(F)F)=CC=C21 SIEMDIHYXXSDGO-UHFFFAOYSA-N 0.000 description 1
- GVQHXCDXIOKTLZ-UHFFFAOYSA-N 3-chloro-7-iodo-1,2,4-benzotriazine Chemical compound C1=C(I)C=CC2=NC(Cl)=NN=C21 GVQHXCDXIOKTLZ-UHFFFAOYSA-N 0.000 description 1
- AZNFNNNGJDIYED-UHFFFAOYSA-N 3-chloro-7-propan-2-yloxy-1,2,4-benzotriazine Chemical compound N1=C(Cl)N=NC2=CC(OC(C)C)=CC=C21 AZNFNNNGJDIYED-UHFFFAOYSA-N 0.000 description 1
- KUTUFXFOUMJNJK-UHFFFAOYSA-N 3-ethoxy-1,2,4-benzotriazine Chemical compound C1=CC=CC2=NC(OCC)=NN=C21 KUTUFXFOUMJNJK-UHFFFAOYSA-N 0.000 description 1
- YCIBGTILPFGMDJ-UHFFFAOYSA-N 3-methoxy-1,2,4-benzotriazine Chemical compound C1=CC=CC2=NC(OC)=NN=C21 YCIBGTILPFGMDJ-UHFFFAOYSA-N 0.000 description 1
- GSJJNOBSLWTFSP-UHFFFAOYSA-N 3-methoxy-1-oxido-7-propan-2-yloxy-1,2,4-benzotriazin-1-ium Chemical compound C1=C(OC(C)C)C=CC2=NC(OC)=N[N+]([O-])=C21 GSJJNOBSLWTFSP-UHFFFAOYSA-N 0.000 description 1
- YAMDNQFVYVEAGY-UHFFFAOYSA-N 3-methoxy-7-(trifluoromethyl)-1,2,4-benzotriazine Chemical compound C1=C(C(F)(F)F)C=CC2=NC(OC)=NN=C21 YAMDNQFVYVEAGY-UHFFFAOYSA-N 0.000 description 1
- JDFDHBSESGTDAL-UHFFFAOYSA-N 3-methoxypropan-1-ol Chemical compound COCCCO JDFDHBSESGTDAL-UHFFFAOYSA-N 0.000 description 1
- OVLLXJADYPNUDQ-UHFFFAOYSA-N 3-propan-2-yloxy-7-(trifluoromethyl)-1,2-dihydro-1,2,4-benzotriazine Chemical compound C1=C(C(F)(F)F)C=C2NNC(OC(C)C)=NC2=C1 OVLLXJADYPNUDQ-UHFFFAOYSA-N 0.000 description 1
- WVYWICLMDOOCFB-UHFFFAOYSA-N 4-methyl-2-pentanol Chemical compound CC(C)CC(C)O WVYWICLMDOOCFB-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- GIAKYOSVEURTRX-UHFFFAOYSA-N 7-bromo-3-chloro-1,2,4-benzotriazine Chemical compound C1=C(Br)C=CC2=NC(Cl)=NN=C21 GIAKYOSVEURTRX-UHFFFAOYSA-N 0.000 description 1
- MVXRXNJUMHSGLO-UHFFFAOYSA-N 7-bromo-3-methoxy-1,2,4-benzotriazine Chemical compound C1=C(Br)C=CC2=NC(OC)=NN=C21 MVXRXNJUMHSGLO-UHFFFAOYSA-N 0.000 description 1
- DVUZAGBHOSQUAH-UHFFFAOYSA-N 7-chloro-3-(2,2,2-trichloroethoxy)-1,2,4-benzotriazine Chemical compound N1=C(OCC(Cl)(Cl)Cl)N=NC2=CC(Cl)=CC=C21 DVUZAGBHOSQUAH-UHFFFAOYSA-N 0.000 description 1
- PZAVKROHWSGQKM-UHFFFAOYSA-N 7-chloro-3-(2-chloroethoxy)-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OCCCl)=NN=C21 PZAVKROHWSGQKM-UHFFFAOYSA-N 0.000 description 1
- WFYOEPPHPIOJPX-UHFFFAOYSA-N 7-chloro-3-(2-methylpropoxy)-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OCC(C)C)=NN=C21 WFYOEPPHPIOJPX-UHFFFAOYSA-N 0.000 description 1
- ZTSVECRXNYNSKX-UHFFFAOYSA-N 7-chloro-3-ethoxy-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OCC)=NN=C21 ZTSVECRXNYNSKX-UHFFFAOYSA-N 0.000 description 1
- MJYSPVJBDGDKHL-UHFFFAOYSA-N 7-chloro-3-hexoxy-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OCCCCCC)=NN=C21 MJYSPVJBDGDKHL-UHFFFAOYSA-N 0.000 description 1
- PMHSZOVGQRDOSS-UHFFFAOYSA-N 7-chloro-3-methoxy-1-oxido-1,2,4-benzotriazin-1-ium Chemical compound C1=C(Cl)C=CC2=NC(OC)=N[N+]([O-])=C21 PMHSZOVGQRDOSS-UHFFFAOYSA-N 0.000 description 1
- LNDVDYSZUKILKC-UHFFFAOYSA-N 7-chloro-3-propan-2-yloxy-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OC(C)C)=NN=C21 LNDVDYSZUKILKC-UHFFFAOYSA-N 0.000 description 1
- KZKLVPLSFVQKIX-UHFFFAOYSA-N 7-chloro-3-propoxy-1,2,4-benzotriazine Chemical compound C1=C(Cl)C=CC2=NC(OCCC)=NN=C21 KZKLVPLSFVQKIX-UHFFFAOYSA-N 0.000 description 1
- RBVRXCZZZLZCOX-UHFFFAOYSA-N 7-ethoxy-3-methoxy-1,2,4-benzotriazine Chemical compound N1=C(OC)N=NC2=CC(OCC)=CC=C21 RBVRXCZZZLZCOX-UHFFFAOYSA-N 0.000 description 1
- PHOPYYGMASCWNK-UHFFFAOYSA-N 7-iodo-3-propan-2-yloxy-1,2,4-benzotriazine Chemical compound C1=C(I)C=CC2=NC(OC(C)C)=NN=C21 PHOPYYGMASCWNK-UHFFFAOYSA-N 0.000 description 1
- 108010088751 Albumins Proteins 0.000 description 1
- 102000009027 Albumins Human genes 0.000 description 1
- 241000235349 Ascomycota Species 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000588698 Erwinia Species 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 240000001931 Ludwigia octovalvis Species 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- GXCLVBGFBYZDAG-UHFFFAOYSA-N N-[2-(1H-indol-3-yl)ethyl]-N-methylprop-2-en-1-amine Chemical group CN(CCC1=CNC2=C1C=CC=C2)CC=C GXCLVBGFBYZDAG-UHFFFAOYSA-N 0.000 description 1
- 239000001888 Peptone Substances 0.000 description 1
- 108010080698 Peptones Proteins 0.000 description 1
- 241001503460 Plasmodiophorida Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 241000221300 Puccinia Species 0.000 description 1
- 241001123569 Puccinia recondita Species 0.000 description 1
- 241000228453 Pyrenophora Species 0.000 description 1
- 241000231139 Pyricularia Species 0.000 description 1
- 241000233639 Pythium Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 206010037888 Rash pustular Diseases 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 241000082085 Verticillium <Phyllachorales> Species 0.000 description 1
- 206010048214 Xanthoma Diseases 0.000 description 1
- 241000567019 Xanthomonas vesicatoria Species 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 230000002464 fungitoxic effect Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000013028 medium composition Substances 0.000 description 1
- 229910001512 metal fluoride Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000000369 oxido group Chemical group [*]=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 235000019319 peptone Nutrition 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 208000029561 pustule Diseases 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/08—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 condensed with carbocyclic rings or ring systems
- C07D253/10—Condensed 1,2,4-triazines; Hydrogenated condensed 1,2,4-triazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2538179A DE2538179C2 (de) | 1975-08-27 | 1975-08-27 | 3-Alkoxy-benzo-1,2,4-triazine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43662L IE43662L (en) | 1977-02-27 |
| IE43662B1 true IE43662B1 (en) | 1981-04-22 |
Family
ID=5954983
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1905/76A IE43662B1 (en) | 1975-08-27 | 1976-08-26 | 3-alkoxy-benzo-1,2,4-triazines, process for their preparation and their use as fungicides and bactericides |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4067981A (enExample) |
| JP (1) | JPS5231085A (enExample) |
| AR (1) | AR217063A1 (enExample) |
| AT (1) | AT348293B (enExample) |
| AU (1) | AU498333B2 (enExample) |
| BE (1) | BE845529A (enExample) |
| BR (1) | BR7605641A (enExample) |
| CA (1) | CA1060017A (enExample) |
| CH (1) | CH618974A5 (enExample) |
| CS (1) | CS189028B2 (enExample) |
| DD (1) | DD127563A5 (enExample) |
| DE (1) | DE2538179C2 (enExample) |
| DK (1) | DK150614B (enExample) |
| FR (1) | FR2322140A1 (enExample) |
| GB (1) | GB1494818A (enExample) |
| HU (1) | HU178986B (enExample) |
| IE (1) | IE43662B1 (enExample) |
| IL (1) | IL50343A (enExample) |
| IT (1) | IT1064914B (enExample) |
| LU (1) | LU75665A1 (enExample) |
| NL (1) | NL7609509A (enExample) |
| PL (1) | PL99306B1 (enExample) |
| RO (1) | RO70191A (enExample) |
| SE (1) | SE424323B (enExample) |
| SU (1) | SU637066A3 (enExample) |
| TR (1) | TR18900A (enExample) |
| ZA (1) | ZA765132B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2740887A1 (de) * | 1977-09-10 | 1979-03-22 | Bayer Ag | Mittel zur bekaempfung von pflanzenbakteriosen |
| DE2910974A1 (de) | 1979-03-21 | 1981-02-19 | Bayer Ag | 3-sulfonyl-benzo-1,2,4-triazine und -benzo-1,2,4-triazin-1-oxide, verfahren zu ihrer herstellung sowie ihre verwendung als antimikrobielle mittel |
| US4420551A (en) * | 1983-01-31 | 1983-12-13 | Polaroid Corporation | Novel benzotriazine developers and photographic product and method |
| US4497950A (en) * | 1983-01-31 | 1985-02-05 | Polaroid Corporation | Benzotriazine compounds |
| GB2203151B (en) * | 1986-09-25 | 1991-05-29 | Stanford Res Inst Int | 1,2,4-benzotriazine oxides as radiosensitisers and selective cytotoxic agents |
| US5624925A (en) | 1986-09-25 | 1997-04-29 | Sri International | 1,2,4-benzotriazine oxides as radiosensitizers and selective cytotoxic agents |
| US5175287A (en) * | 1986-09-25 | 1992-12-29 | S R I International | Process for preparing 1,2,4-benzotriazine oxides |
| JPH0612048Y2 (ja) * | 1987-06-19 | 1994-03-30 | 日立金属株式会社 | アンカ−ボルトの据付装置 |
| IE62911B1 (en) * | 1988-03-18 | 1995-03-08 | Stanford Res Inst Int | 1,2,4-benzotriazine oxides as radiosensitizers and selective cytotoxic agents |
| GR1000941B (el) * | 1989-03-17 | 1993-03-16 | Stanford Res Inst Int | Μεθοδος παρασκευης οξειδιων 1,2,4,βενζοτριαζινης. |
| DE4244009A1 (de) * | 1992-12-24 | 1994-06-30 | Boehringer Mannheim Gmbh | Verwendung von Benzotriazinen als PLA¶2¶-Inhibitoren, neue Benzotriazine, Verfahren zu ihrer Herstellung und Arzneimittel |
| CO5210943A1 (es) * | 1999-05-04 | 2002-10-30 | Novartis Ag | Compuestos plaguicidas derivados de triazina, composiciones para el control de plagas que comprenden dicho compuesto y cuando menos un auxiliar y metodos para controlar plagas |
| DE10237264A1 (de) * | 2002-08-14 | 2004-03-04 | Schülke & Mayr GmbH | Wässrige Dispersion mit fungizider und algizider Wirkung |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD83869A (enExample) * | ||||
| US2489354A (en) * | 1947-01-10 | 1949-11-29 | Merck & Co Inc | Benzotriazines |
| US2489357A (en) * | 1947-01-10 | 1949-11-29 | Merck & Co Inc | Benzotriazines |
| CH487171A (de) * | 1963-10-22 | 1970-03-15 | Siegfried Ag | Verfahren zur Herstellung therapeutisch wirksamer 1,2-Dihydro-1,2,4-benztriazine |
| CH514610A (de) * | 1967-09-27 | 1971-10-31 | Siegfried Ag | Verfahren zur Herstellung von fluorsubstituierten 1,2,4-Benztriazin-Derivaten |
| IL44058A (en) * | 1973-02-02 | 1978-10-31 | Ciba Geigy Ag | 3amino-1,2,4-benzotriazine 1,4-di-noxide derivatives, their preparation and compositions for the control of microorganisms containing them |
-
1975
- 1975-08-27 DE DE2538179A patent/DE2538179C2/de not_active Expired
-
1976
- 1976-08-23 CH CH1067976A patent/CH618974A5/de not_active IP Right Cessation
- 1976-08-24 IL IL7650343A patent/IL50343A/xx unknown
- 1976-08-25 CS CS765520A patent/CS189028B2/cs unknown
- 1976-08-25 GB GB35342/76A patent/GB1494818A/en not_active Expired
- 1976-08-25 SU SU762389902A patent/SU637066A3/ru active
- 1976-08-25 DD DD194462A patent/DD127563A5/xx unknown
- 1976-08-25 RO RO7687362A patent/RO70191A/ro unknown
- 1976-08-25 IT IT26544/76A patent/IT1064914B/it active
- 1976-08-25 TR TR18900A patent/TR18900A/xx unknown
- 1976-08-26 DK DK387376AA patent/DK150614B/da not_active Application Discontinuation
- 1976-08-26 CA CA259,907A patent/CA1060017A/en not_active Expired
- 1976-08-26 BE BE170084A patent/BE845529A/xx not_active IP Right Cessation
- 1976-08-26 LU LU75665A patent/LU75665A1/xx unknown
- 1976-08-26 SE SE7609460A patent/SE424323B/xx not_active IP Right Cessation
- 1976-08-26 NL NL7609509A patent/NL7609509A/xx not_active Application Discontinuation
- 1976-08-26 US US05/717,969 patent/US4067981A/en not_active Expired - Lifetime
- 1976-08-26 ZA ZA765132A patent/ZA765132B/xx unknown
- 1976-08-26 PL PL1976192021A patent/PL99306B1/pl unknown
- 1976-08-26 BR BR7605641A patent/BR7605641A/pt unknown
- 1976-08-26 IE IE1905/76A patent/IE43662B1/en unknown
- 1976-08-27 HU HU76BA3444A patent/HU178986B/hu unknown
- 1976-08-27 AR AR264498A patent/AR217063A1/es active
- 1976-08-27 AU AU17212/76A patent/AU498333B2/en not_active Expired
- 1976-08-27 FR FR7625900A patent/FR2322140A1/fr active Granted
- 1976-08-27 AT AT637976A patent/AT348293B/de not_active IP Right Cessation
- 1976-08-27 JP JP51101767A patent/JPS5231085A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL50343A0 (en) | 1976-10-31 |
| DE2538179C2 (de) | 1986-05-28 |
| AT348293B (de) | 1979-02-12 |
| DE2538179A1 (de) | 1977-03-10 |
| IE43662L (en) | 1977-02-27 |
| ZA765132B (en) | 1977-07-27 |
| PL99306B1 (pl) | 1978-07-31 |
| AU1721276A (en) | 1978-03-02 |
| DD127563A5 (enExample) | 1977-10-05 |
| US4067981A (en) | 1978-01-10 |
| JPS5231085A (en) | 1977-03-09 |
| IL50343A (en) | 1979-11-30 |
| ATA637976A (de) | 1978-06-15 |
| LU75665A1 (enExample) | 1977-04-27 |
| IT1064914B (it) | 1985-02-25 |
| CA1060017A (en) | 1979-08-07 |
| CH618974A5 (enExample) | 1980-08-29 |
| BR7605641A (pt) | 1977-08-09 |
| AU498333B2 (en) | 1979-03-01 |
| TR18900A (tr) | 1977-11-10 |
| SU637066A3 (ru) | 1978-12-05 |
| AR217063A1 (es) | 1980-02-29 |
| FR2322140A1 (fr) | 1977-03-25 |
| CS189028B2 (en) | 1979-03-30 |
| HU178986B (en) | 1982-07-28 |
| RO70191A (ro) | 1982-09-09 |
| SE424323B (sv) | 1982-07-12 |
| FR2322140B1 (enExample) | 1981-03-06 |
| SE7609460L (sv) | 1977-02-28 |
| NL7609509A (nl) | 1977-03-01 |
| GB1494818A (en) | 1977-12-14 |
| BE845529A (fr) | 1977-02-28 |
| DK150614B (da) | 1987-04-21 |
| DK387376A (da) | 1977-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3952002A (en) | Triazolyl-O,N-acetals | |
| CA1261331A (en) | 1-heteroaryl-4-aryl-pyrazolin-5-ones | |
| JPS6147403A (ja) | N‐アセトニルベンヅアミドを含有する殺菌性組成物を用いる植物生病原生物である菌類の防除方法 | |
| IE43662B1 (en) | 3-alkoxy-benzo-1,2,4-triazines, process for their preparation and their use as fungicides and bactericides | |
| JPS61227577A (ja) | ヨードプロパルギルエーテル類、それらの製造法およびそれらの使用 | |
| EP0192055B1 (de) | Hydroxyalkinyl-azolyl-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| US4174398A (en) | Combating fungi with 1-alkyl-1-(1,3,4-thiadiazol-2-yl)-3-phenyl-ureas | |
| IE48102B1 (en) | 3-azolyl-benzotriazine and -benzotriazine 1-oxide-containing fungicidal and bactericidal compositions and their use in plant protection | |
| US3839575A (en) | 2-(pyrazolyl-(1))-benzimidazole fungicidal,and bactericidal agents | |
| US4366152A (en) | Combatting fungi with metal salt complexes of 1-phenyl-2-(1,2,4-triazol-1-yl)-ethanes | |
| CS195322B2 (en) | Fungicide and method of preparing active substances therefor | |
| HU192005B (en) | Fungicide composition and process for preparing azolyl-3-pyrazolyl-2-propanol derivatives | |
| IL33220A (en) | Phenyl esters of acid and hydrocarbyliminocarbonate, their preparation and use for fungicides | |
| JPS58219149A (ja) | アイオドプロパルギルアンモニウム塩類、それらの製造方法、および害虫防除剤としてのそれらの使用 | |
| GB1564182A (en) | Benzothiazolone and benzoxazolone derivatives | |
| JP2963243B2 (ja) | ハロゲノアルキル−アゾリル誘導体類 | |
| CA1220211A (en) | Triazolyl alcohols, their preparation and their use as fungicides | |
| US4178383A (en) | Fungicidally active oxime-ethers of isonitrosocyanoacetamides | |
| CA1088549A (en) | 1-acyloxy-1-phenyl-2-azolyl-ethanes, and their use as fungicides or nematocides | |
| US3832466A (en) | 3-azolylpropyne fungicidal agents | |
| US4935416A (en) | 1-aminomethyl-3-aryl-4-cyano-pyrroles | |
| NZ207124A (en) | N-sulphenylated hydantoins | |
| US3939189A (en) | N-fluorodichl oromethylthio)-n-(trifluoromethyl)-aminobenzhydroxamic acids salts | |
| US4073901A (en) | Metal complexes of N-trityl-azoles for combatting fungi | |
| IE44343B1 (en) | Acylated imidazolyl-o,n-acetals,process for their preparation and their use as fungicides |