IE43086B1 - Stable radiographic scannin agents - Google Patents
Stable radiographic scannin agentsInfo
- Publication number
- IE43086B1 IE43086B1 IE717/76A IE71776A IE43086B1 IE 43086 B1 IE43086 B1 IE 43086B1 IE 717/76 A IE717/76 A IE 717/76A IE 71776 A IE71776 A IE 71776A IE 43086 B1 IE43086 B1 IE 43086B1
- Authority
- IE
- Ireland
- Prior art keywords
- acid
- pertechnetate
- ascorbic acid
- composition
- reducing agent
- Prior art date
Links
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims abstract description 88
- 150000003839 salts Chemical class 0.000 claims abstract description 62
- 235000010323 ascorbic acid Nutrition 0.000 claims abstract description 55
- 239000011668 ascorbic acid Substances 0.000 claims abstract description 55
- 229960005070 ascorbic acid Drugs 0.000 claims abstract description 48
- 239000000203 mixture Substances 0.000 claims abstract description 36
- 239000003638 chemical reducing agent Substances 0.000 claims abstract description 30
- 150000002148 esters Chemical class 0.000 claims abstract description 25
- GKLVYJBZJHMRIY-OUBTZVSYSA-N Technetium-99 Chemical compound [99Tc] GKLVYJBZJHMRIY-OUBTZVSYSA-N 0.000 claims abstract description 9
- 229940056501 technetium 99m Drugs 0.000 claims abstract description 9
- 238000000034 method Methods 0.000 claims description 45
- 239000003795 chemical substances by application Substances 0.000 claims description 31
- 238000002360 preparation method Methods 0.000 claims description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 8
- 210000000056 organ Anatomy 0.000 claims description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 235000010378 sodium ascorbate Nutrition 0.000 claims description 5
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 claims description 5
- 229960005055 sodium ascorbate Drugs 0.000 claims description 5
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical group [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 claims description 5
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical group C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 claims description 4
- 229910021626 Tin(II) chloride Inorganic materials 0.000 claims description 4
- 235000011150 stannous chloride Nutrition 0.000 claims description 4
- 239000001119 stannous chloride Substances 0.000 claims description 4
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims description 3
- MBKDYNNUVRNNRF-UHFFFAOYSA-N medronic acid Chemical group OP(O)(=O)CP(O)(O)=O MBKDYNNUVRNNRF-UHFFFAOYSA-N 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229910021554 Chromium(II) chloride Inorganic materials 0.000 claims description 2
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 claims description 2
- 229940109126 chromous chloride Drugs 0.000 claims description 2
- ACSIXWWBWUQEHA-UHFFFAOYSA-N clodronic acid Chemical compound OP(O)(=O)C(Cl)(Cl)P(O)(O)=O ACSIXWWBWUQEHA-UHFFFAOYSA-N 0.000 claims description 2
- 239000011790 ferrous sulphate Substances 0.000 claims description 2
- 235000003891 ferrous sulphate Nutrition 0.000 claims description 2
- 229910000359 iron(II) sulfate Inorganic materials 0.000 claims description 2
- 239000002253 acid Substances 0.000 abstract description 42
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 4
- 239000001301 oxygen Substances 0.000 abstract description 4
- 229910052760 oxygen Inorganic materials 0.000 abstract description 4
- 238000003608 radiolysis reaction Methods 0.000 abstract description 3
- -1 ascorbic acid compound Chemical class 0.000 description 37
- 239000000243 solution Substances 0.000 description 26
- 150000001875 compounds Chemical class 0.000 description 17
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 10
- 239000011591 potassium Substances 0.000 description 10
- 229910052700 potassium Inorganic materials 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 9
- 150000007513 acids Chemical class 0.000 description 8
- 229940072107 ascorbate Drugs 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 229910052713 technetium Inorganic materials 0.000 description 7
- GKLVYJBZJHMRIY-UHFFFAOYSA-N technetium atom Chemical compound [Tc] GKLVYJBZJHMRIY-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910018828 PO3H2 Inorganic materials 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 150000003863 ammonium salts Chemical class 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 150000002500 ions Chemical class 0.000 description 5
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 241000894007 species Species 0.000 description 3
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical class [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 3
- RHWUIRMVPYNGIV-UHFFFAOYSA-N 1,3,4-triphosphonobutan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O RHWUIRMVPYNGIV-UHFFFAOYSA-N 0.000 description 2
- SXGRAKNNKBAFML-UHFFFAOYSA-N 1,3-diphosphonopropan-2-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)CP(O)(O)=O SXGRAKNNKBAFML-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 150000000996 L-ascorbic acids Chemical class 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 238000009206 nuclear medicine Methods 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- ZJAOAACCNHFJAH-UHFFFAOYSA-N phosphonoformic acid Chemical class OC(=O)P(O)(O)=O ZJAOAACCNHFJAH-UHFFFAOYSA-N 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- HXKKHQJGJAFBHI-GSVOUGTGSA-O (2R)-2-hydroxypropylammonium Chemical compound C[C@@H](O)C[NH3+] HXKKHQJGJAFBHI-GSVOUGTGSA-O 0.000 description 1
- ZWVMLYRJXORSEP-LURJTMIESA-N (2s)-hexane-1,2,6-triol Chemical compound OCCCC[C@H](O)CO ZWVMLYRJXORSEP-LURJTMIESA-N 0.000 description 1
- LFZIDQAULJQNBG-UHFFFAOYSA-N 1,2,3,4,6,7,8,9,10-nonaphosphonodecan-5-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O LFZIDQAULJQNBG-UHFFFAOYSA-N 0.000 description 1
- HPACKUSWEBMYJE-UHFFFAOYSA-N 1,2,3,5,6,7,8-heptaphosphonooctan-4-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O HPACKUSWEBMYJE-UHFFFAOYSA-N 0.000 description 1
- XWFHTVUSIQXPJR-UHFFFAOYSA-N 1,2,3,5,6,7-hexaphosphonoheptan-4-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O XWFHTVUSIQXPJR-UHFFFAOYSA-N 0.000 description 1
- CCSPRGDNSSMNIH-UHFFFAOYSA-N 1,2,4,5,6-pentaphosphonohexan-3-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O CCSPRGDNSSMNIH-UHFFFAOYSA-N 0.000 description 1
- UWOPXOPPISBKGY-UHFFFAOYSA-N 1,2,4,5-tetraphosphonopentan-3-ylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)C(P(O)(O)=O)C(P(O)(O)=O)CP(O)(O)=O UWOPXOPPISBKGY-UHFFFAOYSA-N 0.000 description 1
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical compound OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 1
- YVPHSTVRTGSOSK-UHFFFAOYSA-N 1,3,3-triphosphonopropylphosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)CC(P(O)(O)=O)P(O)(O)=O YVPHSTVRTGSOSK-UHFFFAOYSA-N 0.000 description 1
- LJHKZAQSNTWOLY-UHFFFAOYSA-N 1-[bis(1-phosphonopentyl)amino]pentylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)N(C(CCCC)P(O)(O)=O)C(CCCC)P(O)(O)=O LJHKZAQSNTWOLY-UHFFFAOYSA-N 0.000 description 1
- HFDKJNXFZSYGLU-UHFFFAOYSA-N 1-phosphonododecylphosphonic acid Chemical compound CCCCCCCCCCCC(P(O)(O)=O)P(O)(O)=O HFDKJNXFZSYGLU-UHFFFAOYSA-N 0.000 description 1
- CCBUTSCPNFSHKC-UHFFFAOYSA-N 1-phosphonohexadecylphosphonic acid Chemical compound CCCCCCCCCCCCCCCC(P(O)(O)=O)P(O)(O)=O CCBUTSCPNFSHKC-UHFFFAOYSA-N 0.000 description 1
- OZKFUXZUWPRXHB-UHFFFAOYSA-N 1-phosphonononylphosphonic acid Chemical compound CCCCCCCCC(P(O)(O)=O)P(O)(O)=O OZKFUXZUWPRXHB-UHFFFAOYSA-N 0.000 description 1
- ROKLPPRTPHAGFK-UHFFFAOYSA-N 1-phosphonooctylphosphonic acid Chemical compound CCCCCCCC(P(O)(O)=O)P(O)(O)=O ROKLPPRTPHAGFK-UHFFFAOYSA-N 0.000 description 1
- IRYOZLKMXHUGKP-UHFFFAOYSA-N 1-phosphonopentylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)P(O)(O)=O IRYOZLKMXHUGKP-UHFFFAOYSA-N 0.000 description 1
- GIXFALHDORQSOQ-UHFFFAOYSA-N 2,4,6,8-tetrahydroxy-1,3,5,7,2$l^{5},4$l^{5},6$l^{5},8$l^{5}-tetraoxatetraphosphocane 2,4,6,8-tetraoxide Chemical compound OP1(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)O1 GIXFALHDORQSOQ-UHFFFAOYSA-N 0.000 description 1
- VUITVRLCDCMTNK-UHFFFAOYSA-N 2-[bis(2-phosphonopropan-2-yl)amino]propan-2-ylphosphonic acid Chemical compound OP(=O)(O)C(C)(C)N(C(C)(C)P(O)(O)=O)C(C)(C)P(O)(O)=O VUITVRLCDCMTNK-UHFFFAOYSA-N 0.000 description 1
- HSVLGQVUNHEEGH-UHFFFAOYSA-N 2-phosphonopentan-2-ylphosphonic acid Chemical compound CCCC(C)(P(O)(O)=O)P(O)(O)=O HSVLGQVUNHEEGH-UHFFFAOYSA-N 0.000 description 1
- ROPQINLWRARCTM-UHFFFAOYSA-N 2-phosphonopropan-2-ylphosphonic acid Chemical compound OP(=O)(O)C(C)(C)P(O)(O)=O ROPQINLWRARCTM-UHFFFAOYSA-N 0.000 description 1
- RBJBFHZUIPIEJX-UHFFFAOYSA-N 5-phosphonononan-5-ylphosphonic acid Chemical compound CCCCC(P(O)(O)=O)(P(O)(O)=O)CCCC RBJBFHZUIPIEJX-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 101100025412 Arabidopsis thaliana XI-A gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 229940127052 Hicon Drugs 0.000 description 1
- 244000061600 Laurocerasus officinalis Species 0.000 description 1
- 240000003394 Malpighia glabra Species 0.000 description 1
- 235000014837 Malpighia glabra Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- HWZUDASOMGNLSM-UHFFFAOYSA-N O=P1OCOP(=O)O1 Chemical compound O=P1OCOP(=O)O1 HWZUDASOMGNLSM-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004260 Potassium ascorbate Substances 0.000 description 1
- 235000008990 Prunus myrtifolia Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 244000269722 Thea sinensis Species 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- ZYNHDFDXWSKMCD-UHFFFAOYSA-N [acetamido(phosphono)methyl]phosphonic acid Chemical compound CC(=O)NC(P(O)(O)=O)P(O)(O)=O ZYNHDFDXWSKMCD-UHFFFAOYSA-N 0.000 description 1
- FRCICXIVPRNPLM-UHFFFAOYSA-N [amino(phosphono)methyl]phosphonic acid Chemical compound OP(=O)(O)C(N)P(O)(O)=O FRCICXIVPRNPLM-UHFFFAOYSA-N 0.000 description 1
- XVNZXEWQQDCZSM-UHFFFAOYSA-N [anilino(phosphono)methyl]phosphonic acid Chemical compound OP(O)(=O)C(P(O)(O)=O)NC1=CC=CC=C1 XVNZXEWQQDCZSM-UHFFFAOYSA-N 0.000 description 1
- VOCLSHIYPGYWJW-UHFFFAOYSA-N [dihydroxy(phosphono)methyl]phosphonic acid Chemical compound OP(=O)(O)C(O)(O)P(O)(O)=O VOCLSHIYPGYWJW-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- 239000008366 buffered solution Substances 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 235000010376 calcium ascorbate Nutrition 0.000 description 1
- 229940047036 calcium ascorbate Drugs 0.000 description 1
- 239000011692 calcium ascorbate Substances 0.000 description 1
- BLORRZQTHNGFTI-ZZMNMWMASA-L calcium-L-ascorbate Chemical compound [Ca+2].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] BLORRZQTHNGFTI-ZZMNMWMASA-L 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 229960002286 clodronic acid Drugs 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000002405 diagnostic procedure Methods 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229940074358 magnesium ascorbate Drugs 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- AIOKQVJVNPDJKA-ZZMNMWMASA-L magnesium;(2r)-2-[(1s)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2h-furan-3-olate Chemical compound [Mg+2].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] AIOKQVJVNPDJKA-ZZMNMWMASA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000001455 metallic ions Chemical class 0.000 description 1
- 229940102859 methylene diphosphonate Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 235000019275 potassium ascorbate Nutrition 0.000 description 1
- 229940017794 potassium ascorbate Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- CONVKSGEGAVTMB-RXSVEWSESA-M potassium-L-ascorbate Chemical compound [K+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] CONVKSGEGAVTMB-RXSVEWSESA-M 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000012857 radioactive material Substances 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- FVAUCKIRQBBSSJ-LAIFMVDKSA-M sodium;iodine-131(1-) Chemical compound [Na+].[131I-] FVAUCKIRQBBSSJ-LAIFMVDKSA-M 0.000 description 1
- 210000004872 soft tissue Anatomy 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 210000001519 tissue Anatomy 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K51/00—Preparations containing radioactive substances for use in therapy or testing in vivo
- A61K51/12—Preparations containing radioactive substances for use in therapy or testing in vivo characterised by a special physical form, e.g. emulsion, microcapsules, liposomes, characterized by a special physical form, e.g. emulsions, dispersions, microcapsules
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2123/00—Preparations for testing in vivo
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Physics & Mathematics (AREA)
- Medicinal Chemistry (AREA)
- Optics & Photonics (AREA)
- Dispersion Chemistry (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US57322075A | 1975-04-30 | 1975-04-30 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE43086L IE43086L (en) | 1976-10-30 |
| IE43086B1 true IE43086B1 (en) | 1980-12-17 |
Family
ID=24291098
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE717/76A IE43086B1 (en) | 1975-04-30 | 1976-04-06 | Stable radiographic scannin agents |
Country Status (15)
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4075314A (en) * | 1976-04-29 | 1978-02-21 | Mallinckrodt, Inc. | Stannous pyrophosphate technetium-99m compositions |
| US4233284A (en) * | 1978-03-31 | 1980-11-11 | The Procter & Gamble Company | Stabilized radiographic scanning agents |
| US4247534A (en) * | 1978-07-31 | 1981-01-27 | The Procter & Gamble Company | Radiographic scanning agent |
| JPS5750928A (en) * | 1980-09-13 | 1982-03-25 | Nippon Mejifuijitsukusu Kk | Diagnostic agent for scanning bone |
| JPS5896031A (ja) * | 1981-12-03 | 1983-06-07 | Nippon Mejifuijitsukusu Kk | 放射性診断剤およびその製造用組成物 |
| US4504462A (en) * | 1982-06-10 | 1985-03-12 | Mallinckrodt, Inc. | Process for making a lyophilized product for use in skeletal imaging |
| EP0096931B1 (en) | 1982-06-10 | 1987-03-25 | Mallinckrodt, Inc. (a Delaware corporation) | Radiographic imaging agents |
| US4504463A (en) * | 1982-06-10 | 1985-03-12 | Mallinckrodt, Inc. | Process for making a lyophilized product for use in skeletal imaging |
| EP0096934B1 (en) * | 1982-06-10 | 1986-11-26 | Mallinckrodt, Inc. (a Delaware corporation) | Radiographic imaging agents |
| US4440738A (en) * | 1982-06-10 | 1984-04-03 | Mallinckrodt, Inc. | Stable radiographic imaging agents |
| DE3237573A1 (de) * | 1982-10-09 | 1984-04-12 | Hoechst Ag, 6230 Frankfurt | Technetium-99m-tri- und tetraphosphonate zur szintigraphischen dastellung res-haltiger organe und der lymphgefaesse und verfahren zu deren herstellung |
| EP0111414A3 (en) * | 1982-12-08 | 1985-05-02 | Mallinckrodt, Inc. (a Delaware corporation) | Radiographic imaging agents |
| US4707353A (en) * | 1982-12-08 | 1987-11-17 | Mallinckrodt, Inc. | Radiographic imaging agents |
| US4510125A (en) * | 1982-12-08 | 1985-04-09 | Mallinckrodt, Inc. | Process for making lyophilized radiographic imaging kit |
| DE3331159A1 (de) * | 1983-08-30 | 1985-03-14 | Hoechst Ag, 6230 Frankfurt | N-(4-aminobenzoyl)-aminodicarbonsaeuren zur stabilisierung von technetium-99m-praeparaten, stabilisierte injektionspraeparate und verfahren zu ihrer herstellung |
| GB8910779D0 (en) * | 1989-05-10 | 1989-06-28 | Solanki Kishor K | Stabilisation of radiopharmaceutical compositions |
| AU2541592A (en) * | 1991-08-01 | 1993-03-02 | Hybritech Incorporated | Improvements in or relating to modified haptens useful as imaging and therapeutic agents |
| US6027710A (en) * | 1996-09-18 | 2000-02-22 | Nihon Medi-Physiscs Co., Ltd. | Radiation-protecting agent |
| GB0427392D0 (en) | 2004-12-15 | 2005-01-19 | Amersham Plc | Stabilised 99mTc compositions |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2088149B1 (enrdf_load_stackoverflow) * | 1970-05-22 | 1974-05-24 | Philips France | |
| US3740418A (en) * | 1970-07-01 | 1973-06-19 | Squibb & Sons Inc | Radioactive scanning preparation |
| AU5527973A (en) * | 1972-05-08 | 1974-11-07 | Solco Basel Ag | PROCESS FORTHE MANUFACTURE OF INJECTABLE PREPARATIONS OF Tc99m AND/OR In113m AND APPARATUS FOR CARRYING OUT THE PROCESS |
-
1976
- 1976-03-31 ZA ZA761944A patent/ZA761944B/xx unknown
- 1976-04-06 IE IE717/76A patent/IE43086B1/en unknown
- 1976-04-07 AU AU12736/76A patent/AU509741B2/en not_active Expired
- 1976-04-21 NZ NZ180644A patent/NZ180644A/xx unknown
- 1976-04-26 PH PH18363A patent/PH16096A/en unknown
- 1976-04-27 DE DE2618337A patent/DE2618337B2/de active Granted
- 1976-04-27 DE DE2660417A patent/DE2660417C2/de not_active Expired
- 1976-04-27 DE DE2660424A patent/DE2660424C2/de not_active Expired
- 1976-04-29 NL NLAANVRAGE7604584,A patent/NL176748C/xx not_active IP Right Cessation
- 1976-04-29 IT IT22831/76A patent/IT1059037B/it active
- 1976-04-29 CH CH538376A patent/CH624298A5/de not_active IP Right Cessation
- 1976-04-29 SE SE7604964A patent/SE436246B/xx not_active IP Right Cessation
- 1976-04-29 GB GB17497/76A patent/GB1541070A/en not_active Expired
- 1976-04-29 BE BE166589A patent/BE841298A/xx not_active IP Right Cessation
- 1976-04-29 FR FR7612828A patent/FR2309216A1/fr active Granted
- 1976-04-30 JP JP51048699A patent/JPS521040A/ja active Granted
- 1976-04-30 DK DK195576A patent/DK156620C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL7604584A (nl) | 1976-11-02 |
| DE2618337A1 (de) | 1976-11-11 |
| IE43086L (en) | 1976-10-30 |
| GB1541070A (en) | 1979-02-21 |
| DK195576A (da) | 1976-10-31 |
| AU1273676A (en) | 1977-10-13 |
| JPS521040A (en) | 1977-01-06 |
| DK156620C (da) | 1990-02-05 |
| DE2660424C2 (de) | 1985-08-22 |
| CH624298A5 (en) | 1981-07-31 |
| SE7604964L (sv) | 1976-10-31 |
| FR2309216A1 (fr) | 1976-11-26 |
| BE841298A (fr) | 1976-10-29 |
| DE2618337C3 (enrdf_load_stackoverflow) | 1980-10-16 |
| AU509741B2 (en) | 1980-05-22 |
| NL176748C (nl) | 1985-06-03 |
| NL176748B (nl) | 1985-01-02 |
| SE436246B (sv) | 1984-11-26 |
| JPS5736894B2 (enrdf_load_stackoverflow) | 1982-08-06 |
| IT1059037B (it) | 1982-05-31 |
| DK156620B (da) | 1989-09-18 |
| DE2618337B2 (de) | 1980-02-14 |
| FR2309216B1 (enrdf_load_stackoverflow) | 1979-04-13 |
| PH16096A (en) | 1983-06-24 |
| DE2660417C2 (de) | 1985-03-07 |
| ZA761944B (en) | 1977-03-30 |
| NZ180644A (en) | 1978-03-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0004684B1 (en) | Stabilized radiographic scanning agents and method for preparing them | |
| EP0006658B1 (en) | Radioactive scanning agents with hydroquinone as stabilizer and method for preparing them | |
| CA1118683A (en) | Radioactive scanning agents with stabilizer | |
| IE43086B1 (en) | Stable radiographic scannin agents | |
| Davis et al. | Comparison of 99mTc-labeled phosphate and phosphonate agents for skeletal imaging | |
| US3983227A (en) | Dry mixture containing diphosphonates and a stannous salt useful in the preparation of Tc99M containing bone scanning agents | |
| EP0096930B1 (en) | Stable radiographic imaging agents | |
| US4898724A (en) | Organis amine phosphonic acid complexes for the treatment of calcific tumors | |
| US4497744A (en) | Gentisic acid salts as radiographic scanning agent stabilizers | |
| EP0408701B1 (en) | Macrocyclic aminophosphonic acid complexes, their preparation, formulations and use | |
| US4234562A (en) | Radiographic scanning | |
| JPH0513929B2 (enrdf_load_stackoverflow) | ||
| Subramanian et al. | Technetium-99m-labeled stannous imidodiphosphate, a new radiodiagnostic agent for bone scanning: comparison with other 99mTc complexes | |
| JPH10501218A (ja) | 迅速に消失するテクネチウム−９９ｍホスホネート骨格イメージング剤 | |
| Gawzi | Stabilised radiographic scanning agents | |
| Fawzi | Radioactive scanning agents with stabilizer |