IE41394B1 - Substituted benimidazoles - Google Patents
Substituted benimidazolesInfo
- Publication number
- IE41394B1 IE41394B1 IE1442/75A IE144275A IE41394B1 IE 41394 B1 IE41394 B1 IE 41394B1 IE 1442/75 A IE1442/75 A IE 1442/75A IE 144275 A IE144275 A IE 144275A IE 41394 B1 IE41394 B1 IE 41394B1
- Authority
- IE
- Ireland
- Prior art keywords
- benimidazoles
- substituted
- atom
- sulphonylbenzimidazoles
- r1so2cl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 abstract 2
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 abstract 1
- IYUBCLHILARKQB-UHFFFAOYSA-N 2-sulfonylbenzimidazole Chemical class C1=CC=CC2=NC(=S(=O)=O)N=C21 IYUBCLHILARKQB-UHFFFAOYSA-N 0.000 abstract 1
- 241000700605 Viruses Species 0.000 abstract 1
- 239000003814 drug Substances 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/22—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms directly attached to ring nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US48484174A | 1974-07-01 | 1974-07-01 | |
| US57420275A | 1975-05-08 | 1975-05-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41394L IE41394L (en) | 1976-01-01 |
| IE41394B1 true IE41394B1 (en) | 1979-12-19 |
Family
ID=27048159
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1442/75A IE41394B1 (en) | 1974-07-01 | 1975-06-30 | Substituted benimidazoles |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS51125078A (cs) |
| AR (1) | AR212431A1 (cs) |
| AT (1) | AT344158B (cs) |
| BG (1) | BG27083A3 (cs) |
| CA (1) | CA1026335A (cs) |
| CH (1) | CH617428A5 (cs) |
| DD (1) | DD121109A5 (cs) |
| DE (1) | DE2528846A1 (cs) |
| DK (1) | DK140313B (cs) |
| ES (1) | ES439049A1 (cs) |
| FR (1) | FR2276821A1 (cs) |
| GB (1) | GB1511724A (cs) |
| HU (1) | HU172941B (cs) |
| IE (1) | IE41394B1 (cs) |
| IL (1) | IL47587A (cs) |
| NL (1) | NL7507840A (cs) |
| PH (1) | PH14623A (cs) |
| PL (1) | PL97785B1 (cs) |
| RO (1) | RO68748A (cs) |
| SE (1) | SE415254B (cs) |
| SU (1) | SU786892A3 (cs) |
| YU (1) | YU164075A (cs) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR66420B (cs) * | 1976-12-15 | 1981-03-20 | Lilly Co Eli | |
| GB8504818D0 (en) * | 1985-02-25 | 1985-03-27 | Imperial Chemical Industries Plc | Extraction of metal values |
| JPS625966A (ja) * | 1985-07-03 | 1987-01-12 | Nippon Shinyaku Co Ltd | ベンズイミダゾ−ル誘導体 |
| JP4691988B2 (ja) * | 2002-10-03 | 2011-06-01 | 小野薬品工業株式会社 | Lpa受容体拮抗剤 |
-
1975
- 1975-06-25 JP JP50079313A patent/JPS51125078A/ja active Pending
- 1975-06-26 YU YU01640/75A patent/YU164075A/xx unknown
- 1975-06-27 DK DK292175AA patent/DK140313B/da unknown
- 1975-06-27 CA CA230,418A patent/CA1026335A/en not_active Expired
- 1975-06-27 DE DE19752528846 patent/DE2528846A1/de not_active Withdrawn
- 1975-06-27 RO RO7582673A patent/RO68748A/ro unknown
- 1975-06-27 IL IL47587A patent/IL47587A/xx unknown
- 1975-06-27 GB GB27406/75A patent/GB1511724A/en not_active Expired
- 1975-06-30 CH CH849875A patent/CH617428A5/de not_active IP Right Cessation
- 1975-06-30 HU HU75EI00000632A patent/HU172941B/hu unknown
- 1975-06-30 PL PL1975181664A patent/PL97785B1/pl unknown
- 1975-06-30 AT AT499475A patent/AT344158B/de not_active IP Right Cessation
- 1975-06-30 IE IE1442/75A patent/IE41394B1/xx unknown
- 1975-06-30 SE SE7507482A patent/SE415254B/xx unknown
- 1975-07-01 NL NL7507840A patent/NL7507840A/xx not_active Application Discontinuation
- 1975-07-01 SU SU752149409A patent/SU786892A3/ru active
- 1975-07-01 ES ES439049A patent/ES439049A1/es not_active Expired
- 1975-07-01 FR FR7520653A patent/FR2276821A1/fr active Granted
- 1975-07-01 AR AR259433A patent/AR212431A1/es active
- 1975-07-01 DD DD186999A patent/DD121109A5/xx unknown
- 1975-07-01 BG BG030436A patent/BG27083A3/xx unknown
-
1977
- 1977-11-11 PH PH20425A patent/PH14623A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1511724A (en) | 1978-05-24 |
| IL47587A0 (en) | 1975-08-31 |
| PL97785B1 (pl) | 1978-03-30 |
| DD121109A5 (cs) | 1976-07-12 |
| ATA499475A (de) | 1977-11-15 |
| PH14623A (en) | 1981-10-12 |
| YU164075A (en) | 1982-02-28 |
| IE41394L (en) | 1976-01-01 |
| HU172941B (hu) | 1979-01-28 |
| JPS51125078A (en) | 1976-11-01 |
| FR2276821A1 (fr) | 1976-01-30 |
| SU786892A3 (ru) | 1980-12-07 |
| BG27083A3 (bg) | 1979-08-15 |
| DE2528846A1 (de) | 1976-01-22 |
| CH617428A5 (en) | 1980-05-30 |
| RO68748A (ro) | 1980-06-15 |
| DK140313C (cs) | 1979-12-17 |
| AU8253675A (en) | 1977-01-06 |
| CA1026335A (en) | 1978-02-14 |
| NL7507840A (nl) | 1976-01-05 |
| FR2276821B1 (cs) | 1982-03-05 |
| DK140313B (da) | 1979-07-30 |
| IL47587A (en) | 1978-08-31 |
| AT344158B (de) | 1978-07-10 |
| DK292175A (cs) | 1976-01-02 |
| SE415254B (sv) | 1980-09-22 |
| ES439049A1 (es) | 1977-05-16 |
| AR212431A1 (es) | 1978-07-14 |
| SE7507482L (sv) | 1976-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE45631L (en) | 4-hydroxyphenylalkanolamine derivatives. | |
| CH612427A5 (en) | Process for the preparation of heterocyclic compounds substituted by acylamino groups | |
| IE41394B1 (en) | Substituted benimidazoles | |
| ES466590A1 (es) | Un procedimiento para la preparacion de derivados de oxadia-zolopirimidina. | |
| DE3267188D1 (en) | Hydroxybenzylamino-aryl compounds, process for preparing and pharmaceutical compositions containing the same | |
| GB1471847A (en) | Dibenzofuran derivatives | |
| GB1104773A (en) | Process for the preparation of 5-substituted oxazolidones-(2) | |
| ES449068A1 (es) | Procedimiento para preparar derivados de isoxazol. | |
| EP0042435A4 (en) | BENZOTHIAZINE DERIVATIVES. | |
| JPS52118483A (en) | Nicotinylaminotriazine derivatives | |
| IE44863L (en) | 2-(amino or acylamino)-1-sulphonyl-benzimidazole¹derivatives. | |
| JPS52153947A (en) | Dicyclododecyl peroxycarbonate | |
| IE44614L (en) | Heterocyclylcarbonylpiperazinylquinazolines | |
| JPS52153904A (en) | Preparation of sodium alkoxide | |
| JPS5277003A (en) | Stabilization process of peroxyketones | |
| JPS5257180A (en) | Process for preparing l-ascorbic acid labeled with deuterium | |
| JPS5283742A (en) | Novel thiazole compounds | |
| JPS532476A (en) | Synthesis of 4-substituted-dithio-2-azetidinone derivatives | |
| JPS5283710A (en) | Sulfur-containing amino acid derivatives | |
| JPS52144691A (en) | Preparation of triazoro pyrimidine derivatives | |
| JPS5289679A (en) | Preparation of 5-fluorouracil derivatives | |
| JPS5283716A (en) | Novel 16-substituted prostadienoic acid derivatives | |
| JPS5346955A (en) | Polyoxypregnane type compound | |
| JPS5283612A (en) | Novel substituted aniline derivative | |
| JPS5283717A (en) | Novel 16-hydroxymethylprostadienoic acid derivatives |