IE38886B1 - Heterocyclic compounds - Google Patents
Heterocyclic compoundsInfo
- Publication number
- IE38886B1 IE38886B1 IE00249/74A IE24974A IE38886B1 IE 38886 B1 IE38886 B1 IE 38886B1 IE 00249/74 A IE00249/74 A IE 00249/74A IE 24974 A IE24974 A IE 24974A IE 38886 B1 IE38886 B1 IE 38886B1
- Authority
- IE
- Ireland
- Prior art keywords
- alkyl group
- hydrogen atom
- group
- compounds
- hydroxy
- Prior art date
Links
- 150000002391 heterocyclic compounds Chemical class 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 abstract 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 5
- 150000001875 compounds Chemical class 0.000 abstract 4
- 125000004423 acyloxy group Chemical group 0.000 abstract 3
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 125000003282 alkyl amino group Chemical group 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 125000004663 dialkyl amino group Chemical group 0.000 abstract 2
- 150000002148 esters Chemical class 0.000 abstract 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 abstract 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- XOQQVKDBGLYPGH-UHFFFAOYSA-N 2-oxo-1h-quinoline-3-carboxylic acid Chemical compound C1=CC=C2NC(=O)C(C(=O)O)=CC2=C1 XOQQVKDBGLYPGH-UHFFFAOYSA-N 0.000 abstract 1
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 150000008064 anhydrides Chemical class 0.000 abstract 1
- 239000000427 antigen Substances 0.000 abstract 1
- 102000036639 antigens Human genes 0.000 abstract 1
- 108091007433 antigens Proteins 0.000 abstract 1
- 125000000524 functional group Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- 229960003540 oxyquinoline Drugs 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 150000003536 tetrazoles Chemical class 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB924973A GB1433774A (en) | 1973-02-26 | 1973-02-26 | Heterocyclic compounds apparatus for conveying articles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE38886L IE38886L (en) | 1974-08-26 |
| IE38886B1 true IE38886B1 (en) | 1978-06-21 |
Family
ID=9868317
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE00249/74A IE38886B1 (en) | 1973-02-26 | 1974-02-08 | Heterocyclic compounds |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5029574A (enExample) |
| AT (1) | AT329562B (enExample) |
| AU (1) | AU474797B2 (enExample) |
| BE (1) | BE811246A (enExample) |
| CA (1) | CA1025856A (enExample) |
| CH (1) | CH602707A5 (enExample) |
| DE (1) | DE2407744A1 (enExample) |
| FR (1) | FR2218896B1 (enExample) |
| GB (1) | GB1433774A (enExample) |
| IE (1) | IE38886B1 (enExample) |
| LU (1) | LU69479A1 (enExample) |
| NL (1) | NL7402613A (enExample) |
| SE (1) | SE7401984L (enExample) |
| ZA (1) | ZA74883B (enExample) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2324304A2 (fr) * | 1975-09-22 | 1977-04-15 | Roussel Uclaf | Nouveaux derives de l'acide 3-quinoleine carboxylique, leur procede de preparation et leur application comme medicament |
| US4186201A (en) | 1977-02-07 | 1980-01-29 | Riker Laboratories, Inc. | Methods of using 8(tetrazol-5-ylcarbamoyl)isoquinoline compounds |
| US4264604A (en) | 1977-07-01 | 1981-04-28 | Ciba-Geigy Corporation | Quinolonecarboxylic acid derivatives as bactericides |
| US4390541A (en) | 1980-12-19 | 1983-06-28 | Lilly Industries Limited | Quinolone derivatives and their use in a method of controlling an immediate hypersensitivity disease |
| FR2509728A1 (fr) * | 1981-07-17 | 1983-01-21 | Roussel Uclaf | Nouveaux derives de la quinoleine, leurs sels, procede de preparation, application a titre de medicaments et compositions les renfermant |
| US4377579A (en) | 1981-12-03 | 1983-03-22 | Minnesota Mining And Manufacturing Company | N-(Tetrazol-5-yl)phenazine-1-carboxamides |
| FR2537140B1 (fr) * | 1982-12-07 | 1986-07-18 | Roussel Uclaf | Nouveaux derives de la 4-hydroxy-3-quinoleine carboxamide, leur sels, procede de preparation, application a titre de medicaments, et compositions les renfermant |
| KR960004827B1 (ko) * | 1987-01-20 | 1996-04-16 | 다이닛뽄 세이야꾸 가부시끼가이샤 | 헤테로아릴카르복시아미드 유도체, 그의 제조방법 및 그것을 함유하는 의약조성물 |
| US4959363A (en) * | 1989-06-23 | 1990-09-25 | Sterling Drug Inc. | Quinolonecarboxamide compounds, their preparation and use as antivirals. |
| US6034100A (en) * | 1993-03-10 | 2000-03-07 | Otsuka Pharmaceutical Co., Ltd. | Method for inhibiting cytokine secretion |
| US6143760A (en) | 1997-08-25 | 2000-11-07 | Neurogen Corporation | Substituted 4-oxo-napthyridine-3-carboxamides: GABA brain receptor ligands |
| KR20010023313A (ko) * | 1997-08-25 | 2001-03-26 | 해피 페너 ; 해리 에이치. 페너 2세 | Ｇａｂａ 뇌 수용체 리간드로서의 치환된4-옥소-나프티리딘-3-카르복스아미드 |
| EP1056724B1 (en) * | 1998-02-26 | 2005-05-25 | Neurogen Corporation | Substituted cycloalkyl-4-oxonicotinic carboxamides; gaba brain receptor ligands |
| DK1503759T3 (da) * | 2002-05-14 | 2009-04-14 | Univ California | Substituerede quinoloncarboxylsyrer, deres derivater, virkningssted og anvendelser heraf |
| WO2005009971A1 (ja) * | 2003-07-24 | 2005-02-03 | Astellas Pharma Inc. | キノロン誘導体又はその塩 |
| US8354427B2 (en) | 2004-06-24 | 2013-01-15 | Vertex Pharmaceutical Incorporated | Modulators of ATP-binding cassette transporters |
| EP2502911B1 (en) * | 2004-06-24 | 2017-04-05 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-binding cassette transporters |
| RU2528046C2 (ru) * | 2004-06-24 | 2014-09-10 | Вертекс Фармасьютикалз Инкорпорейтед | Модуляторы транспортеров атф-связывающей кассеты |
| LT2502911T (lt) | 2004-06-24 | 2017-09-11 | Vertex Pharmaceuticals Incorporated | Atp surišančios kasetės transporterių moduliatoriai |
| WO2007079139A2 (en) | 2005-12-28 | 2007-07-12 | Vertex Pharmaceuticals, Inc. | Solid forms of n-[2,4-bis(1,1-dimethylethyl)-5-hydroxyphenyl]-1,4-dihydro-4-oxoquinoline-3-carboxamide |
| US20100074949A1 (en) | 2008-08-13 | 2010-03-25 | William Rowe | Pharmaceutical composition and administration thereof |
| US12458635B2 (en) | 2008-08-13 | 2025-11-04 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administrations thereof |
| SI2408750T1 (sl) | 2009-03-20 | 2015-11-30 | Vertex Pharmaceuticals Incorporated | Postopek za izdelavo modulatorjev cistično-fibroznega transmembranskega regulatorja prevodnosti |
| US8802700B2 (en) | 2010-12-10 | 2014-08-12 | Vertex Pharmaceuticals Incorporated | Modulators of ATP-Binding Cassette transporters |
| EP2819670A1 (en) | 2012-02-27 | 2015-01-07 | Vertex Pharmaceuticals Incorporated | Pharmaceutical composition and administration thereof |
| WO2013129622A1 (ja) | 2012-03-02 | 2013-09-06 | 武田薬品工業株式会社 | 複素環化合物およびその用途 |
| EP2921480B1 (en) | 2012-11-19 | 2017-10-11 | Takeda Pharmaceutical Company Limited | Nitrogen-containing heterocyclic compound |
| KR20170063954A (ko) | 2014-10-07 | 2017-06-08 | 버텍스 파마슈티칼스 인코포레이티드 | 낭성 섬유증 막횡단 전도도 조절자의 조정제의 공-결정 |
| CN105330602B (zh) * | 2015-12-07 | 2018-02-09 | 江南大学 | 一种癸氧喹酯类似物及其应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1383088A (en) * | 1972-07-03 | 1975-02-05 | Allen & Hanburys Ltd | Pharmacologically active quinaldamide derivatives |
-
1973
- 1973-02-26 GB GB924973A patent/GB1433774A/en not_active Expired
-
1974
- 1974-02-08 IE IE00249/74A patent/IE38886B1/xx unknown
- 1974-02-11 ZA ZA740883A patent/ZA74883B/xx unknown
- 1974-02-14 SE SE7401984A patent/SE7401984L/xx unknown
- 1974-02-14 AU AU65592/74A patent/AU474797B2/en not_active Expired
- 1974-02-18 CH CH224374A patent/CH602707A5/xx not_active IP Right Cessation
- 1974-02-18 DE DE19742407744 patent/DE2407744A1/de active Pending
- 1974-02-19 BE BE141102A patent/BE811246A/xx unknown
- 1974-02-22 LU LU69479A patent/LU69479A1/xx unknown
- 1974-02-25 AT AT149974A patent/AT329562B/de not_active IP Right Cessation
- 1974-02-25 JP JP49022232A patent/JPS5029574A/ja active Pending
- 1974-02-25 FR FR7406327A patent/FR2218896B1/fr not_active Expired
- 1974-02-26 CA CA193,476A patent/CA1025856A/en not_active Expired
- 1974-02-26 NL NL7402613A patent/NL7402613A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2407744A1 (de) | 1974-08-29 |
| JPS5029574A (enExample) | 1975-03-25 |
| SE7401984L (enExample) | 1974-08-27 |
| AU474797B2 (en) | 1976-08-05 |
| AU6559274A (en) | 1975-08-14 |
| CH602707A5 (enExample) | 1978-07-31 |
| IE38886L (en) | 1974-08-26 |
| NL7402613A (enExample) | 1974-08-28 |
| GB1433774A (en) | 1976-04-28 |
| ATA149974A (de) | 1975-08-15 |
| FR2218896A1 (enExample) | 1974-09-20 |
| ZA74883B (en) | 1974-12-24 |
| CA1025856A (en) | 1978-02-07 |
| AT329562B (de) | 1976-05-25 |
| FR2218896B1 (enExample) | 1977-09-09 |
| BE811246A (fr) | 1974-08-19 |
| LU69479A1 (enExample) | 1975-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE38886B1 (en) | Heterocyclic compounds | |
| IE37519B1 (en) | Novel amino derivatives of quinoxaline and quinazoline | |
| NO163956C (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive (4-piperidinylmetyl- og -hetero)puriner. | |
| FI900085A0 (fi) | Menetelmä terapeuttisesti käyttökelpoisten N-(pyrimidin- ja kondensoitu pyrimidin-4-oni)etyyli-piperidiini- ja piperatsiinijohdannaisten valmistamiseksi | |
| DE3777505D1 (de) | 4-aminochinolin-derivate und ihre verwendung als arzneimittel. | |
| NO903438D0 (no) | Fremgangsmaate for fremstilling av tiazolderivater. | |
| DE69428142D1 (de) | Quinolin- oder Quinazolinderivate, deren Herstellung und Verwendung | |
| DK457286D0 (da) | Fluorenforbindelse og farmaceutisk praeparat indeholdende en saadan forbindelse | |
| IE37795L (en) | Quinaldamide derivatives | |
| IE812683L (en) | Thieno-pyridine derivatives | |
| ATE3284T1 (de) | Derivate der 9-cis-6,6'-diapo-psi,psicarotindis[ure, ihre herstellung und sie enthaltende pharmazeutische zusammensetzungen. | |
| IE33850L (en) | Pyridoindole derivatives. | |
| GB1530413A (en) | 5,8-dihydro-5-oxopyrido(2,3-d)pyrimidines | |
| GB1008849A (en) | Basically substituted triazolidines, processes for their manufacture and pharmaceutical preparations containing them | |
| GB1398687A (en) | Substituted oxazolidinones and pharmaceutical uses thereof | |
| JPS55129268A (en) | Carbostyril derivative | |
| IE832769L (en) | Acridanone derivative. | |
| SE8502310D0 (sv) | Nya kinolinderivat, sett att framstella dessa samt terapeutiska kompositioner, innehallande desamma | |
| GB1488412A (en) | Imidazo(1,2-a)quinolines | |
| GB1422831A (en) | Acylaminobenzimidazole derivatives | |
| JPS5273875A (en) | Synthesis of carbostyril-carboxylic acid derivatives | |
| GB1453427A (en) | 4-oxo-1,2,3,4-tetrahydropyrido-2,3-d-pyrimidines | |
| KR880012613A (ko) | 퀴놀린카르복실산 유도체 및 그를 함유하는 항생균제 |