IE37750B1 - Process for preparing a quinazolone - Google Patents
Process for preparing a quinazoloneInfo
- Publication number
- IE37750B1 IE37750B1 IE90873A IE90873A IE37750B1 IE 37750 B1 IE37750 B1 IE 37750B1 IE 90873 A IE90873 A IE 90873A IE 90873 A IE90873 A IE 90873A IE 37750 B1 IE37750 B1 IE 37750B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- benzyloxy
- june
- phenyl
- produce
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 abstract 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 2
- BHQNJNLXFVJFFI-UHFFFAOYSA-N 3-phenyl-1h-quinazoline-2,4-dione Chemical compound O=C1NC2=CC=CC=C2C(=O)N1C1=CC=CC=C1 BHQNJNLXFVJFFI-UHFFFAOYSA-N 0.000 abstract 1
- -1 acetoxy, benzoyloxy Chemical group 0.000 abstract 1
- 239000002253 acid Substances 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5763172A JPS5442991B2 (cg-RX-API-DMAC10.html) | 1972-06-12 | 1972-06-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37750L IE37750L (en) | 1973-12-12 |
| IE37750B1 true IE37750B1 (en) | 1977-09-28 |
Family
ID=13061227
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE90873A IE37750B1 (en) | 1972-06-12 | 1973-06-06 | Process for preparing a quinazolone |
Country Status (16)
| Country | Link |
|---|---|
| JP (1) | JPS5442991B2 (cg-RX-API-DMAC10.html) |
| AR (1) | AR197148A1 (cg-RX-API-DMAC10.html) |
| AT (1) | AT330187B (cg-RX-API-DMAC10.html) |
| AU (1) | AU474505B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE800595A (cg-RX-API-DMAC10.html) |
| CA (1) | CA998339A (cg-RX-API-DMAC10.html) |
| CH (1) | CH582160A5 (cg-RX-API-DMAC10.html) |
| CS (1) | CS184815B2 (cg-RX-API-DMAC10.html) |
| ES (1) | ES415794A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2187353B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1443829A (cg-RX-API-DMAC10.html) |
| HU (1) | HU165940B (cg-RX-API-DMAC10.html) |
| IE (1) | IE37750B1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7308045A (cg-RX-API-DMAC10.html) |
| SU (1) | SU563915A3 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA733834B (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU543928B2 (en) * | 1981-01-16 | 1985-05-09 | Masayuki Ishikawa | 4(311)-quinazolinone derivatives |
| JP2766791B2 (ja) * | 1995-09-04 | 1998-06-18 | 森川産業株式会社 | 集合ヘッドを有する気体圧縮機 |
| WO1997010221A1 (en) * | 1995-09-15 | 1997-03-20 | Torrey Pines Institute For Molecular Studies | Synthesis of quinazolinone libraries |
-
1972
- 1972-06-12 JP JP5763172A patent/JPS5442991B2/ja not_active Expired
-
1973
- 1973-06-05 CA CA173,223A patent/CA998339A/en not_active Expired
- 1973-06-06 IE IE90873A patent/IE37750B1/xx unknown
- 1973-06-06 ZA ZA733834A patent/ZA733834B/xx unknown
- 1973-06-07 BE BE131994A patent/BE800595A/xx not_active IP Right Cessation
- 1973-06-08 AU AU56717/73A patent/AU474505B2/en not_active Expired
- 1973-06-08 NL NL7308045A patent/NL7308045A/xx not_active Application Discontinuation
- 1973-06-11 HU HUIO000201 patent/HU165940B/hu unknown
- 1973-06-11 ES ES415794A patent/ES415794A1/es not_active Expired
- 1973-06-11 GB GB2771873A patent/GB1443829A/en not_active Expired
- 1973-06-11 CS CS419873A patent/CS184815B2/cs unknown
- 1973-06-11 SU SU7301930852A patent/SU563915A3/ru active
- 1973-06-12 FR FR7321301A patent/FR2187353B1/fr not_active Expired
- 1973-06-12 AR AR24853673A patent/AR197148A1/es active
- 1973-06-12 AT AT514473A patent/AT330187B/de active
- 1973-06-12 CH CH845773A patent/CH582160A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU474505B2 (en) | 1976-07-22 |
| JPS4914482A (cg-RX-API-DMAC10.html) | 1974-02-07 |
| NL7308045A (cg-RX-API-DMAC10.html) | 1973-12-14 |
| GB1443829A (en) | 1976-07-28 |
| ZA733834B (en) | 1974-04-24 |
| DE2329815B2 (de) | 1976-02-26 |
| HU165940B (cg-RX-API-DMAC10.html) | 1974-12-28 |
| CH582160A5 (cg-RX-API-DMAC10.html) | 1976-11-30 |
| SU563915A3 (ru) | 1977-06-30 |
| ATA514473A (de) | 1975-09-15 |
| AU5671773A (en) | 1974-12-12 |
| AT330187B (de) | 1976-06-25 |
| ES415794A1 (es) | 1976-02-01 |
| FR2187353B1 (cg-RX-API-DMAC10.html) | 1976-09-03 |
| JPS5442991B2 (cg-RX-API-DMAC10.html) | 1979-12-17 |
| CS184815B2 (en) | 1978-09-15 |
| CA998339A (en) | 1976-10-12 |
| FR2187353A1 (cg-RX-API-DMAC10.html) | 1974-01-18 |
| AR197148A1 (es) | 1974-03-15 |
| DE2329815A1 (de) | 1974-01-03 |
| BE800595A (fr) | 1973-10-01 |
| IE37750L (en) | 1973-12-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1333471A (en) | Imidazoline derivatives and process for preparing the same | |
| GB1461184A (en) | Process for the manufacture of 5-fluorocytosine | |
| IE37750B1 (en) | Process for preparing a quinazolone | |
| GB1338851A (en) | Method of preparing fluoran compounds | |
| IE33130L (en) | PYRAZOLO (3,4-d) PYRIMIDINES. | |
| GB1244074A (en) | Process for the production of sodium methallyl sulphonate | |
| ES8106708A1 (es) | Un procedimiento para preparar 7-alcoxicarbonil-6,8-dime- til-4-hidroximetil-1-ftalazona | |
| ATE71937T1 (de) | Verfahren zur herstellung von octahydroindolderivaten und ihre zwischenprodukte. | |
| GB1223663A (en) | Pyrazole compounds and process for preparing the same | |
| GB1349138A (en) | Quinazoline derivative | |
| GB1216975A (en) | Process for the production of watersoluble dyes and optical brighteners | |
| GB1334633A (en) | Quinazoline compounds and methods for their production | |
| GB1387908A (en) | Polymerisable anthranilic acid esters | |
| GB1190228A (en) | 5-Chloro-2,3-Pyridine Diol and a Process for its Production | |
| GB1414115A (en) | Method for producing 2,6-ditert-butyl-4-cumyl phenol | |
| NO982315L (no) | FremgangsmÕte for fremstilling av 3-amino-1,2,4-benzotriazindioksyd | |
| GB1384194A (en) | Process for the production of trisodium or tripotassium citrate | |
| GB1149463A (en) | A process for the manufacture of isoquinoline derivatives | |
| GB1383260A (en) | Hydantoin derivative and preparation thereof | |
| GB1314799A (en) | Process for obtaining or producing very pure tetrachlorobisphenol | |
| GB1335456A (en) | Process for producing liquid fertilizers | |
| GB1486899A (en) | Process for making reconstituted tobacco web | |
| GB1058384A (en) | Guanidinoarylcarboxylic acids and their halides | |
| GB1337377A (en) | Process for the preparation of ethyl 8-hydroxy-1,3-dioxolo | |
| GB1207048A (en) | Novel 2-alkyl-4-oxa-steroids and a process for the manufacture thereof |