IE37392B1 - 5-amino-isophthalic acid derivatives - Google Patents
5-amino-isophthalic acid derivativesInfo
- Publication number
- IE37392B1 IE37392B1 IE1238/72A IE123872A IE37392B1 IE 37392 B1 IE37392 B1 IE 37392B1 IE 1238/72 A IE1238/72 A IE 1238/72A IE 123872 A IE123872 A IE 123872A IE 37392 B1 IE37392 B1 IE 37392B1
- Authority
- IE
- Ireland
- Prior art keywords
- diethyl
- anilino
- nitro
- amino
- benzylamino
- Prior art date
Links
- KBZFDRWPMZESDI-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarboxylic acid Chemical class NC1=CC(C(O)=O)=CC(C(O)=O)=C1 KBZFDRWPMZESDI-UHFFFAOYSA-N 0.000 title abstract 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 3
- ZIVMDGVNLSYXMB-UHFFFAOYSA-N 2-anilino-5-ethoxycarbonyl-3-nitrobenzoic acid Chemical compound N(C1=CC=CC=C1)C1=C(C=C(C(=O)OCC)C=C1C(=O)O)[N+](=O)[O-] ZIVMDGVNLSYXMB-UHFFFAOYSA-N 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 2
- 150000002148 esters Chemical class 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 239000001257 hydrogen Substances 0.000 abstract 2
- BOEMWLSLLLDXOD-UHFFFAOYSA-N 3-nitro-2-phenyl-5-sulfanylcarbonylbenzoic acid Chemical class [N+](=O)([O-])C=1C(=C(C=C(C(=S)O)C1)C(=O)O)C1=CC=CC=C1 BOEMWLSLLLDXOD-UHFFFAOYSA-N 0.000 abstract 1
- UURIZAOKVAUQLS-UHFFFAOYSA-N 4-anilino-3-carbamoyl-5-nitrobenzoic acid Chemical compound N(C1=CC=CC=C1)C1=C(C=C(C(=O)O)C=C1C(N)=O)[N+](=O)[O-] UURIZAOKVAUQLS-UHFFFAOYSA-N 0.000 abstract 1
- SAWOKKQTYAWLPF-UHFFFAOYSA-N 4-anilino-5-nitrobenzene-1,3-dicarboxylic acid Chemical compound N(C1=CC=CC=C1)C1=C(C=C(C(=O)O)C=C1[N+](=O)[O-])C(=O)O SAWOKKQTYAWLPF-UHFFFAOYSA-N 0.000 abstract 1
- SHOLOUDRJYYCPP-UHFFFAOYSA-N 4-chloro-5-nitrobenzene-1,3-dicarboxylic acid Chemical compound ClC1=C(C=C(C(=O)O)C=C1[N+](=O)[O-])C(=O)O SHOLOUDRJYYCPP-UHFFFAOYSA-N 0.000 abstract 1
- BTNBVTZQYKXTOH-UHFFFAOYSA-N CC(C=C1)=CC=C1OC(C([N+]([O-])=O)=CC(C(O)=O)=C1)=C1C(O)=O Chemical class CC(C=C1)=CC=C1OC(C([N+]([O-])=O)=CC(C(O)=O)=C1)=C1C(O)=O BTNBVTZQYKXTOH-UHFFFAOYSA-N 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 abstract 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- ISMPMSKDEONVNN-UHFFFAOYSA-N diethyl 4-anilino-5-nitrobenzene-1,3-dicarboxylate Chemical compound CCOC(=O)C1=CC(=C(NC2=CC=CC=C2)C(=C1)C(=O)OCC)[N+]([O-])=O ISMPMSKDEONVNN-UHFFFAOYSA-N 0.000 abstract 1
- YMIRYOHQZMNFNE-UHFFFAOYSA-N diethyl 5-(benzylamino)-4-(4-chlorophenyl)sulfanylbenzene-1,3-dicarboxylate Chemical compound C(C1=CC=CC=C1)NC=1C(=C(C=C(C(=O)OCC)C1)C(=O)OCC)SC1=CC=C(C=C1)Cl YMIRYOHQZMNFNE-UHFFFAOYSA-N 0.000 abstract 1
- RTWGEUOEQKHYAD-UHFFFAOYSA-N diethyl 5-(benzylamino)-4-phenoxybenzene-1,3-dicarboxylate Chemical compound C(C1=CC=CC=C1)NC=1C(=C(C=C(C(=O)OCC)C1)C(=O)OCC)OC1=CC=CC=C1 RTWGEUOEQKHYAD-UHFFFAOYSA-N 0.000 abstract 1
- NPJIYUOYXHYHIC-UHFFFAOYSA-N ethyl 1-(benzylamino)-5-ethoxycarbothioyl-2-phenylcyclohexa-2,4-diene-1-carboxylate Chemical compound C(C1=CC=CC=C1)NC1(CC(C(=S)OCC)=CC=C1C1=CC=CC=C1)C(=O)OCC NPJIYUOYXHYHIC-UHFFFAOYSA-N 0.000 abstract 1
- SAHDHWGGWWYQOO-UHFFFAOYSA-N ethyl 4-anilino-3-carbonochloridoyl-5-nitrobenzoate Chemical compound N(C1=CC=CC=C1)C1=C(C=C(C(=O)OCC)C=C1C(=O)Cl)[N+](=O)[O-] SAHDHWGGWWYQOO-UHFFFAOYSA-N 0.000 abstract 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 229920006395 saturated elastomer Polymers 0.000 abstract 1
- 238000010561 standard procedure Methods 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C205/60—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms in ortho-position to the carboxyl group, e.g. nitro-salicylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/58—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4629171A GB1380065A (en) | 1971-10-05 | 1971-10-05 | 5-amino-isophthalic acid derivatives |
| GB5810071 | 1971-12-14 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37392L IE37392L (en) | 1973-04-05 |
| IE37392B1 true IE37392B1 (en) | 1977-07-20 |
Family
ID=26265784
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1238/72A IE37392B1 (en) | 1971-10-05 | 1972-09-12 | 5-amino-isophthalic acid derivatives |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3864385A (enExample) |
| JP (1) | JPS4844229A (enExample) |
| BE (1) | BE789679A (enExample) |
| CA (1) | CA1002964A (enExample) |
| DE (1) | DE2248596A1 (enExample) |
| FR (1) | FR2158208B1 (enExample) |
| GB (1) | GB1380065A (enExample) |
| IE (1) | IE37392B1 (enExample) |
| LU (1) | LU66227A1 (enExample) |
| NL (1) | NL7213059A (enExample) |
| SE (1) | SE400551B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50102767A (enExample) * | 1974-01-22 | 1975-08-14 | ||
| US4204970A (en) * | 1978-12-07 | 1980-05-27 | Standard Oil Company (Indiana) | Lubricant compositions containing alkylated aromatic amino acid antioxidants |
| JPS62192494A (ja) * | 1986-02-20 | 1987-08-24 | Echiren Chem Kk | 自動車用液圧ブレ−キ作動液組成物 |
| MX18467A (es) * | 1988-11-23 | 1993-07-01 | Pfizer | Agentes terapeuticos de quinuclidinas |
| TR200101239T2 (tr) | 1998-11-03 | 2001-11-21 | Basf Aktiengesellschaft | İkameli-2-fenilbenzimidazoller, üretimleri ve kullanımları |
| WO2006110683A1 (en) * | 2005-04-11 | 2006-10-19 | Abbott Laboratories | 2-substituted-1h-benzimidazole-4-carboxamides are parp inhibitors |
| TWI375673B (en) * | 2005-04-11 | 2012-11-01 | Abbott Lab | 1h-benzimidazole-4-carboxamides substituted with a quaternary carbon at the 2-position are potent parp inhibitors |
| DE602006013191D1 (de) * | 2005-11-15 | 2010-05-06 | Abbott Lab | Substituierte 1h-benzimidazol-4-carbonsäureamide sind wirksame parp-inhibitoren |
| ATE553104T1 (de) * | 2006-05-02 | 2012-04-15 | Abbott Lab | Substituierte 1h-benzimidazol-4-carboxamide als potente parp-hemmer |
| US8067613B2 (en) * | 2007-07-16 | 2011-11-29 | Abbott Laboratories | Benzimidazole poly(ADP ribose)polymerase inhibitors |
| WO2010083199A1 (en) * | 2009-01-19 | 2010-07-22 | Abbott Laboratories | Benzthiazole inhibitors of poly(adp-ribose)polymerase |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1252959B (de) * | 1964-12-31 | 1967-10-26 | Bayer Ag | Acarizide Mittel |
-
0
- BE BE789679D patent/BE789679A/xx unknown
-
1971
- 1971-10-05 GB GB4629171A patent/GB1380065A/en not_active Expired
-
1972
- 1972-09-12 IE IE1238/72A patent/IE37392B1/xx unknown
- 1972-09-26 CA CA152,555A patent/CA1002964A/en not_active Expired
- 1972-09-27 NL NL7213059A patent/NL7213059A/xx not_active Application Discontinuation
- 1972-09-27 US US292525A patent/US3864385A/en not_active Expired - Lifetime
- 1972-10-03 LU LU66227A patent/LU66227A1/xx unknown
- 1972-10-04 FR FR7235179A patent/FR2158208B1/fr not_active Expired
- 1972-10-04 SE SE7212799A patent/SE400551B/xx unknown
- 1972-10-04 JP JP47099744A patent/JPS4844229A/ja active Pending
- 1972-10-04 DE DE19722248596 patent/DE2248596A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2158208B1 (enExample) | 1975-08-08 |
| LU66227A1 (enExample) | 1973-01-23 |
| FR2158208A1 (enExample) | 1973-06-15 |
| NL7213059A (enExample) | 1973-04-09 |
| SE400551B (sv) | 1978-04-03 |
| JPS4844229A (enExample) | 1973-06-26 |
| IE37392L (en) | 1973-04-05 |
| GB1380065A (en) | 1975-01-08 |
| DE2248596A1 (de) | 1973-04-12 |
| US3864385A (en) | 1975-02-04 |
| CA1002964A (en) | 1977-01-04 |
| BE789679A (fr) | 1973-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE37392L (en) | 5-amino-isophthalic acid derivatives | |
| IE781227L (en) | New peptide derivatives. | |
| GB1448316A (en) | Racemization of optically active 2,2-dimethyl-3,1,-alkenyl- cyclopropane-1-carboxylic acids | |
| GB1496492A (en) | Optically active lysergic acid derivatives | |
| GB1097531A (en) | Improvements in or relating to the preparation of cyclopentane derivatives | |
| GB1432503A (en) | Cycloalkylalkylesters and process for their preparation | |
| GB1496692A (en) | Process for the preparation of ceph-2-em compounds | |
| ES425088A1 (es) | Procedimiento para preparar resinas acidas. | |
| GB1298005A (enExample) | ||
| GB1225461A (enExample) | ||
| GB1453376A (en) | Naphthalene carboxylic acids and derivatives thereof | |
| GB1203538A (en) | Cubane derivatives | |
| IE43708L (en) | D-homosteroid carboxylic acids | |
| GB1364870A (en) | Ethylene polymerization | |
| IE33346B1 (en) | Cyclohexa-1,4-diene-1-acetic acids | |
| JPS5242815A (en) | Process for preparation of carboxylic acid esters | |
| JPS52106857A (en) | Preparation of 1,3-disubstituted-2-azetidinones | |
| GB1474459A (en) | Substituted indanones | |
| JPS5231094A (en) | Preparation of cephalexin | |
| GB1315564A (en) | Nickel salts of phosphonic acid monoesters | |
| GB1417817A (en) | Substituted acetic acid cyclohexyl esters the preparation thereof and pharmaceutical compositions containing them | |
| GB1405303A (en) | Polyester preparation | |
| GB1236355A (en) | Cyclopropanecarboxylic acid esters | |
| GB1465497A (en) | Flupen-thixol ester | |
| GB1292662A (en) | Bicycloheptaneheptanoic acids and esters thereof |