SE400551B - Forfarande for framstellning av terapeutiskt aktiva 3-amino-5-karbamylbensoesyraderivat - Google Patents
Forfarande for framstellning av terapeutiskt aktiva 3-amino-5-karbamylbensoesyraderivatInfo
- Publication number
- SE400551B SE400551B SE7212799A SE1279972A SE400551B SE 400551 B SE400551 B SE 400551B SE 7212799 A SE7212799 A SE 7212799A SE 1279972 A SE1279972 A SE 1279972A SE 400551 B SE400551 B SE 400551B
- Authority
- SE
- Sweden
- Prior art keywords
- carbamylbenzoic
- amino
- procedure
- preparation
- acid derivatives
- Prior art date
Links
- XHLMMVDCYIXUAX-UHFFFAOYSA-N 3-amino-5-carbamoylbenzoic acid Chemical class NC(=O)C1=CC(N)=CC(C(O)=O)=C1 XHLMMVDCYIXUAX-UHFFFAOYSA-N 0.000 title 1
- 230000001225 therapeutic effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C205/60—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms in ortho-position to the carboxyl group, e.g. nitro-salicylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/58—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4629171A GB1380065A (en) | 1971-10-05 | 1971-10-05 | 5-amino-isophthalic acid derivatives |
| GB5810071 | 1971-12-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE400551B true SE400551B (sv) | 1978-04-03 |
Family
ID=26265784
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7212799A SE400551B (sv) | 1971-10-05 | 1972-10-04 | Forfarande for framstellning av terapeutiskt aktiva 3-amino-5-karbamylbensoesyraderivat |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3864385A (enExample) |
| JP (1) | JPS4844229A (enExample) |
| BE (1) | BE789679A (enExample) |
| CA (1) | CA1002964A (enExample) |
| DE (1) | DE2248596A1 (enExample) |
| FR (1) | FR2158208B1 (enExample) |
| GB (1) | GB1380065A (enExample) |
| IE (1) | IE37392B1 (enExample) |
| LU (1) | LU66227A1 (enExample) |
| NL (1) | NL7213059A (enExample) |
| SE (1) | SE400551B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50102767A (enExample) * | 1974-01-22 | 1975-08-14 | ||
| US4204970A (en) * | 1978-12-07 | 1980-05-27 | Standard Oil Company (Indiana) | Lubricant compositions containing alkylated aromatic amino acid antioxidants |
| JPS62192494A (ja) * | 1986-02-20 | 1987-08-24 | Echiren Chem Kk | 自動車用液圧ブレ−キ作動液組成物 |
| MX18467A (es) * | 1988-11-23 | 1993-07-01 | Pfizer | Agentes terapeuticos de quinuclidinas |
| TR200101239T2 (tr) | 1998-11-03 | 2001-11-21 | Basf Aktiengesellschaft | İkameli-2-fenilbenzimidazoller, üretimleri ve kullanımları |
| WO2006110683A1 (en) * | 2005-04-11 | 2006-10-19 | Abbott Laboratories | 2-substituted-1h-benzimidazole-4-carboxamides are parp inhibitors |
| TWI375673B (en) * | 2005-04-11 | 2012-11-01 | Abbott Lab | 1h-benzimidazole-4-carboxamides substituted with a quaternary carbon at the 2-position are potent parp inhibitors |
| DE602006013191D1 (de) * | 2005-11-15 | 2010-05-06 | Abbott Lab | Substituierte 1h-benzimidazol-4-carbonsäureamide sind wirksame parp-inhibitoren |
| ATE553104T1 (de) * | 2006-05-02 | 2012-04-15 | Abbott Lab | Substituierte 1h-benzimidazol-4-carboxamide als potente parp-hemmer |
| US8067613B2 (en) * | 2007-07-16 | 2011-11-29 | Abbott Laboratories | Benzimidazole poly(ADP ribose)polymerase inhibitors |
| WO2010083199A1 (en) * | 2009-01-19 | 2010-07-22 | Abbott Laboratories | Benzthiazole inhibitors of poly(adp-ribose)polymerase |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1252959B (de) * | 1964-12-31 | 1967-10-26 | Bayer Ag | Acarizide Mittel |
-
0
- BE BE789679D patent/BE789679A/xx unknown
-
1971
- 1971-10-05 GB GB4629171A patent/GB1380065A/en not_active Expired
-
1972
- 1972-09-12 IE IE1238/72A patent/IE37392B1/xx unknown
- 1972-09-26 CA CA152,555A patent/CA1002964A/en not_active Expired
- 1972-09-27 NL NL7213059A patent/NL7213059A/xx not_active Application Discontinuation
- 1972-09-27 US US292525A patent/US3864385A/en not_active Expired - Lifetime
- 1972-10-03 LU LU66227A patent/LU66227A1/xx unknown
- 1972-10-04 FR FR7235179A patent/FR2158208B1/fr not_active Expired
- 1972-10-04 SE SE7212799A patent/SE400551B/xx unknown
- 1972-10-04 JP JP47099744A patent/JPS4844229A/ja active Pending
- 1972-10-04 DE DE19722248596 patent/DE2248596A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2158208B1 (enExample) | 1975-08-08 |
| LU66227A1 (enExample) | 1973-01-23 |
| FR2158208A1 (enExample) | 1973-06-15 |
| IE37392B1 (en) | 1977-07-20 |
| NL7213059A (enExample) | 1973-04-09 |
| JPS4844229A (enExample) | 1973-06-26 |
| IE37392L (en) | 1973-04-05 |
| GB1380065A (en) | 1975-01-08 |
| DE2248596A1 (de) | 1973-04-12 |
| US3864385A (en) | 1975-02-04 |
| CA1002964A (en) | 1977-01-04 |
| BE789679A (fr) | 1973-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO145883C (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 7-methoxy-7-acylamino-cefalosporansyrederivater | |
| SE393800B (sv) | Forfarande for framstellning av bensoylamino-alkyl-fenoxi-alkylkarbonsyraderivat med lipidsenkande effekt | |
| NO137321C (no) | Analogifremgangsm}te for fremstilling av terapeutisk aktive 3-okso-17alfa-acyloksyandrost-4-en-17beta-karboksylsyreestere | |
| NO137440C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pleuromutiliner | |
| SE398229B (sv) | Forfarande for framstellning av 4-fenoxi-fenoxialkankarbonsyraderivat | |
| AR213059A1 (es) | Procedimiento de preparacion de derivados de acido 7-acilaminocefalosporanico | |
| SE398877B (sv) | Forfarande for framstellning av 14-hydroxi-morfinanderivat | |
| NO143575C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive prostansyre-derivater | |
| NO145056C (no) | (s)-1-aryloksy-2-propanolderivater for fremstilling av terapeutisk aktive (s)-1-aryloksy-3-amino-2-propanolderivater | |
| NO139685C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive isoindolin-derivater | |
| SE385698B (sv) | Forfarande for framstellning av kinolinettiksyraderivat | |
| NO141651C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive aroyl-substituerte fenyleddiksyrederivater | |
| NO147917C (no) | Fremgangsmaate for fremstilling av 3-metyl-delta3-cefem-4-karboksylsyre-forbindelser | |
| SE400551B (sv) | Forfarande for framstellning av terapeutiskt aktiva 3-amino-5-karbamylbensoesyraderivat | |
| SE397973B (sv) | Forfarande for framstellning av bensoylfenylsmorsyraderivat | |
| NO143064C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive hydroksyalkylxantiner | |
| SE399708B (sv) | Forfarande for framstellning av tioxanton-2-karboxylsyraderivat | |
| NO136795C (no) | Analogifremgangsm}te for fremstilling av terapeutisk aktive indoliner | |
| SE392615B (sv) | Forfarande for framstellning av 2-nitro-5-imidazolaldehydderivat | |
| NO137728C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyrasi-4-oksyd-derivater | |
| SE384686B (sv) | Forfarande for framstellning av linkomycinderivat | |
| SE393801B (sv) | Forfarande for framstellning av tiokarbaminsyraderivat med antifungistatisk lekemedelsverken | |
| NO136841C (no) | Analogifremgangsm}te for fremstilling av terapeutisk aktive fenylimidazolidinoner | |
| NO144488C (no) | Analogifremgangsmaate for fremstilling av terapeutisk virksomme 8,12-diisoprostansyre-derivater | |
| NO137696C (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive benzodiazepin-derivater |