IE35233B1 - 1,4-dihydropyridine derivatives - Google Patents
1,4-dihydropyridine derivativesInfo
- Publication number
- IE35233B1 IE35233B1 IE293/71A IE29371A IE35233B1 IE 35233 B1 IE35233 B1 IE 35233B1 IE 293/71 A IE293/71 A IE 293/71A IE 29371 A IE29371 A IE 29371A IE 35233 B1 IE35233 B1 IE 35233B1
- Authority
- IE
- Ireland
- Prior art keywords
- general formula
- group
- alkyl
- dihydropyridine
- azidoaryl
- Prior art date
Links
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 title 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000000304 alkynyl group Chemical group 0.000 abstract 2
- 150000001412 amines Chemical class 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 125000001246 bromo group Chemical group Br* 0.000 abstract 2
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 2
- 125000005843 halogen group Chemical group 0.000 abstract 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 abstract 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 229910021529 ammonia Inorganic materials 0.000 abstract 1
- 230000003276 anti-hypertensive effect Effects 0.000 abstract 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000000812 cholinergic antagonist Substances 0.000 abstract 1
- 210000004351 coronary vessel Anatomy 0.000 abstract 1
- 230000000916 dilatatory effect Effects 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 150000002081 enamines Chemical class 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 229910052731 fluorine Inorganic materials 0.000 abstract 1
- 125000001153 fluoro group Chemical group F* 0.000 abstract 1
- 125000003709 fluoroalkyl group Chemical group 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 230000002048 spasmolytic effect Effects 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2013431A DE2013431C3 (de) | 1970-03-20 | 1970-03-20 | 4-Azidophenyl-l,4-dihydropyridin-3,5-dicarbonsäureester |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE35233L IE35233L (en) | 1971-09-20 |
| IE35233B1 true IE35233B1 (en) | 1975-12-24 |
Family
ID=5765765
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE293/71A IE35233B1 (en) | 1970-03-20 | 1971-03-09 | 1,4-dihydropyridine derivatives |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3708489A (enFirst) |
| JP (1) | JPS5521032B1 (enFirst) |
| AT (1) | AT303040B (enFirst) |
| BE (1) | BE764556A (enFirst) |
| CH (1) | CH559179A5 (enFirst) |
| CS (2) | CS160139B2 (enFirst) |
| DE (1) | DE2013431C3 (enFirst) |
| FI (1) | FI54295C (enFirst) |
| FR (1) | FR2085727B1 (enFirst) |
| GB (1) | GB1305795A (enFirst) |
| IE (1) | IE35233B1 (enFirst) |
| IL (1) | IL36320A (enFirst) |
| NL (1) | NL169468C (enFirst) |
| NO (1) | NO131986C (enFirst) |
| SE (1) | SE364710B (enFirst) |
| ZA (1) | ZA711597B (enFirst) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2005116C3 (de) * | 1970-02-05 | 1980-02-14 | Bayer Ag, 5090 Leverkusen | Symmetrische 1,4-Dihydropyridin-3,5-dicarbonsäureester |
| US4021434A (en) * | 1972-01-22 | 1977-05-03 | Yamanouchi Pharmaceutical Co., Ltd. | Sodium β-[2,6-dimethyl-3,5-bis(ethoxycarbonyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-1-yl]ethyl sulfate |
| GB1430961A (en) * | 1972-01-22 | 1976-04-07 | Yamanouchi Pharma Co Ltd | 1-substituted-1,4-dihyddrypyridine derivatives |
| US3939171A (en) * | 1972-03-06 | 1976-02-17 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| DE2210672C3 (de) * | 1972-03-06 | 1980-03-20 | Bayer Ag, 5090 Leverkusen | N-substituierte unsymmetrische 1 ^-Dihydropyridin-S^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| US3917620A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
| US3957998A (en) * | 1972-03-06 | 1976-05-18 | Bayer Aktiengesellschaft | Use of 2,6-diamino-4-substituted-1,4-dihydropyridine-3,5-dicarboxylic acid esters for effecting coronary vessel dilation and treating hypertension |
| DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| DD106832A5 (enFirst) * | 1972-03-06 | 1974-07-05 | ||
| US3985886A (en) * | 1972-03-06 | 1976-10-12 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives and process for their preparation |
| US3857849A (en) * | 1973-02-28 | 1974-12-31 | Bayer Ag | 2-amino-1,4-dihydropyridine derivatives |
| US3992545A (en) * | 1972-03-06 | 1976-11-16 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives in pharmaceutical compositions |
| US3860601A (en) * | 1972-03-06 | 1975-01-14 | Horst Meyer | 2,6-diamino-1,4-dihydropyridine derivatives |
| US3996234A (en) * | 1972-04-18 | 1976-12-07 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
| US3974275A (en) * | 1972-04-18 | 1976-08-10 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters useful as coronary vessel dilators and anti-hypertensives |
| US4136187A (en) * | 1972-08-12 | 1979-01-23 | Bayer Aktiengesellschaft | Antihypertensive 2-amino-4,5-dihydropyridine derivatives |
| DE2239815C2 (de) * | 1972-08-12 | 1983-02-10 | Bayer Ag, 5090 Leverkusen | 2-Alkylamino-dihydropyridine, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel |
| DE2242787C2 (de) * | 1972-08-31 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | 4-Phenyl-6-amino-3,4-dihydropyridon-(2)-3,5-dicarbonsäure-diäthylesterderivate, ein Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| US4002762A (en) * | 1973-03-03 | 1977-01-11 | Bayer Aktiengesellschaft | 2-Amino-3,4-dihydropyridines used to effect coronary vessel dilation and treat hypertension |
| US4020178A (en) * | 1973-07-12 | 1977-04-26 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine esters used as coronary dilators and anti-hypertensives |
| NO883326L (no) * | 1987-08-11 | 1989-02-13 | Bayer Ag | Dhp-retard-tilberedning. |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
-
1970
- 1970-03-20 DE DE2013431A patent/DE2013431C3/de not_active Expired
-
1971
- 1971-03-02 IL IL36320A patent/IL36320A/en unknown
- 1971-03-09 IE IE293/71A patent/IE35233B1/xx unknown
- 1971-03-10 FI FI694/71A patent/FI54295C/fi active
- 1971-03-11 CS CS1794A patent/CS160139B2/cs unknown
- 1971-03-11 CS CS3638*A patent/CS160140B2/cs unknown
- 1971-03-11 ZA ZA711597A patent/ZA711597B/xx unknown
- 1971-03-12 SE SE03213/71A patent/SE364710B/xx unknown
- 1971-03-17 US US00125427A patent/US3708489A/en not_active Expired - Lifetime
- 1971-03-18 NO NO1058/71A patent/NO131986C/no unknown
- 1971-03-18 NL NLAANVRAGE7103672,A patent/NL169468C/xx not_active IP Right Cessation
- 1971-03-19 CH CH405371A patent/CH559179A5/xx not_active IP Right Cessation
- 1971-03-19 JP JP1545571A patent/JPS5521032B1/ja active Pending
- 1971-03-19 FR FR7109866A patent/FR2085727B1/fr not_active Expired
- 1971-03-19 AT AT239271A patent/AT303040B/de not_active IP Right Cessation
- 1971-03-19 BE BE764556A patent/BE764556A/xx not_active IP Right Cessation
- 1971-04-19 GB GB2454071*A patent/GB1305795A/en not_active Expired
-
1972
- 1972-06-02 US US00259289A patent/US3773956A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL36320A0 (en) | 1971-05-26 |
| FI54295B (fi) | 1978-07-31 |
| FR2085727B1 (enFirst) | 1974-09-27 |
| IL36320A (en) | 1974-10-22 |
| US3708489A (en) | 1973-01-02 |
| NO131986B (enFirst) | 1975-05-26 |
| ZA711597B (en) | 1972-06-28 |
| CH559179A5 (enFirst) | 1975-02-28 |
| CS160139B2 (enFirst) | 1975-02-28 |
| DE2013431A1 (de) | 1971-10-07 |
| GB1305795A (enFirst) | 1973-02-07 |
| JPS5521032B1 (enFirst) | 1980-06-06 |
| BE764556A (fr) | 1971-09-20 |
| IE35233L (en) | 1971-09-20 |
| NL169468C (nl) | 1982-07-16 |
| SE364710B (enFirst) | 1974-03-04 |
| US3773956A (en) | 1973-11-20 |
| CS160140B2 (enFirst) | 1975-02-28 |
| AT303040B (de) | 1972-11-10 |
| NL7103672A (enFirst) | 1971-09-22 |
| NO131986C (enFirst) | 1975-09-03 |
| SU365069A3 (enFirst) | 1972-12-28 |
| FR2085727A1 (enFirst) | 1971-12-31 |
| NL169468B (nl) | 1982-02-16 |
| FI54295C (fi) | 1978-11-10 |
| DE2013431C3 (de) | 1979-12-20 |
| DE2013431B2 (de) | 1979-04-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE35233B1 (en) | 1,4-dihydropyridine derivatives | |
| ATE25974T1 (de) | Acyl-substituierte derivate von 1,2,3,4tetrahydroisochinolin-3-carboxysaeuren, ihre salze, diese enthaltende arzneimittel und verfahren zu ihrer herstellung. | |
| CH396931A (de) | Verfahren zur Herstellung von basisch substituierten Diphenylalkan-Derivaten | |
| KR890006650A (ko) | 테트라하이드로-푸로 및 -티에노[2,3-c]피리딘, 약제학적 제제로서의 이의 용도 및 이의 제조방법 | |
| GB1326491A (en) | 1,4-dihydropyridine derivatives | |
| KR860009007A (ko) | 피페리딜리덴 디하이드로-디벤조[a,d]-사이클로헵텐의 제조방법 | |
| ATE146473T1 (de) | Pyrazolopyridinverbindungen und verfahren zu ihrer herstellung | |
| GB1305794A (enFirst) | ||
| GB1239679A (enFirst) | ||
| GB1291164A (en) | New sulphur-containing 1,4-dihydropyridine derivatives | |
| GB1373212A (en) | Pyrazole compounds | |
| GB1373548A (en) | Anti-hypertensive 6-substituted 3-hydrazino-pyridazines and their preparation | |
| CH647519A5 (de) | Bluthochdruck senkende amine. | |
| IE34314B1 (en) | Dibenzodioxocine derivatives | |
| GB1454312A (en) | 4-oxo-6,7,8,9-tetrahydropyrido-1,2-a-pyrimidine derivatives methods for their preparation and compositions containing them | |
| ATE50248T1 (de) | Ein imidazolidintrion-derivat oder ein seiner pharmazeutisch akzeptierbaren salze enthaltende pharmazeutische zusammenstellung. | |
| ES452986A1 (es) | Procedimiento para preparar ester isobutilico de acido 2,6- dimetil-3-metoxicarbonil-4-(2'-nitrofenil)-1, 4-dihidropiri-din-5-carboxilico). | |
| US3920823A (en) | Use of unsymmetrical esters of n-substituted 1,4-dihydropyridine 3,5-dicarboxylic acid as cardio-vascular agents | |
| KR870006059A (ko) | 6H-이속사졸로 [5,4-d]피라졸로 [3,4-b]피리딘 및 이의 제조방법 | |
| IE38141L (en) | 3, 4-dihydropyridones. | |
| GB1481032A (en) | Glutamyl amide derivatives of dopamine | |
| GB1317399A (en) | Pyridoindole derivatives | |
| GB1425729A (en) | 1,4-dihydropyridine compounds | |
| GB1358911A (en) | Tetrahydropyridylmethyl carboxylic acid esters | |
| GB1211387A (en) | 0-benzylpiperidine derivative and a process for the preparation thereof |