HU210550B - Contrast medium containing iodinated esters - Google Patents
Contrast medium containing iodinated esters Download PDFInfo
- Publication number
- HU210550B HU210550B HU884573A HU457388A HU210550B HU 210550 B HU210550 B HU 210550B HU 884573 A HU884573 A HU 884573A HU 457388 A HU457388 A HU 457388A HU 210550 B HU210550 B HU 210550B
- Authority
- HU
- Hungary
- Prior art keywords
- alkyl
- mmol
- hydroxy
- hours
- phenyl
- Prior art date
Links
- 150000002148 esters Chemical class 0.000 title claims abstract description 11
- 239000002872 contrast media Substances 0.000 title claims description 34
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 239000001257 hydrogen Substances 0.000 claims abstract description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 210000001124 body fluid Anatomy 0.000 claims abstract description 3
- 239000010839 body fluid Substances 0.000 claims abstract description 3
- 239000002245 particle Substances 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 25
- 210000004185 liver Anatomy 0.000 claims description 21
- 239000007924 injection Substances 0.000 claims description 12
- 238000002347 injection Methods 0.000 claims description 12
- 210000000952 spleen Anatomy 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 238000003384 imaging method Methods 0.000 claims description 6
- 239000007788 liquid Substances 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000001589 carboacyl group Chemical group 0.000 claims 3
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 claims 1
- -1 araliphatic Chemical group 0.000 abstract description 30
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 abstract description 16
- 229910052740 iodine Inorganic materials 0.000 abstract description 15
- 238000002604 ultrasonography Methods 0.000 abstract description 4
- 125000002947 alkylene group Chemical group 0.000 abstract description 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 2
- 125000001931 aliphatic group Chemical group 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 90
- 239000000243 solution Substances 0.000 description 37
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 33
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 26
- 239000000203 mixture Substances 0.000 description 24
- 238000003756 stirring Methods 0.000 description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 239000002904 solvent Substances 0.000 description 22
- 238000005160 1H NMR spectroscopy Methods 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 238000002360 preparation method Methods 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 239000000047 product Substances 0.000 description 19
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 18
- 239000011630 iodine Substances 0.000 description 14
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 14
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 14
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 14
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 13
- 235000019341 magnesium sulphate Nutrition 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000004128 high performance liquid chromatography Methods 0.000 description 12
- 239000000725 suspension Substances 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000002244 precipitate Substances 0.000 description 11
- 235000009518 sodium iodide Nutrition 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 239000002953 phosphate buffered saline Substances 0.000 description 9
- 239000008215 water for injection Substances 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000002502 liposome Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 7
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 7
- 239000008354 sodium chloride injection Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 125000002252 acyl group Chemical group 0.000 description 5
- GGGDNPWHMNJRFN-UHFFFAOYSA-N metrizoic acid Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I GGGDNPWHMNJRFN-UHFFFAOYSA-N 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 210000004027 cell Anatomy 0.000 description 4
- 238000005119 centrifugation Methods 0.000 description 4
- GGRHYQCXXYLUTL-UHFFFAOYSA-N chloromethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCl GGRHYQCXXYLUTL-UHFFFAOYSA-N 0.000 description 4
- 229940039231 contrast media Drugs 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 210000000056 organ Anatomy 0.000 description 4
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000006228 supernatant Substances 0.000 description 4
- 210000002700 urine Anatomy 0.000 description 4
- 125000006701 (C1-C7) alkyl group Chemical group 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 3
- 229910000024 caesium carbonate Inorganic materials 0.000 description 3
- KFYXXCWHKINEIC-UHFFFAOYSA-N chloromethyl 2-phenylacetate Chemical compound ClCOC(=O)CC1=CC=CC=C1 KFYXXCWHKINEIC-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 238000001493 electron microscopy Methods 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 239000002207 metabolite Substances 0.000 description 3
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 3
- 239000011859 microparticle Substances 0.000 description 3
- 210000000865 mononuclear phagocyte system Anatomy 0.000 description 3
- 239000011148 porous material Substances 0.000 description 3
- 238000000527 sonication Methods 0.000 description 3
- VVPUIKNICYCXJZ-UHFFFAOYSA-N 4-iodobutyl benzoate Chemical compound ICCCCOC(=O)C1=CC=CC=C1 VVPUIKNICYCXJZ-UHFFFAOYSA-N 0.000 description 2
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N 4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 208000005189 Embolism Diseases 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001595582 Octolasmis cor Species 0.000 description 2
- 206010057249 Phagocytosis Diseases 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 210000000941 bile Anatomy 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 210000004072 lung Anatomy 0.000 description 2
- 210000003712 lysosome Anatomy 0.000 description 2
- 230000001868 lysosomic effect Effects 0.000 description 2
- 238000013507 mapping Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 230000008782 phagocytosis Effects 0.000 description 2
- 229960003424 phenylacetic acid Drugs 0.000 description 2
- 239000003279 phenylacetic acid Substances 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- UHAPHVBLTJCBGN-UHFFFAOYSA-N (1-acetyloxy-2-phenylethyl) 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoate Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)OC(CC=2C=CC=CC=2)OC(C)=O)=C1I UHAPHVBLTJCBGN-UHFFFAOYSA-N 0.000 description 1
- IMUOZMIQMJSSCV-UHFFFAOYSA-N (1-chloro-2-phenylethyl) acetate Chemical compound CC(=O)OC(Cl)CC1=CC=CC=C1 IMUOZMIQMJSSCV-UHFFFAOYSA-N 0.000 description 1
- WCIYTGPZWSEVSY-UHFFFAOYSA-N (2-chloro-2-phenylethyl) acetate Chemical compound CC(=O)OCC(Cl)C1=CC=CC=C1 WCIYTGPZWSEVSY-UHFFFAOYSA-N 0.000 description 1
- FXOTYEWIWWJQIB-UHFFFAOYSA-N (2-phenylacetyl)oxymethyl 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoate Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)OCOC(=O)CC=2C=CC=CC=2)=C1I FXOTYEWIWWJQIB-UHFFFAOYSA-N 0.000 description 1
- TZFKXMWMGVHCAF-UHFFFAOYSA-N (4-methoxy-3-methylbenzoyl)oxymethyl 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoate Chemical compound C1=C(C)C(OC)=CC=C1C(=O)OCOC(=O)C1=C(I)C(NC(C)=O)=C(I)C(N(C)C(C)=O)=C1I TZFKXMWMGVHCAF-UHFFFAOYSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VQEZDLXEVJCRMO-UHFFFAOYSA-N 1-chloroethyl 2,2-dimethylpropanoate Chemical compound CC(Cl)OC(=O)C(C)(C)C VQEZDLXEVJCRMO-UHFFFAOYSA-N 0.000 description 1
- CGKKDGMMKSOGLM-UHFFFAOYSA-N 1-chloroethyl acetate Chemical compound CC(Cl)OC(C)=O CGKKDGMMKSOGLM-UHFFFAOYSA-N 0.000 description 1
- BRHMHYMADKMHJK-UHFFFAOYSA-N 1-chloroethylsulfanylbenzene Chemical compound CC(Cl)SC1=CC=CC=C1 BRHMHYMADKMHJK-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- AFUGJQSXTOVTHQ-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoate Chemical compound CNC(=O)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)OCOC(=O)C(C)(C)C)=C1I AFUGJQSXTOVTHQ-UHFFFAOYSA-N 0.000 description 1
- SIUTWYZMSNPSIO-UHFFFAOYSA-N 2-chloroethyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCCCl SIUTWYZMSNPSIO-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 206010016654 Fibrosis Diseases 0.000 description 1
- CRZQGDNQQAALAY-UHFFFAOYSA-N Me ester-Phenylacetic acid Natural products COC(=O)CC1=CC=CC=C1 CRZQGDNQQAALAY-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 208000010378 Pulmonary Embolism Diseases 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- KVZCFISKPGOZOA-UHFFFAOYSA-N acetyloxymethyl 3-acetamido-5-[acetyl(methyl)amino]-2,4,6-triiodobenzoate Chemical compound CC(=O)N(C)C1=C(I)C(NC(C)=O)=C(I)C(C(=O)OCOC(C)=O)=C1I KVZCFISKPGOZOA-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000006065 biodegradation reaction Methods 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical class [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 208000035269 cancer or benign tumor Diseases 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- GANOALGPACWCPJ-UHFFFAOYSA-N chloromethyl 4-methoxy-3-methylbenzoate Chemical compound COC1=CC=C(C(=O)OCCl)C=C1C GANOALGPACWCPJ-UHFFFAOYSA-N 0.000 description 1
- SMJYMSAPPGLBAR-UHFFFAOYSA-N chloromethyl acetate Chemical compound CC(=O)OCCl SMJYMSAPPGLBAR-UHFFFAOYSA-N 0.000 description 1
- MZXRBRZQONZAJP-UHFFFAOYSA-N chloromethyl thiophene-2-carboxylate Chemical compound ClCOC(=O)C1=CC=CS1 MZXRBRZQONZAJP-UHFFFAOYSA-N 0.000 description 1
- WCUSVVDFUIMPKY-UHFFFAOYSA-N chloromethylsulfinylbenzene Chemical compound ClCS(=O)C1=CC=CC=C1 WCUSVVDFUIMPKY-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- NZZFYRREKKOMAT-UHFFFAOYSA-N diiodomethane Chemical compound ICI NZZFYRREKKOMAT-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- HBWRDJPOMZHLRU-UHFFFAOYSA-N ethyl 3-[[6-(3-ethoxycarbonyl-2,4,6-triiodoanilino)-6-oxohexanoyl]amino]-2,4,6-triiodobenzoate Chemical compound CCOC(=O)C1=C(I)C=C(I)C(NC(=O)CCCCC(=O)NC=2C(=C(C(=O)OCC)C(I)=CC=2I)I)=C1I HBWRDJPOMZHLRU-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 230000004761 fibrosis Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002440 hepatic effect Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000012216 imaging agent Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002496 iodine Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000644 isotonic solution Substances 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 125000003473 lipid group Chemical group 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004660 morphological change Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 229950010765 pivalate Drugs 0.000 description 1
- IUGYQRQAERSCNH-UHFFFAOYSA-N pivalic acid Chemical compound CC(C)(C)C(O)=O IUGYQRQAERSCNH-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229950008882 polysorbate Drugs 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229940068968 polysorbate 80 Drugs 0.000 description 1
- 239000010491 poppyseed oil Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 238000012285 ultrasound imaging Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Hydrogenated Pyridines (AREA)
- Indole Compounds (AREA)
- Medicinal Preparation (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB878717625A GB8717625D0 (en) | 1987-07-24 | 1987-07-24 | Chemical compounds |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| HU884573D0 HU884573D0 (en) | 1990-09-28 |
| HUT53585A HUT53585A (en) | 1990-11-28 |
| HU210550B true HU210550B (en) | 1995-05-29 |
Family
ID=10621281
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU884573A HU210550B (en) | 1987-07-24 | 1988-07-22 | Contrast medium containing iodinated esters |
Country Status (17)
| Country | Link |
|---|---|
| EP (1) | EP0300828B1 (enExample) |
| JP (1) | JP2563555B2 (enExample) |
| AT (1) | ATE73763T1 (enExample) |
| AU (1) | AU609858B2 (enExample) |
| DE (1) | DE3869256D1 (enExample) |
| DK (1) | DK14490D0 (enExample) |
| ES (1) | ES2030170T3 (enExample) |
| FI (1) | FI94095C (enExample) |
| GB (1) | GB8717625D0 (enExample) |
| GR (1) | GR3004614T3 (enExample) |
| HU (1) | HU210550B (enExample) |
| IE (1) | IE61263B1 (enExample) |
| NO (1) | NO180747C (enExample) |
| NZ (1) | NZ225551A (enExample) |
| RU (1) | RU1829940C (enExample) |
| WO (1) | WO1989000988A1 (enExample) |
| ZA (1) | ZA885411B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4826689A (en) * | 1984-05-21 | 1989-05-02 | University Of Rochester | Method for making uniformly sized particles from water-insoluble organic compounds |
| US4863714A (en) * | 1987-02-05 | 1989-09-05 | Cook Imaging Corporation | Sterilization of compositions of limited stability |
| US5354549A (en) * | 1987-07-24 | 1994-10-11 | Nycomed Imaging As | Iodinated esters |
| US5580600A (en) * | 1991-06-14 | 1996-12-03 | Associated Food Technology Pty, Ltd. | Monounsaturated dairy products |
| US5330739A (en) * | 1992-12-04 | 1994-07-19 | Sterling Winthrop Inc. | Iodinated benzoyl acetals and ketals for x-ray imaging |
| WO2006106513A2 (en) | 2005-04-05 | 2006-10-12 | Bar-Ilan University | New core and core-shell nanoparticles containing iodine for x-ray imaging |
| DE102018212966A1 (de) * | 2018-08-02 | 2020-02-06 | Siemens Mobility GmbH | Verkleidungselement |
| CN119564969B (zh) * | 2025-01-24 | 2025-04-04 | 四川大学华西医院 | 一种荧光显影剂合成注射控制系统、注射泵及存储介质 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1459772A (en) * | 1973-06-28 | 1976-12-31 | Beecham Group Ltd | X-ray contrast agents |
| AU473168B2 (en) * | 1971-04-15 | 1973-10-18 | Nippon Steel Corporation | Magnetic conveyor |
| AT325762B (de) * | 1972-04-12 | 1975-11-10 | Beecham Group Ltd | Rontgenkontrastmittel |
| GB2157283B (en) * | 1984-03-30 | 1987-07-08 | Squibb & Sons Inc | Esters of 3,5-diacetylamino-2,4,6-triiodobenzoic acid as x-ray contrast agents |
| IL86450A (en) * | 1987-05-22 | 1994-05-30 | Bracco Int Bv | Process for making a history of 5-acylamino-2,4,6-triiodo and tribromo-benzoic acid, and some such new compounds |
-
1987
- 1987-07-24 GB GB878717625A patent/GB8717625D0/en active Pending
-
1988
- 1988-07-22 DE DE8888306792T patent/DE3869256D1/de not_active Expired - Lifetime
- 1988-07-22 AU AU20870/88A patent/AU609858B2/en not_active Ceased
- 1988-07-22 EP EP88306792A patent/EP0300828B1/en not_active Expired - Lifetime
- 1988-07-22 JP JP63506227A patent/JP2563555B2/ja not_active Expired - Fee Related
- 1988-07-22 ES ES198888306792T patent/ES2030170T3/es not_active Expired - Lifetime
- 1988-07-22 IE IE224788A patent/IE61263B1/en not_active IP Right Cessation
- 1988-07-22 WO PCT/GB1988/000604 patent/WO1989000988A1/en not_active Ceased
- 1988-07-22 AT AT88306792T patent/ATE73763T1/de not_active IP Right Cessation
- 1988-07-22 HU HU884573A patent/HU210550B/hu not_active IP Right Cessation
- 1988-07-25 ZA ZA885411A patent/ZA885411B/xx unknown
- 1988-07-25 NZ NZ225551A patent/NZ225551A/en unknown
-
1990
- 1990-01-18 DK DK014490A patent/DK14490D0/da not_active Application Discontinuation
- 1990-01-19 NO NO900269A patent/NO180747C/no unknown
- 1990-01-23 FI FI900347A patent/FI94095C/fi not_active IP Right Cessation
- 1990-01-23 RU SU904742976A patent/RU1829940C/ru active
-
1992
- 1992-05-18 GR GR920400938T patent/GR3004614T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AU609858B2 (en) | 1991-05-09 |
| JPH02504270A (ja) | 1990-12-06 |
| IE61263B1 (en) | 1994-10-19 |
| AU2087088A (en) | 1989-03-01 |
| NO180747C (no) | 1997-06-11 |
| DE3869256D1 (de) | 1992-04-23 |
| ATE73763T1 (de) | 1992-04-15 |
| GR3004614T3 (enExample) | 1993-04-28 |
| DK14490A (da) | 1990-01-18 |
| EP0300828A1 (en) | 1989-01-25 |
| NO900269D0 (no) | 1990-01-19 |
| GB8717625D0 (en) | 1987-09-03 |
| FI94095B (fi) | 1995-04-13 |
| RU1829940C (ru) | 1993-07-23 |
| DK14490D0 (da) | 1990-01-18 |
| HU884573D0 (en) | 1990-09-28 |
| JP2563555B2 (ja) | 1996-12-11 |
| IE882247L (en) | 1989-01-24 |
| FI900347A0 (fi) | 1990-01-23 |
| ZA885411B (en) | 1989-04-26 |
| ES2030170T3 (es) | 1992-10-16 |
| WO1989000988A1 (en) | 1989-02-09 |
| FI94095C (fi) | 1995-07-25 |
| EP0300828B1 (en) | 1992-03-18 |
| NZ225551A (en) | 1991-06-25 |
| HUT53585A (en) | 1990-11-28 |
| NO900269L (no) | 1990-01-19 |
| NO180747B (no) | 1997-03-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5354549A (en) | Iodinated esters | |
| US5416223A (en) | Iodinated esters | |
| FI71124C (fi) | Nya derivat av 2,4,6-trijodisoftalsyra foerfarande foer framstaellning av dessa samt roentgenkontrastmedel innehaollande desamma | |
| US4139605A (en) | Water-soluble, non-ionizing, radiopaque compounds and contrast compositions containing the same | |
| JPH06509065A (ja) | 造影剤におけるまたは造影剤に関する改良 | |
| CZ274893A3 (en) | Iodinated aroyloxy esters | |
| CS221814B2 (en) | Method of making the triamide of the acid of 2,4,6-triiodebenzen-1,3-5-tricarboxyle | |
| CZ235593A3 (en) | Iodinated aroyloxycarboxamides | |
| HU210550B (en) | Contrast medium containing iodinated esters | |
| US4957729A (en) | Polyiodinated triglyceride analogs as radiologic agents | |
| PT89004B (pt) | Processo para a preparacao de bis-(3,5-dicarbamoil-2,4,6-tri-iodo-anilidas) de acidos dicarboxilicos substituidos e de composicoes de contraste de raios x que as contem | |
| FR2505834A1 (fr) | Derives de la thiazolidine | |
| US4395391A (en) | Unsymmetrically substituted dicarboxylic-acid-bis-(2,4,6-triiodo-anilides), their preparation, and x-ray contrast media containing same | |
| US2995561A (en) | Certain nu-(3, 5-diiodo-4-pyridonealkanoyl)-aminoalkanoic acids | |
| US3910989A (en) | N-triiodobenzyl-carbamic acid derivatives | |
| US5660815A (en) | Water soluble fluorinated fatty acid sulfonate derivatives useful as magnetic resonance imaging agents | |
| US4044048A (en) | Radiopaque esters of tetra-iodoterephthalic acid | |
| JP2006069894A (ja) | トリヨードアリール基を有するカルボン酸エステル | |
| JP2006069895A (ja) | トリヨードアリール基を有するアルキルアルコールのエステル化合物 | |
| CS223899B2 (cs) | Způsob výroby monoamidových sloučenin kyseliny 2,4,6-trijodisoftalové C-substituované v poloze 5 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |