HU206116B - Process for producing 3h-1,2,3-triazolo(4,5-d)pyrimidine derivatives and pharmaceutical compositions comprising same - Google Patents
Process for producing 3h-1,2,3-triazolo(4,5-d)pyrimidine derivatives and pharmaceutical compositions comprising same Download PDFInfo
- Publication number
- HU206116B HU206116B HU881714A HU171488A HU206116B HU 206116 B HU206116 B HU 206116B HU 881714 A HU881714 A HU 881714A HU 171488 A HU171488 A HU 171488A HU 206116 B HU206116 B HU 206116B
- Authority
- HU
- Hungary
- Prior art keywords
- amino
- formula
- alkyl
- hydrogen
- preparation
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 65
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 14
- GIIGHSIIKVOWKZ-UHFFFAOYSA-N 2h-triazolo[4,5-d]pyrimidine Chemical class N1=CN=CC2=NNN=C21 GIIGHSIIKVOWKZ-UHFFFAOYSA-N 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 155
- 150000003839 salts Chemical class 0.000 claims abstract description 153
- 238000002360 preparation method Methods 0.000 claims abstract description 51
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 84
- -1 m- (trifluoromethyl) phenyl group Chemical group 0.000 claims description 73
- 239000001257 hydrogen Substances 0.000 claims description 66
- 229910052739 hydrogen Inorganic materials 0.000 claims description 66
- 125000000217 alkyl group Chemical group 0.000 claims description 43
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 35
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- 229910052757 nitrogen Inorganic materials 0.000 claims description 30
- 150000002431 hydrogen Chemical class 0.000 claims description 29
- 239000007858 starting material Substances 0.000 claims description 29
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 150000002367 halogens Chemical class 0.000 claims description 21
- 229910052736 halogen Inorganic materials 0.000 claims description 20
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 13
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 6
- 230000002829 reductive effect Effects 0.000 claims description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 5
- MXKACQOAVQQTSN-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-n-methyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC=NC=2N1CC1=CC=CC=C1F MXKACQOAVQQTSN-UHFFFAOYSA-N 0.000 claims description 4
- 230000002921 anti-spasmodic effect Effects 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 238000003797 solvolysis reaction Methods 0.000 claims description 3
- HEYBAHQWHAIYHS-UHFFFAOYSA-N 3-[(2,6-difluorophenyl)methyl]-n-methyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC=NC=2N1CC1=C(F)C=CC=C1F HEYBAHQWHAIYHS-UHFFFAOYSA-N 0.000 claims description 2
- JCZCSTWDTSXNFN-UHFFFAOYSA-N 3-[(2-chlorophenyl)methyl]-n-methyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC=NC=2N1CC1=CC=CC=C1Cl JCZCSTWDTSXNFN-UHFFFAOYSA-N 0.000 claims description 2
- MRYLCLRRINDHDY-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-5-n,5-n,7-n,7-n-tetramethyltriazolo[4,5-d]pyrimidine-5,7-diamine Chemical compound C12=NC(N(C)C)=NC(N(C)C)=C2N=NN1CC1=CC=CC=C1F MRYLCLRRINDHDY-UHFFFAOYSA-N 0.000 claims description 2
- KTLXGCHQSGMAOF-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(N)=NC=NC=2N1CC1=CC=CC=C1F KTLXGCHQSGMAOF-UHFFFAOYSA-N 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- 238000005984 hydrogenation reaction Methods 0.000 claims description 2
- UCVCQPIFVZIZTM-UHFFFAOYSA-N n-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]triazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC=NC=2N1CC1=CC=CC(C(F)(F)F)=C1 UCVCQPIFVZIZTM-UHFFFAOYSA-N 0.000 claims description 2
- ZNLMEVQHRBLKDV-UHFFFAOYSA-N 3-[(2-chlorophenyl)methyl]-n,n-dimethyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(N(C)C)=NC=NC=2N1CC1=CC=CC=C1Cl ZNLMEVQHRBLKDV-UHFFFAOYSA-N 0.000 claims 1
- SITZJQDCSBWHLF-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-5-methyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound C12=NC(C)=NC(N)=C2N=NN1CC1=CC=CC=C1F SITZJQDCSBWHLF-UHFFFAOYSA-N 0.000 claims 1
- RVMYQZWCVAGKGP-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-5-n,5-n,7-n-trimethyltriazolo[4,5-d]pyrimidine-5,7-diamine Chemical compound N1=NC=2C(NC)=NC(N(C)C)=NC=2N1CC1=CC=CC=C1F RVMYQZWCVAGKGP-UHFFFAOYSA-N 0.000 claims 1
- DDVVTNAUSKQFFZ-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-7-n-methyltriazolo[4,5-d]pyrimidine-5,7-diamine Chemical compound N1=NC=2C(NC)=NC(N)=NC=2N1CC1=CC=CC=C1F DDVVTNAUSKQFFZ-UHFFFAOYSA-N 0.000 claims 1
- RVUVZVMCEWYUBV-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-n,5-dimethyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC(C)=NC=2N1CC1=CC=CC=C1F RVUVZVMCEWYUBV-UHFFFAOYSA-N 0.000 claims 1
- DFHTZOUURREBKY-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-n,n-dimethyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(N(C)C)=NC=NC=2N1CC1=CC=CC=C1F DFHTZOUURREBKY-UHFFFAOYSA-N 0.000 claims 1
- AGADZKOAGXZZOB-UHFFFAOYSA-N 3-[(3-fluorophenyl)methyl]-n-methyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC=NC=2N1CC1=CC=CC(F)=C1 AGADZKOAGXZZOB-UHFFFAOYSA-N 0.000 claims 1
- SXBPYMTUBZLKPB-UHFFFAOYSA-N 3-[(4-fluorophenyl)methyl]-n-methyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC=NC=2N1CC1=CC=C(F)C=C1 SXBPYMTUBZLKPB-UHFFFAOYSA-N 0.000 claims 1
- 239000000812 cholinergic antagonist Substances 0.000 claims 1
- 239000012050 conventional carrier Substances 0.000 claims 1
- GMZMELGJFPFJLT-UHFFFAOYSA-N n,n-dimethyl-3-[[3-(trifluoromethyl)phenyl]methyl]triazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(N(C)C)=NC=NC=2N1CC1=CC=CC(C(F)(F)F)=C1 GMZMELGJFPFJLT-UHFFFAOYSA-N 0.000 claims 1
- CWJUTHVZGKLAPT-UHFFFAOYSA-N n-methyl-3-[(2-methylphenyl)methyl]triazolo[4,5-d]pyrimidin-7-amine Chemical compound N1=NC=2C(NC)=NC=NC=2N1CC1=CC=CC=C1C CWJUTHVZGKLAPT-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 abstract description 11
- 239000001961 anticonvulsive agent Substances 0.000 abstract description 5
- 229940125681 anticonvulsant agent Drugs 0.000 abstract description 3
- 206010015037 epilepsy Diseases 0.000 abstract description 2
- 238000004519 manufacturing process Methods 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- 150000003230 pyrimidines Chemical class 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 52
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 41
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- 238000006243 chemical reaction Methods 0.000 description 31
- 239000000243 solution Substances 0.000 description 28
- 239000000203 mixture Substances 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000002253 acid Substances 0.000 description 22
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 16
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- 229960000583 acetic acid Drugs 0.000 description 15
- 125000003277 amino group Chemical group 0.000 description 15
- 239000003795 chemical substances by application Substances 0.000 description 14
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 11
- 229910052801 chlorine Inorganic materials 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000003085 diluting agent Substances 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 125000004043 oxo group Chemical group O=* 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 7
- 229910052794 bromium Inorganic materials 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 230000002140 halogenating effect Effects 0.000 description 6
- 238000000967 suction filtration Methods 0.000 description 6
- 229920002261 Corn starch Polymers 0.000 description 5
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 239000008120 corn starch Substances 0.000 description 5
- 229940099112 cornstarch Drugs 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000011065 in-situ storage Methods 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 5
- 239000011574 phosphorus Substances 0.000 description 5
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- WUPYTHMGZVPZRN-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound FC1=CC=CC=C1CN1C(N=CNC2=O)=C2N=N1 WUPYTHMGZVPZRN-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 239000012433 hydrogen halide Substances 0.000 description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 description 4
- 239000003701 inert diluent Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 229910017604 nitric acid Inorganic materials 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- IXLDZYFEBIQOOJ-UHFFFAOYSA-N 3-[(2,6-difluorophenyl)methyl]-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound FC1=CC=CC(F)=C1CN1C(N=CNC2=O)=C2N=N1 IXLDZYFEBIQOOJ-UHFFFAOYSA-N 0.000 description 3
- ZRMUCGRZXKXFOK-UHFFFAOYSA-N 7-chloro-3-[(2-fluorophenyl)methyl]triazolo[4,5-d]pyrimidin-5-amine Chemical compound C12=NC(N)=NC(Cl)=C2N=NN1CC1=CC=CC=C1F ZRMUCGRZXKXFOK-UHFFFAOYSA-N 0.000 description 3
- LHTSUYPWOFSZSS-UHFFFAOYSA-N 7-chloro-3-[(2-fluorophenyl)methyl]triazolo[4,5-d]pyrimidine Chemical compound FC1=CC=CC=C1CN1C2=NC=NC(Cl)=C2N=N1 LHTSUYPWOFSZSS-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 206010010904 Convulsion Diseases 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical class ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 3
- 239000008116 calcium stearate Substances 0.000 description 3
- 235000013539 calcium stearate Nutrition 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229920001592 potato starch Polymers 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LRFWYBZWRQWZIM-UHFFFAOYSA-N (2-fluorophenyl)methanamine Chemical compound NCC1=CC=CC=C1F LRFWYBZWRQWZIM-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 2
- UATSLYMXRMRNOY-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-7-n,7-n-dimethyltriazolo[4,5-d]pyrimidine-5,7-diamine Chemical compound N1=NC=2C(N(C)C)=NC(N)=NC=2N1CC1=CC=CC=C1F UATSLYMXRMRNOY-UHFFFAOYSA-N 0.000 description 2
- LZKCOWGKSQPPBM-UHFFFAOYSA-N 3-[(3-fluorophenyl)methyl]-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound FC1=CC=CC(CN2C3=C(C(NC=N3)=O)N=N2)=C1 LZKCOWGKSQPPBM-UHFFFAOYSA-N 0.000 description 2
- TYCYCMPVUKTIEC-UHFFFAOYSA-N 3-[[3-(trifluoromethyl)phenyl]methyl]-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound FC(F)(F)C1=CC=CC(CN2C3=C(C(NC=N3)=O)N=N2)=C1 TYCYCMPVUKTIEC-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 2
- HIPGHSXYEAJQCC-UHFFFAOYSA-N 5-amino-1-[(2-fluorophenyl)methyl]triazole-4-carbonitrile Chemical compound NC1=C(C#N)N=NN1CC1=CC=CC=C1F HIPGHSXYEAJQCC-UHFFFAOYSA-N 0.000 description 2
- KMIYWNHMQLBIOU-UHFFFAOYSA-N 5-amino-1-[(2-fluorophenyl)methyl]triazole-4-carboxamide Chemical compound NC1=C(C(=O)N)N=NN1CC1=CC=CC=C1F KMIYWNHMQLBIOU-UHFFFAOYSA-N 0.000 description 2
- NIMDLEFEUALLQY-UHFFFAOYSA-N 5-chloro-3-[(2-fluorophenyl)methyl]-N,N-dimethyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound ClC=1N=C(C2=C(N=1)N(N=N2)CC1=C(C=CC=C1)F)N(C)C NIMDLEFEUALLQY-UHFFFAOYSA-N 0.000 description 2
- VAEBSZYEMMYBNR-UHFFFAOYSA-N 6-chloro-4-n-[(2-fluorophenyl)methyl]-2-n,2-n-dimethylpyrimidine-2,4,5-triamine Chemical compound CN(C)C1=NC(Cl)=C(N)C(NCC=2C(=CC=CC=2)F)=N1 VAEBSZYEMMYBNR-UHFFFAOYSA-N 0.000 description 2
- ZEYMZQHMXPZGOH-UHFFFAOYSA-N 6-chloro-4-n-[(2-fluorophenyl)methyl]pyrimidine-2,4,5-triamine Chemical compound NC1=NC(Cl)=C(N)C(NCC=2C(=CC=CC=2)F)=N1 ZEYMZQHMXPZGOH-UHFFFAOYSA-N 0.000 description 2
- ZLPXBTRINANCMF-UHFFFAOYSA-N 6-chloro-4-n-[(2-fluorophenyl)methyl]pyrimidine-2,4-diamine Chemical compound NC1=NC(Cl)=CC(NCC=2C(=CC=CC=2)F)=N1 ZLPXBTRINANCMF-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- CRCADXQATOUFCS-UHFFFAOYSA-N C1=CC=C(C(=C1)CN2C3=C(C(=NC(=N3)Cl)Cl)N=N2)F Chemical compound C1=CC=C(C(=C1)CN2C3=C(C(=NC(=N3)Cl)Cl)N=N2)F CRCADXQATOUFCS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 2
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229920001800 Shellac Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000003463 adsorbent Substances 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002081 enamines Chemical group 0.000 description 2
- 150000002085 enols Chemical class 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 2
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 2
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000004922 lacquer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000004208 shellac Substances 0.000 description 2
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 2
- 235000013874 shellac Nutrition 0.000 description 2
- 229940113147 shellac Drugs 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- BSSNZUFKXJJCBG-OWOJBTEDSA-N (e)-but-2-enediamide Chemical compound NC(=O)\C=C\C(N)=O BSSNZUFKXJJCBG-OWOJBTEDSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- SWVCWRVIISPNQX-UHFFFAOYSA-N 1-[(2-fluorophenyl)methyl]triazole-4-carboxamide Chemical compound N1=NC(C(=O)N)=CN1CC1=CC=CC=C1F SWVCWRVIISPNQX-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- ILWBVFMKMACOFE-UHFFFAOYSA-N 2,4,5,6-tetrahydrotriazolo[4,5-d]pyrimidin-7-one Chemical compound O=C1NCN=C2NNN=C12 ILWBVFMKMACOFE-UHFFFAOYSA-N 0.000 description 1
- KWPQTFXULUUCGD-UHFFFAOYSA-N 3,4,5,7,8,9,10,10a-octahydropyrido[1,2-a][1,4]diazepine Chemical compound C1CCN=CC2CCCCN21 KWPQTFXULUUCGD-UHFFFAOYSA-N 0.000 description 1
- TZTXJPKPLJTIKE-UHFFFAOYSA-N 3-[(2-chlorophenyl)methyl]-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound ClC1=CC=CC=C1CN1C(N=CNC2=O)=C2N=N1 TZTXJPKPLJTIKE-UHFFFAOYSA-N 0.000 description 1
- OCCXSRNTSCONEL-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-5-methyl-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound N1=NC=2C(=O)NC(C)=NC=2N1CC1=CC=CC=C1F OCCXSRNTSCONEL-UHFFFAOYSA-N 0.000 description 1
- WAFMFNYFOWJBGF-UHFFFAOYSA-N 3-[(2-fluorophenyl)methyl]-5-n,7-n,7-n-trimethyltriazolo[4,5-d]pyrimidine-5,7-diamine Chemical compound C12=NC(NC)=NC(N(C)C)=C2N=NN1CC1=CC=CC=C1F WAFMFNYFOWJBGF-UHFFFAOYSA-N 0.000 description 1
- FYCPZTOUSGBWDM-UHFFFAOYSA-N 3-[(2-methylphenyl)methyl]-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound CC1=CC=CC=C1CN1C(N=CNC2=O)=C2N=N1 FYCPZTOUSGBWDM-UHFFFAOYSA-N 0.000 description 1
- HHWFRKCUICCLDB-UHFFFAOYSA-N 3-[(4-chlorophenyl)methyl]-5-methyltriazolo[4,5-d]pyrimidin-7-amine Chemical compound C12=NC(C)=NC(N)=C2N=NN1CC1=CC=C(Cl)C=C1 HHWFRKCUICCLDB-UHFFFAOYSA-N 0.000 description 1
- IRLRTOZJIGIHCK-UHFFFAOYSA-N 3-[(4-fluorophenyl)methyl]-6H-triazolo[4,5-d]pyrimidin-7-one Chemical compound C1=CC(F)=CC=C1CN1C(N=CNC2=O)=C2N=N1 IRLRTOZJIGIHCK-UHFFFAOYSA-N 0.000 description 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 1
- 125000006495 3-trifluoromethyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C(=C1[H])C([H])([H])*)C(F)(F)F 0.000 description 1
- PWJNRLSPEYCEMV-UHFFFAOYSA-N 4,6-dichloro-n,n-dimethylpyrimidin-2-amine Chemical compound CN(C)C1=NC(Cl)=CC(Cl)=N1 PWJNRLSPEYCEMV-UHFFFAOYSA-N 0.000 description 1
- JPZOAVGMSDSWSW-UHFFFAOYSA-N 4,6-dichloropyrimidin-2-amine Chemical compound NC1=NC(Cl)=CC(Cl)=N1 JPZOAVGMSDSWSW-UHFFFAOYSA-N 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- HDSKJRZKLHXPNF-UHFFFAOYSA-M 4-chlorobenzenediazonium;chloride Chemical compound [Cl-].ClC1=CC=C([N+]#N)C=C1 HDSKJRZKLHXPNF-UHFFFAOYSA-M 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- FJXXPBSXLGDGQI-UHFFFAOYSA-N 5,6-bis(2-chloroethylsulfanyl)-1h-benzimidazole-4,7-dione Chemical compound O=C1C(SCCCl)=C(SCCCl)C(=O)C2=C1N=CN2 FJXXPBSXLGDGQI-UHFFFAOYSA-N 0.000 description 1
- KGBCPLVWNLIEOS-UHFFFAOYSA-N 5-amino-1-[(2,6-difluorophenyl)methyl]triazole-4-carboxamide Chemical compound NC1=C(C(=O)N)N=NN1CC1=C(F)C=CC=C1F KGBCPLVWNLIEOS-UHFFFAOYSA-N 0.000 description 1
- YNHMYRUNFIQMPN-UHFFFAOYSA-N 5-amino-1-[(2-chlorophenyl)methyl]triazole-4-carboxamide Chemical compound NC1=C(C(=O)N)N=NN1CC1=CC=CC=C1Cl YNHMYRUNFIQMPN-UHFFFAOYSA-N 0.000 description 1
- FNFHXJURHKFXDP-UHFFFAOYSA-N 5-amino-1-[(2-methylphenyl)methyl]triazole-4-carboxamide Chemical compound CC1=CC=CC=C1CN1C(N)=C(C(N)=O)N=N1 FNFHXJURHKFXDP-UHFFFAOYSA-N 0.000 description 1
- PPJSXEIGKDPRNI-UHFFFAOYSA-N 5-amino-1-[(3-fluorophenyl)methyl]triazole-4-carboxamide Chemical compound NC1=C(C(=O)N)N=NN1CC1=CC=CC(F)=C1 PPJSXEIGKDPRNI-UHFFFAOYSA-N 0.000 description 1
- ICLSTAOETIHPIN-UHFFFAOYSA-N 6-chloro-4-n-[(2-fluorophenyl)methyl]-2-n,2-n-dimethylpyrimidine-2,4-diamine Chemical compound CN(C)C1=NC(Cl)=CC(NCC=2C(=CC=CC=2)F)=N1 ICLSTAOETIHPIN-UHFFFAOYSA-N 0.000 description 1
- CGFDFLPWAYCEKP-UHFFFAOYSA-N 7-chloro-3-[(2,6-difluorophenyl)methyl]triazolo[4,5-d]pyrimidine Chemical compound FC1=CC=CC(F)=C1CN1C2=NC=NC(Cl)=C2N=N1 CGFDFLPWAYCEKP-UHFFFAOYSA-N 0.000 description 1
- GXPCQCOOQPZHKD-UHFFFAOYSA-N 7-chloro-3-[(2-fluorophenyl)methyl]-5-methyltriazolo[4,5-d]pyrimidine Chemical compound C12=NC(C)=NC(Cl)=C2N=NN1CC1=CC=CC=C1F GXPCQCOOQPZHKD-UHFFFAOYSA-N 0.000 description 1
- ZHSMHWYBXJKHED-UHFFFAOYSA-N 7-chloro-3-[(2-fluorophenyl)methyl]-n,n-dimethyltriazolo[4,5-d]pyrimidin-5-amine Chemical compound C12=NC(N(C)C)=NC(Cl)=C2N=NN1CC1=CC=CC=C1F ZHSMHWYBXJKHED-UHFFFAOYSA-N 0.000 description 1
- DHAOPSUUOSYSCE-UHFFFAOYSA-N 7-chloro-3-[(3-fluorophenyl)methyl]triazolo[4,5-d]pyrimidine Chemical compound FC1=CC=CC(CN2C3=NC=NC(Cl)=C3N=N2)=C1 DHAOPSUUOSYSCE-UHFFFAOYSA-N 0.000 description 1
- KVGVQTOQSNJTJI-UHFFFAOYSA-N 8-azaxanthine Chemical compound O=C1NC(=O)NC2=C1NN=N2 KVGVQTOQSNJTJI-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000151018 Maranta arundinacea Species 0.000 description 1
- 235000010804 Maranta arundinacea Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 235000012419 Thalia geniculata Nutrition 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000003556 anti-epileptic effect Effects 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 229940030999 antipsoriatics Drugs 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- ODYJZKDNEJGBSE-UHFFFAOYSA-N calcium;2-methylpropan-2-olate Chemical compound [Ca+2].CC(C)(C)[O-].CC(C)(C)[O-] ODYJZKDNEJGBSE-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001037 epileptic effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000004997 halocarbonyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Substances CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000002092 orthoester group Chemical group 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- IUBQJLUDMLPAGT-UHFFFAOYSA-N potassium bis(trimethylsilyl)amide Chemical compound C[Si](C)(C)N([K])[Si](C)(C)C IUBQJLUDMLPAGT-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- HCWPIIXVSYCSAN-UHFFFAOYSA-N radium atom Chemical compound [Ra] HCWPIIXVSYCSAN-UHFFFAOYSA-N 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH133387 | 1987-04-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT47577A HUT47577A (en) | 1989-03-28 |
| HU206116B true HU206116B (en) | 1992-08-28 |
Family
ID=4208018
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU881714A HU206116B (en) | 1987-04-07 | 1988-04-06 | Process for producing 3h-1,2,3-triazolo(4,5-d)pyrimidine derivatives and pharmaceutical compositions comprising same |
Country Status (19)
| Country | Link |
|---|---|
| EP (1) | EP0288431B1 (enExample) |
| JP (1) | JPS63258881A (enExample) |
| KR (1) | KR880012603A (enExample) |
| AT (1) | ATE79624T1 (enExample) |
| AU (1) | AU616880B2 (enExample) |
| DD (1) | DD281190A5 (enExample) |
| DE (1) | DE3873812D1 (enExample) |
| DK (1) | DK167681B1 (enExample) |
| ES (1) | ES2051886T3 (enExample) |
| FI (1) | FI89359C (enExample) |
| GR (1) | GR3006249T3 (enExample) |
| HU (1) | HU206116B (enExample) |
| IL (1) | IL85947A (enExample) |
| MX (1) | MX11012A (enExample) |
| NO (1) | NO167919C (enExample) |
| NZ (1) | NZ224154A (enExample) |
| PH (1) | PH26444A (enExample) |
| PT (1) | PT87160B (enExample) |
| ZA (1) | ZA882375B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5204353A (en) * | 1987-04-07 | 1993-04-20 | Ciba-Geigy Corporation | 3-benzyl-3H-1,2,3-triazolo[4,5-d]pyrimidines, compositions thereof, and method of treating epilepsy therewith |
| IT1222414B (it) * | 1987-07-31 | 1990-09-05 | Chiesi Farma Spa | Composizioni farmaceutiche contenenti trapidil,loro procedimento di preparazione e relaticvo impiego terapeutico |
| GB8909136D0 (en) * | 1989-04-21 | 1989-06-07 | Wellcome Found | Anticonvulsant pyridines and analogues thereof |
| US5166209A (en) * | 1989-04-21 | 1992-11-24 | Burroughs Wellcome Co. | Pharmacologically active compounds |
| US5498620A (en) * | 1989-05-19 | 1996-03-12 | The United States Of America As Represented By The Department Of Health And Human Services | Signal transduction inhibitor 1,2,3-triazolo compounds |
| US5359078A (en) * | 1989-05-19 | 1994-10-25 | The United States Of America As Represented By The Department Of Health And Human Services | Signal transduction inhibitor compounds |
| US5880129A (en) * | 1989-05-19 | 1999-03-09 | The United States Of America As Represented By The Department Of Health And Human Services | Methods of inhibiting invasion and metastasis of malignant solid tumors |
| US5240937A (en) * | 1990-04-20 | 1993-08-31 | Burroughs Wellcome Co. | Pharmaceutically active triazolopyridine compounds |
| MA26473A1 (fr) | 1997-03-01 | 2004-12-20 | Glaxo Group Ltd | Composes pharmacologiquement actifs. |
| DE19838705A1 (de) | 1998-08-26 | 2000-03-02 | Bayer Ag | Neue Dihydro-(1,2,3)-triazolo-[4,5-d]pyrimidin-7-one |
| CA2912048A1 (en) * | 2012-05-15 | 2013-11-21 | Calasia Pharmaceuticals, Inc. | Pyrimidine diamine derivatives as inhibitors of cytosolic hsp90 |
| CN116854644B (zh) * | 2023-07-06 | 2025-10-21 | 浙江大学 | 5-氨基-1-烷基-1h-1,2,3-三氮唑-4-甲酰胺类化合物及其制备和应用 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1338235A (en) * | 1970-12-15 | 1973-11-21 | May & Baker Ltd | Azapurinones |
| US4076711A (en) * | 1976-04-05 | 1978-02-28 | Schering Corporation | Triazolo [4,5-d]-pyrimidines |
-
1988
- 1988-03-30 ES ES88810212T patent/ES2051886T3/es not_active Expired - Lifetime
- 1988-03-30 AT AT88810212T patent/ATE79624T1/de not_active IP Right Cessation
- 1988-03-30 EP EP88810212A patent/EP0288431B1/de not_active Expired - Lifetime
- 1988-03-30 DE DE8888810212T patent/DE3873812D1/de not_active Expired - Lifetime
- 1988-03-31 IL IL85947A patent/IL85947A/xx not_active IP Right Cessation
- 1988-04-05 PT PT87160A patent/PT87160B/pt active IP Right Grant
- 1988-04-05 ZA ZA882375A patent/ZA882375B/xx unknown
- 1988-04-05 DD DD88314431A patent/DD281190A5/de not_active IP Right Cessation
- 1988-04-06 JP JP63083212A patent/JPS63258881A/ja active Pending
- 1988-04-06 HU HU881714A patent/HU206116B/hu not_active IP Right Cessation
- 1988-04-06 MX MX1101288A patent/MX11012A/es unknown
- 1988-04-06 DK DK184388A patent/DK167681B1/da active
- 1988-04-06 NO NO881466A patent/NO167919C/no unknown
- 1988-04-06 AU AU14302/88A patent/AU616880B2/en not_active Ceased
- 1988-04-06 NZ NZ224154A patent/NZ224154A/en unknown
- 1988-04-06 FI FI881582A patent/FI89359C/fi not_active IP Right Cessation
- 1988-04-07 KR KR1019880003862A patent/KR880012603A/ko not_active Ceased
-
1990
- 1990-04-27 PH PH36735A patent/PH26444A/en unknown
-
1992
- 1992-11-13 GR GR920401775T patent/GR3006249T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PT87160B (pt) | 1992-07-31 |
| NO167919B (no) | 1991-09-16 |
| DK184388A (da) | 1988-10-08 |
| IL85947A0 (en) | 1988-09-30 |
| EP0288431B1 (de) | 1992-08-19 |
| AU616880B2 (en) | 1991-11-14 |
| ZA882375B (en) | 1989-11-29 |
| HUT47577A (en) | 1989-03-28 |
| EP0288431A1 (de) | 1988-10-26 |
| FI89359B (fi) | 1993-06-15 |
| KR880012603A (ko) | 1988-11-28 |
| NO881466L (no) | 1988-10-10 |
| PT87160A (pt) | 1988-05-01 |
| PH26444A (en) | 1992-07-15 |
| ATE79624T1 (de) | 1992-09-15 |
| FI881582A0 (fi) | 1988-04-06 |
| MX11012A (es) | 1993-12-01 |
| NO167919C (no) | 1991-12-27 |
| DE3873812D1 (de) | 1992-09-24 |
| IL85947A (en) | 1993-06-10 |
| JPS63258881A (ja) | 1988-10-26 |
| FI881582A7 (fi) | 1988-10-08 |
| FI89359C (fi) | 1993-09-27 |
| ES2051886T3 (es) | 1994-07-01 |
| DK167681B1 (da) | 1993-12-06 |
| NZ224154A (en) | 1992-01-29 |
| NO881466D0 (no) | 1988-04-06 |
| DK184388D0 (da) | 1988-04-06 |
| DD281190A5 (de) | 1990-08-01 |
| GR3006249T3 (enExample) | 1993-06-21 |
| AU1430288A (en) | 1988-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU665366B2 (en) | Benzimidazolone derivatives as 5-HT1A and 5-HT2 antagonists | |
| US5834493A (en) | Indole derivatives as 5-HT1A and/or 5-HT2 ligands | |
| KR20180135086A (ko) | Cdk 억제제 | |
| US20030130278A1 (en) | Alkynylated fused ring pyrimidine compounds | |
| HU206116B (en) | Process for producing 3h-1,2,3-triazolo(4,5-d)pyrimidine derivatives and pharmaceutical compositions comprising same | |
| CA2664375A1 (en) | Pyrazolo [1, 5-a] pyrimidine derivatives and their therapeutic use | |
| CA1244028A (en) | Pyrimidine derivatives | |
| CA2197789A1 (en) | Cyclic urea derivatives, pharmaceutical compositions comprising these compounds and processes for their preparation | |
| US5204353A (en) | 3-benzyl-3H-1,2,3-triazolo[4,5-d]pyrimidines, compositions thereof, and method of treating epilepsy therewith | |
| JPH04234860A (ja) | チアジン(又はオキサジン)誘導体、その製法及びその合成中間体 | |
| JP2003507479A (ja) | Gaba受容体リガンドとしてのイミダゾ−トリアジン誘導体 | |
| CA1159056A (en) | Benzodiazepine compounds and their use as pharmaceuticals | |
| AU627181B2 (en) | Imidazoquinoxaline compounds and their preparation and use | |
| CA2304879A1 (en) | New tetracycles, process for their production and pharmaceutical preparations containing these compounds | |
| HU182662B (en) | Process for producing pyrimido-2-benzodiazepine derivatives | |
| US6395905B1 (en) | Tetrahydroindazole derivatives as ligands for GABA-A α 5 receptors | |
| US4053600A (en) | Tricyclic 1,2,4-triazolo-quinazolines | |
| US4608375A (en) | Quinazolinone derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| CA2362400A1 (en) | Triazolo-pyridazine derivatives as ligands for gaba receptors | |
| CN1014992B (zh) | 喹唑啉二酮和吡啶并嘧啶二酮的制备方法 | |
| CN100358875C (zh) | 含氟1h-1,2,3-三氮唑类化合物、制备方法及其用途 | |
| HU206090B (en) | Process for producing new 1-phenyl-1,4-dihydro-3-amino-4-oxopyridazine derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
| IL98428A (en) | 3-(1,2,4-oxadiazolyl) imidazo [1,5-a] quinazolineamine and quinoxalineamine compounds, their preparation and pharmaceutical compositions containing them | |
| CA1201124A (en) | Trifluoromethyl derivatives of 1'-halogenobenzyl- spiro [imidazolidine-4,3'-indoline]-2.2'-5 trione | |
| CN101155787B (zh) | (3,4-二氢-喹唑啉-2-基)-茚满-1-基-胺 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |