HU194165B - Process for preparing 1,3-oxyacyl-2-oxindole derivatives - Google Patents
Process for preparing 1,3-oxyacyl-2-oxindole derivatives Download PDFInfo
- Publication number
- HU194165B HU194165B HU853496A HU349685A HU194165B HU 194165 B HU194165 B HU 194165B HU 853496 A HU853496 A HU 853496A HU 349685 A HU349685 A HU 349685A HU 194165 B HU194165 B HU 194165B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- oxindole
- compounds
- hydrogen
- chloro
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 13
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000011737 fluorine Substances 0.000 claims abstract description 6
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 65
- -1 2-thienylmethyl Chemical group 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 11
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 10
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 150000008065 acid anhydrides Chemical class 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 238000005917 acylation reaction Methods 0.000 claims description 3
- 150000008064 anhydrides Chemical class 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 3
- 230000010933 acylation Effects 0.000 claims 2
- 150000001412 amines Chemical class 0.000 claims 1
- 210000004556 brain Anatomy 0.000 claims 1
- 238000010828 elution Methods 0.000 claims 1
- 239000004009 herbicide Substances 0.000 claims 1
- 150000008048 phenylpyrazoles Chemical class 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 239000000730 antalgic agent Substances 0.000 abstract description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 abstract 1
- 125000000392 cycloalkenyl group Chemical group 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 55
- 239000000243 solution Substances 0.000 description 43
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 30
- 239000007787 solid Substances 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 27
- 239000000203 mixture Substances 0.000 description 27
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 24
- 238000001914 filtration Methods 0.000 description 22
- 239000000047 product Substances 0.000 description 21
- 238000003756 stirring Methods 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 230000000202 analgesic effect Effects 0.000 description 11
- 125000001309 chloro group Chemical group Cl* 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 208000002193 Pain Diseases 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- 239000008194 pharmaceutical composition Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- HSYFISNDMZKGRS-UHFFFAOYSA-N 4-chloro-1h-indole-2,3-dione Chemical compound ClC1=CC=CC2=C1C(=O)C(=O)N2 HSYFISNDMZKGRS-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 4
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 4
- JARRYVQFBQVOBE-UHFFFAOYSA-N 6-bromo-1,3-dihydroindol-2-one Chemical compound BrC1=CC=C2CC(=O)NC2=C1 JARRYVQFBQVOBE-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 230000003187 abdominal effect Effects 0.000 description 4
- 230000003110 anti-inflammatory effect Effects 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 4
- 229910052753 mercury Inorganic materials 0.000 description 4
- 150000005623 oxindoles Chemical class 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- DJPAQYXQRCWKEH-UHFFFAOYSA-N 2-chloro-n-(3-chloro-4-fluorophenyl)acetamide Chemical compound FC1=CC=C(NC(=O)CCl)C=C1Cl DJPAQYXQRCWKEH-UHFFFAOYSA-N 0.000 description 3
- FTAPQMFBYKYMNM-UHFFFAOYSA-N 3-(pyridine-3-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)C1=CC=CN=C1 FTAPQMFBYKYMNM-UHFFFAOYSA-N 0.000 description 3
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 3
- XNSPDJAXCBZCRV-UHFFFAOYSA-N 4-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=CC2=C1CC(=O)N2 XNSPDJAXCBZCRV-UHFFFAOYSA-N 0.000 description 3
- RVXLBLSGEPQBIO-UHFFFAOYSA-N 6-chloro-1h-indole-2,3-dione Chemical compound ClC1=CC=C2C(=O)C(=O)NC2=C1 RVXLBLSGEPQBIO-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 206010003246 arthritis Diseases 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 239000000679 carrageenan Substances 0.000 description 3
- 229920001525 carrageenan Polymers 0.000 description 3
- 235000010418 carrageenan Nutrition 0.000 description 3
- 229940113118 carrageenan Drugs 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000002587 enol group Chemical group 0.000 description 3
- 208000027866 inflammatory disease Diseases 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 239000003981 vehicle Substances 0.000 description 3
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 3
- GYHWFPPEKVSHSR-UHFFFAOYSA-N 1-acetyl-3-(pyridine-3-carbonyl)-3h-indol-2-one Chemical compound C12=CC=CC=C2N(C(=O)C)C(=O)C1C(=O)C1=CC=CN=C1 GYHWFPPEKVSHSR-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- XWLIAACTIOFOOA-UHFFFAOYSA-N 3-(2-thiophen-2-ylacetyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)CC1=CC=CS1 XWLIAACTIOFOOA-UHFFFAOYSA-N 0.000 description 2
- WPXZFSQTAFULLU-UHFFFAOYSA-N 4-chloro-3-hydrazinylindol-2-one Chemical compound C1=CC(Cl)=C2C(=NN)C(=O)NC2=C1 WPXZFSQTAFULLU-UHFFFAOYSA-N 0.000 description 2
- WWJLCYHYLZZXBE-UHFFFAOYSA-N 5-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=C2NC(=O)CC2=C1 WWJLCYHYLZZXBE-UHFFFAOYSA-N 0.000 description 2
- FIWADZAJMKCAHJ-UHFFFAOYSA-N 5-fluoro-3-methyl-1,3-dihydroindole-2-thione Chemical compound C1=C(F)C=C2C(C)C(=S)NC2=C1 FIWADZAJMKCAHJ-UHFFFAOYSA-N 0.000 description 2
- CENVPIZOTHULGJ-UHFFFAOYSA-N 6-chloro-1,3-dihydroindol-2-one Chemical compound ClC1=CC=C2CC(=O)NC2=C1 CENVPIZOTHULGJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 208000017667 Chronic Disease Diseases 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- MDIAKIHKBBNYHF-UHFFFAOYSA-N Ethyl 2-(methylthio)acetate Chemical compound CCOC(=O)CSC MDIAKIHKBBNYHF-UHFFFAOYSA-N 0.000 description 2
- PAEYAKGINDQUCT-UHFFFAOYSA-N Ethyl 2-pyrrolecarboxylate Chemical compound CCOC(=O)C1=CC=CN1 PAEYAKGINDQUCT-UHFFFAOYSA-N 0.000 description 2
- XBLVHTDFJBKJLG-UHFFFAOYSA-N Ethyl nicotinate Chemical compound CCOC(=O)C1=CC=CN=C1 XBLVHTDFJBKJLG-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 102000003820 Lipoxygenases Human genes 0.000 description 2
- 108090000128 Lipoxygenases Proteins 0.000 description 2
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 2
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 208000005298 acute pain Diseases 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 2
- 229960002327 chloral hydrate Drugs 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000010908 decantation Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- NJAONFWUEGWOPG-UHFFFAOYSA-N dimethyl 2-(4-bromo-2-nitrophenyl)propanedioate Chemical compound COC(=O)C(C(=O)OC)C1=CC=C(Br)C=C1[N+]([O-])=O NJAONFWUEGWOPG-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- KHXUTOLCCFWPDH-UHFFFAOYSA-N methyl 2-(4-bromo-2-nitrophenyl)acetate Chemical compound COC(=O)CC1=CC=C(Br)C=C1[N+]([O-])=O KHXUTOLCCFWPDH-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 201000008482 osteoarthritis Diseases 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- IBRBMZRLVYKVRF-UHFFFAOYSA-N 1,2,4-trichloro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)C=C1Cl IBRBMZRLVYKVRF-UHFFFAOYSA-N 0.000 description 1
- WRGKKASJBOREMB-UHFFFAOYSA-N 1,4-dibromo-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(Br)=CC=C1Br WRGKKASJBOREMB-UHFFFAOYSA-N 0.000 description 1
- HDUMVABVMRJYJU-UHFFFAOYSA-N 1-acetyl-3-(2-phenylacetyl)-3h-indol-2-one Chemical compound C12=CC=CC=C2N(C(=O)C)C(=O)C1C(=O)CC1=CC=CC=C1 HDUMVABVMRJYJU-UHFFFAOYSA-N 0.000 description 1
- SVZJCWOSQMVMNB-UHFFFAOYSA-N 1-acetyl-3-(2-thiophen-2-ylacetyl)-3h-indol-2-one Chemical compound C12=CC=CC=C2N(C(=O)C)C(=O)C1C(=O)CC1=CC=CS1 SVZJCWOSQMVMNB-UHFFFAOYSA-N 0.000 description 1
- XBRIJXCKWJSVDJ-UHFFFAOYSA-N 1-acetyl-3-(furan-2-carbonyl)-3h-indol-2-one Chemical compound C12=CC=CC=C2N(C(=O)C)C(=O)C1C(=O)C1=CC=CO1 XBRIJXCKWJSVDJ-UHFFFAOYSA-N 0.000 description 1
- NRWLXCRLJQEJHE-UHFFFAOYSA-N 1-acetyl-3h-indol-2-one Chemical compound C1=CC=C2N(C(=O)C)C(=O)CC2=C1 NRWLXCRLJQEJHE-UHFFFAOYSA-N 0.000 description 1
- BGJIBXMUNLQWMZ-UHFFFAOYSA-N 1-acetyl-5-chloro-3h-indol-2-one Chemical compound ClC1=CC=C2N(C(=O)C)C(=O)CC2=C1 BGJIBXMUNLQWMZ-UHFFFAOYSA-N 0.000 description 1
- WWBQKHDTVLEKKZ-UHFFFAOYSA-N 1-acetyl-6-chloro-5-fluoro-3h-indol-2-one Chemical compound FC1=C(Cl)C=C2N(C(=O)C)C(=O)CC2=C1 WWBQKHDTVLEKKZ-UHFFFAOYSA-N 0.000 description 1
- SCRXASNUPJPFGP-UHFFFAOYSA-N 1-fluoro-3h-indol-2-one Chemical compound C1=CC=C2N(F)C(=O)CC2=C1 SCRXASNUPJPFGP-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical class C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- ZIANUHDZYNNUDC-UHFFFAOYSA-N 2-oxo-1,3-dihydroindole-3-carboxamide Chemical class C1=CC=C2C(C(=O)N)C(=O)NC2=C1 ZIANUHDZYNNUDC-UHFFFAOYSA-N 0.000 description 1
- XQZKYLPWWQYVOT-UHFFFAOYSA-N 2-oxo-1,3-dihydroindole-3-carboxylic acid Chemical class C1=CC=C2C(C(=O)O)C(=O)NC2=C1 XQZKYLPWWQYVOT-UHFFFAOYSA-N 0.000 description 1
- AXNUZKSSQHTNPZ-UHFFFAOYSA-N 3,4-difluoroaniline Chemical compound NC1=CC=C(F)C(F)=C1 AXNUZKSSQHTNPZ-UHFFFAOYSA-N 0.000 description 1
- WRKDCCMBSYWXRX-UHFFFAOYSA-N 3-(1h-pyrrole-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)C1=CC=CN1 WRKDCCMBSYWXRX-UHFFFAOYSA-N 0.000 description 1
- SGWARXIRNQTLND-UHFFFAOYSA-N 3-(2-phenoxyacetyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)COC1=CC=CC=C1 SGWARXIRNQTLND-UHFFFAOYSA-N 0.000 description 1
- GIJOSBZDOYLKLR-UHFFFAOYSA-N 3-(2-phenylacetyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)CC1=CC=CC=C1 GIJOSBZDOYLKLR-UHFFFAOYSA-N 0.000 description 1
- MVZPGVKQORMMNZ-UHFFFAOYSA-N 3-(furan-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)C1=CC=CO1 MVZPGVKQORMMNZ-UHFFFAOYSA-N 0.000 description 1
- PAOHOTMVBPLGIG-UHFFFAOYSA-N 3-(furan-2-carbonyl)-5-(trifluoromethyl)-1,3-dihydroindol-2-one Chemical compound C12=CC(C(F)(F)F)=CC=C2NC(=O)C1C(=O)C1=CC=CO1 PAOHOTMVBPLGIG-UHFFFAOYSA-N 0.000 description 1
- BZNRLFBUTXSYHJ-UHFFFAOYSA-N 3-(furan-3-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC=CC=C2C1C(=O)C=1C=COC=1 BZNRLFBUTXSYHJ-UHFFFAOYSA-N 0.000 description 1
- YSEMCVGMNUUNRK-UHFFFAOYSA-N 3-chloro-4-fluoroaniline Chemical compound NC1=CC=C(F)C(Cl)=C1 YSEMCVGMNUUNRK-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- PJTZNVWIFVMORN-UHFFFAOYSA-N 4-chloro-5-fluoro-1,3-dihydroindol-2-one Chemical compound FC1=CC=C2NC(=O)CC2=C1Cl PJTZNVWIFVMORN-UHFFFAOYSA-N 0.000 description 1
- KRZCOLNOCZKSDF-UHFFFAOYSA-N 4-fluoroaniline Chemical compound NC1=CC=C(F)C=C1 KRZCOLNOCZKSDF-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- ADDAYZCZQHOPJX-UHFFFAOYSA-N 5,6-dichloro-1,3-dihydroindol-2-one Chemical compound C1=C(Cl)C(Cl)=CC2=C1NC(=O)C2 ADDAYZCZQHOPJX-UHFFFAOYSA-N 0.000 description 1
- FQIJOGDQWRLSQW-UHFFFAOYSA-N 5,6-difluoro-1h-indole-2,3-dione Chemical compound C1=C(F)C(F)=CC2=C1C(=O)C(=O)N2 FQIJOGDQWRLSQW-UHFFFAOYSA-N 0.000 description 1
- RANTVMNWZIWPNR-UHFFFAOYSA-N 5-(trifluoromethyl)-1,3-dihydroindol-2-one Chemical compound FC(F)(F)C1=CC=C2NC(=O)CC2=C1 RANTVMNWZIWPNR-UHFFFAOYSA-N 0.000 description 1
- XHDJYQWGFIBCEP-UHFFFAOYSA-N 5-Chloro-1H-indole-2,3-dione Chemical compound ClC1=CC=C2NC(=O)C(=O)C2=C1 XHDJYQWGFIBCEP-UHFFFAOYSA-N 0.000 description 1
- VIMNAEVMZXIKFL-UHFFFAOYSA-N 5-bromo-1,3-dihydroindol-2-one Chemical compound BrC1=CC=C2NC(=O)CC2=C1 VIMNAEVMZXIKFL-UHFFFAOYSA-N 0.000 description 1
- WFTPNVXOYYDURQ-UHFFFAOYSA-N 5-chloro-3-(2-phenylacetyl)-1,3-dihydroindol-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)C1C(=O)CC1=CC=CC=C1 WFTPNVXOYYDURQ-UHFFFAOYSA-N 0.000 description 1
- WKGXYCVVQBRTBJ-UHFFFAOYSA-N 5-chloro-3-hydrazinylindol-2-one Chemical compound C1=C(Cl)C=C2C(=NN)C(=O)NC2=C1 WKGXYCVVQBRTBJ-UHFFFAOYSA-N 0.000 description 1
- JZBODFWDMQIWPR-UHFFFAOYSA-N 5-fluoro-3-(furan-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound C12=CC(F)=CC=C2NC(=O)C1C(=O)C1=CC=CO1 JZBODFWDMQIWPR-UHFFFAOYSA-N 0.000 description 1
- QDUXBJGXHPPFJG-UHFFFAOYSA-N 6-chloro-5-fluoro-1,3-dihydroindol-2-one Chemical compound C1=C(Cl)C(F)=CC2=C1NC(=O)C2 QDUXBJGXHPPFJG-UHFFFAOYSA-N 0.000 description 1
- WTLPTQGQDPDZTO-UHFFFAOYSA-N 6-fluoro-3-(furan-2-carbonyl)-1,3-dihydroindol-2-one Chemical compound O=C1NC2=CC(F)=CC=C2C1C(=O)C1=CC=CO1 WTLPTQGQDPDZTO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 208000000094 Chronic Pain Diseases 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- LOFDXZJSDVCYAS-UHFFFAOYSA-N Ethyl 3-furoate Chemical compound CCOC(=O)C=1C=COC=1 LOFDXZJSDVCYAS-UHFFFAOYSA-N 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229920005479 Lucite® Polymers 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 208000023178 Musculoskeletal disease Diseases 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 206010030124 Oedema peripheral Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 229940064982 ethylnicotinate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229960002163 hydrogen peroxide Drugs 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- LIRDJALZRPAZOR-UHFFFAOYSA-N indolin-3-one Chemical class C1=CC=C2C(=O)CNC2=C1 LIRDJALZRPAZOR-UHFFFAOYSA-N 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 208000014674 injury Diseases 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- QIQITDHWZYEEPA-UHFFFAOYSA-N thiophene-2-carbonyl chloride Chemical compound ClC(=O)C1=CC=CS1 QIQITDHWZYEEPA-UHFFFAOYSA-N 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US65237284A | 1984-09-19 | 1984-09-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT38906A HUT38906A (en) | 1986-07-28 |
| HU194165B true HU194165B (en) | 1988-01-28 |
Family
ID=24616591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU853496A HU194165B (en) | 1984-09-19 | 1985-09-17 | Process for preparing 1,3-oxyacyl-2-oxindole derivatives |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS6178765A (cs) |
| KR (1) | KR870000289B1 (cs) |
| ES (1) | ES8609244A1 (cs) |
| FI (1) | FI80270C (cs) |
| HU (1) | HU194165B (cs) |
| PL (1) | PL145950B1 (cs) |
| PT (1) | PT81140B (cs) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5047554A (en) * | 1989-04-18 | 1991-09-10 | Pfizer Inc. | 3-substituted-2-oxindole derivatives |
| DE19808261A1 (de) * | 1998-02-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| DK2569283T3 (en) * | 2010-05-10 | 2014-12-01 | Bayer Ip Gmbh | PROCEDURE FOR PREPARING SUBSTITUTED 1,3-DIHYDRO-2H-INDOL-2-ONES |
| HUE034106T2 (en) * | 2012-10-17 | 2018-01-29 | Univ Okayama | Compound, tautomer and geometric isomer thereof, compound, tautomer or salt of geometric isomer, process for preparing the compound, tautomer, isomer or salt, antimicrobial agent and anti-infectious drug |
-
1985
- 1985-08-16 FI FI853163A patent/FI80270C/fi not_active IP Right Cessation
- 1985-09-17 PT PT81140A patent/PT81140B/pt not_active IP Right Cessation
- 1985-09-17 PL PL1985255399A patent/PL145950B1/pl unknown
- 1985-09-17 ES ES547054A patent/ES8609244A1/es not_active Expired
- 1985-09-17 HU HU853496A patent/HU194165B/hu not_active IP Right Cessation
- 1985-09-18 KR KR1019850006813A patent/KR870000289B1/ko not_active Expired
- 1985-09-19 JP JP60207738A patent/JPS6178765A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| PT81140B (pt) | 1988-01-22 |
| PL145950B1 (en) | 1988-12-31 |
| FI80270B (fi) | 1990-01-31 |
| FI853163A0 (fi) | 1985-08-16 |
| ES8609244A1 (es) | 1986-07-16 |
| JPS6178765A (ja) | 1986-04-22 |
| KR860002505A (ko) | 1986-04-26 |
| FI80270C (fi) | 1990-05-10 |
| PT81140A (en) | 1985-10-01 |
| KR870000289B1 (ko) | 1987-02-25 |
| FI853163L (fi) | 1986-03-20 |
| ES547054A0 (es) | 1986-07-16 |
| PL255399A1 (en) | 1986-08-12 |
| JPH049781B2 (cs) | 1992-02-21 |
| HUT38906A (en) | 1986-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0175551B1 (en) | Analgesic and antiinflammatory 1,3-diacyl-2-oxindole compounds | |
| US4556672A (en) | 3-Substituted 2-oxindole-1-carboxamides as analgesic and anti-inflammatory agents | |
| EP0164860B1 (en) | N,3-disubstituted 2-oxindole-1-carboxamides as analgesic and antiinflammatory agents | |
| EP0208510B1 (en) | 1-substituted oxindole-3-carboxamines as antiinflammatory and analgesic agents | |
| US4721712A (en) | 1,3-disubstituted 2-oxindoles as analgesic and anti-inflammatory agents | |
| US4658037A (en) | Intermediates for 1,3-disubstituted 2-oxindoles as analgesic and antiinflammatory agents | |
| EP0153818B1 (en) | 1,3-disubstituted 2-oxindoles as analgesic and anti-inflammatory agents | |
| EP0155828B1 (en) | Process for making 2-oxindole-1-carboxamides and intermediates therefor | |
| HU194165B (en) | Process for preparing 1,3-oxyacyl-2-oxindole derivatives | |
| US4665194A (en) | Process for making 2-oxindole-1-carboxamides and intermediates therefor | |
| US4808601A (en) | Analgesic and antiinflammatory 1,3-diacyl-2-oxindole compounds | |
| US4752609A (en) | Analgesic and antiinflammatory 1,3-diacyl-2-oxindole compounds | |
| US4652658A (en) | Process for making 2-oxindole-1-carboxamides and intermediates therefor | |
| DD232039A5 (de) | Verfahren zur herstellung einer 2-oxinidol-1-carboxamid-verbindung | |
| US4730004A (en) | Analgesic and anti-inflammatory 1-acyl-2-oxindole-3-carboxamides | |
| US4791131A (en) | Analgesic and antiinflammatory 1-acyl-2-oxindole-3-carboxamides | |
| JPH0335315B2 (cs) | ||
| IE850288L (en) | Analgesic oxindoles. | |
| JPH0678337B2 (ja) | 抗炎症性1―ヘテロアリール―オキシインドール―3―カルボキサミド | |
| HU193942B (en) | Process for preparing 1,3-disubstituted 2-oxindole derivatives | |
| CS252847B2 (cs) | Způsob výroby N,3-disubstituovaných 2-oxindol-1-karboxamidů |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |