HU189627B - Process for producing /1,1'-biphenyl/-3-yl-methyl-derivatives - Google Patents
Process for producing /1,1'-biphenyl/-3-yl-methyl-derivatives Download PDFInfo
- Publication number
- HU189627B HU189627B HU824084A HU408482A HU189627B HU 189627 B HU189627 B HU 189627B HU 824084 A HU824084 A HU 824084A HU 408482 A HU408482 A HU 408482A HU 189627 B HU189627 B HU 189627B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- biphenyl
- group
- preparation
- optionally
- Prior art date
Links
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 title claims description 26
- 235000010290 biphenyl Nutrition 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 35
- -1 [1,1-biphenyl]-3-ylmethyl compounds Chemical class 0.000 claims abstract description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 22
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 21
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 14
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000001246 bromo group Chemical group Br* 0.000 claims description 7
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 claims description 6
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 claims description 6
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 claims description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 4
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 4
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 4
- WVKFJUYXMBJNKD-UHFFFAOYSA-N (3-iodo-2-methylphenyl)methanol Chemical compound CC1=C(I)C=CC=C1CO WVKFJUYXMBJNKD-UHFFFAOYSA-N 0.000 claims description 3
- BGTLHJPGBIVQLJ-UHFFFAOYSA-N (2-methyl-3-phenylphenyl)methanol Chemical compound CC1=C(CO)C=CC=C1C1=CC=CC=C1 BGTLHJPGBIVQLJ-UHFFFAOYSA-N 0.000 claims description 2
- NLGMXVVDTYXMDM-UHFFFAOYSA-N (3-phenylphenyl)methyl acetate Chemical group CC(=O)OCC1=CC=CC(C=2C=CC=CC=2)=C1 NLGMXVVDTYXMDM-UHFFFAOYSA-N 0.000 claims description 2
- WEAUVDQUPGJTSZ-UHFFFAOYSA-N 2-(bromomethyl)-1,3-difluoro-4-phenylbenzene Chemical compound FC1=C(CBr)C(F)=CC=C1C1=CC=CC=C1 WEAUVDQUPGJTSZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229940102396 methyl bromide Drugs 0.000 claims description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N methyl bromide Substances BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- XNAKKTLRTNNKAS-UHFFFAOYSA-N 1,3,5-trifluoro-2-phenylbenzene Chemical compound FC1=CC(F)=CC(F)=C1C1=CC=CC=C1 XNAKKTLRTNNKAS-UHFFFAOYSA-N 0.000 claims 1
- JSYQTZNGDSJIFO-UHFFFAOYSA-N 2,4,6-trifluoro-3-phenylbenzoic acid Chemical compound C1(=CC=CC=C1)C=1C(=C(C(=O)O)C(=CC=1F)F)F JSYQTZNGDSJIFO-UHFFFAOYSA-N 0.000 claims 1
- WEJZHZJJXPXXMU-UHFFFAOYSA-N 2,4-dichloro-1-phenylbenzene Chemical compound ClC1=CC(Cl)=CC=C1C1=CC=CC=C1 WEJZHZJJXPXXMU-UHFFFAOYSA-N 0.000 claims 1
- QGCCNWSXJHGUNL-UHFFFAOYSA-N 3-iodo-benzyl alcohol Chemical group OCC1=CC=CC(I)=C1 QGCCNWSXJHGUNL-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 abstract description 6
- 229910052731 fluorine Inorganic materials 0.000 abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 abstract description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract description 3
- 239000002917 insecticide Substances 0.000 abstract description 2
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000012044 organic layer Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 229910052786 argon Inorganic materials 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 5
- 239000002728 pyrethroid Substances 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 4
- 229940070846 pyrethrins Drugs 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- SKDWLRPVWTVSKZ-UHFFFAOYSA-N 1,2,3,5-tetrafluoro-4-phenylbenzene Chemical compound FC1=C(F)C(F)=CC(F)=C1C1=CC=CC=C1 SKDWLRPVWTVSKZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- IBWKCPDCFMRCQJ-UHFFFAOYSA-N (2,6-dimethyl-3-nitrophenyl)methanol Chemical compound CC1=CC=C([N+]([O-])=O)C(C)=C1CO IBWKCPDCFMRCQJ-UHFFFAOYSA-N 0.000 description 2
- RCXSATVYZMEQIR-UHFFFAOYSA-N (2,6-dimethyl-3-phenylphenyl)methanol Chemical compound CC1=C(CO)C(C)=CC=C1C1=CC=CC=C1 RCXSATVYZMEQIR-UHFFFAOYSA-N 0.000 description 2
- VODBTCPLHMEMAS-UHFFFAOYSA-N (3-amino-2-methylphenyl)methanol;hydrochloride Chemical group Cl.CC1=C(N)C=CC=C1CO VODBTCPLHMEMAS-UHFFFAOYSA-N 0.000 description 2
- NPDIDUXTRAITDE-UHFFFAOYSA-N 1-methyl-3-phenylbenzene Chemical group CC1=CC=CC(C=2C=CC=CC=2)=C1 NPDIDUXTRAITDE-UHFFFAOYSA-N 0.000 description 2
- GOGALNMBJIGJNW-UHFFFAOYSA-N 2,6-dimethyl-3-nitrobenzoic acid Chemical compound CC1=CC=C([N+]([O-])=O)C(C)=C1C(O)=O GOGALNMBJIGJNW-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical class CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- FFXJWZTZUIIASV-UHFFFAOYSA-N (2,3,4,6-tetrafluoro-5-phenylphenyl)methanol Chemical compound OCC1=C(F)C(F)=C(F)C(C=2C=CC=CC=2)=C1F FFXJWZTZUIIASV-UHFFFAOYSA-N 0.000 description 1
- JWPXIGDSYFYWGA-UHFFFAOYSA-N (2,4,6-trifluoro-3-phenylphenyl)methanol Chemical compound OCC1=C(F)C=C(F)C(C=2C=CC=CC=2)=C1F JWPXIGDSYFYWGA-UHFFFAOYSA-N 0.000 description 1
- MFPNOMOEXONQIP-UHFFFAOYSA-N (2,6-dimethyl-3-nitrophenyl)methyl acetate Chemical compound CC(=O)OCC1=C(C)C=CC([N+]([O-])=O)=C1C MFPNOMOEXONQIP-UHFFFAOYSA-N 0.000 description 1
- QJANIQCEDPJNLO-UHFFFAOYSA-N (2-methyl-3-nitrophenyl)methanol Chemical compound CC1=C(CO)C=CC=C1[N+]([O-])=O QJANIQCEDPJNLO-UHFFFAOYSA-N 0.000 description 1
- CYTRJTGMWNBWJV-UHFFFAOYSA-N (3-amino-2,6-dimethylphenyl)methyl acetate Chemical compound CC(=O)OCC1=C(C)C=CC(N)=C1C CYTRJTGMWNBWJV-UHFFFAOYSA-N 0.000 description 1
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical class CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 1
- VZYNKQSBVWJUSJ-UHFFFAOYSA-N 2,3,4,6-tetrafluoro-5-phenylbenzoic acid Chemical compound OC(=O)C1=C(F)C(F)=C(F)C(C=2C=CC=CC=2)=C1F VZYNKQSBVWJUSJ-UHFFFAOYSA-N 0.000 description 1
- FNPGJPKNKADBGK-UHFFFAOYSA-N 2,4-dimethyl-1-phenylbenzene Chemical group CC1=CC(C)=CC=C1C1=CC=CC=C1 FNPGJPKNKADBGK-UHFFFAOYSA-N 0.000 description 1
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical compound CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 1
- JUEZYTFQWZACEL-UHFFFAOYSA-N 2-nitrosoacetamide Chemical compound NC(=O)CN=O JUEZYTFQWZACEL-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- XTNRHLDLGNQMCW-UHFFFAOYSA-N acetic acid;1,1'-biphenyl Chemical compound CC(O)=O.C1=CC=CC=C1C1=CC=CC=C1 XTNRHLDLGNQMCW-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- KWHDXJHBFYQOTK-UHFFFAOYSA-N heptane;toluene Chemical compound CCCCCCC.CC1=CC=CC=C1 KWHDXJHBFYQOTK-UHFFFAOYSA-N 0.000 description 1
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 1
- 239000012414 tert-butyl nitrite Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/966,405 US4214004A (en) | 1978-12-04 | 1978-12-04 | Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189627B true HU189627B (en) | 1986-07-28 |
Family
ID=25511348
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU824084A HU189627B (en) | 1978-12-04 | 1979-11-30 | Process for producing /1,1'-biphenyl/-3-yl-methyl-derivatives |
| HU79FE1060A HU182486B (en) | 1978-12-04 | 1979-11-30 | Insecticide and acaricide compositions and process for producing bracket-1,1-biphenyl-bracket closed-3-yl-methyl-3-bracket-2,2-dihalogen-ethenyl-bracket closed-2,2-dimethyl-cyclopropane-carboxylates as active agents |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79FE1060A HU182486B (en) | 1978-12-04 | 1979-11-30 | Insecticide and acaricide compositions and process for producing bracket-1,1-biphenyl-bracket closed-3-yl-methyl-3-bracket-2,2-dihalogen-ethenyl-bracket closed-2,2-dimethyl-cyclopropane-carboxylates as active agents |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4214004A (cg-RX-API-DMAC10.html) |
| EP (2) | EP0063374B1 (cg-RX-API-DMAC10.html) |
| JP (2) | JPS6128653B2 (cg-RX-API-DMAC10.html) |
| AR (1) | AR228245A1 (cg-RX-API-DMAC10.html) |
| AU (1) | AU526973B2 (cg-RX-API-DMAC10.html) |
| BR (1) | BR7908936A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1140574A (cg-RX-API-DMAC10.html) |
| DD (2) | DD147665A5 (cg-RX-API-DMAC10.html) |
| DK (1) | DK161141C (cg-RX-API-DMAC10.html) |
| EG (1) | EG13820A (cg-RX-API-DMAC10.html) |
| ES (1) | ES486547A1 (cg-RX-API-DMAC10.html) |
| GR (1) | GR74124B (cg-RX-API-DMAC10.html) |
| GT (1) | GT197960870A (cg-RX-API-DMAC10.html) |
| HU (2) | HU189627B (cg-RX-API-DMAC10.html) |
| IE (1) | IE49208B1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL58744A (cg-RX-API-DMAC10.html) |
| MX (2) | MX5998E (cg-RX-API-DMAC10.html) |
| TR (1) | TR20753A (cg-RX-API-DMAC10.html) |
| WO (1) | WO1980001163A1 (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA796583B (cg-RX-API-DMAC10.html) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2819788A1 (de) * | 1978-05-05 | 1979-11-08 | Bayer Ag | Benzylester mit fluorsubstituierten aether- und/oder thioaethergruppen und ihre verwendung als insektizide |
| US4329518A (en) * | 1979-09-18 | 1982-05-11 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4668792A (en) * | 1978-12-04 | 1987-05-26 | Fmc Corporation | Intermediates to insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4341796A (en) * | 1979-06-25 | 1982-07-27 | Fmc Corporation | Control of acarids with biphenylmethyl perhaloalkylvinylcyclopropanecarboxylates |
| US4402973A (en) * | 1980-10-02 | 1983-09-06 | Fmc Corporation | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters |
| US4473709A (en) * | 1980-07-14 | 1984-09-25 | Fmc Corporation | Pyrethroid intermediates and process |
| US4426524A (en) | 1980-09-02 | 1984-01-17 | Fmc Corporation | Heterocyclic substituted benzyl alcohol, insecticidal ester derivatives, and intermediates |
| US4339457A (en) * | 1980-10-20 | 1982-07-13 | Fmc Corporation | 3-(Pyrrol-1-yl)phenylmethyl esters and intermediates |
| US4507317A (en) * | 1981-04-30 | 1985-03-26 | Fmc Corporation | Acaricidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4451484A (en) * | 1981-04-30 | 1984-05-29 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4433182A (en) * | 1981-04-30 | 1984-02-21 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4536591A (en) * | 1981-05-21 | 1985-08-20 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4423234A (en) * | 1982-05-17 | 1983-12-27 | Fmc Corporation | Copper-catalyzed biaromatic coupling process |
| US4493844A (en) * | 1982-08-19 | 1985-01-15 | Fmc Corporation | Insecticidal 2,2'-bridged(1,1'-biphenyl)-3-ylmethyl carboxamides |
| USH49H (en) | 1983-01-10 | 1986-04-01 | Fmc Corporation | Process for producing 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylates |
| US4552892A (en) * | 1983-03-11 | 1985-11-12 | Fmc Corporation | Acaricidal difluoroethenylcyclopropanecarboxylates |
| US4465879A (en) * | 1983-08-19 | 1984-08-14 | Fmc Corporation | Process to insecticide intermediate |
| WO1985001045A1 (en) * | 1983-08-19 | 1985-03-14 | Fmc Corporation | Catalyzed grignard coupling process |
| US4818273A (en) * | 1983-11-14 | 1989-04-04 | The Dow Chemical Company | Substituted 1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamides, compositions containing them, and their utility as herbicides |
| DE3343092A1 (de) * | 1983-11-29 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Wasserloesliche pestizide formulierung |
| US4740637A (en) * | 1984-07-26 | 1988-04-26 | Fmc Corporation | Process for hydroxymethylation |
| CA1284665C (en) * | 1984-07-26 | 1991-06-04 | Eric George Delmar | Process for hydroxymethylation |
| US6276050B1 (en) | 1998-07-20 | 2001-08-21 | Emhart Inc. | Riveting system and process for forming a riveted joint |
| WO2012150221A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue halogenierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
| CN104560053B (zh) * | 2014-12-24 | 2016-09-14 | 北京八亿时空液晶科技股份有限公司 | 含有1,3-二氟-2-甲基苯结构的液晶化合物及其制备方法 |
| CN114560772B (zh) * | 2022-02-14 | 2023-07-28 | 南昌大学 | 一种3-甲基-2-硝基苯甲酸的合成方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3156715A (en) * | 1962-09-18 | 1964-11-10 | Robert N Haszeldine | Polyfluorinated organo-mercury compounds and their preparation |
| US4053639A (en) * | 1964-01-24 | 1977-10-11 | The Boots Company Limited | Therapeutically active phenylalkane derivatives |
| GB1140748A (en) * | 1966-06-23 | 1969-01-22 | Ici Ltd | New carboxylic acid derivatives |
| CS167886B2 (cg-RX-API-DMAC10.html) * | 1968-06-06 | 1976-05-28 | ||
| BE794926A (fr) | 1971-04-23 | 1973-08-02 | Shell Int Research | Compositions biologiquement actives |
| US4024163A (en) * | 1972-05-25 | 1977-05-17 | National Research Development Corporation | Insecticides |
| US3987197A (en) * | 1972-08-17 | 1976-10-19 | Boehringer Ingelheim Gmbh | 3-(2'-fluoro-4-biphenylyl)-butyric acid and salts thereof |
| JPS5238030B2 (cg-RX-API-DMAC10.html) * | 1973-02-06 | 1977-09-27 | ||
| DE2528958A1 (de) * | 1975-06-28 | 1977-01-13 | Merck Patent Gmbh | Araliphatische dihalogenverbindungen und verfahren zu ihrer herstellung |
| US4130657A (en) * | 1977-10-20 | 1978-12-19 | Fmc Corporation | [1,1'-Biphenyl]-3-ylmethyl 3-(2,2-dihaloethenyl)-2,2-dimethylcyclopropanecarboxylates |
-
1978
- 1978-12-04 US US05/966,405 patent/US4214004A/en not_active Expired - Lifetime
-
1979
- 1979-11-08 CA CA000339499A patent/CA1140574A/en not_active Expired
- 1979-11-09 WO PCT/US1979/000971 patent/WO1980001163A1/en not_active Ceased
- 1979-11-09 JP JP55500106A patent/JPS6128653B2/ja not_active Expired
- 1979-11-09 EP EP82103273A patent/EP0063374B1/en not_active Expired
- 1979-11-09 BR BRPI7908936-4A patent/BR7908936A/pt not_active IP Right Cessation
- 1979-11-09 EP EP80900040A patent/EP0020685B1/en not_active Expired
- 1979-11-15 IE IE2188/79A patent/IE49208B1/en not_active IP Right Cessation
- 1979-11-19 IL IL58744A patent/IL58744A/xx not_active IP Right Cessation
- 1979-11-27 GR GR60609A patent/GR74124B/el unknown
- 1979-11-28 MX MX798508U patent/MX5998E/es unknown
- 1979-11-30 HU HU824084A patent/HU189627B/hu not_active IP Right Cessation
- 1979-11-30 AU AU53347/79A patent/AU526973B2/en not_active Ceased
- 1979-11-30 HU HU79FE1060A patent/HU182486B/hu not_active IP Right Cessation
- 1979-12-03 AR AR279128A patent/AR228245A1/es active
- 1979-12-03 EG EG718/79A patent/EG13820A/xx active
- 1979-12-03 ES ES486547A patent/ES486547A1/es not_active Expired
- 1979-12-03 GT GT197960870A patent/GT197960870A/es unknown
- 1979-12-03 TR TR20753A patent/TR20753A/xx unknown
- 1979-12-04 DD DD79217352A patent/DD147665A5/de unknown
- 1979-12-04 DD DD79220174A patent/DD157332A5/de unknown
- 1979-12-04 ZA ZA796583A patent/ZA796583B/xx unknown
-
1980
- 1980-08-01 DK DK332980A patent/DK161141C/da not_active IP Right Cessation
-
1984
- 1984-03-23 MX MX834184A patent/MX8341A/es unknown
- 1984-09-11 JP JP59188982A patent/JPS6094927A/ja active Granted
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU189627B (en) | Process for producing /1,1'-biphenyl/-3-yl-methyl-derivatives | |
| EP0032121B1 (en) | Substituted tetrafluorobenzyl alcohols and halides | |
| EP0061800B1 (en) | Anti srs-a carboxylic acid derivatives, processes for their production and pharmaceutical formulations containing them | |
| US4371711A (en) | Process for producing 4-hydroxycyclopentenones | |
| JPH0127053B2 (cg-RX-API-DMAC10.html) | ||
| JPH0699354B2 (ja) | ベンジルアルコールの新誘導体 | |
| JPH0341039A (ja) | 新規化合物 | |
| DE3881817T2 (de) | 3,5-Dihydroxy-6,8-nonadiensäuren und -derivate als hypocholesterolemische Mittel. | |
| HU183706B (en) | Insecticide compositions and process for producing 3-bracket-pyrrol-1-yl-bracket closed-phenyl-methyl-esters as active agents | |
| MELTZER et al. | Thyroxine Analogs | |
| US4929772A (en) | Process for preparing polyhalogenated carbinols | |
| JP2787602B2 (ja) | イソキサゾリン誘導体 | |
| US4663474A (en) | Synthetic intermediates for a chiral 3-(substituted-phenyl)-4-(3-hydroxypropyl) cyclohexanol | |
| GB2081714A (en) | Cyclohexylcarboxylic acid derivatives | |
| US4154743A (en) | 3-Oxobenzofuranyl-2-idenyl, haloacetic acids | |
| US5068390A (en) | 1,1,1-trifluoro-2-propene compounds | |
| US4243682A (en) | Fluoronaphthylones | |
| US4102896A (en) | Preparation of a 5-(2,2-dihalovinyl)-4,4-dimethyl-2-oxotetrahydrofuran | |
| JPS6354699B2 (cg-RX-API-DMAC10.html) | ||
| US4232039A (en) | Phenyl- or cycloalkyl-benzo-oxacyclic compounds | |
| US4891433A (en) | Process for the preparation of dibenzothiepin derivative | |
| US4585888A (en) | Synthetic method for a chiral 3-(substituted-phenyl)-4-(3-hydroxypropyl)cyclohexanol | |
| JPS647065B2 (cg-RX-API-DMAC10.html) | ||
| US4511726A (en) | Production method of an insect pheromone | |
| JPH0147464B2 (cg-RX-API-DMAC10.html) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |