HU185975B - Process forproducing new, benzoaxazolinone derivatives substituted with an aminoalkohol- or aminoketone chain at the 6 position and pharmaceutically acceptable salts thereof - Google Patents
Process forproducing new, benzoaxazolinone derivatives substituted with an aminoalkohol- or aminoketone chain at the 6 position and pharmaceutically acceptable salts thereof Download PDFInfo
- Publication number
- HU185975B HU185975B HU813255A HU325581A HU185975B HU 185975 B HU185975 B HU 185975B HU 813255 A HU813255 A HU 813255A HU 325581 A HU325581 A HU 325581A HU 185975 B HU185975 B HU 185975B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- compound
- group
- pharmaceutically acceptable
- compounds
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims abstract description 13
- 238000000034 method Methods 0.000 title claims description 16
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical group NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 51
- -1 hydroxy-methylene Chemical group 0.000 claims abstract description 21
- 239000001257 hydrogen Substances 0.000 claims abstract description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 150000002576 ketones Chemical class 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 2
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 claims 2
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 1
- 206010020772 Hypertension Diseases 0.000 claims 1
- 230000037396 body weight Effects 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 125000003884 phenylalkyl group Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 abstract description 6
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 5
- 125000001302 tertiary amino group Chemical group 0.000 abstract description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract description 4
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 3
- 230000000202 analgesic effect Effects 0.000 abstract description 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 2
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 abstract 1
- 239000002585 base Substances 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 230000000694 effects Effects 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000000921 elemental analysis Methods 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 6
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 230000000638 stimulation Effects 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 4
- 108020003175 receptors Proteins 0.000 description 4
- 102000005962 receptors Human genes 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- 239000000556 agonist Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical group C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 2
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- WMALGHVGWLGXGP-UHFFFAOYSA-N 6-(2-bromoacetyl)-3h-1,3-benzoxazol-2-one Chemical compound BrCC(=O)C1=CC=C2NC(=O)OC2=C1 WMALGHVGWLGXGP-UHFFFAOYSA-N 0.000 description 2
- 108060003345 Adrenergic Receptor Proteins 0.000 description 2
- 102000017910 Adrenergic receptor Human genes 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 102000004305 alpha Adrenergic Receptors Human genes 0.000 description 2
- 108090000861 alpha Adrenergic Receptors Proteins 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- 229940124630 bronchodilator Drugs 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000004312 hexamethylene tetramine Substances 0.000 description 2
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 229960001317 isoprenaline Drugs 0.000 description 2
- 229960002748 norepinephrine Drugs 0.000 description 2
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- VNZLQLYBRIOLFZ-UHFFFAOYSA-N 1-(2-methoxyphenyl)piperazine Chemical compound COC1=CC=CC=C1N1CCNCC1 VNZLQLYBRIOLFZ-UHFFFAOYSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- XERIIBQQYDXGKO-UHFFFAOYSA-N 3-methyl-6-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]acetyl]-1,3-benzoxazol-2-one Chemical compound C1=C2OC(=O)N(C)C2=CC=C1C(=O)CN(CC1)CCN1C1=CC=CC(C(F)(F)F)=C1 XERIIBQQYDXGKO-UHFFFAOYSA-N 0.000 description 1
- ABGXADJDTPFFSZ-UHFFFAOYSA-N 4-benzylpiperidine Chemical compound C=1C=CC=CC=1CC1CCNCC1 ABGXADJDTPFFSZ-UHFFFAOYSA-N 0.000 description 1
- AMJVTWRLIMEEPG-UHFFFAOYSA-N 6-(2-aminoacetyl)-3h-1,3-benzoxazol-2-one Chemical compound NCC(=O)C1=CC=C2NC(=O)OC2=C1 AMJVTWRLIMEEPG-UHFFFAOYSA-N 0.000 description 1
- RKUQQEGIGSEJTO-UHFFFAOYSA-N 6-[1-hydroxy-2-(propan-2-ylamino)ethyl]-3h-1,3-benzoxazol-2-one Chemical compound CC(C)NCC(O)C1=CC=C2NC(=O)OC2=C1 RKUQQEGIGSEJTO-UHFFFAOYSA-N 0.000 description 1
- OWRNIUVEDDORAG-UHFFFAOYSA-N 6-[1-hydroxy-2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound COC1=CC=CC=C1N1CCN(CC(O)C=2C=C3OC(=O)N(C)C3=CC=2)CC1 OWRNIUVEDDORAG-UHFFFAOYSA-N 0.000 description 1
- ZGDOZAMLFIQTSK-UHFFFAOYSA-N 6-[1-hydroxy-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound FC(C=1C=C(C=CC1)N1CCN(CC1)CC(O)C1=CC2=C(N(C(O2)=O)C)C=C1)(F)F ZGDOZAMLFIQTSK-UHFFFAOYSA-N 0.000 description 1
- PFSFMCOQPSVFIZ-UHFFFAOYSA-N 6-[2-(4-benzylpiperidin-1-yl)-1-hydroxyethyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound C1=C2OC(=O)N(C)C2=CC=C1C(O)CN(CC1)CCC1CC1=CC=CC=C1 PFSFMCOQPSVFIZ-UHFFFAOYSA-N 0.000 description 1
- RDDDEMHKDKUQOV-UHFFFAOYSA-N 6-[2-(4-benzylpiperidin-1-yl)acetyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound C1=C2OC(=O)N(C)C2=CC=C1C(=O)CN(CC1)CCC1CC1=CC=CC=C1 RDDDEMHKDKUQOV-UHFFFAOYSA-N 0.000 description 1
- CBONAAMOYZXHCW-UHFFFAOYSA-N 6-[2-(propan-2-ylamino)acetyl]-3h-1,3-benzoxazol-2-one Chemical compound CC(C)NCC(=O)C1=CC=C2NC(=O)OC2=C1 CBONAAMOYZXHCW-UHFFFAOYSA-N 0.000 description 1
- GIUCPKLUEFYYCS-UHFFFAOYSA-N 6-[2-[4-(2-methoxyphenyl)piperazin-1-yl]acetyl]-3-methyl-1,3-benzoxazol-2-one Chemical compound COC1=C(C=CC=C1)N1CCN(CC1)CC(=O)C1=CC2=C(N(C(O2)=O)C)C=C1 GIUCPKLUEFYYCS-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 238000012404 In vitro experiment Methods 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000009090 positive inotropic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000012232 skeletal muscle contraction Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000010415 tropism Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8020861A FR2491066A1 (fr) | 1980-09-29 | 1980-09-29 | Benzoxazolinones substituees en 6 par une chaine aminoalcool ou aminocetone, leur preparation et leur application en therapeutique |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU185975B true HU185975B (en) | 1985-04-28 |
Family
ID=9246379
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU813255A HU185975B (en) | 1980-09-29 | 1981-09-21 | Process forproducing new, benzoaxazolinone derivatives substituted with an aminoalkohol- or aminoketone chain at the 6 position and pharmaceutically acceptable salts thereof |
Country Status (10)
| Country | Link |
|---|---|
| EP (1) | EP0049203A1 (enExample) |
| JP (1) | JPS57501427A (enExample) |
| CA (1) | CA1179343A (enExample) |
| DK (1) | DK49682A (enExample) |
| FR (1) | FR2491066A1 (enExample) |
| GR (1) | GR82309B (enExample) |
| HU (1) | HU185975B (enExample) |
| PT (1) | PT73740B (enExample) |
| WO (1) | WO1982001186A1 (enExample) |
| ZA (1) | ZA816555B (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3278014D1 (en) * | 1982-10-01 | 1988-02-25 | Merck & Co Inc | Aralkylaminoethanol heterocyclic compounds |
| FR2536749A1 (fr) * | 1982-11-25 | 1984-06-01 | Cerm Cent Europ Rech Mauvernay | (amino-2 ethyl)-6 benzoxazolinones substituees, leur preparation et leurs applications en therapeutique |
| GB8325370D0 (en) * | 1983-09-22 | 1983-10-26 | Fujisawa Pharmaceutical Co | Benzoxazoline and benzothiazoline derivatives |
| FR2637286A1 (fr) * | 1988-10-04 | 1990-04-06 | Adir | Nouveaux derives benzoxazolinoniques, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent |
| US5182278A (en) * | 1989-02-28 | 1993-01-26 | Adir Et Compagnie | Analgesic benzoxazolinones having at the 6-position a 1-hydroxy-3-morpholinopropyl side chain |
| IL93473A0 (en) * | 1989-02-28 | 1990-11-29 | Pfizer | Antiinflammatory benzoxazolones |
| FR2643634A1 (fr) * | 1989-02-28 | 1990-08-31 | Adir | Nouveaux derives benzoxazolinoniques, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent |
| FR2645149A1 (enExample) * | 1989-03-30 | 1990-10-05 | Adir | |
| FR2646350B1 (fr) * | 1989-04-28 | 1991-06-28 | Adir | Nouveaux derives benzothiazolinoniques, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| US5166353A (en) * | 1989-04-28 | 1992-11-24 | Adir Et Compagnie | Benzothiazolinone compounds |
| FR2663634B1 (fr) * | 1990-06-22 | 1992-09-04 | Adir | Nouvelles acyl benzoxazolinones, leur procede de preparation et les compositions pharmaceutiques qui les contiennent. |
| ATE194982T1 (de) | 1992-04-24 | 2000-08-15 | Takeda Chemical Industries Ltd | Benzoxazepin-derivate als cholinesterase- inhibitoren |
| US20090130165A1 (en) * | 2005-12-21 | 2009-05-21 | Cortical Pty Ltd | MIF Inhibitors |
| DE102007047737A1 (de) | 2007-10-05 | 2009-04-30 | Merck Patent Gmbh | Piperidin- und Piperazinderivate |
| CN101759665B (zh) * | 2008-12-23 | 2012-03-28 | 江苏恩华药业股份有限公司 | 取代苯基哌嗪芳烷醇衍生物及其在制备镇痛药物中的应用 |
| DE102009049211A1 (de) | 2009-10-13 | 2011-04-28 | Merck Patent Gmbh | Sulfoxide |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2244507A1 (en) * | 1973-06-26 | 1975-04-18 | Inst Nat Sante Rech Med | Chalcones and analogues - analgesics having low toxicity |
| DE2429253A1 (de) * | 1974-06-19 | 1976-01-15 | Boehringer Sohn Ingelheim | Phenylalkanolamine |
-
1980
- 1980-09-29 FR FR8020861A patent/FR2491066A1/fr active Granted
-
1981
- 1981-09-21 ZA ZA816555A patent/ZA816555B/xx unknown
- 1981-09-21 JP JP56503061A patent/JPS57501427A/ja active Pending
- 1981-09-21 WO PCT/EP1981/000149 patent/WO1982001186A1/en not_active Ceased
- 1981-09-21 HU HU813255A patent/HU185975B/hu unknown
- 1981-09-28 EP EP81401497A patent/EP0049203A1/fr not_active Withdrawn
- 1981-09-28 PT PT73740A patent/PT73740B/pt unknown
- 1981-09-28 GR GR66134A patent/GR82309B/el unknown
- 1981-09-28 CA CA000386770A patent/CA1179343A/en not_active Expired
-
1982
- 1982-02-05 DK DK49682A patent/DK49682A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2491066A1 (fr) | 1982-04-02 |
| DK49682A (da) | 1982-04-15 |
| PT73740A (en) | 1981-10-01 |
| EP0049203A1 (fr) | 1982-04-07 |
| WO1982001186A1 (en) | 1982-04-15 |
| ZA816555B (en) | 1982-09-29 |
| GR82309B (enExample) | 1984-12-13 |
| FR2491066B1 (enExample) | 1983-06-17 |
| PT73740B (en) | 1982-12-30 |
| JPS57501427A (enExample) | 1982-08-12 |
| CA1179343A (en) | 1984-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4007196A (en) | 4-Phenylpiperidine compounds | |
| HU185975B (en) | Process forproducing new, benzoaxazolinone derivatives substituted with an aminoalkohol- or aminoketone chain at the 6 position and pharmaceutically acceptable salts thereof | |
| US4675319A (en) | Antianaphylactic and antibronchospastic piperazinyl-(N-substituted phenyl)carboxamides, compositions and use | |
| EP0434561B1 (fr) | Dérivés de la napht-1-yl pipérazine, leur procédé de préparation et les compositions pharmaceutiques qui les contiennent | |
| US4202896A (en) | N-Benzhydryloxyethyl-N-phenylpropyl-piperazines | |
| US4234595A (en) | 3-Indolyl-tertiary butylaminopropanols | |
| KR870001268B1 (ko) | 크산틴 유도체의 제조 방법 | |
| EP0025111B1 (en) | 3-aminopropoxyaryl derivatives, their preparation and pharmaceutical compositions containing them | |
| EP0373998A1 (fr) | Ethers d'oxime de propénone, procédé pour leur préparation et compositions pharmaceutiques les contenant | |
| HU220592B1 (hu) | Eljárás diaminszármazékok és ezeket hatóanyagként tartalmazó gyógyszerkészítmények előállítására | |
| MXPA02006499A (es) | Derivados de fenilpiperazinilo. | |
| Augstein et al. | . beta.-Adrenoceptor blocking agents. 1. Cardioselective 1-aryloxy-3-(aryloxyalkylamino) propan-2-ols | |
| JPH0819057B2 (ja) | 新規なフェニルプロピニルアミン誘導体の製造法 | |
| US5244894A (en) | 2-aminopyrimidine-4-carboxamide derivatives, their preparation and their use in therapeutics | |
| JP2002504549A (ja) | ベンジルピペラジニル−およびベンジルピペリジニルエタノン誘導体、その調製、およびドーパミンd4受容体アンタゴニストとしてのその使用 | |
| FR2557570A1 (fr) | Nouveaux derives de la quinoleine, leur procede de preparation et les compositions pharmaceutiques les renfermant | |
| EP0406739A2 (en) | Piperidine derivative, method for preparation thereof, and a pharmaceutical composition comprising the same | |
| JP2765876B2 (ja) | ピリジルケトオキシムエーテル誘導体 | |
| IE921319A1 (en) | 2-aminopyrimidine-4-carboxamide derivatives, their¹preparation and their application in therapy | |
| US5198587A (en) | Phenethylamine derivatives | |
| HU185432B (en) | Process for producing indene derivatives | |
| CA2046005A1 (en) | Benzhydryl derivatives having calmodulin inhibitor properties | |
| GB2123410A (en) | New derivatives of 1,2,3,4-tetrahydronaphthalene, process for their preparation and associated pharmaceutical compositions | |
| EP0649419A1 (fr) | Derives de la n-cycloalkylpiperazine, procedes d'obtention et compositions pharmaceutiques les contenant | |
| US4048322A (en) | Bronchially effective xanthene-9-carboxylates |