HU183505B - Process for cleaving 1-substituted 2,2,2-trihalogenoethyl-esters - Google Patents
Process for cleaving 1-substituted 2,2,2-trihalogenoethyl-esters Download PDFInfo
- Publication number
- HU183505B HU183505B HU811945A HU194581A HU183505B HU 183505 B HU183505 B HU 183505B HU 811945 A HU811945 A HU 811945A HU 194581 A HU194581 A HU 194581A HU 183505 B HU183505 B HU 183505B
- Authority
- HU
- Hungary
- Prior art keywords
- acid
- organic solvent
- methyl
- water
- reaction
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 29
- 230000008569 process Effects 0.000 title claims abstract description 12
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 31
- 239000002253 acid Substances 0.000 claims abstract description 18
- 239000011701 zinc Substances 0.000 claims abstract description 14
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 14
- 229910052500 inorganic mineral Inorganic materials 0.000 claims abstract description 7
- 239000011707 mineral Substances 0.000 claims abstract description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 5
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 150000002367 halogens Chemical class 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 51
- 238000006243 chemical reaction Methods 0.000 claims description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 25
- 239000000725 suspension Substances 0.000 claims description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 14
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 12
- 239000003960 organic solvent Substances 0.000 claims description 12
- -1 acyclic ethers Chemical class 0.000 claims description 11
- 239000000243 solution Substances 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 239000002002 slurry Substances 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 238000010992 reflux Methods 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 claims 2
- 239000000843 powder Substances 0.000 claims 2
- 150000001298 alcohols Chemical class 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical group 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 claims 1
- 239000002904 solvent Substances 0.000 abstract description 3
- 238000003786 synthesis reaction Methods 0.000 abstract description 3
- 150000002431 hydrogen Chemical group 0.000 abstract description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 abstract 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 abstract 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 abstract 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract 1
- 229910052782 aluminium Inorganic materials 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 229910052742 iron Inorganic materials 0.000 abstract 1
- 239000011777 magnesium Substances 0.000 abstract 1
- 229910052749 magnesium Inorganic materials 0.000 abstract 1
- 210000000056 organ Anatomy 0.000 abstract 1
- 239000011135 tin Substances 0.000 abstract 1
- 229910052718 tin Inorganic materials 0.000 abstract 1
- 239000000047 product Substances 0.000 description 28
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- YYOLVILSZOVWLS-UHFFFAOYSA-N 1,1-dichloro-4-methylpenta-1,3-diene Chemical compound CC(C)=CC=C(Cl)Cl YYOLVILSZOVWLS-UHFFFAOYSA-N 0.000 description 18
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- YSLRNSJUAJXAPT-UHFFFAOYSA-N (1,1,1-trichloro-4-methylpent-3-en-2-yl) acetate Chemical compound CC(C)=CC(C(Cl)(Cl)Cl)OC(C)=O YSLRNSJUAJXAPT-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000006227 byproduct Substances 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 7
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- CLLRCFUVSNRVEU-UHFFFAOYSA-N (1,1-dichloro-4-methylpent-3-en-2-yl) acetate Chemical compound CC(C)=CC(C(Cl)Cl)OC(C)=O CLLRCFUVSNRVEU-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 238000006894 reductive elimination reaction Methods 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- ZFIHZJPVRVOBFF-UHFFFAOYSA-N (1,1,1-trichloro-4-methylpent-4-en-2-yl) acetate Chemical compound CC(=C)CC(C(Cl)(Cl)Cl)OC(C)=O ZFIHZJPVRVOBFF-UHFFFAOYSA-N 0.000 description 3
- 125000004797 2,2,2-trichloroethoxy group Chemical group ClC(CO*)(Cl)Cl 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- LWWJZSNCITZYEB-UHFFFAOYSA-N 1,1,1-trichloro-4-methylpent-4-en-2-ol Chemical compound CC(=C)CC(O)C(Cl)(Cl)Cl LWWJZSNCITZYEB-UHFFFAOYSA-N 0.000 description 2
- QVUBZVXSODSSKU-UHFFFAOYSA-N 1,1-dichloro-4-methylpenta-1,4-diene Chemical compound CC(=C)CC=C(Cl)Cl QVUBZVXSODSSKU-UHFFFAOYSA-N 0.000 description 2
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- KCPBRSOFTQKGLM-UHFFFAOYSA-N (1,1-dichloro-4-methylpent-4-en-2-yl) acetate Chemical compound CC(=C)CC(C(Cl)Cl)OC(C)=O KCPBRSOFTQKGLM-UHFFFAOYSA-N 0.000 description 1
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-dichloroethene Chemical group ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- WGXLSZQUOYSATB-UHFFFAOYSA-N 2,2,2-trichloroethyl benzoate Chemical compound ClC(Cl)(Cl)COC(=O)C1=CC=CC=C1 WGXLSZQUOYSATB-UHFFFAOYSA-N 0.000 description 1
- PQOOXAVSUMDZHX-UHFFFAOYSA-N 2,2-dichloroethyl benzoate Chemical compound ClC(Cl)COC(=O)C1=CC=CC=C1 PQOOXAVSUMDZHX-UHFFFAOYSA-N 0.000 description 1
- JMMZCWZIJXAGKW-UHFFFAOYSA-N 2-methylpent-2-ene Chemical compound CCC=C(C)C JMMZCWZIJXAGKW-UHFFFAOYSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- IRMOYHOUSZZKBG-UHFFFAOYSA-N ClC(C(C=C(C)C)OC(=O)OCC)Cl Chemical compound ClC(C(C=C(C)C)OC(=O)OCC)Cl IRMOYHOUSZZKBG-UHFFFAOYSA-N 0.000 description 1
- OVGORFFCBUIFIA-UHFFFAOYSA-N Fenipentol Chemical compound CCCCC(O)C1=CC=CC=C1 OVGORFFCBUIFIA-UHFFFAOYSA-N 0.000 description 1
- KYKQHSMYWLWROM-UHFFFAOYSA-N ac1l4yjn Chemical compound [Hg].[Hg] KYKQHSMYWLWROM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005868 electrolysis reaction Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- RYPKRALMXUUNKS-UHFFFAOYSA-N hex-2-ene Chemical compound CCCC=CC RYPKRALMXUUNKS-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- NYGZKMXIYAFNRM-UHFFFAOYSA-N methanol;zinc Chemical compound [Zn].OC NYGZKMXIYAFNRM-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DHRLEVQXOMLTIM-UHFFFAOYSA-N phosphoric acid;trioxomolybdenum Chemical compound O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.OP(O)(O)=O DHRLEVQXOMLTIM-UHFFFAOYSA-N 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/361—Preparation of halogenated hydrocarbons by reactions involving a decrease in the number of carbon atoms
- C07C17/363—Preparation of halogenated hydrocarbons by reactions involving a decrease in the number of carbon atoms by elimination of carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU811945A HU183505B (en) | 1981-07-03 | 1981-07-03 | Process for cleaving 1-substituted 2,2,2-trihalogenoethyl-esters |
| US06/391,866 US4450309A (en) | 1981-07-03 | 1982-06-24 | Process for the preparation of unsaturated geminal dihalogen compounds |
| DE19823224162 DE3224162A1 (de) | 1981-07-03 | 1982-06-29 | Verfahren zur herstellung von ungesaettigten geminalen dihalogenverbindungen |
| FR8211578A FR2508900B1 (fr) | 1981-07-03 | 1982-07-01 | Procede de reparation de composes dihalogenes geminaux non satures |
| DD82241368A DD204240A5 (de) | 1981-07-03 | 1982-07-02 | Verfahren zur herstellung von ungesaettigten geminalen dihalogenverbindungen |
| GB08219270A GB2101997B (en) | 1981-07-03 | 1982-07-02 | Process for the preparation of gem-dihalogen compounds |
| SU823462148A SU1205756A3 (ru) | 1981-07-03 | 1982-07-02 | Способ получени 1,1-дихлор-4-метилпентадиенов |
| JP57114124A JPS5810530A (ja) | 1981-07-03 | 1982-07-02 | 不飽和gem−ジハロゲン化合物の製造方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU811945A HU183505B (en) | 1981-07-03 | 1981-07-03 | Process for cleaving 1-substituted 2,2,2-trihalogenoethyl-esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU183505B true HU183505B (en) | 1984-05-28 |
Family
ID=10956951
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU811945A HU183505B (en) | 1981-07-03 | 1981-07-03 | Process for cleaving 1-substituted 2,2,2-trihalogenoethyl-esters |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4450309A (enExample) |
| JP (1) | JPS5810530A (enExample) |
| DD (1) | DD204240A5 (enExample) |
| DE (1) | DE3224162A1 (enExample) |
| FR (1) | FR2508900B1 (enExample) |
| GB (1) | GB2101997B (enExample) |
| HU (1) | HU183505B (enExample) |
| SU (1) | SU1205756A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3423762A1 (de) * | 1984-06-28 | 1986-01-09 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von chlorolefinen |
| JP2024509444A (ja) | 2021-03-10 | 2024-03-01 | スリーエム イノベイティブ プロパティズ カンパニー | ウェブスプライサ |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1480671A (en) * | 1975-04-17 | 1977-07-20 | Ici Ltd | Process for the preparation of 1,1-dihalo-4-methyl pentadienes |
| CH618434A5 (enExample) * | 1976-01-21 | 1980-07-31 | Cheminova As | |
| CA1146977A (en) * | 1979-03-27 | 1983-05-24 | Petrus A. Kramer | Process for the preparation of dihalovinyl compounds |
-
1981
- 1981-07-03 HU HU811945A patent/HU183505B/hu not_active IP Right Cessation
-
1982
- 1982-06-24 US US06/391,866 patent/US4450309A/en not_active Expired - Lifetime
- 1982-06-29 DE DE19823224162 patent/DE3224162A1/de not_active Ceased
- 1982-07-01 FR FR8211578A patent/FR2508900B1/fr not_active Expired
- 1982-07-02 GB GB08219270A patent/GB2101997B/en not_active Expired
- 1982-07-02 SU SU823462148A patent/SU1205756A3/ru active
- 1982-07-02 JP JP57114124A patent/JPS5810530A/ja active Granted
- 1982-07-02 DD DD82241368A patent/DD204240A5/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB2101997A (en) | 1983-01-26 |
| JPH0345049B2 (enExample) | 1991-07-09 |
| DD204240A5 (de) | 1983-11-23 |
| GB2101997B (en) | 1985-06-05 |
| SU1205756A3 (ru) | 1986-01-15 |
| JPS5810530A (ja) | 1983-01-21 |
| US4450309A (en) | 1984-05-22 |
| FR2508900A1 (fr) | 1983-01-07 |
| FR2508900B1 (fr) | 1986-09-26 |
| DE3224162A1 (de) | 1983-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0177454B1 (de) | Silane, Verfahren zu deren Herstellung und deren Verwendung | |
| DD139852B1 (de) | Verfahren zur herstellung kristallin-fluessiger substituierter 1,3-dioxane | |
| EP2616424B1 (de) | Verfahren zur herstellung von 2-methyl-3-(4-tert-butylphenyl)-propanal mit hoher para-isomerenreinheit | |
| EP0623577A1 (de) | Herstellung von Carbonsäurehalogeniden und Carboxylat-Salzen | |
| HU183505B (en) | Process for cleaving 1-substituted 2,2,2-trihalogenoethyl-esters | |
| DE2536504C3 (de) | Verfahren zur Herstellung von Halogendienen | |
| DE69015931T2 (de) | Verfahren zur Herstellung von 4-halogeno-2-alkoximino-3-oxo Fettsäuren. | |
| DE60031509T2 (de) | Optisch aktive fluorierte binaphthol-derivate | |
| EP0133548B1 (en) | Process for producing alpha,beta-unsaturated ketones | |
| DE2708382C3 (de) | Verfahren zur Herstellung von 3-Cyanmethylcyclopentanon-Derivaten | |
| DE2560629C2 (de) | Verfahren zur Herstellung substituierter 2-Hydroxybutensäureester und einige 2-Hydroxybutensäureester als solche | |
| DE112004002335B4 (de) | Verfahren zur Herstellung von in 2,7-Position substituierten Xanthen-4,5-diolen | |
| EP0365914B1 (de) | Neue Fluor enthaltende und an der CH3-Gruppe gegebenenfalls halogenierte Acetophenone und deren Herstellung aus neuen Fluor enthaltenden Benzonitrilen | |
| US5569780A (en) | Dialkyl 2-haloethyl malonates | |
| DE2824841C3 (de) | Verfahren zur Herstellung von 2-Cyclopentenonderivaten sowie diese enthaltende Parfüm-Kompositionen | |
| DE2611694A1 (de) | Verfahren zur gleichzeitigen herstellung von 2,5-dioxo-1,2-oxa-phospholanen und beta-halogenpropionsaeurehalogenid | |
| EP0133711B1 (de) | Isomerisierung von 1,3,3-Trimethyl-7-oxabicyclo[4.1.0]heptan-2-on | |
| US1979614A (en) | Halogenated ethanol | |
| Darses et al. | Facile multi-decagram synthesis of methyl but-2-ynoate | |
| JP3188930B2 (ja) | 1,4−ジヒドロキシ−2−ナフトエ酸アリールエステルの製造方法 | |
| SU715580A1 (ru) | Способ получени кремнийацетиленовых карбонильных соединений | |
| DE2609126A1 (de) | Verfahren zur herstellung von eckige klammer auf 2-(halogenformyl)- vinyl eckige klammer zu organyl-phosphinsaeurehalogeniden | |
| DE2415062C3 (de) | Verfahren zur Herstellung von 2-Nitrobenzaldehyd | |
| DE3715704A1 (de) | Ss-fluoracyl-ss-halogenvinylalkylether | |
| JP4641772B2 (ja) | フラノンの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee | ||
| HPC4 | Succession in title of patentee |
Owner name: AGRO-CHEMIE NOEVENYVEDOESZER GYARTO, ERTEKESITOE E |