HU182486B - Insecticide and acaricide compositions and process for producing bracket-1,1-biphenyl-bracket closed-3-yl-methyl-3-bracket-2,2-dihalogen-ethenyl-bracket closed-2,2-dimethyl-cyclopropane-carboxylates as active agents - Google Patents
Insecticide and acaricide compositions and process for producing bracket-1,1-biphenyl-bracket closed-3-yl-methyl-3-bracket-2,2-dihalogen-ethenyl-bracket closed-2,2-dimethyl-cyclopropane-carboxylates as active agents Download PDFInfo
- Publication number
- HU182486B HU182486B HU79FE1060A HUFE001060A HU182486B HU 182486 B HU182486 B HU 182486B HU 79FE1060 A HU79FE1060 A HU 79FE1060A HU FE001060 A HUFE001060 A HU FE001060A HU 182486 B HU182486 B HU 182486B
- Authority
- HU
- Hungary
- Prior art keywords
- methyl
- biphenyl
- fluoro
- formula
- compound
- Prior art date
Links
- 239000002917 insecticide Substances 0.000 title claims abstract description 8
- 239000000203 mixture Substances 0.000 title claims description 71
- 238000000034 method Methods 0.000 title claims description 26
- 230000000895 acaricidal effect Effects 0.000 title claims description 16
- 239000000642 acaricide Substances 0.000 title claims description 5
- 239000013543 active substance Substances 0.000 title description 2
- -1 [1,1-biphenyl]-3-ylmethyl compounds Chemical class 0.000 claims abstract description 88
- 150000001875 compounds Chemical class 0.000 claims abstract description 30
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 18
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 17
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 6
- 239000011541 reaction mixture Substances 0.000 claims description 51
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 35
- 150000002148 esters Chemical class 0.000 claims description 26
- 239000004480 active ingredient Substances 0.000 claims description 24
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 19
- 230000000361 pesticidal effect Effects 0.000 claims description 17
- 235000010290 biphenyl Nutrition 0.000 claims description 16
- 239000000460 chlorine Substances 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 239000011737 fluorine Chemical group 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 13
- 230000005764 inhibitory process Effects 0.000 claims description 11
- 238000011282 treatment Methods 0.000 claims description 11
- 150000001298 alcohols Chemical class 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 238000011161 development Methods 0.000 claims description 6
- 239000004094 surface-active agent Substances 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 claims description 4
- 239000005909 Kieselgur Substances 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 4
- 239000000194 fatty acid Substances 0.000 claims description 4
- 229930195729 fatty acid Natural products 0.000 claims description 4
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 239000000454 talc Substances 0.000 claims description 4
- 229910052623 talc Inorganic materials 0.000 claims description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 229960000892 attapulgite Drugs 0.000 claims description 3
- 239000000440 bentonite Substances 0.000 claims description 3
- 229910000278 bentonite Inorganic materials 0.000 claims description 3
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052625 palygorskite Inorganic materials 0.000 claims description 3
- 239000011591 potassium Chemical group 0.000 claims description 3
- 229910052700 potassium Chemical group 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 240000007124 Brassica oleracea Species 0.000 claims description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 2
- 235000019738 Limestone Nutrition 0.000 claims description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 2
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 claims description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 2
- 239000001506 calcium phosphate Substances 0.000 claims description 2
- 229910000389 calcium phosphate Inorganic materials 0.000 claims description 2
- 235000011010 calcium phosphates Nutrition 0.000 claims description 2
- 239000006028 limestone Substances 0.000 claims description 2
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 claims description 2
- 239000001095 magnesium carbonate Substances 0.000 claims description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 claims description 2
- 235000014380 magnesium carbonate Nutrition 0.000 claims description 2
- 239000002480 mineral oil Substances 0.000 claims description 2
- 229920000570 polyether Polymers 0.000 claims description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 2
- 235000019422 polyvinyl alcohol Nutrition 0.000 claims description 2
- 229910052903 pyrophyllite Inorganic materials 0.000 claims description 2
- 239000004576 sand Substances 0.000 claims description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 claims description 2
- 239000008158 vegetable oil Substances 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 claims 1
- 150000008052 alkyl sulfonates Chemical class 0.000 claims 1
- 239000010775 animal oil Substances 0.000 claims 1
- 229960003563 calcium carbonate Drugs 0.000 claims 1
- 235000010216 calcium carbonate Nutrition 0.000 claims 1
- 239000004927 clay Substances 0.000 claims 1
- 235000019000 fluorine Nutrition 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000003090 pesticide formulation Substances 0.000 claims 1
- 235000001508 sulfur Nutrition 0.000 claims 1
- 235000013311 vegetables Nutrition 0.000 claims 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 abstract 2
- 239000000243 solution Substances 0.000 description 58
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 48
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 48
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 46
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- 238000010992 reflux Methods 0.000 description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 239000000706 filtrate Substances 0.000 description 26
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 24
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 23
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 22
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000007787 solid Substances 0.000 description 20
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000003921 oil Substances 0.000 description 17
- 235000019198 oils Nutrition 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000012044 organic layer Substances 0.000 description 15
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 14
- 230000000749 insecticidal effect Effects 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- 229920006395 saturated elastomer Polymers 0.000 description 13
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 12
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- 239000011780 sodium chloride Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000004305 biphenyl Substances 0.000 description 10
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 241000238631 Hexapoda Species 0.000 description 9
- LLMLSUSAKZVFOA-UJURSFKZSA-N (1S,3R)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(O)=O LLMLSUSAKZVFOA-UJURSFKZSA-N 0.000 description 8
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000012141 concentrate Substances 0.000 description 8
- 235000008504 concentrate Nutrition 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- QJOOIMSFFIUFKX-IYSWYEEDSA-N methyl (1s,3s)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)[C@H]1[C@@H](C=C(Cl)Cl)C1(C)C QJOOIMSFFIUFKX-IYSWYEEDSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 241000254173 Coleoptera Species 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 239000002728 pyrethroid Substances 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 239000000969 carrier Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-dichloroethene Chemical group ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 4
- RTFPTPXBTIUISM-UHFFFAOYSA-N 1-(bromomethyl)-3-phenylbenzene Chemical class BrCC1=CC=CC(C=2C=CC=CC=2)=C1 RTFPTPXBTIUISM-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 244000046052 Phaseolus vulgaris Species 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 241001454293 Tetranychus urticae Species 0.000 description 4
- VXSIXFKKSNGRRO-MXOVTSAMSA-N [(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate;[(1s)-2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-3-[(e)-3-methoxy-2-methyl-3-oxoprop-1-enyl Chemical class CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1.CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VXSIXFKKSNGRRO-MXOVTSAMSA-N 0.000 description 4
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 4
- 125000003158 alcohol group Chemical group 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- VEMKTZHHVJILDY-UXHICEINSA-N bioresmethrin Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCC1=COC(CC=2C=CC=CC=2)=C1 VEMKTZHHVJILDY-UXHICEINSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 238000002329 infrared spectrum Methods 0.000 description 4
- 238000005191 phase separation Methods 0.000 description 4
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 4
- 229940070846 pyrethrins Drugs 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- RCXSATVYZMEQIR-UHFFFAOYSA-N (2,6-dimethyl-3-phenylphenyl)methanol Chemical compound CC1=C(CO)C(C)=CC=C1C1=CC=CC=C1 RCXSATVYZMEQIR-UHFFFAOYSA-N 0.000 description 3
- ALLIZEAXNXSFGD-UHFFFAOYSA-N 1-methyl-2-phenylbenzene Chemical compound CC1=CC=CC=C1C1=CC=CC=C1 ALLIZEAXNXSFGD-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical class CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- CEHQWCFLTWFAOL-UHFFFAOYSA-N [3-(2-methylphenyl)phenyl]methanol Chemical compound CC1=CC=CC=C1C1=CC=CC(CO)=C1 CEHQWCFLTWFAOL-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 231100000517 death Toxicity 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- MOMORSVRSWLPKH-UHFFFAOYSA-N ethyl 6-(2-fluorophenyl)-2-methyl-4-oxocyclohex-2-ene-1-carboxylate Chemical compound C1C(=O)C=C(C)C(C(=O)OCC)C1C1=CC=CC=C1F MOMORSVRSWLPKH-UHFFFAOYSA-N 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- FFXJWZTZUIIASV-UHFFFAOYSA-N (2,3,4,6-tetrafluoro-5-phenylphenyl)methanol Chemical compound OCC1=C(F)C(F)=C(F)C(C=2C=CC=CC=2)=C1F FFXJWZTZUIIASV-UHFFFAOYSA-N 0.000 description 2
- IBWKCPDCFMRCQJ-UHFFFAOYSA-N (2,6-dimethyl-3-nitrophenyl)methanol Chemical compound CC1=CC=C([N+]([O-])=O)C(C)=C1CO IBWKCPDCFMRCQJ-UHFFFAOYSA-N 0.000 description 2
- UIPNWXZLPOCARV-UHFFFAOYSA-N (2-bromo-3-phenylphenyl)methanol Chemical compound OCC1=CC=CC(C=2C=CC=CC=2)=C1Br UIPNWXZLPOCARV-UHFFFAOYSA-N 0.000 description 2
- VUBUHVBODOUAAF-UHFFFAOYSA-N (3-amino-2-bromophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC(N)=C1Br VUBUHVBODOUAAF-UHFFFAOYSA-N 0.000 description 2
- VODBTCPLHMEMAS-UHFFFAOYSA-N (3-amino-2-methylphenyl)methanol;hydrochloride Chemical group Cl.CC1=C(N)C=CC=C1CO VODBTCPLHMEMAS-UHFFFAOYSA-N 0.000 description 2
- WVKFJUYXMBJNKD-UHFFFAOYSA-N (3-iodo-2-methylphenyl)methanol Chemical compound CC1=C(I)C=CC=C1CO WVKFJUYXMBJNKD-UHFFFAOYSA-N 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- SKDWLRPVWTVSKZ-UHFFFAOYSA-N 1,2,3,5-tetrafluoro-4-phenylbenzene Chemical group FC1=C(F)C(F)=CC(F)=C1C1=CC=CC=C1 SKDWLRPVWTVSKZ-UHFFFAOYSA-N 0.000 description 2
- QVCUKHQDEZNNOC-UHFFFAOYSA-N 1,2-diazabicyclo[2.2.2]octane Chemical compound C1CC2CCN1NC2 QVCUKHQDEZNNOC-UHFFFAOYSA-N 0.000 description 2
- VFIQBQAZDAFZKR-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-methylcyclohexan-1-ol Chemical compound C1C(C)CCCC1(O)C1=CC=CC(Cl)=C1 VFIQBQAZDAFZKR-UHFFFAOYSA-N 0.000 description 2
- MBTFNFODAQPJNE-UHFFFAOYSA-N 1-(bromomethyl)-3-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C=C(CBr)C=CC=2)=C1 MBTFNFODAQPJNE-UHFFFAOYSA-N 0.000 description 2
- UVXXXPUFDFKYEE-UHFFFAOYSA-N 1-chloro-3-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C=C(Cl)C=CC=2)=C1 UVXXXPUFDFKYEE-UHFFFAOYSA-N 0.000 description 2
- BUIPKDFUVKLJTF-UHFFFAOYSA-N 1-fluoro-2-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C(=CC=CC=2)F)=C1 BUIPKDFUVKLJTF-UHFFFAOYSA-N 0.000 description 2
- NPDIDUXTRAITDE-UHFFFAOYSA-N 1-methyl-3-phenylbenzene Chemical group CC1=CC=CC(C=2C=CC=CC=2)=C1 NPDIDUXTRAITDE-UHFFFAOYSA-N 0.000 description 2
- FNPGJPKNKADBGK-UHFFFAOYSA-N 2,4-dimethyl-1-phenylbenzene Chemical group CC1=CC(C)=CC=C1C1=CC=CC=C1 FNPGJPKNKADBGK-UHFFFAOYSA-N 0.000 description 2
- GOGALNMBJIGJNW-UHFFFAOYSA-N 2,6-dimethyl-3-nitrobenzoic acid Chemical compound CC1=CC=C([N+]([O-])=O)C(C)=C1C(O)=O GOGALNMBJIGJNW-UHFFFAOYSA-N 0.000 description 2
- WEAUVDQUPGJTSZ-UHFFFAOYSA-N 2-(bromomethyl)-1,3-difluoro-4-phenylbenzene Chemical compound FC1=C(CBr)C(F)=CC=C1C1=CC=CC=C1 WEAUVDQUPGJTSZ-UHFFFAOYSA-N 0.000 description 2
- IMFSHMCSISIQIN-UHFFFAOYSA-N 2-bromo-1-(bromomethyl)-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(CBr)=C1Br IMFSHMCSISIQIN-UHFFFAOYSA-N 0.000 description 2
- GCAAVRIWNMTOKB-UHFFFAOYSA-N 2-bromo-1-methyl-3-nitrobenzene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1Br GCAAVRIWNMTOKB-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical class CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 2
- UJBOOUHRTQVGRU-UHFFFAOYSA-N 3-methylcyclohexan-1-one Chemical compound CC1CCCC(=O)C1 UJBOOUHRTQVGRU-UHFFFAOYSA-N 0.000 description 2
- IIZVERXSSGEDTK-UHFFFAOYSA-N 5-(2-fluorophenyl)-3-methylcyclohex-2-en-1-ol Chemical compound C1C(C)=CC(O)CC1C1=CC=CC=C1F IIZVERXSSGEDTK-UHFFFAOYSA-N 0.000 description 2
- 241000238876 Acari Species 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 2
- 241001600407 Aphis <genus> Species 0.000 description 2
- 241000498522 Aphis medicaginis Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000462639 Epilachna varivestis Species 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 241000365762 Scirtothrips Species 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 238000007710 freezing Methods 0.000 description 2
- 230000008014 freezing Effects 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- JYVHOGDBFNJNMR-UHFFFAOYSA-N hexane;hydrate Chemical compound O.CCCCCC JYVHOGDBFNJNMR-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- YSILGROPIYCDQO-CAHLUQPWSA-N methyl (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound BrC(=C[C@@H]1C([C@H]1C(=O)OC)(C)C)Br YSILGROPIYCDQO-CAHLUQPWSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- IOGXOCVLYRDXLW-UHFFFAOYSA-N tert-butyl nitrite Chemical compound CC(C)(C)ON=O IOGXOCVLYRDXLW-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- NHGXDBSUJJNIRV-UHFFFAOYSA-M tetrabutylammonium chloride Chemical compound [Cl-].CCCC[N+](CCCC)(CCCC)CCCC NHGXDBSUJJNIRV-UHFFFAOYSA-M 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- MDIQXIJPQWLFSD-UJURSFKZSA-N (1s,3r)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@@H](C=C(Br)Br)[C@@H]1C(O)=O MDIQXIJPQWLFSD-UJURSFKZSA-N 0.000 description 1
- CHLAOFANYRDCPD-UJURSFKZSA-N (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(Cl)=O CHLAOFANYRDCPD-UJURSFKZSA-N 0.000 description 1
- CHLAOFANYRDCPD-INEUFUBQSA-N (1s,3s)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carbonyl chloride Chemical compound CC1(C)[C@H](C=C(Cl)Cl)[C@@H]1C(Cl)=O CHLAOFANYRDCPD-INEUFUBQSA-N 0.000 description 1
- LLMLSUSAKZVFOA-INEUFUBQSA-N (1s,3s)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)[C@H](C=C(Cl)Cl)[C@@H]1C(O)=O LLMLSUSAKZVFOA-INEUFUBQSA-N 0.000 description 1
- JWPXIGDSYFYWGA-UHFFFAOYSA-N (2,4,6-trifluoro-3-phenylphenyl)methanol Chemical compound OCC1=C(F)C=C(F)C(C=2C=CC=CC=2)=C1F JWPXIGDSYFYWGA-UHFFFAOYSA-N 0.000 description 1
- WNUWIGVXOYQIHQ-UHFFFAOYSA-N (2,6-difluoro-3-phenylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=C(F)C=CC(C=2C=CC=CC=2)=C1F WNUWIGVXOYQIHQ-UHFFFAOYSA-N 0.000 description 1
- RHYFIMGPEOVKRO-UHFFFAOYSA-N (2-bromo-3-nitrophenyl)methyl acetate Chemical compound CC(=O)OCC1=CC=CC([N+]([O-])=O)=C1Br RHYFIMGPEOVKRO-UHFFFAOYSA-N 0.000 description 1
- QJANIQCEDPJNLO-UHFFFAOYSA-N (2-methyl-3-nitrophenyl)methanol Chemical compound CC1=C(CO)C=CC=C1[N+]([O-])=O QJANIQCEDPJNLO-UHFFFAOYSA-N 0.000 description 1
- BGTLHJPGBIVQLJ-UHFFFAOYSA-N (2-methyl-3-phenylphenyl)methanol Chemical compound CC1=C(CO)C=CC=C1C1=CC=CC=C1 BGTLHJPGBIVQLJ-UHFFFAOYSA-N 0.000 description 1
- CYTRJTGMWNBWJV-UHFFFAOYSA-N (3-amino-2,6-dimethylphenyl)methyl acetate Chemical compound CC(=O)OCC1=C(C)C=CC(N)=C1C CYTRJTGMWNBWJV-UHFFFAOYSA-N 0.000 description 1
- KGANAERDZBAECK-UHFFFAOYSA-N (3-phenoxyphenyl)methanol Chemical compound OCC1=CC=CC(OC=2C=CC=CC=2)=C1 KGANAERDZBAECK-UHFFFAOYSA-N 0.000 description 1
- RMLZACGTCXHCGL-UHFFFAOYSA-N (3-phenylphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical class CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(C=2C=CC=CC=2)=C1 RMLZACGTCXHCGL-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- XNAKKTLRTNNKAS-UHFFFAOYSA-N 1,3,5-trifluoro-2-phenylbenzene Chemical compound FC1=CC(F)=CC(F)=C1C1=CC=CC=C1 XNAKKTLRTNNKAS-UHFFFAOYSA-N 0.000 description 1
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-bis(diphenylphosphino)propane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 1
- JHVWXYIBBBNXBL-UHFFFAOYSA-N 1,3-dibromo-2-(bromomethyl)-4-phenylbenzene Chemical compound BrCC1=C(Br)C=CC(C=2C=CC=CC=2)=C1Br JHVWXYIBBBNXBL-UHFFFAOYSA-N 0.000 description 1
- GUXRLULKFQOZJU-UHFFFAOYSA-N 1-(bromomethyl)-3-(2-fluorophenyl)benzene Chemical compound FC1=CC=CC=C1C1=CC=CC(CBr)=C1 GUXRLULKFQOZJU-UHFFFAOYSA-N 0.000 description 1
- IJYJYBHESXAIDP-UHFFFAOYSA-N 1-(bromomethyl)-3-(3-chlorophenyl)benzene Chemical compound ClC1=CC=CC(C=2C=C(CBr)C=CC=2)=C1 IJYJYBHESXAIDP-UHFFFAOYSA-N 0.000 description 1
- NBYFWZAXXNLBEG-UHFFFAOYSA-N 1-(chloromethyl)-2-methyl-3-phenylbenzene Chemical group CC1=C(CCl)C=CC=C1C1=CC=CC=C1 NBYFWZAXXNLBEG-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- QWBKPDHJCCYBLE-UHFFFAOYSA-N 1-ethyl-2-(2-methylphenyl)benzene Chemical compound CCC1=CC=CC=C1C1=CC=CC=C1C QWBKPDHJCCYBLE-UHFFFAOYSA-N 0.000 description 1
- GVEDOIATHPCYGS-UHFFFAOYSA-N 1-methyl-3-(3-methylphenyl)benzene Chemical compound CC1=CC=CC(C=2C=C(C)C=CC=2)=C1 GVEDOIATHPCYGS-UHFFFAOYSA-N 0.000 description 1
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical class CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 1
- SBYRHTZJKKWEMP-UHFFFAOYSA-N 2,3,4,6-tetrafluoroaniline Chemical compound NC1=C(F)C=C(F)C(F)=C1F SBYRHTZJKKWEMP-UHFFFAOYSA-N 0.000 description 1
- VAKQOVUDENJBNU-UHFFFAOYSA-N 2,4-dibromo-1-[3-(bromomethyl)phenyl]benzene Chemical compound BrCC1=CC=CC(C=2C(=CC(Br)=CC=2)Br)=C1 VAKQOVUDENJBNU-UHFFFAOYSA-N 0.000 description 1
- GEMLIOXWQRDDOA-UHFFFAOYSA-N 2,4-difluoro-3-methylaniline Chemical compound CC1=C(F)C=CC(N)=C1F GEMLIOXWQRDDOA-UHFFFAOYSA-N 0.000 description 1
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical compound CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 1
- APSMUYYLXZULMS-UHFFFAOYSA-N 2-bromonaphthalene Chemical compound C1=CC=CC2=CC(Br)=CC=C21 APSMUYYLXZULMS-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- GXUQMKBQDGPMKZ-UHFFFAOYSA-N 2-hydroxy-2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CC(O)C1=CC=CC(OC=2C=CC=CC=2)=C1 GXUQMKBQDGPMKZ-UHFFFAOYSA-N 0.000 description 1
- FCMRHMPITHLLLA-UHFFFAOYSA-N 2-methyl-6-nitroaniline Chemical compound CC1=CC=CC([N+]([O-])=O)=C1N FCMRHMPITHLLLA-UHFFFAOYSA-N 0.000 description 1
- JUEZYTFQWZACEL-UHFFFAOYSA-N 2-nitrosoacetamide Chemical compound NC(=O)CN=O JUEZYTFQWZACEL-UHFFFAOYSA-N 0.000 description 1
- MDIQXIJPQWLFSD-UHFFFAOYSA-N 3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)C(C=C(Br)Br)C1C(O)=O MDIQXIJPQWLFSD-UHFFFAOYSA-N 0.000 description 1
- JNETYVLEGPSOFY-UHFFFAOYSA-N 3-bromopyrrolidine-2,5-dione Chemical compound BrC1CC(=O)NC1=O JNETYVLEGPSOFY-UHFFFAOYSA-N 0.000 description 1
- VXUIDVTXKZPLSS-UHFFFAOYSA-N 4,4-dimethyl-2-[3-(2-methylphenyl)phenyl]-5h-1,3-oxazole Chemical compound CC1=CC=CC=C1C1=CC=CC(C=2OCC(C)(C)N=2)=C1 VXUIDVTXKZPLSS-UHFFFAOYSA-N 0.000 description 1
- HFLMFOSJYVLCQL-UHFFFAOYSA-N 5-(2-fluorophenyl)-3-methylcyclohex-2-en-1-one Chemical compound C1C(C)=CC(=O)CC1C1=CC=CC=C1F HFLMFOSJYVLCQL-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- 241000253994 Acyrthosiphon pisum Species 0.000 description 1
- 241001425390 Aphis fabae Species 0.000 description 1
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 1
- 241000254127 Bemisia tabaci Species 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- JQJPBYFTQAANLE-UHFFFAOYSA-N Butyl nitrite Chemical compound CCCCON=O JQJPBYFTQAANLE-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000995023 Empoasca Species 0.000 description 1
- 241000189565 Frankliniella Species 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 241000256257 Heliothis Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical class ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 241001521235 Spodoptera eridania Species 0.000 description 1
- 241001454294 Tetranychus Species 0.000 description 1
- 241001414989 Thysanoptera Species 0.000 description 1
- 241000018135 Trialeurodes Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- DSVGQVZAZSZEEX-UHFFFAOYSA-N [C].[Pt] Chemical compound [C].[Pt] DSVGQVZAZSZEEX-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- DOAYJPJLHNHQSU-UHFFFAOYSA-N aluminum;lithium;hydrate Chemical compound [Li].O.[Al] DOAYJPJLHNHQSU-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- GESZGOQOLBACSZ-UHFFFAOYSA-N copper(1+);1,2,3,4,5-pentafluorobenzene-6-ide Chemical compound [Cu+].FC1=[C-]C(F)=C(F)C(F)=C1F GESZGOQOLBACSZ-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical compound O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- ZPVOQGKXJAZROX-UHFFFAOYSA-N ethyl 3-(2-methylphenyl)benzoate Chemical compound CCOC(=O)C1=CC=CC(C=2C(=CC=CC=2)C)=C1 ZPVOQGKXJAZROX-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 244000080020 horsebean Species 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- QJOOIMSFFIUFKX-CAHLUQPWSA-N methyl (1s,3r)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)[C@H]1[C@H](C=C(Cl)Cl)C1(C)C QJOOIMSFFIUFKX-CAHLUQPWSA-N 0.000 description 1
- QJOOIMSFFIUFKX-UHFFFAOYSA-N methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate Chemical compound COC(=O)C1C(C=C(Cl)Cl)C1(C)C QJOOIMSFFIUFKX-UHFFFAOYSA-N 0.000 description 1
- KERAQDGNPUOGFF-UHFFFAOYSA-N methyl 3-(2,3,4,5,6-pentafluorophenyl)benzoate Chemical compound COC(=O)C1=CC=CC(C=2C(=C(F)C(F)=C(F)C=2F)F)=C1 KERAQDGNPUOGFF-UHFFFAOYSA-N 0.000 description 1
- NPXOIGSBRLCOSD-UHFFFAOYSA-N methyl 3-iodobenzoate Chemical compound COC(=O)C1=CC=CC(I)=C1 NPXOIGSBRLCOSD-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- VQTGUFBGYOIUFS-UHFFFAOYSA-N nitrosylsulfuric acid Chemical compound OS(=O)(=O)ON=O VQTGUFBGYOIUFS-UHFFFAOYSA-N 0.000 description 1
- 150000002895 organic esters Chemical class 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical class Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000012414 tert-butyl nitrite Substances 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- HTSABYAWKQAHBT-UHFFFAOYSA-N trans 3-methylcyclohexanol Natural products CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N53/00—Biocides, pest repellants or attractants, or plant growth regulators containing cyclopropane carboxylic acids or derivatives thereof
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/966,405 US4214004A (en) | 1978-12-04 | 1978-12-04 | Insecticidal cyclopropanecarboxylates from substituted [1,1'-biphenyl]-3-ylmethyl compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU182486B true HU182486B (en) | 1984-01-30 |
Family
ID=25511348
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU79FE1060A HU182486B (en) | 1978-12-04 | 1979-11-30 | Insecticide and acaricide compositions and process for producing bracket-1,1-biphenyl-bracket closed-3-yl-methyl-3-bracket-2,2-dihalogen-ethenyl-bracket closed-2,2-dimethyl-cyclopropane-carboxylates as active agents |
| HU824084A HU189627B (en) | 1978-12-04 | 1979-11-30 | Process for producing /1,1'-biphenyl/-3-yl-methyl-derivatives |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU824084A HU189627B (en) | 1978-12-04 | 1979-11-30 | Process for producing /1,1'-biphenyl/-3-yl-methyl-derivatives |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4214004A (show.php) |
| EP (2) | EP0063374B1 (show.php) |
| JP (2) | JPS6128653B2 (show.php) |
| AR (1) | AR228245A1 (show.php) |
| AU (1) | AU526973B2 (show.php) |
| BR (1) | BR7908936A (show.php) |
| CA (1) | CA1140574A (show.php) |
| DD (2) | DD157332A5 (show.php) |
| DK (1) | DK161141C (show.php) |
| EG (1) | EG13820A (show.php) |
| ES (1) | ES486547A1 (show.php) |
| GR (1) | GR74124B (show.php) |
| GT (1) | GT197960870A (show.php) |
| HU (2) | HU182486B (show.php) |
| IE (1) | IE49208B1 (show.php) |
| IL (1) | IL58744A (show.php) |
| MX (2) | MX5998E (show.php) |
| TR (1) | TR20753A (show.php) |
| WO (1) | WO1980001163A1 (show.php) |
| ZA (1) | ZA796583B (show.php) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2819788A1 (de) * | 1978-05-05 | 1979-11-08 | Bayer Ag | Benzylester mit fluorsubstituierten aether- und/oder thioaethergruppen und ihre verwendung als insektizide |
| US4329518A (en) * | 1979-09-18 | 1982-05-11 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4668792A (en) * | 1978-12-04 | 1987-05-26 | Fmc Corporation | Intermediates to insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4341796A (en) * | 1979-06-25 | 1982-07-27 | Fmc Corporation | Control of acarids with biphenylmethyl perhaloalkylvinylcyclopropanecarboxylates |
| US4402973A (en) * | 1980-10-02 | 1983-09-06 | Fmc Corporation | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters |
| US4473709A (en) * | 1980-07-14 | 1984-09-25 | Fmc Corporation | Pyrethroid intermediates and process |
| US4426524A (en) | 1980-09-02 | 1984-01-17 | Fmc Corporation | Heterocyclic substituted benzyl alcohol, insecticidal ester derivatives, and intermediates |
| US4339457A (en) * | 1980-10-20 | 1982-07-13 | Fmc Corporation | 3-(Pyrrol-1-yl)phenylmethyl esters and intermediates |
| US4433182A (en) * | 1981-04-30 | 1984-02-21 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4451484A (en) * | 1981-04-30 | 1984-05-29 | Fmc Corporation | Insecticidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4507317A (en) * | 1981-04-30 | 1985-03-26 | Fmc Corporation | Acaricidal 2,2'-bridged[1,1'-biphenyl]-3-ylmethyl esters |
| US4536591A (en) * | 1981-05-21 | 1985-08-20 | Fmc Corporation | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters |
| US4423234A (en) * | 1982-05-17 | 1983-12-27 | Fmc Corporation | Copper-catalyzed biaromatic coupling process |
| US4493844A (en) * | 1982-08-19 | 1985-01-15 | Fmc Corporation | Insecticidal 2,2'-bridged(1,1'-biphenyl)-3-ylmethyl carboxamides |
| USH49H (en) | 1983-01-10 | 1986-04-01 | Fmc Corporation | Process for producing 3-(2-chloro-3,3,3-trifluoro-1-propenyl)-2,2-dimethylcyclopropanecarboxylates |
| US4552892A (en) * | 1983-03-11 | 1985-11-12 | Fmc Corporation | Acaricidal difluoroethenylcyclopropanecarboxylates |
| US4465879A (en) * | 1983-08-19 | 1984-08-14 | Fmc Corporation | Process to insecticide intermediate |
| HU194526B (en) * | 1983-08-19 | 1988-02-29 | Fmc Corp | Catalytic process for producing grignard-connection |
| US4818273A (en) * | 1983-11-14 | 1989-04-04 | The Dow Chemical Company | Substituted 1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamides, compositions containing them, and their utility as herbicides |
| DE3343092A1 (de) * | 1983-11-29 | 1985-06-05 | Bayer Ag, 5090 Leverkusen | Wasserloesliche pestizide formulierung |
| US4740637A (en) * | 1984-07-26 | 1988-04-26 | Fmc Corporation | Process for hydroxymethylation |
| CA1284665C (en) * | 1984-07-26 | 1991-06-04 | Eric George Delmar | Process for hydroxymethylation |
| US6276050B1 (en) | 1998-07-20 | 2001-08-21 | Emhart Inc. | Riveting system and process for forming a riveted joint |
| WO2012150221A2 (de) | 2011-05-04 | 2012-11-08 | Bayer Cropscience Ag | Neue halogenierte benzylalkoholester der cyclopropancarbonsäure als schädlingsbekämpfungsmittel |
| CN104560053B (zh) * | 2014-12-24 | 2016-09-14 | 北京八亿时空液晶科技股份有限公司 | 含有1,3-二氟-2-甲基苯结构的液晶化合物及其制备方法 |
| CN114560772B (zh) * | 2022-02-14 | 2023-07-28 | 南昌大学 | 一种3-甲基-2-硝基苯甲酸的合成方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3156715A (en) * | 1962-09-18 | 1964-11-10 | Robert N Haszeldine | Polyfluorinated organo-mercury compounds and their preparation |
| US4053639A (en) * | 1964-01-24 | 1977-10-11 | The Boots Company Limited | Therapeutically active phenylalkane derivatives |
| GB1140748A (en) * | 1966-06-23 | 1969-01-22 | Ici Ltd | New carboxylic acid derivatives |
| CS167886B2 (show.php) * | 1968-06-06 | 1976-05-28 | ||
| BE794926A (fr) | 1971-04-23 | 1973-08-02 | Shell Int Research | Compositions biologiquement actives |
| US4024163A (en) * | 1972-05-25 | 1977-05-17 | National Research Development Corporation | Insecticides |
| US3987197A (en) * | 1972-08-17 | 1976-10-19 | Boehringer Ingelheim Gmbh | 3-(2'-fluoro-4-biphenylyl)-butyric acid and salts thereof |
| JPS5238030B2 (show.php) * | 1973-02-06 | 1977-09-27 | ||
| DE2528958A1 (de) * | 1975-06-28 | 1977-01-13 | Merck Patent Gmbh | Araliphatische dihalogenverbindungen und verfahren zu ihrer herstellung |
| US4130657A (en) * | 1977-10-20 | 1978-12-19 | Fmc Corporation | [1,1'-Biphenyl]-3-ylmethyl 3-(2,2-dihaloethenyl)-2,2-dimethylcyclopropanecarboxylates |
-
1978
- 1978-12-04 US US05/966,405 patent/US4214004A/en not_active Expired - Lifetime
-
1979
- 1979-11-08 CA CA000339499A patent/CA1140574A/en not_active Expired
- 1979-11-09 EP EP82103273A patent/EP0063374B1/en not_active Expired
- 1979-11-09 BR BRPI7908936-4A patent/BR7908936A/pt not_active IP Right Cessation
- 1979-11-09 JP JP55500106A patent/JPS6128653B2/ja not_active Expired
- 1979-11-09 WO PCT/US1979/000971 patent/WO1980001163A1/en not_active Ceased
- 1979-11-09 EP EP80900040A patent/EP0020685B1/en not_active Expired
- 1979-11-15 IE IE2188/79A patent/IE49208B1/en not_active IP Right Cessation
- 1979-11-19 IL IL58744A patent/IL58744A/xx not_active IP Right Cessation
- 1979-11-27 GR GR60609A patent/GR74124B/el unknown
- 1979-11-28 MX MX798508U patent/MX5998E/es unknown
- 1979-11-30 HU HU79FE1060A patent/HU182486B/hu not_active IP Right Cessation
- 1979-11-30 HU HU824084A patent/HU189627B/hu not_active IP Right Cessation
- 1979-11-30 AU AU53347/79A patent/AU526973B2/en not_active Ceased
- 1979-12-03 TR TR20753A patent/TR20753A/xx unknown
- 1979-12-03 EG EG718/79A patent/EG13820A/xx active
- 1979-12-03 ES ES486547A patent/ES486547A1/es not_active Expired
- 1979-12-03 GT GT197960870A patent/GT197960870A/es unknown
- 1979-12-03 AR AR279128A patent/AR228245A1/es active
- 1979-12-04 DD DD79220174A patent/DD157332A5/de unknown
- 1979-12-04 DD DD79217352A patent/DD147665A5/de unknown
- 1979-12-04 ZA ZA796583A patent/ZA796583B/xx unknown
-
1980
- 1980-08-01 DK DK332980A patent/DK161141C/da not_active IP Right Cessation
-
1984
- 1984-03-23 MX MX834184A patent/MX8341A/es unknown
- 1984-09-11 JP JP59188982A patent/JPS6094927A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GT197960870A (es) | 1981-05-26 |
| JPH0222741B2 (show.php) | 1990-05-21 |
| DK332980A (da) | 1980-08-01 |
| AR228245A1 (es) | 1983-02-15 |
| AU5334779A (en) | 1980-06-12 |
| JPS56500065A (show.php) | 1981-01-22 |
| IE49208B1 (en) | 1985-08-21 |
| IE792188L (en) | 1980-06-04 |
| EP0020685A1 (en) | 1981-01-07 |
| JPS6128653B2 (show.php) | 1986-07-01 |
| MX5998E (es) | 1984-09-18 |
| IL58744A (en) | 1983-06-15 |
| EP0063374A1 (en) | 1982-10-27 |
| DK161141C (da) | 1991-11-18 |
| ES486547A1 (es) | 1980-09-16 |
| WO1980001163A1 (en) | 1980-06-12 |
| CA1140574A (en) | 1983-02-01 |
| EG13820A (en) | 1983-03-31 |
| DD157332A5 (de) | 1982-11-03 |
| DK161141B (da) | 1991-06-03 |
| ZA796583B (en) | 1981-06-24 |
| US4214004A (en) | 1980-07-22 |
| HU189627B (en) | 1986-07-28 |
| TR20753A (tr) | 1982-06-24 |
| BR7908936A (pt) | 1981-06-30 |
| MX8341A (es) | 1993-07-01 |
| IL58744A0 (en) | 1980-02-29 |
| AU526973B2 (en) | 1983-02-10 |
| EP0063374B1 (en) | 1984-02-22 |
| JPS6094927A (ja) | 1985-05-28 |
| GR74124B (show.php) | 1984-06-06 |
| EP0020685A4 (en) | 1981-07-16 |
| EP0020685B1 (en) | 1983-06-15 |
| DD147665A5 (de) | 1981-04-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU182486B (en) | Insecticide and acaricide compositions and process for producing bracket-1,1-biphenyl-bracket closed-3-yl-methyl-3-bracket-2,2-dihalogen-ethenyl-bracket closed-2,2-dimethyl-cyclopropane-carboxylates as active agents | |
| EP0031199B1 (en) | Substituted benzyl esters of cyclopropane carboxylic acids and their preparation, compositions containing them and methods of combating insect pests therewith, and substituted benzyl alcohols | |
| EP0003336B1 (en) | Insecticidal perhaloalkylvinylcyclopropanecarboxylates | |
| US4329518A (en) | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters | |
| US4402973A (en) | Insecticidal (1,1'-biphenyl)-3-ylmethyl esters | |
| US4426524A (en) | Heterocyclic substituted benzyl alcohol, insecticidal ester derivatives, and intermediates | |
| JPH0112742B2 (show.php) | ||
| US4551546A (en) | Halogenated esters | |
| JPH0150216B2 (show.php) | ||
| US4339457A (en) | 3-(Pyrrol-1-yl)phenylmethyl esters and intermediates | |
| US4536591A (en) | Insecticidal [1,1'-biphenyl]-3-ylmethyl esters | |
| JPS6136823B2 (show.php) | ||
| US4335252A (en) | Insecticidal pyrethroid enantiomer pair | |
| US4429149A (en) | 4-Phenyl-2-indanyl esters of 1R,cis-3-(2-halo-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylic acid | |
| US4346251A (en) | 4-Substituted-2-indanols | |
| US5223536A (en) | 1,4-diaryl-1-cyclopropyl-4-substituted butanes as insecticides and acaricides | |
| US4408057A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| US4239773A (en) | Insecticidal esters of certain substituted 7-oxabicyclo[2.2.1]2,5-heptadiene methanols | |
| US4348326A (en) | Substituted 7-oxabicyclo[2,2,1]hepta-2,5-diene methanols | |
| US4442296A (en) | 4-Heterocyclic-substituted-2-indanyl alcohols and insecticidal ester derivatives | |
| KR810000386B1 (ko) | 싸이클로 프로판 유도체의 제조방법 | |
| GB2093831A (en) | 4-substituted-2-indanols and insecticidal ester derivatives | |
| EP0014593A1 (en) | Novel bicyclic alcohol and insecticidal ester derivatives, their production, and compositions containing and insecticidal methods using the esters | |
| JPS6236017B2 (show.php) | ||
| JPH0120133B2 (show.php) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |