HU177338B - Process for producing acylamino-heteroaryl compounds - Google Patents
Process for producing acylamino-heteroaryl compounds Download PDFInfo
- Publication number
- HU177338B HU177338B HU76LI294A HULI000294A HU177338B HU 177338 B HU177338 B HU 177338B HU 76LI294 A HU76LI294 A HU 76LI294A HU LI000294 A HULI000294 A HU LI000294A HU 177338 B HU177338 B HU 177338B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- alkyl
- methyl
- compound
- phenyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 31
- 150000001875 compounds Chemical class 0.000 claims abstract description 91
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 39
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 32
- 239000001301 oxygen Substances 0.000 claims abstract description 32
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 12
- 125000001072 heteroaryl group Chemical group 0.000 claims abstract description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 6
- -1 heteroaryl compound Chemical class 0.000 claims description 46
- 229910052739 hydrogen Inorganic materials 0.000 claims description 43
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 239000001257 hydrogen Substances 0.000 claims description 28
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 150000002431 hydrogen Chemical group 0.000 claims description 21
- 239000004480 active ingredient Substances 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 11
- 239000011593 sulfur Substances 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical group 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 3
- 230000002152 alkylating effect Effects 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- 125000006555 (C3-C5) cycloalkyl group Chemical group 0.000 claims 1
- FWEOQOXTVHGIFQ-UHFFFAOYSA-N 8-anilinonaphthalene-1-sulfonic acid Chemical compound C=12C(S(=O)(=O)O)=CC=CC2=CC=CC=1NC1=CC=CC=C1 FWEOQOXTVHGIFQ-UHFFFAOYSA-N 0.000 claims 1
- 206010029897 Obsessive thoughts Diseases 0.000 claims 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 230000000911 decarboxylating effect Effects 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 229910000595 mu-metal Inorganic materials 0.000 claims 1
- 230000003266 anti-allergic effect Effects 0.000 abstract description 3
- 239000005864 Sulphur Substances 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 238000004458 analytical method Methods 0.000 description 57
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 28
- 239000000203 mixture Substances 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 239000000047 product Substances 0.000 description 23
- 239000003921 oil Substances 0.000 description 20
- 235000019198 oils Nutrition 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- 150000001408 amides Chemical class 0.000 description 8
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 8
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 8
- 239000013078 crystal Substances 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 8
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 230000010933 acylation Effects 0.000 description 7
- 238000005917 acylation reaction Methods 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 6
- 125000004442 acylamino group Chemical group 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- UPZGJLYTRBYTLM-UHFFFAOYSA-M lithium;iodide;dihydrate Chemical compound [Li+].O.O.[I-] UPZGJLYTRBYTLM-UHFFFAOYSA-M 0.000 description 6
- 239000003380 propellant Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 5
- NVSGQPDFZXBUKR-UHFFFAOYSA-N 2-methyl-n-(5-methylthiophen-2-yl)propanamide Chemical compound CC(C)C(=O)NC1=CC=C(C)S1 NVSGQPDFZXBUKR-UHFFFAOYSA-N 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000007789 gas Substances 0.000 description 5
- 239000007903 gelatin capsule Substances 0.000 description 5
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical compound [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000010183 spectrum analysis Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- 229930192474 thiophene Natural products 0.000 description 4
- SMUKODJVMQOSAB-UHFFFAOYSA-N 2-ethylbutanoyl chloride Chemical compound CCC(CC)C(Cl)=O SMUKODJVMQOSAB-UHFFFAOYSA-N 0.000 description 3
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 206010020751 Hypersensitivity Diseases 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- 208000026935 allergic disease Diseases 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- 208000006673 asthma Diseases 0.000 description 3
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 3
- 235000019282 butylated hydroxyanisole Nutrition 0.000 description 3
- 229940043253 butylated hydroxyanisole Drugs 0.000 description 3
- CZBZUDVBLSSABA-UHFFFAOYSA-N butylated hydroxyanisole Chemical compound COC1=CC=C(O)C(C(C)(C)C)=C1.COC1=CC=C(O)C=C1C(C)(C)C CZBZUDVBLSSABA-UHFFFAOYSA-N 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 239000008108 microcrystalline cellulose Substances 0.000 description 3
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 3
- 229940016286 microcrystalline cellulose Drugs 0.000 description 3
- ZBQLWGDJOLHBNG-UHFFFAOYSA-N n-(5-methylthiophen-2-yl)cyclopropanecarboxamide Chemical compound S1C(C)=CC=C1NC(=O)C1CC1 ZBQLWGDJOLHBNG-UHFFFAOYSA-N 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 2
- QLSWIGRIBOSFMV-UHFFFAOYSA-N 1h-pyrrol-2-amine Chemical class NC1=CC=CN1 QLSWIGRIBOSFMV-UHFFFAOYSA-N 0.000 description 2
- RWHMERFQXIXANG-UHFFFAOYSA-N 2-[2-(cyclohexanecarbonylamino)-5-phenylthiophen-3-yl]acetic acid Chemical compound OC(=O)CC=1C=C(C=2C=CC=CC=2)SC=1NC(=O)C1CCCCC1 RWHMERFQXIXANG-UHFFFAOYSA-N 0.000 description 2
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical compound OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 description 2
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 238000006114 decarboxylation reaction Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000004185 ester group Chemical group 0.000 description 2
- LZCLXQDLBQLTDK-UHFFFAOYSA-N ethyl 2-hydroxypropanoate Chemical compound CCOC(=O)C(C)O LZCLXQDLBQLTDK-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 230000009610 hypersensitivity Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- GHPDMFBHITXJAZ-UHFFFAOYSA-N methyl 2-amino-5-methylthiophene-3-carboxylate Chemical compound COC(=O)C=1C=C(C)SC=1N GHPDMFBHITXJAZ-UHFFFAOYSA-N 0.000 description 2
- OEGTUIAPKPUIOI-UHFFFAOYSA-N n-(1-methylpyrrol-2-yl)acetamide Chemical compound CC(=O)NC1=CC=CN1C OEGTUIAPKPUIOI-UHFFFAOYSA-N 0.000 description 2
- FWGLBLBVJQPUOD-UHFFFAOYSA-N n-(5-methylthiophen-2-yl)-2-phenylacetamide Chemical compound S1C(C)=CC=C1NC(=O)CC1=CC=CC=C1 FWGLBLBVJQPUOD-UHFFFAOYSA-N 0.000 description 2
- XESOFFCUZUTHQC-UHFFFAOYSA-N n-butyl-n-(5-phenylthiophen-2-yl)benzamide Chemical compound C=1C=C(C=2C=CC=CC=2)SC=1N(CCCC)C(=O)C1=CC=CC=C1 XESOFFCUZUTHQC-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000002390 rotary evaporation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- ZNTAXEMTUMCOTJ-UHFFFAOYSA-N 1-methyl-2-nitropyrrole Chemical compound CN1C=CC=C1[N+]([O-])=O ZNTAXEMTUMCOTJ-UHFFFAOYSA-N 0.000 description 1
- HFGUJHUGZWLDMT-UHFFFAOYSA-N 2-(2-benzamido-5-phenylthiophen-3-yl)acetic acid Chemical compound OC(=O)CC=1C=C(C=2C=CC=CC=2)SC=1NC(=O)C1=CC=CC=C1 HFGUJHUGZWLDMT-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- VDGKMJYQQUTBQD-UHFFFAOYSA-N 2-(4-methylphenyl)-4,5-dihydro-1h-imidazole Chemical compound C1=CC(C)=CC=C1C1=NCCN1 VDGKMJYQQUTBQD-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-M 2-cyanoacetate Chemical compound [O-]C(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-M 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- QMZPFPPXRUKTPS-UHFFFAOYSA-N 2-methyl-n-(5-methylfuran-2-yl)propanamide Chemical compound CC(C)C(=O)NC1=CC=C(C)O1 QMZPFPPXRUKTPS-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- RVMGXWBCQGAWBR-UHFFFAOYSA-N 4-oxo-1-benzopyran-2-carboxylic acid Chemical compound C1=CC=C2OC(C(=O)O)=CC(=O)C2=C1 RVMGXWBCQGAWBR-UHFFFAOYSA-N 0.000 description 1
- IFLKEBSJTZGCJG-UHFFFAOYSA-N 5-methyl-2-thiophenecarboxylic acid Natural products CC=1C=CSC=1C(O)=O IFLKEBSJTZGCJG-UHFFFAOYSA-N 0.000 description 1
- OVOCLWJUABOAPL-UHFFFAOYSA-N 5-methylfuran-2-carboxylic acid Chemical compound CC1=CC=C(C(O)=O)O1 OVOCLWJUABOAPL-UHFFFAOYSA-N 0.000 description 1
- VCNGNQLPFHVODE-UHFFFAOYSA-N 5-methylthiophene-2-carboxylic acid Chemical compound CC1=CC=C(C(O)=O)S1 VCNGNQLPFHVODE-UHFFFAOYSA-N 0.000 description 1
- PJJRNKYPVOONED-UHFFFAOYSA-N 5-phenylthiophen-2-amine;hydrochloride Chemical compound Cl.S1C(N)=CC=C1C1=CC=CC=C1 PJJRNKYPVOONED-UHFFFAOYSA-N 0.000 description 1
- JWZMCIVGRRFEEX-UHFFFAOYSA-N 5-tert-butylfuran-2-carboxylic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)O1 JWZMCIVGRRFEEX-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- IOQGKRYHGHKTFN-UHFFFAOYSA-N CCC1=CCC(S1)(C(=O)OCC)N Chemical compound CCC1=CCC(S1)(C(=O)OCC)N IOQGKRYHGHKTFN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000881 Modified starch Polymers 0.000 description 1
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000004147 Sorbitan trioleate Substances 0.000 description 1
- PRXRUNOAOLTIEF-ADSICKODSA-N Sorbitan trioleate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H]1OC[C@H](O)[C@H]1OC(=O)CCCCCCC\C=C/CCCCCCCC PRXRUNOAOLTIEF-ADSICKODSA-N 0.000 description 1
- 208000005279 Status Asthmaticus Diseases 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 240000006474 Theobroma bicolor Species 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- MIBQYWIOHFTKHD-UHFFFAOYSA-N adamantane-1-carbonyl chloride Chemical compound C1C(C2)CC3CC2CC1(C(=O)Cl)C3 MIBQYWIOHFTKHD-UHFFFAOYSA-N 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005526 alkyl sulfate group Chemical group 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000010210 aluminium Nutrition 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 229940082500 cetostearyl alcohol Drugs 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 1
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- AFQJGIVHAURZIY-UHFFFAOYSA-N ethyl 5-ethyl-2-(2-methylpropanoylamino)thiophene-3-carboxylate Chemical compound CCOC(=O)C=1C=C(CC)SC=1NC(=O)C(C)C AFQJGIVHAURZIY-UHFFFAOYSA-N 0.000 description 1
- GIZXTZUDMRQLQQ-UHFFFAOYSA-N ethyl 5-ethyl-2-[hexyl(2-methylpropanoyl)amino]thiophene-3-carboxylate Chemical compound CCCCCCN(C(=O)C(C)C)C=1SC(CC)=CC=1C(=O)OCC GIZXTZUDMRQLQQ-UHFFFAOYSA-N 0.000 description 1
- QTDBPWPSHBVVMQ-UHFFFAOYSA-N ethyl acetate;tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl.CCOC(C)=O QTDBPWPSHBVVMQ-UHFFFAOYSA-N 0.000 description 1
- 229940116333 ethyl lactate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- UTVVREMVDJTZAC-UHFFFAOYSA-N furan-2-amine Chemical class NC1=CC=CO1 UTVVREMVDJTZAC-UHFFFAOYSA-N 0.000 description 1
- 150000002240 furans Chemical class 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000001361 intraarterial administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- AGJSNMGHAVDLRQ-HUUJSLGLSA-N methyl (2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-HUUJSLGLSA-N 0.000 description 1
- DTLHUQNLDJNECW-UHFFFAOYSA-N methyl 2-(cyclopropanecarbonylamino)-5-methylthiophene-3-carboxylate Chemical compound C1=C(C)SC(NC(=O)C2CC2)=C1C(=O)OC DTLHUQNLDJNECW-UHFFFAOYSA-N 0.000 description 1
- PXOVHWCIJDUPOW-UHFFFAOYSA-N methyl 2-amino-4-methyl-5-phenylthiophene-3-carboxylate Chemical compound COC(=O)C1=C(N)SC(C=2C=CC=CC=2)=C1C PXOVHWCIJDUPOW-UHFFFAOYSA-N 0.000 description 1
- ZSAQPDNLUCZNEF-UHFFFAOYSA-N methyl 5-methyl-2-(2-methylpropanoylamino)thiophene-3-carboxylate Chemical compound COC(=O)C=1C=C(C)SC=1NC(=O)C(C)C ZSAQPDNLUCZNEF-UHFFFAOYSA-N 0.000 description 1
- IBYZJVQPOVIUPX-UHFFFAOYSA-N methyl 5-methyl-2-[(2-phenylacetyl)amino]thiophene-3-carboxylate Chemical compound C1=C(C)SC(NC(=O)CC=2C=CC=CC=2)=C1C(=O)OC IBYZJVQPOVIUPX-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 235000019426 modified starch Nutrition 0.000 description 1
- LATWAHMSFQWEQH-UHFFFAOYSA-N n-(1-methylpyrrol-2-yl)-n-prop-2-enylacetamide Chemical compound C=CCN(C(=O)C)C1=CC=CN1C LATWAHMSFQWEQH-UHFFFAOYSA-N 0.000 description 1
- CMPQSNPRGISBPA-UHFFFAOYSA-N n-(1-methylpyrrol-3-yl)-n-prop-2-enylacetamide Chemical compound C=CCN(C(=O)C)C=1C=CN(C)C=1 CMPQSNPRGISBPA-UHFFFAOYSA-N 0.000 description 1
- QKSVRPDGALMRNW-UHFFFAOYSA-N n-(5-methylfuran-2-yl)-n-propylcyclopentanecarboxamide Chemical compound C=1C=C(C)OC=1N(CCC)C(=O)C1CCCC1 QKSVRPDGALMRNW-UHFFFAOYSA-N 0.000 description 1
- AMPZEECRYAUDMZ-UHFFFAOYSA-N n-(5-phenylthiophen-2-yl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(S1)=CC=C1C1=CC=CC=C1 AMPZEECRYAUDMZ-UHFFFAOYSA-N 0.000 description 1
- QCFAYMQDKHATMF-UHFFFAOYSA-N n-(5-phenylthiophen-2-yl)cyclohexanecarboxamide Chemical compound C1CCCCC1C(=O)NC(S1)=CC=C1C1=CC=CC=C1 QCFAYMQDKHATMF-UHFFFAOYSA-N 0.000 description 1
- UMMWIAMZNHBLDB-UHFFFAOYSA-N n-(furan-2-yl)-n-methylacetamide Chemical compound CC(=O)N(C)C1=CC=CO1 UMMWIAMZNHBLDB-UHFFFAOYSA-N 0.000 description 1
- HFJSZWFSWUAZPZ-UHFFFAOYSA-N n-(furan-2-yl)-n-prop-2-ynylcyclohexanecarboxamide Chemical compound C=1C=COC=1N(CC#C)C(=O)C1CCCCC1 HFJSZWFSWUAZPZ-UHFFFAOYSA-N 0.000 description 1
- PDXJWIAJGWPYKU-UHFFFAOYSA-N n-(furan-2-yl)cyclohexanecarboxamide Chemical compound C1CCCCC1C(=O)NC1=CC=CO1 PDXJWIAJGWPYKU-UHFFFAOYSA-N 0.000 description 1
- WBKFIFLNPFJMGA-UHFFFAOYSA-N n-(furan-3-yl)-2-methylpropanamide Chemical compound CC(C)C(=O)NC=1C=COC=1 WBKFIFLNPFJMGA-UHFFFAOYSA-N 0.000 description 1
- CSQRKKPQWGPDLM-UHFFFAOYSA-N n-[(4-bromophenyl)methyl]-2-methyl-n-(1-methylpyrrol-3-yl)propanamide Chemical compound C1=CN(C)C=C1N(C(=O)C(C)C)CC1=CC=C(Br)C=C1 CSQRKKPQWGPDLM-UHFFFAOYSA-N 0.000 description 1
- DWAUBQHHANGTSC-UHFFFAOYSA-N n-[(4-chlorophenyl)methyl]-n-(5-phenylthiophen-2-yl)benzamide Chemical compound C1=CC(Cl)=CC=C1CN(C=1SC(=CC=1)C=1C=CC=CC=1)C(=O)C1=CC=CC=C1 DWAUBQHHANGTSC-UHFFFAOYSA-N 0.000 description 1
- HICBONUPKCMSBQ-UHFFFAOYSA-N n-[(4-chlorophenyl)methyl]benzamide Chemical compound C1=CC(Cl)=CC=C1CNC(=O)C1=CC=CC=C1 HICBONUPKCMSBQ-UHFFFAOYSA-N 0.000 description 1
- AGGPCFIIUUDENX-UHFFFAOYSA-N n-benzyl-2-methyl-n-(1-methylpyrrol-3-yl)propanamide Chemical compound C1=CN(C)C=C1N(C(=O)C(C)C)CC1=CC=CC=C1 AGGPCFIIUUDENX-UHFFFAOYSA-N 0.000 description 1
- XHOOBPNSORJGFM-UHFFFAOYSA-N n-benzyl-n-(5-methylfuran-2-yl)cyclopentanecarboxamide Chemical compound O1C(C)=CC=C1N(C(=O)C1CCCC1)CC1=CC=CC=C1 XHOOBPNSORJGFM-UHFFFAOYSA-N 0.000 description 1
- ONUHXCKLRUKXMZ-UHFFFAOYSA-N n-benzyl-n-(furan-2-yl)acetamide Chemical compound C=1C=COC=1N(C(=O)C)CC1=CC=CC=C1 ONUHXCKLRUKXMZ-UHFFFAOYSA-N 0.000 description 1
- PADVRWWZMIARLT-UHFFFAOYSA-N n-butyl-2-methyl-n-(1-methylpyrrol-2-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C1=CC=CN1C PADVRWWZMIARLT-UHFFFAOYSA-N 0.000 description 1
- LFBIOZWGZLARJG-UHFFFAOYSA-N n-butyl-2-methyl-n-(1-methylpyrrol-3-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C=1C=CN(C)C=1 LFBIOZWGZLARJG-UHFFFAOYSA-N 0.000 description 1
- BDUFKGMUYSCDLA-UHFFFAOYSA-N n-butyl-2-methyl-n-(5-methylthiophen-2-yl)propanamide Chemical compound CCCCN(C(=O)C(C)C)C1=CC=C(C)S1 BDUFKGMUYSCDLA-UHFFFAOYSA-N 0.000 description 1
- HLHRLIWFZQCDGH-UHFFFAOYSA-N n-butyl-2-methyl-n-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]propanamide Chemical compound O1C(N(C(=O)C(C)C)CCCC)=CC=C1C1=CC=CC(C(F)(F)F)=C1 HLHRLIWFZQCDGH-UHFFFAOYSA-N 0.000 description 1
- DGGGASCQTTZMQR-UHFFFAOYSA-N n-butyl-n-(1-methylpyrrol-3-yl)acetamide Chemical compound CCCCN(C(C)=O)C=1C=CN(C)C=1 DGGGASCQTTZMQR-UHFFFAOYSA-N 0.000 description 1
- JFLFTXBRZFCCMR-UHFFFAOYSA-N n-butyl-n-(5-phenylfuran-2-yl)heptanamide Chemical compound O1C(N(CCCC)C(=O)CCCCCC)=CC=C1C1=CC=CC=C1 JFLFTXBRZFCCMR-UHFFFAOYSA-N 0.000 description 1
- YKRLUZZJHIXCJW-UHFFFAOYSA-N n-butyl-n-(5-tert-butylfuran-2-yl)-2-methylpropanamide Chemical compound CCCCN(C(=O)C(C)C)C1=CC=C(C(C)(C)C)O1 YKRLUZZJHIXCJW-UHFFFAOYSA-N 0.000 description 1
- NJGDBEVMGBVRMT-UHFFFAOYSA-N n-butyl-n-(furan-2-yl)-2-methylpropanamide Chemical compound CCCCN(C(=O)C(C)C)C1=CC=CO1 NJGDBEVMGBVRMT-UHFFFAOYSA-N 0.000 description 1
- OBQRDMRSVZAVDT-UHFFFAOYSA-N n-butyl-n-(furan-2-yl)cyclohexanecarboxamide Chemical compound C=1C=COC=1N(CCCC)C(=O)C1CCCCC1 OBQRDMRSVZAVDT-UHFFFAOYSA-N 0.000 description 1
- ZFNLKLCZXKBLFZ-UHFFFAOYSA-N n-butyl-n-(furan-3-yl)-2-methylpropanamide Chemical compound CCCCN(C(=O)C(C)C)C=1C=COC=1 ZFNLKLCZXKBLFZ-UHFFFAOYSA-N 0.000 description 1
- JVXGZCUWGCGJST-UHFFFAOYSA-N n-hexyl-2-methyl-n-(5-methylthiophen-2-yl)propanamide Chemical compound CCCCCCN(C(=O)C(C)C)C1=CC=C(C)S1 JVXGZCUWGCGJST-UHFFFAOYSA-N 0.000 description 1
- YZSZNFYQNJFYEZ-UHFFFAOYSA-N n-hexyl-n-(5-methylfuran-2-yl)cyclopentanecarboxamide Chemical compound C=1C=C(C)OC=1N(CCCCCC)C(=O)C1CCCC1 YZSZNFYQNJFYEZ-UHFFFAOYSA-N 0.000 description 1
- UWARCTWZFKDNSU-UHFFFAOYSA-N n-hexyl-n-(5-methylfuran-2-yl)heptanamide Chemical compound CCCCCCC(=O)N(CCCCCC)C1=CC=C(C)O1 UWARCTWZFKDNSU-UHFFFAOYSA-N 0.000 description 1
- IMSLYUUYTMUMID-UHFFFAOYSA-N n-methyl-n-(5-methylfuran-2-yl)benzamide Chemical compound C=1C=C(C)OC=1N(C)C(=O)C1=CC=CC=C1 IMSLYUUYTMUMID-UHFFFAOYSA-N 0.000 description 1
- YXKUCIXJMDYYRB-UHFFFAOYSA-N n-methyl-n-(5-phenylthiophen-2-yl)benzamide Chemical compound C=1C=C(C=2C=CC=CC=2)SC=1N(C)C(=O)C1=CC=CC=C1 YXKUCIXJMDYYRB-UHFFFAOYSA-N 0.000 description 1
- NOVWFVZMRSROID-UHFFFAOYSA-N n-methyl-n-(5-phenylthiophen-2-yl)cyclohexanecarboxamide Chemical compound C=1C=C(C=2C=CC=CC=2)SC=1N(C)C(=O)C1CCCCC1 NOVWFVZMRSROID-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229940055577 oleyl alcohol Drugs 0.000 description 1
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229940045681 other alkylating agent in atc Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920006316 polyvinylpyrrolidine Polymers 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000004237 preparative chromatography Methods 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 239000000473 propyl gallate Substances 0.000 description 1
- 235000010388 propyl gallate Nutrition 0.000 description 1
- 229940075579 propyl gallate Drugs 0.000 description 1
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 1
- 229960003415 propylparaben Drugs 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 150000003233 pyrroles Chemical class 0.000 description 1
- 239000003169 respiratory stimulant agent Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 235000019337 sorbitan trioleate Nutrition 0.000 description 1
- 229960000391 sorbitan trioleate Drugs 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- VLKIAAIBGOPSEY-UHFFFAOYSA-N tert-butyl n-(5-methylfuran-2-yl)carbamate Chemical compound CC1=CC=C(NC(=O)OC(C)(C)C)O1 VLKIAAIBGOPSEY-UHFFFAOYSA-N 0.000 description 1
- SLFXZJQCKKOIHO-UHFFFAOYSA-N tert-butyl n-(5-phenylfuran-2-yl)carbamate Chemical compound O1C(NC(=O)OC(C)(C)C)=CC=C1C1=CC=CC=C1 SLFXZJQCKKOIHO-UHFFFAOYSA-N 0.000 description 1
- QUPYDDORIVFDHP-UHFFFAOYSA-N tert-butyl n-(furan-2-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=CO1 QUPYDDORIVFDHP-UHFFFAOYSA-N 0.000 description 1
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontyl alcohol Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical class Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 210000002105 tongue Anatomy 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 235000012431 wafers Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/66—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/36—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB24223/75A GB1548398A (en) | 1975-06-05 | 1975-06-05 | Acylamino pyrroles furans and thiophenes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU177338B true HU177338B (en) | 1981-09-28 |
Family
ID=10208332
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU76LI294A HU177338B (en) | 1975-06-05 | 1976-06-03 | Process for producing acylamino-heteroaryl compounds |
Country Status (31)
| Country | Link |
|---|---|
| US (3) | US4088773A (en:Method) |
| JP (1) | JPS51149264A (en:Method) |
| AR (1) | AR214974A1 (en:Method) |
| AT (1) | AT355011B (en:Method) |
| AU (1) | AU505603B2 (en:Method) |
| BE (1) | BE842577A (en:Method) |
| BG (1) | BG27358A3 (en:Method) |
| CA (1) | CA1090794A (en:Method) |
| CH (1) | CH616660A5 (en:Method) |
| CS (1) | CS189771B2 (en:Method) |
| DD (1) | DD125076A5 (en:Method) |
| DE (1) | DE2625242A1 (en:Method) |
| DK (1) | DK243476A (en:Method) |
| ES (1) | ES448588A1 (en:Method) |
| FR (1) | FR2313032A1 (en:Method) |
| GB (1) | GB1548398A (en:Method) |
| GR (1) | GR60435B (en:Method) |
| HU (1) | HU177338B (en:Method) |
| IE (1) | IE43473B1 (en:Method) |
| IL (1) | IL49690A (en:Method) |
| MX (1) | MX3637E (en:Method) |
| NL (1) | NL7606120A (en:Method) |
| NZ (1) | NZ181009A (en:Method) |
| PH (3) | PH14688A (en:Method) |
| PL (1) | PL103100B1 (en:Method) |
| PT (1) | PT65181B (en:Method) |
| RO (1) | RO70686A (en:Method) |
| SE (1) | SE426591B (en:Method) |
| SU (1) | SU655313A3 (en:Method) |
| YU (1) | YU137076A (en:Method) |
| ZA (1) | ZA762363B (en:Method) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4269849A (en) * | 1979-02-22 | 1981-05-26 | Chevron Research Company | Fungicidal 3-(N-cycloalkylcarbonyl-N-arylamino)-gamma-butyrolactones and gamma-butyrothiolactones |
| FR2502153A1 (fr) * | 1981-03-19 | 1982-09-24 | Rech Pharmaceutiq Medicale | Acides (2-oxo-3-tetrahydrothienylcarbamoyl)-alkylthio) acetiques, leurs sels et leurs esters, leur procede de preparation et les compositions pharmaceutiques en contenant |
| EP0078860A1 (en) * | 1981-11-07 | 1983-05-18 | A. Nattermann & Cie. GmbH | New 5-(N-alkyl-N-acyl-amino)-thiophen-2-carboxylic acid derivatives, process for producing the same and pharmaceutical compounds containing the same |
| US4349686A (en) * | 1981-11-12 | 1982-09-14 | A. Nattermann & Cie Gmbh | 5-(N-Alkyl-N-acyl-amino)-thiophen-2-carboxylic acid derivatives |
| CH655312A5 (de) * | 1982-02-09 | 1986-04-15 | Sandoz Ag | Chloracetamide. |
| US4666502A (en) * | 1982-02-09 | 1987-05-19 | Sandoz Ltd. | Herbicidal N-thienyl-chloroacetamides |
| DE3348463C2 (de) * | 1982-02-09 | 1995-03-30 | Sandoz Ag | Thiophenverbindungen |
| DE3331874A1 (de) * | 1982-09-13 | 1984-04-05 | Sandoz-Patent-GmbH, 7850 Lörrach | Neue thiophenderivate |
| US4643758A (en) * | 1982-09-30 | 1987-02-17 | Eli Lilly And Company | Herbicidal furyl-, thienyl- and pyrrolyl-2-pyrrolidinones |
| US5047555A (en) * | 1988-12-13 | 1991-09-10 | Tanabe Seiyaku Co., Ltd. | 4-aminophenol derivatives and processes for preparing the same |
| EP0390739B1 (de) * | 1989-03-28 | 1995-08-09 | Ciba-Geigy Ag | Substituierte Aminopyrrole als Stabilisatoren chlorhaltige Polymerisate |
| US6906069B1 (en) | 1999-01-08 | 2005-06-14 | Amgen Inc. | LXR modulators |
| AU2000235960A1 (en) * | 2000-02-14 | 2001-08-27 | Tularik, Inc. | Lxr modulators |
| AU2003208952B2 (en) | 2002-01-30 | 2008-04-24 | Amgen Inc. | Heterocyclic arylsulfonamidobenzylic compounds |
| WO2006081389A1 (en) * | 2005-01-25 | 2006-08-03 | Synta Pharmaceuticals Corp. | Thiophene compounds for inflammation and immune-related uses |
| AU2008299220B2 (en) * | 2007-09-10 | 2011-07-21 | Calcimedica, Inc. | Compounds that modulate intracellular calcium |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2437465A (en) * | 1942-07-13 | 1948-03-09 | Ici Ltd | Manufacture of new coloring matters |
| US2785181A (en) * | 1954-04-19 | 1957-03-12 | American Cyanamid Co | Substituted aminopyrrolecarboxylic acids and esters |
| US2797228A (en) * | 1955-08-02 | 1957-06-25 | American Cyanamid Co | Alkylpyrrole carboxylic acids and derivatives thereof |
| FR1186904A (fr) * | 1956-03-28 | 1959-09-03 | Geigy Ag J R | Amines tertiaires de la série du tétrahydrofurane et leur procédé de préparation |
| US2901489A (en) * | 1956-12-04 | 1959-08-25 | American Cyanamid Co | Substituted pyrroles |
| US3152136A (en) * | 1958-10-30 | 1964-10-06 | Dow Chemical Co | Dinitroaroyl-nu-pyridyl amides |
| FR86210E (en:Method) * | 1963-04-04 | 1966-03-23 | ||
| US3506678A (en) * | 1967-02-21 | 1970-04-14 | Merck & Co Inc | Certain 2-substituted thieno(2,3-d) imidazoles |
| US3577440A (en) * | 1968-12-23 | 1971-05-04 | Robins Co Inc A H | 1-substituted-3-amido-pyrrolidines |
| US3966957A (en) * | 1972-04-03 | 1976-06-29 | A. H. Robins Company, Incorporated | Method for controlling emesis with N-(1-substituted-3-pyrrolidinyl)benzamides and thiobenzamides |
| GB1427945A (en) * | 1973-08-22 | 1976-03-10 | Lepetit Spa | Aminopyrrole derivatives |
-
1975
- 1975-06-05 GB GB24223/75A patent/GB1548398A/en not_active Expired
-
1976
- 1976-04-21 ZA ZA762363A patent/ZA762363B/xx unknown
- 1976-05-31 NZ NZ181009A patent/NZ181009A/xx unknown
- 1976-05-31 IE IE1146/76A patent/IE43473B1/en unknown
- 1976-05-31 CA CA253,730A patent/CA1090794A/en not_active Expired
- 1976-05-31 IL IL49690A patent/IL49690A/xx unknown
- 1976-06-01 US US05/691,964 patent/US4088773A/en not_active Expired - Lifetime
- 1976-06-01 RO RO7686317A patent/RO70686A/ro unknown
- 1976-06-01 US US05/691,961 patent/US4082771A/en not_active Expired - Lifetime
- 1976-06-01 AR AR263473A patent/AR214974A1/es active
- 1976-06-01 GR GR50866A patent/GR60435B/el unknown
- 1976-06-02 SE SE7606224A patent/SE426591B/xx unknown
- 1976-06-02 DK DK243476A patent/DK243476A/da not_active Application Discontinuation
- 1976-06-03 AU AU14620/76A patent/AU505603B2/en not_active Expired
- 1976-06-03 BE BE6045537A patent/BE842577A/xx not_active IP Right Cessation
- 1976-06-03 HU HU76LI294A patent/HU177338B/hu unknown
- 1976-06-03 CH CH699076A patent/CH616660A5/fr not_active IP Right Cessation
- 1976-06-03 PT PT65181A patent/PT65181B/pt unknown
- 1976-06-04 DE DE19762625242 patent/DE2625242A1/de not_active Withdrawn
- 1976-06-04 ES ES448588A patent/ES448588A1/es not_active Expired
- 1976-06-04 FR FR7616974A patent/FR2313032A1/fr active Granted
- 1976-06-04 PH PH18536A patent/PH14688A/en unknown
- 1976-06-04 SU SU762365996A patent/SU655313A3/ru active
- 1976-06-04 BG BG033365A patent/BG27358A3/xx unknown
- 1976-06-04 DD DD193204A patent/DD125076A5/xx unknown
- 1976-06-04 MX MX76266U patent/MX3637E/es unknown
- 1976-06-04 PL PL1976190131A patent/PL103100B1/pl unknown
- 1976-06-04 JP JP51066025A patent/JPS51149264A/ja active Pending
- 1976-06-04 NL NL7606120A patent/NL7606120A/xx not_active Application Discontinuation
- 1976-06-04 AT AT412476A patent/AT355011B/de not_active IP Right Cessation
- 1976-06-04 CS CS763713A patent/CS189771B2/cs unknown
- 1976-06-13 YU YU01370/76A patent/YU137076A/xx unknown
-
1979
- 1979-01-12 US US06/002,835 patent/US4222946A/en not_active Expired - Lifetime
-
1981
- 1981-01-29 PH PH25151A patent/PH15711A/en unknown
- 1981-01-29 PH PH25152A patent/PH16022A/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100425405B1 (ko) | 피라졸카르복실산 유도체, 그의 제조 방법, 및 그를함유하는 제약 조성물 | |
| HU177338B (en) | Process for producing acylamino-heteroaryl compounds | |
| JP3137222B2 (ja) | 置換されたn−ピペリジノ−ピラゾール−3−カルボキサミド | |
| EP0674624B1 (en) | Pyrazoles having crf antagonist activity | |
| RU2184731C2 (ru) | Амиды аминотиофенкарбоновой кислоты, способ их получения (варианты) и фармацевтическая композиция | |
| US4110337A (en) | Triazolobenzodiazepines | |
| JPH0236163A (ja) | 新規なヒドロキサメート誘導体 | |
| US4166123A (en) | Acylaminopyrazoles | |
| HU198030B (en) | Process for production of derivatives of benzotiasole and benzotiophen and medical preparatives containing these compounds as active substance | |
| GB2130205A (en) | Improvements in or relating to 3-aryl-5-pyrazole derivatives | |
| US5110831A (en) | Vinylogous hydroxamic acids and derivatives thereof as 5-lipoxygenase inhibitors | |
| IE880002L (en) | Heteroaryl 3-oxo-propanenitrile derivatives | |
| WO1996034856A1 (en) | 2-ureido-benzamide derivatives | |
| IL46027A (en) | Organo-metallic compounds their preparation and pharmaceutical compositions containing them | |
| US4042706A (en) | Novel anti-inflammatory pyrazole derivatives and preparation thereof | |
| DE69605975T2 (de) | Arylalkyl(thio)carboxamidverbindungen mit Affinität für Melatoninrezeptoren, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zusammensetzungen | |
| US3644631A (en) | Therapeutic methods utilizing aryl pyrrol-3-yl ketones | |
| US4187232A (en) | Acylamino derivatives | |
| US5158971A (en) | Pharmaceutical compounds | |
| KR940011151B1 (ko) | 시클로알킬 우레아 화합물 | |
| DD146046A5 (de) | Verfahren zur herstellung von auronderivaten | |
| JPS63246364A (ja) | 薬剤化合物 | |
| KR830001838B1 (ko) | 페닐-퀴놀리지딘의 제조방법 | |
| IE45905B1 (en) | Substituted furan and thiophen alkyl ketones | |
| WO2000053581A2 (en) | Heterocyclic compounds having antitumor activity |