GB632270A - Stabilised polythene compositions - Google Patents
Stabilised polythene compositionsInfo
- Publication number
- GB632270A GB632270A GB25713/47A GB2571347A GB632270A GB 632270 A GB632270 A GB 632270A GB 25713/47 A GB25713/47 A GB 25713/47A GB 2571347 A GB2571347 A GB 2571347A GB 632270 A GB632270 A GB 632270A
- Authority
- GB
- United Kingdom
- Prior art keywords
- polythene
- sulphur
- hydrocarbon group
- para
- nitrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000573 polyethylene Polymers 0.000 title abstract 4
- 239000000203 mixture Substances 0.000 title abstract 2
- -1 beta-thiopropionic acid ester Chemical class 0.000 abstract 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 2
- 239000005864 Sulphur Substances 0.000 abstract 2
- 150000002148 esters Chemical class 0.000 abstract 2
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 2
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 abstract 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 abstract 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 abstract 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 abstract 1
- 239000007900 aqueous suspension Substances 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 abstract 1
- 238000000576 coating method Methods 0.000 abstract 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 abstract 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 abstract 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 abstract 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 abstract 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 abstract 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- 238000003801 milling Methods 0.000 abstract 1
- 125000001624 naphthyl group Chemical group 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- RUVINXPYWBROJD-UHFFFAOYSA-N para-methoxyphenyl Natural products COC1=CC=C(C=CC)C=C1 RUVINXPYWBROJD-UHFFFAOYSA-N 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
- 239000008096 xylene Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/37—Thiols
- C08K5/372—Sulfides, e.g. R-(S)x-R'
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US699341A US2519755A (en) | 1946-09-25 | 1946-09-25 | Thiodipropionates-polythene antioxidants |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB632270A true GB632270A (en) | 1949-11-18 |
Family
ID=24808900
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB25713/47A Expired GB632270A (en) | 1946-09-25 | 1947-09-22 | Stabilised polythene compositions |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2519755A (enExample) |
| BE (1) | BE477172A (enExample) |
| FR (1) | FR956489A (enExample) |
| GB (1) | GB632270A (enExample) |
| NL (1) | NL65773C (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2605250A (en) * | 1949-01-18 | 1952-07-29 | Us Rubber Co | Rubber anticracking chemicals |
| GB771857A (en) * | 1954-08-26 | 1957-04-03 | Metal & Thermit Corp | Composition |
| DE1025139B (de) * | 1955-11-18 | 1958-02-27 | Hoechst Ag | Verfahren zur Verminderung der Abbau- und Versproedungsneigung von Polyolefinen |
| NL97325C (enExample) * | 1955-12-15 | |||
| US3006829A (en) * | 1956-03-15 | 1961-10-31 | Grace W R & Co | Process for treating linear polypropylene |
| DE1096597B (de) * | 1956-08-25 | 1961-01-05 | Hoechst Ag | Verfahren zum Stabilisieren von Homo- und Mischpolymerisaten von Olefinen |
| US2956982A (en) * | 1957-01-24 | 1960-10-18 | Eastman Kodak Co | Stabilization of polyethylene |
| GB837164A (en) * | 1958-01-31 | 1960-06-09 | Petrochemicals Ltd | Improvements in or relating to polymeric material comprising low pressure ziegler polyolefines |
| LU37064A1 (enExample) * | 1958-04-04 | Hercules Powder Co Ltd | ||
| DE1191567B (de) * | 1958-09-18 | 1965-04-22 | Du Pont | Formmassen aus Propylenpolymerisaten und einer Stabilisatorkombination |
| DE1104692B (de) * | 1958-12-19 | 1961-04-13 | Bayer Ag | Verfahren zum Stabilisieren von Polyolefinen |
| US3496128A (en) * | 1959-02-05 | 1970-02-17 | Avisun Corp | Stabilization of polypropylene |
| US3243408A (en) * | 1959-05-04 | 1966-03-29 | American Cyanamid Co | Stabilized polyolefin compositions |
| NL124403C (enExample) * | 1959-05-27 | |||
| US2998405A (en) * | 1959-08-25 | 1961-08-29 | Hercules Powder Co Ltd | Stabilized polyolefin compositions |
| US3454522A (en) * | 1959-10-23 | 1969-07-08 | Eastman Kodak Co | Black polyethylene compositions stabilized against ultra-violet light degradation with a synergistic mixture of carbon black and a diester of 3,3-thiodipropionic acid |
| NL258714A (enExample) * | 1959-12-05 | |||
| BE598430A (enExample) * | 1959-12-21 | |||
| GB890761A (en) * | 1959-12-31 | 1962-03-07 | Ici Ltd | Copper articles coated with polypropylene compositions |
| NL260309A (enExample) * | 1960-01-21 | |||
| BE599358A (enExample) * | 1960-01-25 | |||
| US3450671A (en) * | 1960-01-29 | 1969-06-17 | Eastman Kodak Co | Poly-alpha-olefin compositions containing dialkyl - 3,3' - thiodipropionates and polyphenols |
| US3016363A (en) * | 1960-02-15 | 1962-01-09 | Eastman Kodak Co | Poly-alpha-olefin compositions containing dialkyl-3, 3'-thiodipropionates and alkylated hydroquinone monoglycidyl ethers |
| IT649411A (enExample) * | 1960-03-23 | |||
| US3072603A (en) * | 1960-03-23 | 1963-01-08 | Eastman Kodak Co | Poly-alpha-olefin compositions containing dialkyl-3, 3'-thiodipropionates and a nitrogen containing compound |
| NL267526A (enExample) * | 1960-08-01 | 1964-08-10 | ||
| NL130891C (enExample) * | 1960-11-10 | |||
| NL124224C (enExample) * | 1960-12-01 | |||
| BE622031A (enExample) * | 1961-09-05 | |||
| US3227677A (en) * | 1962-01-02 | 1966-01-04 | Phillips Petroleum Co | Polyolefins containing bis(hydrocarbyloxycarbonylalkylthioalkyl) phenols as stabilizers |
| US3282890A (en) * | 1962-07-25 | 1966-11-01 | Eastman Kodak Co | Poly-alpha-olefins containing a diester of 3, 3'-thiodipropionic acid and 3-hydroxy-2, 2, 4-trimethylpentyl isobutyrate and optionally a sterically hindered phenol as stabilizers |
| US3190852A (en) * | 1962-07-31 | 1965-06-22 | Shell Oil Co | Polyolefins stabilized with a combination of dialkyl thiodipropionates and polyphenols |
| US3226357A (en) * | 1962-09-11 | 1965-12-28 | Nat Distillers Chem Corp | Polyolefins stabilized with derivatives of xylylene thioethers |
| GB978161A (enExample) * | 1962-09-17 | |||
| US3262910A (en) * | 1962-10-18 | 1966-07-26 | Monsanto Co | Stabilized polypropionaldehyde containing triphenylphosphine and dilauryl thiodipropionate as stabilizers |
| NL121883C (enExample) * | 1962-10-31 | |||
| FR86656E (fr) * | 1963-09-16 | 1966-03-25 | Eastman Kodak Co | Poly-alpha-oléfines stabilisées |
| US3313754A (en) * | 1964-12-16 | 1967-04-11 | Hercules Inc | Alloys of polyolefins and rosin derivatives |
| US3376250A (en) * | 1965-01-22 | 1968-04-02 | Eastman Kodak Co | Ultraviolet light stabilized, zinc oxide pigmented, 1-olefin resin composition |
| US3487044A (en) * | 1968-09-23 | 1969-12-30 | Eastman Kodak Co | Thiodipropionates and phenolic stabilized polyolefin compositions |
| US3678047A (en) * | 1970-04-27 | 1972-07-18 | Goodrich Co B F | Alkylhydroxyphenylcarboalkoxy-substituted isocyanurates |
| US4604417A (en) * | 1984-12-10 | 1986-08-05 | The Goodyear Tire & Rubber Company | Polymerizable thioester synergists |
| CA2064622C (en) * | 1991-04-03 | 2005-01-18 | Mohammed Shahid | Thioester polymerization modifiers |
| FR2806732B1 (fr) * | 2000-03-24 | 2004-05-14 | Rhodia Chimie Sa | Procede de stabilisation de moules en elastomere silicone |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL42295C (enExample) * | 1934-01-20 | |||
| US2397960A (en) * | 1944-08-28 | 1946-04-09 | Du Pont | Food antioxidants |
-
0
- BE BE477172D patent/BE477172A/xx unknown
- NL NL65773D patent/NL65773C/xx active
- FR FR956489D patent/FR956489A/fr not_active Expired
-
1946
- 1946-09-25 US US699341A patent/US2519755A/en not_active Expired - Lifetime
-
1947
- 1947-09-22 GB GB25713/47A patent/GB632270A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US2519755A (en) | 1950-08-22 |
| NL65773C (enExample) | |
| BE477172A (enExample) | |
| FR956489A (enExample) | 1950-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB632270A (en) | Stabilised polythene compositions | |
| ATE21699T1 (de) | Verfahren zur herstellung von 2-penemverbindungen. | |
| ES483767A1 (es) | Procedimiento para producir n-arilsulfonil-l-argininamidas | |
| SE7906026L (sv) | Metafenylendiaminer och fergkompositioner, som innehaller dessa foreningar | |
| SE7507254L (sv) | Kompositioner i fast form for tvettning, rengoring och blekning, sett att framstella desamma och deras anvendning. | |
| GB1014912A (en) | Esters of n-disubstituted amino amic acids and their use as plant growth regulants | |
| SE8003095L (sv) | Sett att ferga har samt komposition och forening herfor | |
| NZ236083A (en) | Phenyl thioglyoxylic acid methyl ester o-methyloxime derivatives and fungicidal compositions | |
| GB1303346A (enExample) | ||
| ES416891A1 (es) | Un procedimiento de preparacion de derivados de acido suc- cinico. | |
| GB820661A (en) | Halogenated aminoisophthalic acids and derivatives thereof | |
| GB840155A (en) | Improvements in or relating to pharmaceutical compositions | |
| GB860856A (en) | Improvements in or relating to phytohormonal compositions | |
| GB927979A (en) | Polymeric compositions | |
| GB1296102A (enExample) | ||
| SE405113B (sv) | Forfarande for framstellning av pyroglutamylforeningar med antidepressiv verkan | |
| GB631917A (en) | Improvements in or relating to moulding compositions containing acrylic polymers and the application thereof | |
| NO144422C (no) | Analogifremgangsmaate ved fremstilling av 10,11-dihydro-3-carboxycyproheptadin. | |
| GB1113382A (en) | Novel pyrimidine derivatives and their preparation | |
| ES483307A1 (es) | Procedimiento para la preparacion de halogenosulfamoilben- cenos | |
| GB891004A (en) | Improvements in or relating to tetrocycline derivatives | |
| FR2322160A1 (fr) | Copolymeres comportant des atomes d'halogene et des groupes phosphonates | |
| GB776322A (en) | 1-(p-aminophenyl)-3-aminopyrazolines and their production | |
| GB760603A (en) | Anaesthetic compositions | |
| GB825413A (en) | Cosmetic preparations containing stilbene derivatives |