GB1573770A - Bis-(alkyl piperidyl) malonate derivatives of use as stabilisers for polymers - Google Patents
Bis-(alkyl piperidyl) malonate derivatives of use as stabilisers for polymers Download PDFInfo
- Publication number
- GB1573770A GB1573770A GB18538/77A GB1853877A GB1573770A GB 1573770 A GB1573770 A GB 1573770A GB 18538/77 A GB18538/77 A GB 18538/77A GB 1853877 A GB1853877 A GB 1853877A GB 1573770 A GB1573770 A GB 1573770A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkyl
- benzyl
- bis
- hydrogen
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000002690 malonic acid derivatives Chemical class 0.000 title claims description 22
- 239000003381 stabilizer Substances 0.000 title claims description 18
- 229920000642 polymer Polymers 0.000 title claims description 13
- -1 oxyl Chemical group 0.000 claims description 88
- 239000001257 hydrogen Substances 0.000 claims description 39
- 229910052739 hydrogen Inorganic materials 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 33
- 238000000034 method Methods 0.000 claims description 33
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 22
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 239000004033 plastic Substances 0.000 claims description 18
- 229920003023 plastic Polymers 0.000 claims description 18
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 17
- 239000000203 mixture Substances 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 150000002431 hydrogen Chemical class 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 239000000463 material Substances 0.000 claims description 13
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 claims description 11
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 10
- RYFCSKVXWRJEOB-UHFFFAOYSA-N dibenzyl propanedioate Chemical compound C=1C=CC=CC=1COC(=O)CC(=O)OCC1=CC=CC=C1 RYFCSKVXWRJEOB-UHFFFAOYSA-N 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 9
- 125000005394 methallyl group Chemical group 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000001931 aliphatic group Chemical group 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 229910052740 iodine Inorganic materials 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 7
- AOESAXAWXYJFNC-UHFFFAOYSA-N bis(prop-2-enyl) propanedioate Chemical compound C=CCOC(=O)CC(=O)OCC=C AOESAXAWXYJFNC-UHFFFAOYSA-N 0.000 claims description 7
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 6
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 claims description 5
- 125000002723 alicyclic group Chemical group 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 claims description 5
- 229920000098 polyolefin Polymers 0.000 claims description 5
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 4
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- BMEDLUMUKAQXMT-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-dibenzylpropanedioate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)C(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)(CC=1C=CC=CC=1)CC1=CC=CC=C1 BMEDLUMUKAQXMT-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000000155 melt Substances 0.000 claims description 3
- 229920002635 polyurethane Polymers 0.000 claims description 3
- 239000004814 polyurethane Substances 0.000 claims description 3
- 239000011814 protection agent Substances 0.000 claims description 3
- 230000003019 stabilising effect Effects 0.000 claims description 3
- 239000004604 Blowing Agent Substances 0.000 claims description 2
- 239000004793 Polystyrene Substances 0.000 claims description 2
- 240000008042 Zea mays Species 0.000 claims description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 claims description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 claims description 2
- 239000003963 antioxidant agent Substances 0.000 claims description 2
- 239000002216 antistatic agent Substances 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- 235000005822 corn Nutrition 0.000 claims description 2
- 238000004132 cross linking Methods 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 238000010348 incorporation Methods 0.000 claims description 2
- 239000000314 lubricant Substances 0.000 claims description 2
- 239000006078 metal deactivator Substances 0.000 claims description 2
- 150000004965 peroxy acids Chemical class 0.000 claims description 2
- 239000000049 pigment Substances 0.000 claims description 2
- 239000004014 plasticizer Substances 0.000 claims description 2
- 229920000728 polyester Polymers 0.000 claims description 2
- 229920000570 polyether Polymers 0.000 claims description 2
- 229920002223 polystyrene Polymers 0.000 claims description 2
- LJZPPWWHKPGCHS-UHFFFAOYSA-N propargyl chloride Chemical compound ClCC#C LJZPPWWHKPGCHS-UHFFFAOYSA-N 0.000 claims description 2
- 239000012779 reinforcing material Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 2
- 239000011630 iodine Substances 0.000 claims 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 239000004698 Polyethylene Substances 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 230000003078 antioxidant effect Effects 0.000 claims 1
- RLVKZFOXSWDGCL-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-diethylpropanedioate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)C(CC)(CC)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 RLVKZFOXSWDGCL-UHFFFAOYSA-N 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 150000002118 epoxides Chemical class 0.000 claims 1
- 239000000945 filler Substances 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 230000004048 modification Effects 0.000 claims 1
- 229920000573 polyethylene Polymers 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 6
- 229940073608 benzyl chloride Drugs 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 6
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 5
- NFKGQHYUYGYHIS-UHFFFAOYSA-N dibutyl propanedioate Chemical compound CCCCOC(=O)CC(=O)OCCCC NFKGQHYUYGYHIS-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- CZFZJPUIMMJHSW-UHFFFAOYSA-N 2-benzyl-3-butoxy-3-oxopropanoic acid Chemical compound C(CCC)OC(C(C(=O)O)CC1=CC=CC=C1)=O CZFZJPUIMMJHSW-UHFFFAOYSA-N 0.000 description 4
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical class O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 150000001339 alkali metal compounds Chemical class 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- FGHCYIPZQUMLRQ-UHFFFAOYSA-N 2,6-dibromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=CC(=O)C=C(Br)C1=O FGHCYIPZQUMLRQ-UHFFFAOYSA-N 0.000 description 3
- 125000003352 4-tert-butyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 230000008033 biological extinction Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- KYCZMGBGMMBQAH-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C(CC)(CC)C(=O)OC1CC(C)(C)NC(C)(C)C1 KYCZMGBGMMBQAH-UHFFFAOYSA-N 0.000 description 3
- 229940125904 compound 1 Drugs 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000005809 transesterification reaction Methods 0.000 description 3
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- 125000006040 2-hexenyl group Chemical group 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- DDKLCRRSUQTBPC-UHFFFAOYSA-N 3-O-benzyl 1-O-octyl propanedioate Chemical compound C(CC(=O)OCC1=CC=CC=C1)(=O)OCCCCCCCC DDKLCRRSUQTBPC-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- HUVXRECPRXSYKJ-UHFFFAOYSA-N bis(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl) 2,2-dibenzylpropanedioate Chemical compound C1C(C)(C)N(CCCCCCCC)C(C)(C)CC1OC(=O)C(C(=O)OC1CC(C)(C)N(CCCCCCCC)C(C)(C)C1)(CC=1C=CC=CC=1)CC1=CC=CC=C1 HUVXRECPRXSYKJ-UHFFFAOYSA-N 0.000 description 2
- RSDBZQKUILQTCZ-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibenzylpropanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C(C(=O)OC1CC(C)(C)NC(C)(C)C1)(CC=1C=CC=CC=1)CC1=CC=CC=C1 RSDBZQKUILQTCZ-UHFFFAOYSA-N 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000004922 lacquer Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000000199 molecular distillation Methods 0.000 description 2
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 2
- LKPFBGKZCCBZDK-UHFFFAOYSA-N n-hydroxypiperidine Chemical class ON1CCCCC1 LKPFBGKZCCBZDK-UHFFFAOYSA-N 0.000 description 2
- 239000011368 organic material Substances 0.000 description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229920001059 synthetic polymer Polymers 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- AOSZTAHDEDLTLQ-AZKQZHLXSA-N (1S,2S,4R,8S,9S,11S,12R,13S,19S)-6-[(3-chlorophenyl)methyl]-12,19-difluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one Chemical compound C([C@@H]1C[C@H]2[C@H]3[C@]([C@]4(C=CC(=O)C=C4[C@@H](F)C3)C)(F)[C@@H](O)C[C@@]2([C@@]1(C1)C(=O)CO)C)N1CC1=CC=CC(Cl)=C1 AOSZTAHDEDLTLQ-AZKQZHLXSA-N 0.000 description 1
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 1
- SZUVGFMDDVSKSI-WIFOCOSTSA-N (1s,2s,3s,5r)-1-(carboxymethyl)-3,5-bis[(4-phenoxyphenyl)methyl-propylcarbamoyl]cyclopentane-1,2-dicarboxylic acid Chemical compound O=C([C@@H]1[C@@H]([C@](CC(O)=O)([C@H](C(=O)N(CCC)CC=2C=CC(OC=3C=CC=CC=3)=CC=2)C1)C(O)=O)C(O)=O)N(CCC)CC(C=C1)=CC=C1OC1=CC=CC=C1 SZUVGFMDDVSKSI-WIFOCOSTSA-N 0.000 description 1
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- ITOFPJRDSCGOSA-KZLRUDJFSA-N (2s)-2-[[(4r)-4-[(3r,5r,8r,9s,10s,13r,14s,17r)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound C([C@H]1CC2)[C@H](O)CC[C@]1(C)[C@@H](CC[C@]13C)[C@@H]2[C@@H]3CC[C@@H]1[C@H](C)CCC(=O)N[C@H](C(O)=O)CC1=CNC2=CC=CC=C12 ITOFPJRDSCGOSA-KZLRUDJFSA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- XCPFSALHURPPJE-UHFFFAOYSA-N (3,5-ditert-butyl-4-hydroxyphenyl) propanoate Chemical compound CCC(=O)OC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 XCPFSALHURPPJE-UHFFFAOYSA-N 0.000 description 1
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- MHCVCKDNQYMGEX-UHFFFAOYSA-N 1,1'-biphenyl;phenoxybenzene Chemical group C1=CC=CC=C1C1=CC=CC=C1.C=1C=CC=CC=1OC1=CC=CC=C1 MHCVCKDNQYMGEX-UHFFFAOYSA-N 0.000 description 1
- OTPDWCMLUKMQNO-UHFFFAOYSA-N 1,2,3,4-tetrahydropyrimidine Chemical compound C1NCC=CN1 OTPDWCMLUKMQNO-UHFFFAOYSA-N 0.000 description 1
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 1
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 1
- ONBQEOIKXPHGMB-VBSBHUPXSA-N 1-[2-[(2s,3r,4s,5r)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)propan-1-one Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1OC1=CC(O)=CC(O)=C1C(=O)CCC1=CC=C(O)C=C1 ONBQEOIKXPHGMB-VBSBHUPXSA-N 0.000 description 1
- UFCONGYNRWGVGH-UHFFFAOYSA-N 1-hydroxy-2,2,3,3-tetramethylpiperidine Chemical compound CC1(C)CCCN(O)C1(C)C UFCONGYNRWGVGH-UHFFFAOYSA-N 0.000 description 1
- WIXBXJIVPHLUHV-UHFFFAOYSA-N 2,2,6,6-tetramethyl-1-prop-2-enylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1CC=C WIXBXJIVPHLUHV-UHFFFAOYSA-N 0.000 description 1
- VDVUCLWJZJHFAV-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)N1 VDVUCLWJZJHFAV-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-N 2,2-diethylpropanedioic acid Chemical class CCC(CC)(C(O)=O)C(O)=O LTMRRSWNXVJMBA-UHFFFAOYSA-N 0.000 description 1
- VPSXHKGJZJCWLV-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(1-ethylpiperidin-4-yl)oxypyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)OC1CCN(CC1)CC VPSXHKGJZJCWLV-UHFFFAOYSA-N 0.000 description 1
- YSUIQYOGTINQIN-UZFYAQMZSA-N 2-amino-9-[(1S,6R,8R,9S,10R,15R,17R,18R)-8-(6-aminopurin-9-yl)-9,18-difluoro-3,12-dihydroxy-3,12-bis(sulfanylidene)-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one Chemical compound NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(S)(=O)O[C@@H]4[C@@H](COP(S)(=O)O[C@@H]2[C@@H]3F)O[C@H]([C@H]4F)N2C=NC3=C2N=CN=C3N)C(=O)N1 YSUIQYOGTINQIN-UZFYAQMZSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- 125000003816 2-hydroxybenzoyl group Chemical group OC1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 1
- PZMWHOITXWIHBP-UHFFFAOYSA-N 3-[hydroxy(phenyl)methoxy]-3-oxopropanoic acid Chemical class OC(=O)CC(=O)OC(O)C1=CC=CC=C1 PZMWHOITXWIHBP-UHFFFAOYSA-N 0.000 description 1
- CGNOCUSLPSCMLL-UHFFFAOYSA-N 3-o-benzyl 1-o-ethyl propanedioate Chemical compound CCOC(=O)CC(=O)OCC1=CC=CC=C1 CGNOCUSLPSCMLL-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 1
- 229940126657 Compound 17 Drugs 0.000 description 1
- LYUUVYQGUMRKOV-UHFFFAOYSA-N Diethyl diallylmalonate Chemical compound CCOC(=O)C(CC=C)(CC=C)C(=O)OCC LYUUVYQGUMRKOV-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- RRSNDVCODIMOFX-MPKOGUQCSA-N Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O Chemical compound Fc1c(Cl)cccc1[C@H]1[C@@H](NC2(CCCCC2)[C@@]11C(=O)Nc2cc(Cl)ccc12)C(=O)Nc1ccc(cc1)C(=O)NCCCCCc1cccc2C(=O)N(Cc12)C1CCC(=O)NC1=O RRSNDVCODIMOFX-MPKOGUQCSA-N 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- LJOOWESTVASNOG-UFJKPHDISA-N [(1s,3r,4ar,7s,8s,8as)-3-hydroxy-8-[2-[(4r)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-yl] (2s)-2-methylbutanoate Chemical compound C([C@H]1[C@@H](C)C=C[C@H]2C[C@@H](O)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)CC1C[C@@H](O)CC(=O)O1 LJOOWESTVASNOG-UFJKPHDISA-N 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000006193 alkinyl group Chemical group 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000005030 aluminium foil Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- CXPJAKCERKFUME-UHFFFAOYSA-N bis(1,2,2,6,6-pentamethylpiperidin-4-yl) propanedioate Chemical compound C1C(C)(C)N(C)C(C)(C)CC1OC(=O)CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 CXPJAKCERKFUME-UHFFFAOYSA-N 0.000 description 1
- GBSJXIPGUFIBIO-UHFFFAOYSA-N bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibenzylpropanedioate Chemical compound CC1(C)CC(OC(=O)C(CC=2C=CC=CC=2)(CC=2C=CC=CC=2)C(=O)OC2CC(C)(C)N(CC=3C=CC=CC=3)C(C)(C)C2)CC(C)(C)N1CC1=CC=CC=C1 GBSJXIPGUFIBIO-UHFFFAOYSA-N 0.000 description 1
- WJUHPBBRBPSTBM-UHFFFAOYSA-N bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dimethylpropanedioate Chemical compound C1C(C)(C)N(CC=2C=CC=CC=2)C(C)(C)CC1OC(=O)C(C)(C)C(=O)OC(CC1(C)C)CC(C)(C)N1CC1=CC=CC=C1 WJUHPBBRBPSTBM-UHFFFAOYSA-N 0.000 description 1
- HTXMYNCFLFEGGM-UHFFFAOYSA-N bis(1-benzyl-2,2,6,6-tetramethylpiperidin-4-yl) propanedioate Chemical compound CC1(C)CC(OC(=O)CC(=O)OC2CC(C)(C)N(CC=3C=CC=CC=3)C(C)(C)C2)CC(C)(C)N1CC1=CC=CC=C1 HTXMYNCFLFEGGM-UHFFFAOYSA-N 0.000 description 1
- BQSFLUAYYIRYKI-UHFFFAOYSA-N bis(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibenzylpropanedioate Chemical compound C1C(C)(C)N(CCCC)C(C)(C)CC1OC(=O)C(C(=O)OC1CC(C)(C)N(CCCC)C(C)(C)C1)(CC=1C=CC=CC=1)CC1=CC=CC=C1 BQSFLUAYYIRYKI-UHFFFAOYSA-N 0.000 description 1
- LPYNRFGUZTXBIS-UHFFFAOYSA-N bis(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate Chemical compound C1C(C)(C)N(CCCC)C(C)(C)CC1OC(=O)C(CC)(CC)C(=O)OC1CC(C)(C)N(CCCC)C(C)(C)C1 LPYNRFGUZTXBIS-UHFFFAOYSA-N 0.000 description 1
- QEOXKPHMRAJJIY-UHFFFAOYSA-N bis(1-dodecyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-dibenzylpropanedioate Chemical compound C1C(C)(C)N(CCCCCCCCCCCC)C(C)(C)CC1OC(=O)C(C(=O)OC1CC(C)(C)N(CCCCCCCCCCCC)C(C)(C)C1)(CC=1C=CC=CC=1)CC1=CC=CC=C1 QEOXKPHMRAJJIY-UHFFFAOYSA-N 0.000 description 1
- IHQGNGGZUYZFPA-UHFFFAOYSA-N bis(1-dodecyl-2,2,6,6-tetramethylpiperidin-4-yl) 2,2-diethylpropanedioate Chemical compound C1C(C)(C)N(CCCCCCCCCCCC)C(C)(C)CC1OC(=O)C(CC)(CC)C(=O)OC1CC(C)(C)N(CCCCCCCCCCCC)C(C)(C)C1 IHQGNGGZUYZFPA-UHFFFAOYSA-N 0.000 description 1
- RQNCSMOHOBMUJY-UHFFFAOYSA-N bis(1-hexyl-2,2,6,6-tetramethylpiperidin-4-yl) propanedioate Chemical compound C1C(C)(C)N(CCCCCC)C(C)(C)CC1OC(=O)CC(=O)OC1CC(C)(C)N(CCCCCC)C(C)(C)C1 RQNCSMOHOBMUJY-UHFFFAOYSA-N 0.000 description 1
- COPXTPWRSPZDOO-UHFFFAOYSA-N bis(2,2,6,6-tetramethyl-1-octylpiperidin-4-yl) 2,2-diethylpropanedioate Chemical compound C1C(C)(C)N(CCCCCCCC)C(C)(C)CC1OC(=O)C(CC)(CC)C(=O)OC1CC(C)(C)N(CCCCCCCC)C(C)(C)C1 COPXTPWRSPZDOO-UHFFFAOYSA-N 0.000 description 1
- AEPBUMHEAKNCQM-UHFFFAOYSA-N bis(2,2,6,6-tetramethyl-1-prop-2-enoylpiperidin-4-yl) 2,2-diethylpropanedioate Chemical compound C1C(C)(C)N(C(=O)C=C)C(C)(C)CC1OC(=O)C(CC)(CC)C(=O)OC1CC(C)(C)N(C(=O)C=C)C(C)(C)C1 AEPBUMHEAKNCQM-UHFFFAOYSA-N 0.000 description 1
- LHBDGPMKDCUHSG-UHFFFAOYSA-N bis(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) propanedioate Chemical compound C1C(C)(C)N(CCC)C(C)(C)CC1OC(=O)CC(=O)OC1CC(C)(C)N(CCC)C(C)(C)C1 LHBDGPMKDCUHSG-UHFFFAOYSA-N 0.000 description 1
- TVCJSJVBLVKRGN-UHFFFAOYSA-N bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis(2-methylpropyl)propanedioate Chemical compound C1C(C)(C)NC(C)(C)CC1OC(=O)C(CC(C)C)(CC(C)C)C(=O)OC1CC(C)(C)NC(C)(C)C1 TVCJSJVBLVKRGN-UHFFFAOYSA-N 0.000 description 1
- HXLWZWJKVOPYGS-UHFFFAOYSA-N bis(2,6-diethyl-1,2,3,6-tetramethylpiperidin-4-yl) 2,2-dibenzylpropanedioate Chemical compound CC1C(C)(CC)N(C)C(CC)(C)CC1OC(=O)C(C(=O)OC1C(C(C)(CC)N(C)C(C)(CC)C1)C)(CC=1C=CC=CC=1)CC1=CC=CC=C1 HXLWZWJKVOPYGS-UHFFFAOYSA-N 0.000 description 1
- ZVFIILGXJVXSJV-UHFFFAOYSA-N bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2,2-diethylpropanedioate Chemical compound C1C(C)(CC)NC(C)(CC)C(C)C1OC(=O)C(CC)(CC)C(=O)OC1CC(C)(CC)NC(C)(CC)C1C ZVFIILGXJVXSJV-UHFFFAOYSA-N 0.000 description 1
- FPCJKVGGYOAWIZ-UHFFFAOYSA-N butan-1-ol;titanium Chemical compound [Ti].CCCCO.CCCCO.CCCCO.CCCCO FPCJKVGGYOAWIZ-UHFFFAOYSA-N 0.000 description 1
- 125000006226 butoxyethyl group Chemical group 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940126543 compound 14 Drugs 0.000 description 1
- 229940125758 compound 15 Drugs 0.000 description 1
- 229940126142 compound 16 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940125846 compound 25 Drugs 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 229940127204 compound 29 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125877 compound 31 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920003020 cross-linked polyethylene Polymers 0.000 description 1
- 239000004703 cross-linked polyethylene Substances 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- WHKKUUPZLWUOIW-UHFFFAOYSA-N diethyl 2,2-dibutylpropanedioate Chemical compound CCCCC(CCCC)(C(=O)OCC)C(=O)OCC WHKKUUPZLWUOIW-UHFFFAOYSA-N 0.000 description 1
- FGYDHYCFHBSNPE-UHFFFAOYSA-N diethyl phenylmalonate Chemical compound CCOC(=O)C(C(=O)OCC)C1=CC=CC=C1 FGYDHYCFHBSNPE-UHFFFAOYSA-N 0.000 description 1
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 1
- VMSDGXIKDYLSHB-UHFFFAOYSA-N dimethyl 2,2-bis(2-methylpropyl)propanedioate Chemical compound COC(=O)C(CC(C)C)(CC(C)C)C(=O)OC VMSDGXIKDYLSHB-UHFFFAOYSA-N 0.000 description 1
- FUTIQDVLZWEJKO-UHFFFAOYSA-N dimethyl 2,2-dibenzylpropanedioate Chemical compound C=1C=CC=CC=1CC(C(=O)OC)(C(=O)OC)CC1=CC=CC=C1 FUTIQDVLZWEJKO-UHFFFAOYSA-N 0.000 description 1
- JPWYCSKXKSUGGL-UHFFFAOYSA-N dimethyl 2-benzyl-2-butylpropanedioate Chemical compound CCCCC(C(=O)OC)(C(=O)OC)CC1=CC=CC=C1 JPWYCSKXKSUGGL-UHFFFAOYSA-N 0.000 description 1
- BEPAFCGSDWSTEL-UHFFFAOYSA-N dimethyl malonate Chemical compound COC(=O)CC(=O)OC BEPAFCGSDWSTEL-UHFFFAOYSA-N 0.000 description 1
- OREAFAJWWJHCOT-UHFFFAOYSA-N dimethylmalonic acid Chemical class OC(=O)C(C)(C)C(O)=O OREAFAJWWJHCOT-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 229920001684 low density polyethylene Polymers 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K15/00—Anti-oxidant compositions; Compositions inhibiting chemical change
- C09K15/04—Anti-oxidant compositions; Compositions inhibiting chemical change containing organic compounds
- C09K15/30—Anti-oxidant compositions; Compositions inhibiting chemical change containing organic compounds containing heterocyclic ring with at least one nitrogen atom as ring member
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/46—Oxygen atoms attached in position 4 having a hydrogen atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3412—Heterocyclic compounds having nitrogen in the ring having one nitrogen atom in the ring
- C08K5/3432—Six-membered rings
- C08K5/3435—Piperidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Hydrogenated Pyridines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH555876 | 1976-05-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1573770A true GB1573770A (en) | 1980-08-28 |
Family
ID=4295595
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB18538/77A Expired GB1573770A (en) | 1976-05-04 | 1977-05-03 | Bis-(alkyl piperidyl) malonate derivatives of use as stabilisers for polymers |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US4293468A (enExample) |
| JP (1) | JPS52133990A (enExample) |
| AU (1) | AU2482777A (enExample) |
| BE (1) | BE854197A (enExample) |
| CA (1) | CA1091235A (enExample) |
| DE (1) | DE2718458A1 (enExample) |
| FR (1) | FR2350342A1 (enExample) |
| GB (1) | GB1573770A (enExample) |
| NL (1) | NL7704920A (enExample) |
| SU (1) | SU797589A3 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2755340A1 (de) * | 1976-12-23 | 1978-06-29 | Ciba Geigy Ag | Neue polyalkylpiperidinderivate |
| EP0002260B1 (de) * | 1977-12-02 | 1982-07-14 | Ciba-Geigy Ag | Malonsäurederivate von sterisch gehinderten Piperidinen, Verfahren zu ihrer Herstellung und mit ihnen stabilisiertes organisches Material |
| IT1110826B (it) * | 1979-02-01 | 1986-01-06 | Montedison Spa | N-alchil-piperidin derivati dell'acido idrossi-benzil malonico e loro impiego come stabilizzanti per polimeri |
| US4444928A (en) * | 1981-08-14 | 1984-04-24 | Ciba-Geigy Corporation | Polymeric malonic acid derivatives |
| US4526972A (en) * | 1984-06-27 | 1985-07-02 | Texaco Inc. | Ultraviolet light stabilizing sterically hindered polyoxyalkylene amines |
| US4965301A (en) * | 1984-12-03 | 1990-10-23 | Phillips Petroleum Company | Stabilization of polyolefins |
| US4701485A (en) * | 1985-10-11 | 1987-10-20 | Ici Americas Inc. | Malonate-based light stabilizers for plastics |
| US4762872A (en) * | 1985-11-01 | 1988-08-09 | The B. F. Goodrich Company | Oligomeric light stabilizers with substituted piperidine ends |
| DE3724223A1 (de) * | 1987-07-22 | 1989-02-02 | Huels Chemische Werke Ag | Stabilisatorsystem |
| JPH03115496U (enExample) * | 1990-03-12 | 1991-11-28 | ||
| KR920002533A (ko) * | 1990-07-19 | 1992-02-28 | 베르너 발데크 | 석유 화학 추출용매의 산화 방지방법 |
| DE69200943T2 (de) * | 1991-06-03 | 1995-06-01 | Mitsubishi Petrochemical Co | Derivate von Piperidin. |
| KR100550224B1 (ko) | 1998-12-14 | 2006-02-08 | 시바 스폐셜티 케미칼스 홀딩 인코포레이티드 | 입체장애 아민 화합물 |
| US7081213B2 (en) * | 2002-05-14 | 2006-07-25 | Clariant Finance (Bvi) Limited | Stabilizer mixtures for the protection of polymer substrates |
| WO2006022405A1 (ja) | 2004-08-24 | 2006-03-02 | Fujifilm Corporation | ハロゲン化銀カラー写真感光材料及び画像形成方法 |
| WO2008123504A1 (ja) | 2007-03-30 | 2008-10-16 | Fujifilm Corporation | 紫外線吸収剤組成物 |
| JP5320720B2 (ja) * | 2007-10-17 | 2013-10-23 | 旭硝子株式会社 | 新規な、含フッ素化合物および含フッ素重合体 |
| JP5244437B2 (ja) | 2008-03-31 | 2013-07-24 | 富士フイルム株式会社 | 紫外線吸収剤組成物 |
| JP2010059235A (ja) | 2008-09-01 | 2010-03-18 | Fujifilm Corp | 紫外線吸収剤組成物 |
| JP5261319B2 (ja) | 2008-09-10 | 2013-08-14 | 富士フイルム株式会社 | 照明カバー |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3640928A (en) * | 1968-06-12 | 1972-02-08 | Sankyo Co | Stabilization of synthetic polymers |
| BE792043A (fr) * | 1971-11-30 | 1973-05-29 | Ciba Geigy | Derives de la piperidine utilisables pour stabiliser des matieres organiques |
| US4021432A (en) * | 1971-11-30 | 1977-05-03 | Ciba-Geigy Corporation | Piperidine derivatives |
| CH589056A5 (enExample) * | 1973-12-10 | 1977-06-30 | Ciba Geigy Ag | |
| US4056507A (en) * | 1973-12-28 | 1977-11-01 | Ciba-Geigy Corporation | Hindered piperidine carboxylic acids, metal salts thereof and stabilized compositions |
-
1977
- 1977-04-26 DE DE19772718458 patent/DE2718458A1/de active Granted
- 1977-05-02 CA CA277,387A patent/CA1091235A/en not_active Expired
- 1977-05-03 AU AU24827/77A patent/AU2482777A/en not_active Expired
- 1977-05-03 GB GB18538/77A patent/GB1573770A/en not_active Expired
- 1977-05-03 BE BE177211A patent/BE854197A/xx not_active IP Right Cessation
- 1977-05-04 JP JP5172377A patent/JPS52133990A/ja active Granted
- 1977-05-04 NL NL7704920A patent/NL7704920A/xx not_active Application Discontinuation
- 1977-05-04 FR FR7713499A patent/FR2350342A1/fr active Granted
- 1977-05-04 SU SU772480486A patent/SU797589A3/ru active
-
1980
- 1980-02-04 US US06/118,219 patent/US4293468A/en not_active Expired - Lifetime
-
1981
- 1981-06-08 US US06/271,263 patent/US4369275A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU2482777A (en) | 1978-11-09 |
| JPS52133990A (en) | 1977-11-09 |
| NL7704920A (nl) | 1977-11-08 |
| DE2718458A1 (de) | 1977-11-24 |
| FR2350342B1 (enExample) | 1980-02-08 |
| US4293468A (en) | 1981-10-06 |
| DE2718458C2 (enExample) | 1989-09-14 |
| FR2350342A1 (fr) | 1977-12-02 |
| US4369275A (en) | 1983-01-18 |
| JPH0232298B2 (enExample) | 1990-07-19 |
| CA1091235A (en) | 1980-12-09 |
| SU797589A3 (ru) | 1981-01-15 |
| BE854197A (fr) | 1977-11-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1573770A (en) | Bis-(alkyl piperidyl) malonate derivatives of use as stabilisers for polymers | |
| US4226999A (en) | Piperidyl esters of phenolalkylene carboxylic acids | |
| DE2647452C2 (enExample) | ||
| US4237297A (en) | Piperidine containing malonic acid derivatives | |
| US4161592A (en) | Piperidinyl-s-triazines | |
| US3840494A (en) | Process for preparing acid esters of 4-piperidinol derivatives and their use as stabilizers | |
| US5705545A (en) | Use of HALS compounds | |
| EP0316582B1 (de) | 4-Formylaminopiperidinderivate, deren Verwendung als Stabilisatoren und damit stabilisiertes organisches Material | |
| US4238613A (en) | Polyalkylpiperidine derivatives | |
| US4131599A (en) | Stabilization of poly(mono-olefins) | |
| CA1093556A (en) | Cyanuric acid derivatives | |
| US4197236A (en) | Piperidine stabilizers | |
| US4154722A (en) | Polyalkylpiperidinyl esters of diazocarboxylic acid and their use for stabilizing polymers | |
| CA1236098A (en) | Compounds containing piperidine groups, as stabilisers for synthetic polymers | |
| DE2805821A1 (de) | Neue metallsalze von hydroxybenzoesaeuren, die durch polyalkylpiperidin-liganden komplexiert sind | |
| CA1284504C (en) | Piperidine compounds | |
| EP0149781B1 (de) | Furan-3-carbonsäurederivate | |
| EP0912514A1 (de) | Neue sterisch gehinderte piperidinderivate als lichtschutzmittel für polymere | |
| KR810001105B1 (ko) | 말로네이트류의 제조방법 | |
| EP0550001B1 (en) | Cyclohexylamine derivatives | |
| US4981969A (en) | Polyalkylpiperidine-substituted tetrahydropyridones and use thereof | |
| CH597297A5 (en) | (4)-Piperidyl hydroxybenzyl-malonates and -malonamides | |
| DE4109650A1 (de) | Cyclische ss-ketocarbonsaeure-polyalkylpiperidinylester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19940503 |