GB1305795A - - Google Patents
Info
- Publication number
- GB1305795A GB1305795A GB2454071*A GB2454071A GB1305795A GB 1305795 A GB1305795 A GB 1305795A GB 2454071 A GB2454071 A GB 2454071A GB 1305795 A GB1305795 A GB 1305795A
- Authority
- GB
- United Kingdom
- Prior art keywords
- general formula
- group
- alkyl
- azidoaryl
- dihydropyridine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000000304 alkynyl group Chemical group 0.000 abstract 2
- 150000001412 amines Chemical class 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 125000001246 bromo group Chemical group Br* 0.000 abstract 2
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- 125000001309 chloro group Chemical group Cl* 0.000 abstract 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 2
- 125000005843 halogen group Chemical group 0.000 abstract 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 2
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 abstract 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 229910021529 ammonia Inorganic materials 0.000 abstract 1
- 230000003276 anti-hypertensive effect Effects 0.000 abstract 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000000812 cholinergic antagonist Substances 0.000 abstract 1
- 210000004351 coronary vessel Anatomy 0.000 abstract 1
- 230000000916 dilatatory effect Effects 0.000 abstract 1
- 239000003085 diluting agent Substances 0.000 abstract 1
- 150000002081 enamines Chemical class 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 229910052731 fluorine Inorganic materials 0.000 abstract 1
- 125000001153 fluoro group Chemical group F* 0.000 abstract 1
- 125000003709 fluoroalkyl group Chemical group 0.000 abstract 1
- 239000007788 liquid Substances 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000007787 solid Substances 0.000 abstract 1
- 230000002048 spasmolytic effect Effects 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2013431A DE2013431C3 (de) | 1970-03-20 | 1970-03-20 | 4-Azidophenyl-l,4-dihydropyridin-3,5-dicarbonsäureester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1305795A true GB1305795A (https=) | 1973-02-07 |
Family
ID=5765765
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB2454071*A Expired GB1305795A (https=) | 1970-03-20 | 1971-04-19 |
Country Status (16)
| Country | Link |
|---|---|
| US (2) | US3708489A (https=) |
| JP (1) | JPS5521032B1 (https=) |
| AT (1) | AT303040B (https=) |
| BE (1) | BE764556A (https=) |
| CH (1) | CH559179A5 (https=) |
| CS (2) | CS160139B2 (https=) |
| DE (1) | DE2013431C3 (https=) |
| FI (1) | FI54295C (https=) |
| FR (1) | FR2085727B1 (https=) |
| GB (1) | GB1305795A (https=) |
| IE (1) | IE35233B1 (https=) |
| IL (1) | IL36320A (https=) |
| NL (1) | NL169468C (https=) |
| NO (1) | NO131986C (https=) |
| SE (1) | SE364710B (https=) |
| ZA (1) | ZA711597B (https=) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2005116C3 (de) * | 1970-02-05 | 1980-02-14 | Bayer Ag, 5090 Leverkusen | Symmetrische 1,4-Dihydropyridin-3,5-dicarbonsäureester |
| US4021434A (en) * | 1972-01-22 | 1977-05-03 | Yamanouchi Pharmaceutical Co., Ltd. | Sodium β-[2,6-dimethyl-3,5-bis(ethoxycarbonyl)-4-(3-nitrophenyl)-1,4-dihydropyridine-1-yl]ethyl sulfate |
| GB1430961A (en) * | 1972-01-22 | 1976-04-07 | Yamanouchi Pharma Co Ltd | 1-substituted-1,4-dihyddrypyridine derivatives |
| US3857849A (en) * | 1973-02-28 | 1974-12-31 | Bayer Ag | 2-amino-1,4-dihydropyridine derivatives |
| US3957998A (en) * | 1972-03-06 | 1976-05-18 | Bayer Aktiengesellschaft | Use of 2,6-diamino-4-substituted-1,4-dihydropyridine-3,5-dicarboxylic acid esters for effecting coronary vessel dilation and treating hypertension |
| US3917620A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
| DD106832A5 (https=) * | 1972-03-06 | 1974-07-05 | ||
| US3985886A (en) * | 1972-03-06 | 1976-10-12 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives and process for their preparation |
| US3939171A (en) * | 1972-03-06 | 1976-02-17 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| DE2210672C3 (de) * | 1972-03-06 | 1980-03-20 | Bayer Ag, 5090 Leverkusen | N-substituierte unsymmetrische 1 ^-Dihydropyridin-S^-dicarbonsäureester, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |
| DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| US3992545A (en) * | 1972-03-06 | 1976-11-16 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives in pharmaceutical compositions |
| US3860601A (en) * | 1972-03-06 | 1975-01-14 | Horst Meyer | 2,6-diamino-1,4-dihydropyridine derivatives |
| US3996234A (en) * | 1972-04-18 | 1976-12-07 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
| US3974275A (en) * | 1972-04-18 | 1976-08-10 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters useful as coronary vessel dilators and anti-hypertensives |
| DE2239815C2 (de) * | 1972-08-12 | 1983-02-10 | Bayer Ag, 5090 Leverkusen | 2-Alkylamino-dihydropyridine, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel |
| US4136187A (en) * | 1972-08-12 | 1979-01-23 | Bayer Aktiengesellschaft | Antihypertensive 2-amino-4,5-dihydropyridine derivatives |
| DE2242787C2 (de) * | 1972-08-31 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | 4-Phenyl-6-amino-3,4-dihydropyridon-(2)-3,5-dicarbonsäure-diäthylesterderivate, ein Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| US4002762A (en) * | 1973-03-03 | 1977-01-11 | Bayer Aktiengesellschaft | 2-Amino-3,4-dihydropyridines used to effect coronary vessel dilation and treat hypertension |
| US4020178A (en) * | 1973-07-12 | 1977-04-26 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine esters used as coronary dilators and anti-hypertensives |
| NO883326L (no) * | 1987-08-11 | 1989-02-13 | Bayer Ag | Dhp-retard-tilberedning. |
| EP0330470A3 (en) * | 1988-02-24 | 1992-01-02 | Ajinomoto Co., Inc. | 1,4-dihydropyridine derivatives useful against tumour cells |
| US5216172A (en) * | 1988-02-24 | 1993-06-01 | Ajinomoto Co., Inc. | 1,4-dihydropyridine-4-aryl-2,6-dimethyl-3,5-dicarboxylates useful as agents against drug resistant tumor cells |
-
1970
- 1970-03-20 DE DE2013431A patent/DE2013431C3/de not_active Expired
-
1971
- 1971-03-02 IL IL36320A patent/IL36320A/en unknown
- 1971-03-09 IE IE293/71A patent/IE35233B1/xx unknown
- 1971-03-10 FI FI694/71A patent/FI54295C/fi active
- 1971-03-11 CS CS1794A patent/CS160139B2/cs unknown
- 1971-03-11 ZA ZA711597A patent/ZA711597B/xx unknown
- 1971-03-11 CS CS3638*A patent/CS160140B2/cs unknown
- 1971-03-12 SE SE03213/71A patent/SE364710B/xx unknown
- 1971-03-17 US US00125427A patent/US3708489A/en not_active Expired - Lifetime
- 1971-03-18 NL NLAANVRAGE7103672,A patent/NL169468C/xx not_active IP Right Cessation
- 1971-03-18 NO NO1058/71A patent/NO131986C/no unknown
- 1971-03-19 BE BE764556A patent/BE764556A/xx not_active IP Right Cessation
- 1971-03-19 JP JP1545571A patent/JPS5521032B1/ja active Pending
- 1971-03-19 CH CH405371A patent/CH559179A5/xx not_active IP Right Cessation
- 1971-03-19 AT AT239271A patent/AT303040B/de not_active IP Right Cessation
- 1971-03-19 FR FR7109866A patent/FR2085727B1/fr not_active Expired
- 1971-04-19 GB GB2454071*A patent/GB1305795A/en not_active Expired
-
1972
- 1972-06-02 US US00259289A patent/US3773956A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5521032B1 (https=) | 1980-06-06 |
| NL7103672A (https=) | 1971-09-22 |
| DE2013431B2 (de) | 1979-04-26 |
| NL169468B (nl) | 1982-02-16 |
| AT303040B (de) | 1972-11-10 |
| CS160140B2 (https=) | 1975-02-28 |
| IL36320A0 (en) | 1971-05-26 |
| SU365069A3 (https=) | 1972-12-28 |
| FR2085727B1 (https=) | 1974-09-27 |
| NO131986C (https=) | 1975-09-03 |
| ZA711597B (en) | 1972-06-28 |
| US3708489A (en) | 1973-01-02 |
| IE35233L (en) | 1971-09-20 |
| FI54295C (fi) | 1978-11-10 |
| DE2013431C3 (de) | 1979-12-20 |
| CH559179A5 (https=) | 1975-02-28 |
| CS160139B2 (https=) | 1975-02-28 |
| FI54295B (fi) | 1978-07-31 |
| BE764556A (fr) | 1971-09-20 |
| US3773956A (en) | 1973-11-20 |
| IL36320A (en) | 1974-10-22 |
| IE35233B1 (en) | 1975-12-24 |
| DE2013431A1 (de) | 1971-10-07 |
| FR2085727A1 (https=) | 1971-12-31 |
| SE364710B (https=) | 1974-03-04 |
| NO131986B (https=) | 1975-05-26 |
| NL169468C (nl) | 1982-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1305795A (https=) | ||
| KR890006650A (ko) | 테트라하이드로-푸로 및 -티에노[2,3-c]피리딘, 약제학적 제제로서의 이의 용도 및 이의 제조방법 | |
| GB1326491A (en) | 1,4-dihydropyridine derivatives | |
| IE40945B1 (en) | Benzomorphanes derivatives | |
| KR860009007A (ko) | 피페리딜리덴 디하이드로-디벤조[a,d]-사이클로헵텐의 제조방법 | |
| GB1239679A (https=) | ||
| GB1305794A (https=) | ||
| GB1291164A (en) | New sulphur-containing 1,4-dihydropyridine derivatives | |
| GB1373212A (en) | Pyrazole compounds | |
| GB1373548A (en) | Anti-hypertensive 6-substituted 3-hydrazino-pyridazines and their preparation | |
| GB1062714A (en) | -ß-(4'-acyloxy-4'-piperidyl)-ketones | |
| GB1342520A (en) | Alpha-alkyl-substituted benzyl or thenyl-benzyloxy derivatives of amines | |
| GB1265279A (https=) | ||
| GB1191237A (en) | 0,3-Diazacyclo alkeno[2,1-a]isoindole Derivatives and a process for the mnufacture thereof | |
| GB1514389A (en) | Glycerides with antibacterial properties | |
| GB1336913A (en) | Indolyl acetic acid derivatives processes for producing them and compositions containing them | |
| KR880011163A (ko) | 4- 벤질- 피페라지닐 하이드라존 | |
| GB1481032A (en) | Glutamyl amide derivatives of dopamine | |
| GB1317399A (en) | Pyridoindole derivatives | |
| GB1358911A (en) | Tetrahydropyridylmethyl carboxylic acid esters | |
| GB1425729A (en) | 1,4-dihydropyridine compounds | |
| GB1151095A (en) | 1,3-Dioxan-2-yl-Alkanoic Acids and derivatives thereof | |
| GB1116308A (en) | Novels-triazolo[3,4-a]isoquinolines and the preparation thereof | |
| GB1211387A (en) | 0-benzylpiperidine derivative and a process for the preparation thereof | |
| GB1315575A (en) | Schiffs bases from 2-aminoimidazole derivatives and the preparation thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |