FI80672C - Foerfarande foer framstaellning av para-acyloxibensensulfonater medelst syrakatalys. - Google Patents
Foerfarande foer framstaellning av para-acyloxibensensulfonater medelst syrakatalys. Download PDFInfo
- Publication number
- FI80672C FI80672C FI850636A FI850636A FI80672C FI 80672 C FI80672 C FI 80672C FI 850636 A FI850636 A FI 850636A FI 850636 A FI850636 A FI 850636A FI 80672 C FI80672 C FI 80672C
- Authority
- FI
- Finland
- Prior art keywords
- process according
- acid
- phenol sulfonate
- anhydride
- para
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 9
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims abstract description 8
- 238000000034 method Methods 0.000 claims description 25
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 20
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 18
- 229940044652 phenolsulfonate Drugs 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 15
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 8
- 150000008065 acid anhydrides Chemical class 0.000 claims description 7
- 238000000605 extraction Methods 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 239000002798 polar solvent Substances 0.000 claims 3
- 229940087596 sodium phenolsulfonate Drugs 0.000 claims 1
- BLXAGSNYHSQSRC-UHFFFAOYSA-M sodium;2-hydroxybenzenesulfonate Chemical group [Na+].OC1=CC=CC=C1S([O-])(=O)=O BLXAGSNYHSQSRC-UHFFFAOYSA-M 0.000 claims 1
- 150000008064 anhydrides Chemical class 0.000 abstract description 13
- 150000003871 sulfonates Chemical class 0.000 abstract description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 2
- 239000003513 alkali Substances 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical class 0.000 abstract 1
- AXUYHJMSEJPTPI-UHFFFAOYSA-N azane;4-hydroxybenzenesulfonic acid Chemical compound [NH4+].OC1=CC=C(S([O-])(=O)=O)C=C1 AXUYHJMSEJPTPI-UHFFFAOYSA-N 0.000 abstract 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 239000003880 polar aprotic solvent Substances 0.000 abstract 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 239000002253 acid Substances 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- SBUVJXWGEPFERU-UHFFFAOYSA-N 3,5,5-trimethylhexanoyl 3,5,5-trimethylhexanoate Chemical class CC(C)(C)CC(C)CC(=O)OC(=O)CC(C)CC(C)(C)C SBUVJXWGEPFERU-UHFFFAOYSA-N 0.000 description 3
- -1 aliphatic anhydrides Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- PBBAFLCORNAZCD-UHFFFAOYSA-N nonanoyl nonanoate Chemical compound CCCCCCCCC(=O)OC(=O)CCCCCCCC PBBAFLCORNAZCD-UHFFFAOYSA-N 0.000 description 3
- YDLQSTFHBCVEJV-UHFFFAOYSA-M sodium;2-(3,5,5-trimethylhexanoyloxy)benzenesulfonate Chemical compound [Na+].CC(C)(C)CC(C)CC(=O)OC1=CC=CC=C1S([O-])(=O)=O YDLQSTFHBCVEJV-UHFFFAOYSA-M 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 238000007171 acid catalysis Methods 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- NWADXBLMWHFGGU-UHFFFAOYSA-N dodecanoic anhydride Chemical class CCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCC NWADXBLMWHFGGU-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- RAFYDKXYXRZODZ-UHFFFAOYSA-N octanoyl octanoate Chemical compound CCCCCCCC(=O)OC(=O)CCCCCCC RAFYDKXYXRZODZ-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- PEVPCUFZCODDGN-UHFFFAOYSA-M sodium;2-dodecanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O PEVPCUFZCODDGN-UHFFFAOYSA-M 0.000 description 2
- BYMHXIQVEAYSJD-UHFFFAOYSA-M sodium;4-sulfophenolate Chemical compound [Na+].OC1=CC=C(S([O-])(=O)=O)C=C1 BYMHXIQVEAYSJD-UHFFFAOYSA-M 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- OJEWIWBDGBRNFP-UHFFFAOYSA-N 2,2,3-trimethylhexanoic acid Chemical compound CCCC(C)C(C)(C)C(O)=O OJEWIWBDGBRNFP-UHFFFAOYSA-N 0.000 description 1
- HWTDMFJYBAURQR-UHFFFAOYSA-N 80-82-0 Chemical compound OS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O HWTDMFJYBAURQR-UHFFFAOYSA-N 0.000 description 1
- ZYCHKMJJSBYZOM-UHFFFAOYSA-M C(CCCCCCCCCCC)(=O)OC(CCCCCCCCCCC)=O.C(CCCCCCCCCCC)(=O)OC1=C(C=CC=C1)S(=O)(=O)[O-].[Na+] Chemical compound C(CCCCCCCCCCC)(=O)OC(CCCCCCCCCCC)=O.C(CCCCCCCCCCC)(=O)OC1=C(C=CC=C1)S(=O)(=O)[O-].[Na+] ZYCHKMJJSBYZOM-UHFFFAOYSA-M 0.000 description 1
- 241000208152 Geranium Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- WRSCKTINGQCIQM-UHFFFAOYSA-N benzenesulfonyl octanoate;sodium Chemical compound [Na].CCCCCCCC(=O)OS(=O)(=O)C1=CC=CC=C1 WRSCKTINGQCIQM-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- VMNZSPZHEZLXCQ-UHFFFAOYSA-M potassium;4-hydroxybenzenesulfonate Chemical compound [K+].OC1=CC=C(S([O-])(=O)=O)C=C1 VMNZSPZHEZLXCQ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- PXDLHKPVKLUIJV-UHFFFAOYSA-M sodium;2-octanoyloxybenzenesulfonate Chemical compound [Na+].CCCCCCCC(=O)OC1=CC=CC=C1S([O-])(=O)=O PXDLHKPVKLUIJV-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Medicines Containing Plant Substances (AREA)
- Saccharide Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8402398A FR2559768B1 (fr) | 1984-02-17 | 1984-02-17 | Procede de preparation de para-acyloxybenzenesulfonate par catalyse acide |
| FR8402398 | 1984-02-17 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI850636A0 FI850636A0 (fi) | 1985-02-15 |
| FI850636L FI850636L (fi) | 1985-08-18 |
| FI80672B FI80672B (fi) | 1990-03-30 |
| FI80672C true FI80672C (fi) | 1990-07-10 |
Family
ID=9301117
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI850636A FI80672C (fi) | 1984-02-17 | 1985-02-15 | Foerfarande foer framstaellning av para-acyloxibensensulfonater medelst syrakatalys. |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4588532A (enExample) |
| EP (1) | EP0153222B1 (enExample) |
| JP (1) | JPS60202856A (enExample) |
| AT (1) | ATE24313T1 (enExample) |
| BR (1) | BR8500715A (enExample) |
| DE (1) | DE3560032D1 (enExample) |
| DK (1) | DK71485A (enExample) |
| ES (1) | ES8602628A1 (enExample) |
| FI (1) | FI80672C (enExample) |
| FR (1) | FR2559768B1 (enExample) |
| GR (1) | GR850408B (enExample) |
| NO (1) | NO160134C (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2559769B1 (fr) * | 1984-02-17 | 1986-06-13 | Rhone Poulenc Chim Base | Procede de preparation de para acyloxybenzenesulfonate par catalyse basique |
| DE3538141A1 (de) * | 1985-10-26 | 1987-04-30 | Hoechst Ag | Kontinuierliches verfahren zur herstellung von acyloxybenzolsulfonsaeuren |
| GB8531392D0 (en) * | 1985-12-20 | 1986-02-05 | Unilever Plc | Sulphonated aromated esters |
| US4735740A (en) * | 1986-10-03 | 1988-04-05 | The Clorox Company | Diperoxyacid precursors and method |
| ATE65495T1 (de) * | 1986-12-05 | 1991-08-15 | Interox Chemicals Ltd | Esterherstellung. |
| GB8712909D0 (en) * | 1987-06-02 | 1987-07-08 | Interox Chemicals Ltd | Preparation of esters |
| US5078907A (en) * | 1989-11-01 | 1992-01-07 | Lever Brothers Company, Division Of Conopco, Inc. | Unsymmetrical dicarboxylic esters as bleach precursors |
| GB9726246D0 (en) * | 1997-12-11 | 1998-02-11 | Ass Octel | Preparation of esters |
| US6218555B1 (en) | 1999-09-03 | 2001-04-17 | Eastman Chemical Company | Process for the preparation of alkanoyloxy-benzenesulfonic acids and salts thereof |
| US6448430B1 (en) | 1999-09-10 | 2002-09-10 | Eastman Chemical Company | Process for the preparation of aryl carboxylate esters |
| US6448431B1 (en) | 1999-09-13 | 2002-09-10 | Eastman Chemical Company | Production of aryl carboxylate esters |
| US6790981B2 (en) | 2002-12-13 | 2004-09-14 | Clariant Finance (Bvi) Limited | Process for the preparation of acyloxybenzenesulfonates |
| DE10300981A1 (de) * | 2003-01-14 | 2004-07-22 | Clariant Gmbh | Verfahren zur Herstellung von Acyloxybenzolsulfonaten |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US628503A (en) * | 1898-02-10 | 1899-07-11 | Ernst Twitchell | Fatty aromatic sulfo compound and process of making same. |
| US1642595A (en) * | 1925-05-18 | 1927-09-13 | Petroff Grigori | Process for obtaining sulpho-aromatic fatty acids |
| GB363770A (en) * | 1929-10-29 | 1931-12-31 | Chem Ind Basel | Manufacture of new sulphonation products |
| US3056818A (en) * | 1955-10-13 | 1962-10-02 | Goodrich Co B F | Titanium and zirconium esterification catalysts |
| US3383396A (en) * | 1963-10-30 | 1968-05-14 | Lever Brothers Ltd | Preparation of surface-active agents using a dissolved zirconium catalyst |
| US3394155A (en) * | 1964-05-22 | 1968-07-23 | Lever Brothers Ltd | Preparation of surface-active agents |
| US3636016A (en) * | 1969-05-28 | 1972-01-18 | Continental Oil Co | Surface active agents |
| US3775445A (en) * | 1972-01-14 | 1973-11-27 | Continental Oil Co | Surface active agents |
| GB1519351A (en) * | 1975-01-29 | 1978-07-26 | Unilever Ltd | Preparation of acetoxy arylene sulphonates |
| EP0105673B1 (en) * | 1982-09-28 | 1988-07-27 | The Procter & Gamble Company | Synthesis of hydrophilic phenol ester derivatives |
-
1984
- 1984-02-17 FR FR8402398A patent/FR2559768B1/fr not_active Expired
-
1985
- 1985-02-08 EP EP85400208A patent/EP0153222B1/fr not_active Expired
- 1985-02-08 DE DE8585400208T patent/DE3560032D1/de not_active Expired
- 1985-02-08 AT AT85400208T patent/ATE24313T1/de not_active IP Right Cessation
- 1985-02-15 GR GR850408A patent/GR850408B/el unknown
- 1985-02-15 JP JP60026637A patent/JPS60202856A/ja active Granted
- 1985-02-15 DK DK71485A patent/DK71485A/da not_active Application Discontinuation
- 1985-02-15 ES ES540435A patent/ES8602628A1/es not_active Expired
- 1985-02-15 NO NO850593A patent/NO160134C/no unknown
- 1985-02-15 FI FI850636A patent/FI80672C/fi not_active IP Right Cessation
- 1985-02-15 BR BR8500715A patent/BR8500715A/pt unknown
- 1985-02-19 US US06/702,733 patent/US4588532A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| NO160134C (no) | 1989-03-15 |
| FR2559768B1 (fr) | 1986-06-13 |
| ES540435A0 (es) | 1985-12-01 |
| JPS6327340B2 (enExample) | 1988-06-02 |
| ATE24313T1 (de) | 1987-01-15 |
| NO850593L (no) | 1985-08-19 |
| US4588532A (en) | 1986-05-13 |
| DK71485D0 (da) | 1985-02-15 |
| FI80672B (fi) | 1990-03-30 |
| FI850636A0 (fi) | 1985-02-15 |
| NO160134B (no) | 1988-12-05 |
| EP0153222A1 (fr) | 1985-08-28 |
| DE3560032D1 (en) | 1987-01-29 |
| FR2559768A1 (fr) | 1985-08-23 |
| ES8602628A1 (es) | 1985-12-01 |
| FI850636L (fi) | 1985-08-18 |
| JPS60202856A (ja) | 1985-10-14 |
| EP0153222B1 (fr) | 1986-12-17 |
| BR8500715A (pt) | 1985-10-08 |
| GR850408B (enExample) | 1985-06-17 |
| DK71485A (da) | 1985-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI80672B (fi) | Foerfarande foer framstaellning av para-acyloxibensensulfonater medelst syrakatalys. | |
| FI80015B (fi) | Foerfarande foer framstaellning av para-acyloxibensensulfonater medelst alkalisk katalys. | |
| CA2170486C (en) | Synthesis of amido acids from carboxylic acids and lactams | |
| WO1995007882A1 (en) | Synthesis of amido acids from carboxylic acid esters and amino acid salts | |
| JPH078847B2 (ja) | スルホフエニルエステルの製法 | |
| HUT63404A (en) | Process for producing cyclic sulfate derivatives | |
| JPH03372B2 (enExample) | ||
| US6448430B1 (en) | Process for the preparation of aryl carboxylate esters | |
| Mohacsi | A convenient preparation of methyl esters from carboxylic acids | |
| US4613683A (en) | Preparation of alkyl gallates | |
| US4369144A (en) | Preparation and use of alkali metal isethionates from ethionic acid | |
| US6448431B1 (en) | Production of aryl carboxylate esters | |
| KR950013472B1 (ko) | 플루페남산의 2-(2-히드록시에톡시)에탄올아민을 제조하는 방법 | |
| US5153341A (en) | Process for preparing benzenesulfonate salts | |
| US3056827A (en) | Preparation of esters by reacting an anhydride with carbonic acid diesters | |
| US4435328A (en) | Preparation and use of alkali metal isethionates from ethionic acid | |
| US6291710B1 (en) | Process for preparing sulfonyl halides | |
| JPH08245508A (ja) | 不飽和カルボン酸エステルおよび不飽和カルボン酸エステルの製造方法 | |
| CA1079298A (en) | Preparation of 3.5-dialkyl-4-hydroxybenzoic acid | |
| US3492337A (en) | Process for the preparation of alkyl 4-ketoalkanoates | |
| US4433163A (en) | Process for the production of 3,3-dimethylglutaric acid or its esters | |
| RU2071464C1 (ru) | Способ получения симметричных сложных эфиров | |
| JP3868599B2 (ja) | アルカノイルオキシ安息香酸の製造方法 | |
| RU2114099C1 (ru) | Способ получения сложных эфиров на основе 2,2,4-триметил-3-гидроксипентилизобутирата | |
| JP2001011015A (ja) | 酒石酸低級アルキルジエステルの製造法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: RHONE-POULENC CHIMIE |