FI80032C - Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 2-sulfamoylbenso/b/tiofenderivat. - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 2-sulfamoylbenso/b/tiofenderivat. Download PDFInfo
- Publication number
- FI80032C FI80032C FI842478A FI842478A FI80032C FI 80032 C FI80032 C FI 80032C FI 842478 A FI842478 A FI 842478A FI 842478 A FI842478 A FI 842478A FI 80032 C FI80032 C FI 80032C
- Authority
- FI
- Finland
- Prior art keywords
- compound
- thiophene
- sulfamoylbenzo
- solution
- mixture
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000002360 preparation method Methods 0.000 title claims description 20
- 230000008569 process Effects 0.000 title claims description 9
- 150000003577 thiophenes Chemical class 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims description 67
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- -1 alkali metal cation Chemical class 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 239000002585 base Substances 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 125000001475 halogen functional group Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 229910006074 SO2NH2 Inorganic materials 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 claims description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 4
- 239000012433 hydrogen halide Substances 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 2
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 2
- 230000001590 oxidative effect Effects 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 2
- 150000001412 amines Chemical class 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 93
- 239000000243 solution Substances 0.000 description 92
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 75
- 239000000203 mixture Substances 0.000 description 75
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 58
- 239000002904 solvent Substances 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- 239000000047 product Substances 0.000 description 36
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 29
- 239000011541 reaction mixture Substances 0.000 description 28
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 26
- 239000007787 solid Substances 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 23
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 239000000284 extract Substances 0.000 description 21
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 20
- 239000000706 filtrate Substances 0.000 description 15
- 238000010992 reflux Methods 0.000 description 15
- 229930192474 thiophene Natural products 0.000 description 15
- 238000004458 analytical method Methods 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 14
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 13
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 12
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 12
- XRZYWSVMYHEQPN-UHFFFAOYSA-N 6-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 XRZYWSVMYHEQPN-UHFFFAOYSA-N 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 229940124530 sulfonamide Drugs 0.000 description 11
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 10
- 229910052799 carbon Inorganic materials 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- 230000004410 intraocular pressure Effects 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 8
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 7
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 7
- 125000001033 ether group Chemical group 0.000 description 7
- 150000003455 sulfinic acids Chemical class 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- OHZAHWOAMVVGEL-UHFFFAOYSA-N 2,2'-bithiophene Chemical compound C1=CSC(C=2SC=CC=2)=C1 OHZAHWOAMVVGEL-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 208000010412 Glaucoma Diseases 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 239000012267 brine Substances 0.000 description 6
- 239000003489 carbonate dehydratase inhibitor Substances 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000012442 inert solvent Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 6
- 125000001544 thienyl group Chemical group 0.000 description 6
- CHXZRHMQQRUVHF-UHFFFAOYSA-N thiophene A Natural products CC#CC1=CC=C(C#CC#CC=C)S1 CHXZRHMQQRUVHF-UHFFFAOYSA-N 0.000 description 6
- 230000000699 topical effect Effects 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 102000003846 Carbonic anhydrases Human genes 0.000 description 5
- 108090000209 Carbonic anhydrases Proteins 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 239000012467 final product Substances 0.000 description 5
- RWSXRVCMGQZWBV-WDSKDSINSA-N glutathione Chemical compound OC(=O)[C@@H](N)CCC(=O)N[C@@H](CS)C(=O)NCC(O)=O RWSXRVCMGQZWBV-WDSKDSINSA-N 0.000 description 5
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 150000003456 sulfonamides Chemical class 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 4
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 4
- IGYDWQWQYFXSNN-UHFFFAOYSA-N 5-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 IGYDWQWQYFXSNN-UHFFFAOYSA-N 0.000 description 4
- XQQVPVSVESNUHO-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C2C=C(S(N)(=O)=O)SC2=C1 XQQVPVSVESNUHO-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical group [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 4
- 239000012346 acetyl chloride Substances 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 238000005576 amination reaction Methods 0.000 description 4
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 4
- 150000003863 ammonium salts Chemical class 0.000 description 4
- 239000002876 beta blocker Substances 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000003814 drug Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 230000004406 elevated intraocular pressure Effects 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- JDRMYOQETPMYQX-UHFFFAOYSA-N monomethyl succinate Chemical compound COC(=O)CCC(O)=O JDRMYOQETPMYQX-UHFFFAOYSA-N 0.000 description 4
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 4
- QCHFTSOMWOSFHM-WPRPVWTQSA-N (+)-Pilocarpine Chemical compound C1OC(=O)[C@@H](CC)[C@H]1CC1=CN=CN1C QCHFTSOMWOSFHM-WPRPVWTQSA-N 0.000 description 3
- DXMQCYBZTUPOFT-UHFFFAOYSA-N 1-(2,2-diethoxyethylsulfanyl)-3-methoxybenzene Chemical compound CCOC(OCC)CSC1=CC=CC(OC)=C1 DXMQCYBZTUPOFT-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- JRTUPGWOWBPJAF-UHFFFAOYSA-N 3-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC=C2C(O)=C(S(=O)(=O)N)SC2=C1 JRTUPGWOWBPJAF-UHFFFAOYSA-N 0.000 description 3
- QMVAZEHZOPDGHA-UHFFFAOYSA-N 3-methoxybenzenethiol Chemical compound COC1=CC=CC(S)=C1 QMVAZEHZOPDGHA-UHFFFAOYSA-N 0.000 description 3
- YPOBRGLUEDOCKJ-UHFFFAOYSA-N 4-methoxy-1-benzothiophene Chemical compound COC1=CC=CC2=C1C=CS2 YPOBRGLUEDOCKJ-UHFFFAOYSA-N 0.000 description 3
- WGDVDMKNSDCNGB-UHFFFAOYSA-N 6-methoxy-1-benzothiophene Chemical compound COC1=CC=C2C=CSC2=C1 WGDVDMKNSDCNGB-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 229940122072 Carbonic anhydrase inhibitor Drugs 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- QCHFTSOMWOSFHM-UHFFFAOYSA-N SJ000285536 Natural products C1OC(=O)C(CC)C1CC1=CN=CN1C QCHFTSOMWOSFHM-UHFFFAOYSA-N 0.000 description 3
- 239000000538 analytical sample Substances 0.000 description 3
- 229940006133 antiglaucoma drug and miotics carbonic anhydrase inhibitors Drugs 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 229960001416 pilocarpine Drugs 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000002516 radical scavenger Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- BSXLLFUSNQCWJP-UHFFFAOYSA-N thiophene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CS1 BSXLLFUSNQCWJP-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- UZMQSZBTFGHLAH-UHFFFAOYSA-N 1-benzothiophene-2-sulfonamide Chemical class C1=CC=C2SC(S(=O)(=O)N)=CC2=C1 UZMQSZBTFGHLAH-UHFFFAOYSA-N 0.000 description 2
- XQHJVVACNIPHNW-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethynesulfonyl chloride Chemical compound COC1=CC=C(C#CS(Cl)(=O)=O)C=C1 XQHJVVACNIPHNW-UHFFFAOYSA-N 0.000 description 2
- RKVLVYGPKVDZSF-UHFFFAOYSA-N 2-benzyl-1-benzothiophen-6-ol Chemical compound OC=1C=CC2=C(SC(=C2)CC2=CC=CC=C2)C=1 RKVLVYGPKVDZSF-UHFFFAOYSA-N 0.000 description 2
- LILXDMFJXYAKMK-UHFFFAOYSA-N 2-bromo-1,1-diethoxyethane Chemical compound CCOC(CBr)OCC LILXDMFJXYAKMK-UHFFFAOYSA-N 0.000 description 2
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 2
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 2
- KWNKEEZVYAHKNV-UHFFFAOYSA-N 4-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC=C2SC(S(=O)(=O)N)=CC2=C1O KWNKEEZVYAHKNV-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- MRIXVKKOHPQOFK-UHFFFAOYSA-N 4-methoxysalicylic acid Chemical compound COC1=CC=C(C(O)=O)C(O)=C1 MRIXVKKOHPQOFK-UHFFFAOYSA-N 0.000 description 2
- RGUKYNXWOWSRET-UHFFFAOYSA-N 4-pyrrolidin-1-ylpyridine Chemical compound C1CCCN1C1=CC=NC=C1 RGUKYNXWOWSRET-UHFFFAOYSA-N 0.000 description 2
- QFOUMNMBMUBSFP-UHFFFAOYSA-N 5,6-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 QFOUMNMBMUBSFP-UHFFFAOYSA-N 0.000 description 2
- UQEZXYPVQGPICM-UHFFFAOYSA-N 5-bromo-1-benzothiophene-2-sulfonamide Chemical compound BrC1=CC=C2SC(S(=O)(=O)N)=CC2=C1 UQEZXYPVQGPICM-UHFFFAOYSA-N 0.000 description 2
- SPHFFWSPWNZWSL-UHFFFAOYSA-N 5-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 SPHFFWSPWNZWSL-UHFFFAOYSA-N 0.000 description 2
- PNLRJPAUMHTMEL-UHFFFAOYSA-N 7-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC(O)=C2SC(S(=O)(=O)N)=CC2=C1 PNLRJPAUMHTMEL-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 201000004569 Blindness Diseases 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- PIJVFDBKTWXHHD-UHFFFAOYSA-N Physostigmine Natural products C12=CC(OC(=O)NC)=CC=C2N(C)C2C1(C)CCN2C PIJVFDBKTWXHHD-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical class [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- JZRWCGZRTZMZEH-UHFFFAOYSA-N Thiamine Natural products CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229960003180 glutathione Drugs 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanillin Chemical compound COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 2
- 229960001697 physostigmine Drugs 0.000 description 2
- PIJVFDBKTWXHHD-HIFRSBDPSA-N physostigmine Chemical compound C12=CC(OC(=O)NC)=CC=C2N(C)[C@@H]2[C@@]1(C)CCN2C PIJVFDBKTWXHHD-HIFRSBDPSA-N 0.000 description 2
- IUGYQRQAERSCNH-UHFFFAOYSA-M pivalate Chemical compound CC(C)(C)C([O-])=O IUGYQRQAERSCNH-UHFFFAOYSA-M 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- KYMBYSLLVAOCFI-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SCN1CC1=CN=C(C)N=C1N KYMBYSLLVAOCFI-UHFFFAOYSA-N 0.000 description 2
- 229960003495 thiamine Drugs 0.000 description 2
- 235000019157 thiamine Nutrition 0.000 description 2
- 239000011721 thiamine Substances 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- WILBTFWIBAOWLN-UHFFFAOYSA-N triethyl(triethylsilyloxy)silane Chemical class CC[Si](CC)(CC)O[Si](CC)(CC)CC WILBTFWIBAOWLN-UHFFFAOYSA-N 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 239000003039 volatile agent Substances 0.000 description 2
- XCFHKUMSCZELBW-UHFFFAOYSA-N (2-sulfamoyl-1-benzothiophen-5-yl) acetate Chemical compound CC(=O)OC1=CC=C2SC(S(N)(=O)=O)=CC2=C1 XCFHKUMSCZELBW-UHFFFAOYSA-N 0.000 description 1
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- BLJRIMJGRPQVNF-JTQLQIEISA-N (S)-timolol (anhydrous) Chemical compound CC(C)(C)NC[C@H](O)COC1=NSN=C1N1CCOCC1 BLJRIMJGRPQVNF-JTQLQIEISA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- CXNKWKSSGJRRSO-UHFFFAOYSA-N 1,1-dioxo-1-benzothiophen-6-ol Chemical compound OC1=CC=C2C=CS(=O)(=O)C2=C1 CXNKWKSSGJRRSO-UHFFFAOYSA-N 0.000 description 1
- AZEBOLMCENDPNH-UHFFFAOYSA-N 1,1-dioxo-2,3-dihydro-1-benzothiophen-6-ol Chemical compound OC1=CC=C2CCS(=O)(=O)C2=C1 AZEBOLMCENDPNH-UHFFFAOYSA-N 0.000 description 1
- RYUKSOMAQSVSMH-UHFFFAOYSA-N 1,3-benzodioxole-5-thiol Chemical compound SC1=CC=C2OCOC2=C1 RYUKSOMAQSVSMH-UHFFFAOYSA-N 0.000 description 1
- SDYMYAFSQACTQP-UHFFFAOYSA-N 1,3-benzothiazole-2-sulfonamide Chemical class C1=CC=C2SC(S(=O)(=O)N)=NC2=C1 SDYMYAFSQACTQP-UHFFFAOYSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DQUZFPKUMCZPQD-UHFFFAOYSA-N 1-benzothiophen-6-ol Chemical compound OC1=CC=C2C=CSC2=C1 DQUZFPKUMCZPQD-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- YZBOZNXACBQJHI-UHFFFAOYSA-N 1-dichlorophosphoryloxyethane Chemical compound CCOP(Cl)(Cl)=O YZBOZNXACBQJHI-UHFFFAOYSA-N 0.000 description 1
- XYPISWUKQGWYGX-UHFFFAOYSA-N 2,2,2-trifluoroethaneperoxoic acid Chemical compound OOC(=O)C(F)(F)F XYPISWUKQGWYGX-UHFFFAOYSA-N 0.000 description 1
- PGZVFRAEAAXREB-UHFFFAOYSA-N 2,2-dimethylpropanoyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC(=O)C(C)(C)C PGZVFRAEAAXREB-UHFFFAOYSA-N 0.000 description 1
- FZHTUELUUNCLRZ-UHFFFAOYSA-N 2,4-dimethoxybenzenethiol Chemical compound COC1=CC=C(S)C(OC)=C1 FZHTUELUUNCLRZ-UHFFFAOYSA-N 0.000 description 1
- SESUUAOAUZDHHP-UHFFFAOYSA-N 2,5-dimethoxybenzenethiol Chemical compound COC1=CC=C(OC)C(S)=C1 SESUUAOAUZDHHP-UHFFFAOYSA-N 0.000 description 1
- BFAKMCFOJJJDRO-UHFFFAOYSA-N 2-(2,2-diethoxyethylsulfanyl)-1,1-diethoxyethane Chemical compound CCOC(OCC)CSCC(OCC)OCC BFAKMCFOJJJDRO-UHFFFAOYSA-N 0.000 description 1
- FXHIODPNVOWMIT-UHFFFAOYSA-N 2-(4-methoxyphenyl)ethynesulfonamide Chemical compound COC1=CC=C(C#CS(N)(=O)=O)C=C1 FXHIODPNVOWMIT-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- JKRXLQVWEGDCNI-UHFFFAOYSA-N 2-aminosulfanyl-1-benzothiophen-6-ol Chemical compound C1=C(O)C=C2SC(SN)=CC2=C1 JKRXLQVWEGDCNI-UHFFFAOYSA-N 0.000 description 1
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 1
- MBNVSWHUJDDZRH-UHFFFAOYSA-N 2-methylthiirane Chemical compound CC1CS1 MBNVSWHUJDDZRH-UHFFFAOYSA-N 0.000 description 1
- VLSNXPQHGFTPFG-UHFFFAOYSA-N 2-sulfanyl-1-benzothiophen-6-ol Chemical compound OC1=CC=C2C=C(S)SC2=C1 VLSNXPQHGFTPFG-UHFFFAOYSA-N 0.000 description 1
- QZPYQRRHHPFSPL-UHFFFAOYSA-N 3-(4-hydroxy-3-methoxyphenyl)-2-sulfanylprop-2-enoic acid Chemical compound COC1=CC(C=C(S)C(O)=O)=CC=C1O QZPYQRRHHPFSPL-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- OSAIAKVTJXISFA-UHFFFAOYSA-N 3-hydroxy-4-methoxybenzenesulfonamide Chemical compound COC1=CC=C(S(N)(=O)=O)C=C1O OSAIAKVTJXISFA-UHFFFAOYSA-N 0.000 description 1
- LTKKWYIAUXMKRY-UHFFFAOYSA-N 3-methoxy-4-methylbenzenethiol Chemical compound COC1=CC(S)=CC=C1C LTKKWYIAUXMKRY-UHFFFAOYSA-N 0.000 description 1
- WQIPUSSEWROJPT-UHFFFAOYSA-N 4,5-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C2SC(S(N)(=O)=O)=CC2=C1OC WQIPUSSEWROJPT-UHFFFAOYSA-N 0.000 description 1
- NPGUAIJZFKGKRQ-UHFFFAOYSA-N 4,7-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound C1=CC(O)=C2SC(S(=O)(=O)N)=CC2=C1O NPGUAIJZFKGKRQ-UHFFFAOYSA-N 0.000 description 1
- ZCIZYKUGKUABPV-UHFFFAOYSA-N 4,7-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=C(OC)C2=C1C=C(S(N)(=O)=O)S2 ZCIZYKUGKUABPV-UHFFFAOYSA-N 0.000 description 1
- LOLKAJARZKDJTD-UHFFFAOYSA-N 4-Ethoxy-4-oxobutanoic acid Chemical compound CCOC(=O)CCC(O)=O LOLKAJARZKDJTD-UHFFFAOYSA-N 0.000 description 1
- ACJCKSYUUNLSAT-UHFFFAOYSA-N 4-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=CC2=C1C=C(S(N)(=O)=O)S2 ACJCKSYUUNLSAT-UHFFFAOYSA-N 0.000 description 1
- QAISRGJLXWPJRW-UHFFFAOYSA-N 4-methoxy-2-(sulfamoylmethylsulfanyl)benzoic acid Chemical compound COC1=CC=C(C(O)=O)C(SCS(N)(=O)=O)=C1 QAISRGJLXWPJRW-UHFFFAOYSA-N 0.000 description 1
- HZTCEOITUGFBIS-UHFFFAOYSA-N 4-methoxy-2-sulfanylbenzoic acid Chemical compound COC1=CC=C(C(O)=O)C(S)=C1 HZTCEOITUGFBIS-UHFFFAOYSA-N 0.000 description 1
- XVITXHRHLDUBTA-UHFFFAOYSA-N 4-methoxy-3-methylbenzenethiol Chemical compound COC1=CC=C(S)C=C1C XVITXHRHLDUBTA-UHFFFAOYSA-N 0.000 description 1
- KLQSAAONLQIKDE-UHFFFAOYSA-N 5,6-dimethoxy-1-benzothiophene Chemical compound C1=C(OC)C(OC)=CC2=C1SC=C2 KLQSAAONLQIKDE-UHFFFAOYSA-N 0.000 description 1
- IQXTXLLJSBDWKH-UHFFFAOYSA-N 5,6-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(OC)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 IQXTXLLJSBDWKH-UHFFFAOYSA-N 0.000 description 1
- QZFHRVFRHKHGSN-UHFFFAOYSA-N 5,7-dihydroxy-1-benzothiophene-2-sulfonamide Chemical compound OC1=CC(O)=C2SC(S(=O)(=O)N)=CC2=C1 QZFHRVFRHKHGSN-UHFFFAOYSA-N 0.000 description 1
- CJHWGLBDSDKVIH-UHFFFAOYSA-N 5,7-dimethoxy-1-benzothiophene Chemical compound COC1=CC(OC)=C2SC=CC2=C1 CJHWGLBDSDKVIH-UHFFFAOYSA-N 0.000 description 1
- XONQNKZFMRFPIM-UHFFFAOYSA-N 5,7-dimethoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC(OC)=C2SC(S(N)(=O)=O)=CC2=C1 XONQNKZFMRFPIM-UHFFFAOYSA-N 0.000 description 1
- OWXPWWRBBBGOLO-UHFFFAOYSA-N 5-[(4-hydroxy-3-methoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound C1=C(O)C(OC)=CC(C=C2C(NC(=S)S2)=O)=C1 OWXPWWRBBBGOLO-UHFFFAOYSA-N 0.000 description 1
- RDSIMGKJEYNNLF-UHFFFAOYSA-N 5-bromo-1-benzothiophene Chemical compound BrC1=CC=C2SC=CC2=C1 RDSIMGKJEYNNLF-UHFFFAOYSA-N 0.000 description 1
- LMFBTVWJHQCPPU-UHFFFAOYSA-N 5-chloro-6-hydroxy-1-benzothiophene-2-sulfonamide Chemical compound ClC1=C(O)C=C2SC(S(=O)(=O)N)=CC2=C1 LMFBTVWJHQCPPU-UHFFFAOYSA-N 0.000 description 1
- PJEWDGVKGZESMX-UHFFFAOYSA-N 5-chloro-6-hydroxy-1-benzothiophene-2-sulfonyl chloride Chemical compound C1=C(Cl)C(O)=CC2=C1C=C(S(Cl)(=O)=O)S2 PJEWDGVKGZESMX-UHFFFAOYSA-N 0.000 description 1
- NOEDAINOWFMFAS-UHFFFAOYSA-N 5-hydroxy-6-methoxy-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(OC)=CC2=C1C=C(S(N)(=O)=O)S2 NOEDAINOWFMFAS-UHFFFAOYSA-N 0.000 description 1
- SSVLPEOHQGTJMO-UHFFFAOYSA-N 5-hydroxy-6-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(C)=CC2=C1C=C(S(N)(=O)=O)S2 SSVLPEOHQGTJMO-UHFFFAOYSA-N 0.000 description 1
- JPCWACUXSHAWEC-UHFFFAOYSA-N 5-methoxy-6-methyl-1-benzothiophene Chemical compound C1=C(C)C(OC)=CC2=C1SC=C2 JPCWACUXSHAWEC-UHFFFAOYSA-N 0.000 description 1
- FRZJACQZZZQLEU-UHFFFAOYSA-N 5-methoxy-6-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(C)C(OC)=CC2=C1SC(S(N)(=O)=O)=C2 FRZJACQZZZQLEU-UHFFFAOYSA-N 0.000 description 1
- IZZIWIAOVZOBLF-UHFFFAOYSA-N 5-methyloxysalicylic acid Natural products COC1=CC=C(O)C(C(O)=O)=C1 IZZIWIAOVZOBLF-UHFFFAOYSA-N 0.000 description 1
- GEVSDYHAXHDFKL-UHFFFAOYSA-N 6-hydroxy-5-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(O)C(C)=CC2=C1SC(S(N)(=O)=O)=C2 GEVSDYHAXHDFKL-UHFFFAOYSA-N 0.000 description 1
- OUTXDOFZXSHHAY-UHFFFAOYSA-N 6-hydroxy-n-methoxy-1-benzothiophene-5-sulfonamide Chemical compound C1=C(O)C(S(=O)(=O)NOC)=CC2=C1SC=C2 OUTXDOFZXSHHAY-UHFFFAOYSA-N 0.000 description 1
- OGHXQNICXQQONG-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonic acid Chemical compound COC1=CC=C2C=C(S(O)(=O)=O)SC2=C1 OGHXQNICXQQONG-UHFFFAOYSA-N 0.000 description 1
- QWAWVUNLIVQYBA-UHFFFAOYSA-N 6-methoxy-1-benzothiophene-2-sulfonyl chloride Chemical compound COC1=CC=C2C=C(S(Cl)(=O)=O)SC2=C1 QWAWVUNLIVQYBA-UHFFFAOYSA-N 0.000 description 1
- PTLHTECLFJRDRX-UHFFFAOYSA-N 6-methoxy-5-methyl-1-benzothiophene Chemical compound C1=C(C)C(OC)=CC2=C1C=CS2 PTLHTECLFJRDRX-UHFFFAOYSA-N 0.000 description 1
- PXDSGQSTTDJZRV-UHFFFAOYSA-N 6-methoxy-5-methyl-1-benzothiophene-2-sulfonamide Chemical compound C1=C(C)C(OC)=CC2=C1C=C(S(N)(=O)=O)S2 PXDSGQSTTDJZRV-UHFFFAOYSA-N 0.000 description 1
- WOGMIMNVXACKEB-UHFFFAOYSA-N 6-methyl-1-benzothiophene Chemical compound CC1=CC=C2C=CSC2=C1 WOGMIMNVXACKEB-UHFFFAOYSA-N 0.000 description 1
- RWWDZFRDYYQTFJ-UHFFFAOYSA-N 7-methoxy-1-benzothiophene Chemical compound COC1=CC=CC2=C1SC=C2 RWWDZFRDYYQTFJ-UHFFFAOYSA-N 0.000 description 1
- IAZFVHUTOZUOMP-UHFFFAOYSA-N 7-methoxy-1-benzothiophene-2-sulfonamide Chemical compound COC1=CC=CC2=C1SC(S(N)(=O)=O)=C2 IAZFVHUTOZUOMP-UHFFFAOYSA-N 0.000 description 1
- 208000004998 Abdominal Pain Diseases 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- GEHMBYLTCISYNY-UHFFFAOYSA-N Ammonium sulfamate Chemical compound [NH4+].NS([O-])(=O)=O GEHMBYLTCISYNY-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- CZPABJPSROQLBW-UHFFFAOYSA-N BrC1=CC=C(C=C1)C(CSCC(C1=CC=C(C=C1)Br)(OCC)OCC)(OCC)OCC Chemical compound BrC1=CC=C(C=C1)C(CSCC(C1=CC=C(C=C1)Br)(OCC)OCC)(OCC)OCC CZPABJPSROQLBW-UHFFFAOYSA-N 0.000 description 1
- SGGYKPYISDTOOD-UHFFFAOYSA-N C(CC)(=O)O.C(C)OC(=O)CCC(=O)O Chemical compound C(CC)(=O)O.C(C)OC(=O)CCC(=O)O SGGYKPYISDTOOD-UHFFFAOYSA-N 0.000 description 1
- DRFRMDUZGSESSN-UHFFFAOYSA-N CCOC(CSC1=CC=CC2(C1)OCO2)OCC Chemical compound CCOC(CSC1=CC=CC2(C1)OCO2)OCC DRFRMDUZGSESSN-UHFFFAOYSA-N 0.000 description 1
- YUWDKBBMJGHMAX-UHFFFAOYSA-N CN(C)C(=S)C1=C(C=CC(=C1)OC)C(=O)O Chemical compound CN(C)C(=S)C1=C(C=CC(=C1)OC)C(=O)O YUWDKBBMJGHMAX-UHFFFAOYSA-N 0.000 description 1
- NSQFBISHVQNMPZ-UHFFFAOYSA-N COC1=C(SC2=CC=CC(=C21)O)S(=O)(=O)N Chemical group COC1=C(SC2=CC=CC(=C21)O)S(=O)(=O)N NSQFBISHVQNMPZ-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 208000002881 Colic Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 108010024636 Glutathione Proteins 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 206010030043 Ocular hypertension Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 208000013449 Visual field disease Diseases 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001266 acyl halides Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001343 alkyl silanes Chemical class 0.000 description 1
- 108010027597 alpha-chymotrypsin Proteins 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 210000001742 aqueous humor Anatomy 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229940097320 beta blocking agent Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- WKNONNGLPOBGEZ-UHFFFAOYSA-N bromomethanesulfonamide Chemical compound NS(=O)(=O)CBr WKNONNGLPOBGEZ-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- ITVPBBDAZKBMRP-UHFFFAOYSA-N chloro-dioxido-oxo-$l^{5}-phosphane;hydron Chemical compound OP(O)(Cl)=O ITVPBBDAZKBMRP-UHFFFAOYSA-N 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 208000010247 contact dermatitis Diseases 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000017858 demethylation Effects 0.000 description 1
- 238000010520 demethylation reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- ISCACRDMGTYTHJ-UHFFFAOYSA-N dichlorophosphoryloxymethylbenzene Chemical compound ClP(Cl)(=O)OCC1=CC=CC=C1 ISCACRDMGTYTHJ-UHFFFAOYSA-N 0.000 description 1
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical class [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 239000000469 ethanolic extract Substances 0.000 description 1
- JOXWSDNHLSQKCC-UHFFFAOYSA-N ethenesulfonamide Chemical compound NS(=O)(=O)C=C JOXWSDNHLSQKCC-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 208000030533 eye disease Diseases 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 1
- 238000006459 hydrosilylation reaction Methods 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 229940011051 isopropyl acetate Drugs 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 208000018769 loss of vision Diseases 0.000 description 1
- 231100000864 loss of vision Toxicity 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000000936 membranestabilizing effect Effects 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- PHWISQNXPLXQRU-UHFFFAOYSA-N n,n-dimethylcarbamothioyl chloride Chemical compound CN(C)C(Cl)=S PHWISQNXPLXQRU-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000002997 ophthalmic solution Substances 0.000 description 1
- 229940054534 ophthalmic solution Drugs 0.000 description 1
- 210000001328 optic nerve Anatomy 0.000 description 1
- 229940126701 oral medication Drugs 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- JBKPUQTUERUYQE-UHFFFAOYSA-O pralidoxime Chemical compound C[N+]1=CC=CC=C1\C=N\O JBKPUQTUERUYQE-UHFFFAOYSA-O 0.000 description 1
- 229960003370 pralidoxime Drugs 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- BHZOKUMUHVTPBX-UHFFFAOYSA-M sodium acetic acid acetate Chemical class [Na+].CC(O)=O.CC([O-])=O BHZOKUMUHVTPBX-UHFFFAOYSA-M 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 229910001495 sodium tetrafluoroborate Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- FGQOOHJZONJGDT-UHFFFAOYSA-N vanillin Natural products COC1=CC(O)=CC(C=O)=C1 FGQOOHJZONJGDT-UHFFFAOYSA-N 0.000 description 1
- 235000012141 vanillin Nutrition 0.000 description 1
- 230000004393 visual impairment Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D333/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D333/70—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6553—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms
- C07F9/655345—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms the sulfur atom being part of a five-membered ring
- C07F9/655354—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having sulfur atoms, with or without selenium or tellurium atoms, as the only ring hetero atoms the sulfur atom being part of a five-membered ring condensed with carbocyclic rings or carbocyclic ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50609283A | 1983-06-20 | 1983-06-20 | |
| US50609283 | 1983-06-20 | ||
| US54719183A | 1983-10-31 | 1983-10-31 | |
| US54719183 | 1983-10-31 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI842478A0 FI842478A0 (fi) | 1984-06-19 |
| FI842478A7 FI842478A7 (fi) | 1984-12-21 |
| FI80032B FI80032B (fi) | 1989-12-29 |
| FI80032C true FI80032C (fi) | 1990-04-10 |
Family
ID=27055356
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI842478A FI80032C (fi) | 1983-06-20 | 1984-06-19 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 2-sulfamoylbenso/b/tiofenderivat. |
Country Status (15)
| Country | Link |
|---|---|
| EP (1) | EP0129478B1 (enFirst) |
| KR (1) | KR890000386B1 (enFirst) |
| AU (1) | AU558665B2 (enFirst) |
| CA (1) | CA1253151A (enFirst) |
| DE (1) | DE3481057D1 (enFirst) |
| DK (1) | DK298584A (enFirst) |
| ES (1) | ES533390A0 (enFirst) |
| FI (1) | FI80032C (enFirst) |
| GR (1) | GR82372B (enFirst) |
| HU (1) | HUT37420A (enFirst) |
| IE (1) | IE57601B1 (enFirst) |
| IL (1) | IL72070A (enFirst) |
| NO (1) | NO842467L (enFirst) |
| NZ (1) | NZ208444A (enFirst) |
| PT (1) | PT78762A (enFirst) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0189690B1 (en) * | 1984-12-12 | 1989-03-01 | Merck & Co. Inc. | Substituted aromatic sulfonamides, their preparation and ophthalmic compositions containing them |
| US4820848A (en) * | 1984-12-12 | 1989-04-11 | Merck & Co., Inc. | Substituted aromatic sulfonamides as antiglaucoma agents |
| US4731368A (en) * | 1986-12-08 | 1988-03-15 | Merck & Co., Inc. | Thienopyridine sulfonamides and their ophthalmological formulation |
| EP0271273A3 (en) * | 1986-12-08 | 1989-07-12 | Merck & Co. Inc. | Thieno-and furopyridine sulfonamides |
| US4808595A (en) * | 1986-12-24 | 1989-02-28 | Merck & Co., Inc. | Furopyridine sulfonamides and their opthalmological compositions |
| CA1320487C (en) * | 1987-08-03 | 1993-07-20 | George D. Hartman | Substituted thieno[2,3-.beta.]thiophene-2-sulfonamides as antiglaucoma agents |
| US4894390A (en) * | 1987-08-03 | 1990-01-16 | Merck & Co., Inc. | Substituted thieno[2,3-b]thiophene-2-sulfonamides as antiglaucoma agents |
| US4751231A (en) * | 1987-09-16 | 1988-06-14 | Merck & Co., Inc. | Substituted thieno[2,3-b]pyrrole-5-sulfonamides as antiglaucoma agents |
| US4929549A (en) * | 1989-02-08 | 1990-05-29 | Merck & Co., Inc. | 5-carbamoylthieno[2,3-b]thiophene-2-sulfon-amides as topically active carbonic anhydrase inhibitors |
| AU3378399A (en) * | 1998-04-02 | 1999-10-25 | Ortho-Mcneil Pharmaceutical, Inc. | 4-thionaphthyl-1h-imidazoles with alpha-2-adrenergic activity |
| US6313309B1 (en) * | 1999-04-05 | 2001-11-06 | Ortho-Mcneil Pharmaceutical, Inc. | 4-thionaphthyl—1H—imidazoles which are usefulα22-adrenoceptoR agonists/ antagonists |
| ES2380443T3 (es) | 2005-03-28 | 2012-05-11 | Toyama Chemical Co., Ltd. | Proceso para la producción de ácido 1-(3-(2-(1-benzotiofen-5-il)etoxi)propiónico o sales del mismo |
| RU2397169C2 (ru) * | 2005-03-28 | 2010-08-20 | Тояма Кемикал Ко., Лтд. | Способ получения 1-(3-(2-(1-бензотиофен-5-ил)этокси) пропил)азетидин-3-ола или его солей |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR241136A1 (es) * | 1981-07-13 | 1991-11-29 | Merck E Co Inc | Procedimiento para preparar esteres de 6-hidroxi-2-benzotiazolsulfonamida para tratamiento topicode presion intraocular elevada" |
| US4386098A (en) * | 1981-11-03 | 1983-05-31 | Merck & Co., Inc. | 6-Hydroxy-2-benzothiazolesulfonamide for the topical treatment of elevated intraocular pressure |
| US4426388A (en) * | 1982-04-02 | 1984-01-17 | Merck & Co., Inc. | 5-Benzothiazolesulfonamide derivatives for the topical treatment of elevated intraocular pressure |
-
1984
- 1984-06-11 IL IL72070A patent/IL72070A/xx not_active IP Right Cessation
- 1984-06-11 NZ NZ208444A patent/NZ208444A/en unknown
- 1984-06-13 ES ES533390A patent/ES533390A0/es active Granted
- 1984-06-14 DE DE8484401227T patent/DE3481057D1/de not_active Expired - Lifetime
- 1984-06-14 GR GR75021A patent/GR82372B/el unknown
- 1984-06-14 EP EP84401227A patent/EP0129478B1/en not_active Expired - Lifetime
- 1984-06-18 PT PT78762A patent/PT78762A/pt not_active IP Right Cessation
- 1984-06-18 CA CA000456789A patent/CA1253151A/en not_active Expired
- 1984-06-19 IE IE1536/84A patent/IE57601B1/en not_active IP Right Cessation
- 1984-06-19 HU HU842363A patent/HUT37420A/hu unknown
- 1984-06-19 FI FI842478A patent/FI80032C/fi not_active IP Right Cessation
- 1984-06-19 NO NO842467A patent/NO842467L/no unknown
- 1984-06-19 AU AU29496/84A patent/AU558665B2/en not_active Ceased
- 1984-06-19 KR KR1019840003455A patent/KR890000386B1/ko not_active Expired
- 1984-06-19 DK DK298584A patent/DK298584A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3481057D1 (de) | 1990-02-22 |
| IL72070A0 (en) | 1984-10-31 |
| KR850000428A (ko) | 1985-02-27 |
| PT78762A (en) | 1984-07-01 |
| CA1253151A (en) | 1989-04-25 |
| NO842467L (no) | 1985-12-21 |
| EP0129478A2 (en) | 1984-12-27 |
| FI842478A0 (fi) | 1984-06-19 |
| AU558665B2 (en) | 1987-02-05 |
| FI80032B (fi) | 1989-12-29 |
| IL72070A (en) | 1988-11-30 |
| KR890000386B1 (ko) | 1989-03-16 |
| IE841536L (en) | 1984-12-20 |
| DK298584A (da) | 1984-12-21 |
| NZ208444A (en) | 1987-08-31 |
| FI842478A7 (fi) | 1984-12-21 |
| AU2949684A (en) | 1985-06-13 |
| IE57601B1 (en) | 1993-01-27 |
| ES8600272A1 (es) | 1985-10-01 |
| EP0129478A3 (en) | 1987-03-25 |
| DK298584D0 (da) | 1984-06-19 |
| EP0129478B1 (en) | 1990-01-17 |
| HUT37420A (en) | 1985-12-28 |
| GR82372B (enFirst) | 1984-12-13 |
| ES533390A0 (es) | 1985-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI80032C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 2-sulfamoylbenso/b/tiofenderivat. | |
| Graham et al. | Topically active carbonic anhydrase inhibitors. 2. Benzo [b] thiophenesulfonamide derivatives with ocular hypotensive activity | |
| DK167684B1 (da) | Substitueret aromatisk sulfonamid og farmaceutisk praeparat til behandling af glaucom indeholdende en saadan forbindelse | |
| AU655924B2 (en) | Thiophene sulfonamides useful as carbonic anydrase inhibitors | |
| US4668697A (en) | Elevated intraocular pressure lowering benzo-[b]-thiophene-2-sulfonamide derivatives, compositions, and method of use therefor | |
| IE47261B1 (en) | Thiazine derivatives | |
| US4677115A (en) | Antiglaucoma thieno-thiopyran and thieno-thiepin sulfonamide derivatives, compositions, and method of use thereof | |
| CA1328261C (en) | Thiophene sulfonamide antiglaucoma agents | |
| KR850000272B1 (ko) | 1이미도 디설파미드의 제조방법 | |
| EP0189690B1 (en) | Substituted aromatic sulfonamides, their preparation and ophthalmic compositions containing them | |
| KR100226509B1 (ko) | 항염증제로 유용한, 복소환부를 갖는 디-t-부틸페놀 화합물 | |
| US4777172A (en) | Pyrimidylalkylthio benzimidale compounds, pharmaceutical compositions and use | |
| JPH0588228B2 (enFirst) | ||
| US5602144A (en) | Thienopyridones | |
| EP0228237B1 (en) | Substituted thiophene-2-sulfonamide antiglaucoma agents | |
| JPH04226992A (ja) | 4−アルキルアミノ−6−(C3〜5−ヒドロカルビル)チエノ〔2,3−b〕チオピラン−2−スルホンアミド−7,7−ジオキシド類 | |
| EP0252640B1 (en) | Alkanesulfonamides as antiglaucoma agents | |
| NO790821L (no) | Fremgangsmaate ved fremstilling av antiinflammatorisk aktive 4,5-diaryl-2-(substituerte-thio)pyrroler og deres tilsvarende sulfoxyder og sulfoner | |
| US4929637A (en) | Substituted thiophene-2-sulfonamide antiglaucoma agents | |
| EP0182691B1 (en) | Substituted thiophene-2-sulfonamides and their preparation | |
| JPH0219837B2 (enFirst) | ||
| EP0543497A1 (en) | Tricyclic thienothiopyrans as antiglancoma agents | |
| US5175284A (en) | Tricyclic thienothiopyrans as pharmaceutical intermediates | |
| DK167064B1 (da) | Thienooe2,3-baafuran-2-sulfonamid og farmaceutisk praeparat indeholdende en saadan forbindelse | |
| US5308842A (en) | Tricyclic derivatives of the thienodiazocine and thienothiadiazocine classes of compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: MERCK & CO., INC. |