FI72299C - Foerfarande foer framstaellning av vattenfria vaeteperoxidloesningar. - Google Patents
Foerfarande foer framstaellning av vattenfria vaeteperoxidloesningar. Download PDFInfo
- Publication number
- FI72299C FI72299C FI840691A FI840691A FI72299C FI 72299 C FI72299 C FI 72299C FI 840691 A FI840691 A FI 840691A FI 840691 A FI840691 A FI 840691A FI 72299 C FI72299 C FI 72299C
- Authority
- FI
- Finland
- Prior art keywords
- hydrogen peroxide
- solvent
- weight
- boiling
- process according
- Prior art date
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 181
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 61
- 238000009835 boiling Methods 0.000 claims abstract description 60
- 239000002904 solvent Substances 0.000 claims abstract description 52
- 238000000034 method Methods 0.000 claims abstract description 32
- 239000003960 organic solvent Substances 0.000 claims abstract description 11
- 238000002156 mixing Methods 0.000 claims abstract description 8
- 238000004519 manufacturing process Methods 0.000 claims abstract description 4
- 230000015572 biosynthetic process Effects 0.000 claims abstract 2
- 239000000243 solution Substances 0.000 claims description 47
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropyl acetate Chemical compound CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 11
- -1 phosphorus compound Chemical class 0.000 claims description 11
- 239000007864 aqueous solution Substances 0.000 claims description 10
- FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical compound CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 4
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 235000021317 phosphate Nutrition 0.000 claims description 4
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical group CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 claims description 4
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 150000003672 ureas Chemical class 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- SNDGLCYYBKJSOT-UHFFFAOYSA-N 1,1,3,3-tetrabutylurea Chemical compound CCCCN(CCCC)C(=O)N(CCCC)CCCC SNDGLCYYBKJSOT-UHFFFAOYSA-N 0.000 claims description 3
- UWHSPZZUAYSGTB-UHFFFAOYSA-N 1,1,3,3-tetraethylurea Chemical group CCN(CC)C(=O)N(CC)CC UWHSPZZUAYSGTB-UHFFFAOYSA-N 0.000 claims description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 150000003951 lactams Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229920006395 saturated elastomer Polymers 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 claims description 2
- 239000011550 stock solution Substances 0.000 claims description 2
- 239000004202 carbamide Substances 0.000 claims 4
- 150000002367 halogens Chemical class 0.000 claims 4
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims 2
- 239000010452 phosphate Substances 0.000 claims 2
- 229910052698 phosphorus Inorganic materials 0.000 claims 2
- 239000011574 phosphorus Substances 0.000 claims 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 8
- 238000004821 distillation Methods 0.000 description 13
- 229940011051 isopropyl acetate Drugs 0.000 description 12
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 12
- 238000002360 preparation method Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000010533 azeotropic distillation Methods 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 150000001733 carboxylic acid esters Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- 238000012856 packing Methods 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 150000008379 phenol ethers Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 208000005156 Dehydration Diseases 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- QBWAHTSWCPQIMU-UHFFFAOYSA-N P(=O)(OCCCCCCCC)(OCCCCCCCC)OCCCCCCCC.OO Chemical compound P(=O)(OCCCCCCCC)(OCCCCCCCC)OCCCCCCCC.OO QBWAHTSWCPQIMU-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- WVPGXJOLGGFBCR-UHFFFAOYSA-N trioctyl phosphate Chemical class CCCCCCCCOP(=O)(OCCCCCCCC)OCCCCCCCC WVPGXJOLGGFBCR-UHFFFAOYSA-N 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/01—Hydrogen peroxide
- C01B15/013—Separation; Purification; Concentration
- C01B15/017—Anhydrous hydrogen peroxide; Anhydrous solutions or gaseous mixtures containing hydrogen peroxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Steroid Compounds (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3308740 | 1983-03-11 | ||
| DE19833308740 DE3308740A1 (de) | 1983-03-11 | 1983-03-11 | Verfahren zur herstellung nichtwaessriger wasserstoffperoxidloesungen |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI840691A0 FI840691A0 (fi) | 1984-02-20 |
| FI840691L FI840691L (fi) | 1984-09-12 |
| FI72299B FI72299B (fi) | 1987-01-30 |
| FI72299C true FI72299C (fi) | 1987-05-11 |
Family
ID=6193221
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI840691A FI72299C (fi) | 1983-03-11 | 1984-02-20 | Foerfarande foer framstaellning av vattenfria vaeteperoxidloesningar. |
Country Status (9)
| Country | Link |
|---|---|
| EP (1) | EP0121660B1 (OSRAM) |
| JP (1) | JPS59169906A (OSRAM) |
| AT (1) | ATE33615T1 (OSRAM) |
| BR (1) | BR8400946A (OSRAM) |
| CA (1) | CA1206741A (OSRAM) |
| DE (2) | DE3308740A1 (OSRAM) |
| ES (1) | ES8502659A1 (OSRAM) |
| FI (1) | FI72299C (OSRAM) |
| IL (1) | IL71040A (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU85789A1 (fr) * | 1985-02-26 | 1986-09-02 | Oreal | Utilisation dans les domaines therapeutique et cosmetique d'une solution anhydre de peroxyde d'hydrogene |
| USD551726S1 (en) * | 2003-07-09 | 2007-09-25 | Ricky Charles Pierce | Training basketball |
| EP4352010A1 (en) * | 2021-06-09 | 2024-04-17 | Lyondell Chemical Technology, L.P. | Non-aqueous hydrogen peroxide solution and method of manufacture |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1262982B (de) * | 1966-03-02 | 1968-03-14 | Bayer Ag | Wasserstoffperoxidloesungen in fluessigen Estern |
| DE2038320C3 (de) * | 1970-08-01 | 1981-05-07 | Bayer Ag, 5090 Leverkusen | Nichtwäßrige Wasserstoffperpxid-Lösungen |
| DE2038319C3 (de) * | 1970-08-01 | 1980-09-04 | Bayer Ag, 5090 Leverkusen | Nichtwäßrige Wasserstoffperoxid-Lösungen |
| DE3225307A1 (de) * | 1982-07-07 | 1984-01-12 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung wasserfreier, organischer wasserstoffperoxidloesungen |
-
1983
- 1983-03-11 DE DE19833308740 patent/DE3308740A1/de active Granted
-
1984
- 1984-01-27 EP EP84100839A patent/EP0121660B1/de not_active Expired
- 1984-01-27 AT AT84100839T patent/ATE33615T1/de not_active IP Right Cessation
- 1984-01-27 DE DE8484100839T patent/DE3470515D1/de not_active Expired
- 1984-02-15 ES ES529731A patent/ES8502659A1/es not_active Expired
- 1984-02-20 FI FI840691A patent/FI72299C/fi not_active IP Right Cessation
- 1984-02-22 IL IL71040A patent/IL71040A/xx unknown
- 1984-02-29 BR BR8400946A patent/BR8400946A/pt not_active IP Right Cessation
- 1984-03-09 CA CA000449245A patent/CA1206741A/en not_active Expired
- 1984-03-09 JP JP59044224A patent/JPS59169906A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| ES529731A0 (es) | 1985-01-16 |
| IL71040A (en) | 1987-08-31 |
| FI840691L (fi) | 1984-09-12 |
| ES8502659A1 (es) | 1985-01-16 |
| EP0121660B1 (de) | 1988-04-20 |
| DE3308740A1 (de) | 1984-09-13 |
| BR8400946A (pt) | 1984-10-16 |
| ATE33615T1 (de) | 1988-05-15 |
| IL71040A0 (en) | 1984-05-31 |
| DE3308740C2 (OSRAM) | 1987-11-05 |
| FI72299B (fi) | 1987-01-30 |
| CA1206741A (en) | 1986-07-02 |
| JPS59169906A (ja) | 1984-09-26 |
| EP0121660A1 (de) | 1984-10-17 |
| DE3470515D1 (en) | 1988-05-26 |
| FI840691A0 (fi) | 1984-02-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1279644C (en) | Process for producing aqueous n-methylmorpholine-n-oxide solutions | |
| US5922244A (en) | 4-acylaminopiperidin-N-oxyle | |
| AU2009248506B2 (en) | Production of ethylenically unsaturated acids or esters thereof | |
| KR101237101B1 (ko) | 기체를 분리하는 방법 | |
| KR950701600A (ko) | 무기질 겔의 제조방법(process for making inorganic gels) | |
| US4564514A (en) | Process for the production of water-free organic hydrogen peroxide solution | |
| FI72299B (fi) | Foerfarande foer framstaellning av vattenfria vaeteperoxidloesningar. | |
| DE10010825A1 (de) | Verfahren zur Abtrennung eines Azepin-Derivats aus einer Mischung enthaltend ein Amin und ein Azepin-Derivat | |
| JPH06510324A (ja) | アルミナ含有二酸化チタニウムの存在下に有機ホスホン酸またはエステルの触媒を用いてポリアミドの分子量を増加させる方法 | |
| FI72707B (fi) | Foerfarande foer framstaellning av vattenfria, organiska vaeteperoxidloesningar. | |
| FI79292B (fi) | Foerfarande foer framstaellning av ringhydroxileringsprodukter av fenoler eller fenoletrar. | |
| KR100458669B1 (ko) | 이미도-알칸퍼카르복실산중의물과극성불순물을감소시키는방법 | |
| US4713437A (en) | Salt of oxaalkylenediamine with dicarboxylic acid, containing hydrazine, preparation, and nylon prepared therefrom | |
| US2956051A (en) | Process for preparing cyclic amides | |
| SU687090A1 (ru) | Композици на основе полиэтилентерефталата | |
| JP2000256265A (ja) | メタクリル酸メチルの製造方法 | |
| US2779765A (en) | Stabilization of pyrrole | |
| US4328069A (en) | Process for the elimination of the residual fluorescence resulting from optical bleaching agents | |
| JPS61101590A (ja) | タール酸の精製方法 | |
| RU2127243C1 (ru) | Композиция, предупреждающая преждевременную полимеризацию, и способ ингибирования преждевременной полимеризации | |
| US3998854A (en) | Trithiophosphite stabilized maleic anhydride | |
| DE3539036A1 (de) | In 2-stellung substituierte diperoxyglutarsaeuren, ein verfahren zur herstellung und ihre verwendung | |
| CA1295339C (en) | N-alkyl-benzenesulphonamides | |
| CA1291763C (en) | Obtaining maleic anhydride not prone to discolor | |
| KR100398992B1 (ko) | 디메틸 아디페이트 증류방법 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: DEGUSSA AKTIENGESELLSCHAFT |