FI70209C - Foerfarande foer framstaellning av pyrrolidin-2-oner och 3-pyrrolin-2-oner - Google Patents
Foerfarande foer framstaellning av pyrrolidin-2-oner och 3-pyrrolin-2-oner Download PDFInfo
- Publication number
 - FI70209C FI70209C FI791866A FI791866A FI70209C FI 70209 C FI70209 C FI 70209C FI 791866 A FI791866 A FI 791866A FI 791866 A FI791866 A FI 791866A FI 70209 C FI70209 C FI 70209C
 - Authority
 - FI
 - Finland
 - Prior art keywords
 - alkyl
 - optionally substituted
 - group
 - aryl
 - hydrogen
 - Prior art date
 
Links
- 238000000034 method Methods 0.000 title claims description 16
 - OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 39
 - 229910052739 hydrogen Inorganic materials 0.000 claims description 37
 - 239000001257 hydrogen Substances 0.000 claims description 31
 - 125000000217 alkyl group Chemical group 0.000 claims description 28
 - 125000000547 substituted alkyl group Chemical group 0.000 claims description 23
 - 150000001875 compounds Chemical class 0.000 claims description 22
 - 125000003107 substituted aryl group Chemical group 0.000 claims description 21
 - 150000002431 hydrogen Chemical group 0.000 claims description 18
 - XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
 - 125000003118 aryl group Chemical group 0.000 claims description 17
 - CDCHBOQVXIGZHA-UHFFFAOYSA-N 1,2-dihydropyrrol-5-one Chemical class O=C1NCC=C1 CDCHBOQVXIGZHA-UHFFFAOYSA-N 0.000 claims description 13
 - HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical class O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 13
 - 238000002360 preparation method Methods 0.000 claims description 12
 - 238000007363 ring formation reaction Methods 0.000 claims description 10
 - 239000003054 catalyst Substances 0.000 claims description 9
 - UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
 - DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 8
 - 239000002253 acid Substances 0.000 claims description 8
 - 125000002252 acyl group Chemical group 0.000 claims description 6
 - 125000003435 aroyl group Chemical group 0.000 claims description 6
 - 230000008569 process Effects 0.000 claims description 6
 - 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
 - 125000001188 haloalkyl group Chemical group 0.000 claims description 4
 - 229910052736 halogen Inorganic materials 0.000 claims description 4
 - 150000002367 halogens Chemical class 0.000 claims description 4
 - 238000005984 hydrogenation reaction Methods 0.000 claims description 4
 - CMSYDJVRTHCWFP-UHFFFAOYSA-N triphenylphosphane;hydrobromide Chemical group Br.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 CMSYDJVRTHCWFP-UHFFFAOYSA-N 0.000 claims description 4
 - DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
 - 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 3
 - 229910052703 rhodium Inorganic materials 0.000 claims description 3
 - 239000010948 rhodium Substances 0.000 claims description 3
 - MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 3
 - 239000011734 sodium Substances 0.000 claims description 3
 - 229910052708 sodium Inorganic materials 0.000 claims description 3
 - 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
 - 239000011541 reaction mixture Substances 0.000 claims description 2
 - RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims 3
 - DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 claims 1
 - QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
 - 229910000510 noble metal Inorganic materials 0.000 claims 1
 - 229910052760 oxygen Inorganic materials 0.000 claims 1
 - 239000001301 oxygen Substances 0.000 claims 1
 - LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 claims 1
 - VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
 - 239000000243 solution Substances 0.000 description 25
 - 239000000203 mixture Substances 0.000 description 20
 - UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
 - HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
 - -1 bromine compound Chemical class 0.000 description 10
 - YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
 - XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
 - HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 8
 - HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
 - WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
 - RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
 - 238000001704 evaporation Methods 0.000 description 8
 - 230000008020 evaporation Effects 0.000 description 8
 - 238000001914 filtration Methods 0.000 description 7
 - 229910052757 nitrogen Inorganic materials 0.000 description 7
 - QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
 - 239000002585 base Substances 0.000 description 6
 - RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 6
 - XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical class NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
 - 239000013078 crystal Substances 0.000 description 5
 - 239000000047 product Substances 0.000 description 5
 - 239000002002 slurry Substances 0.000 description 5
 - 125000001424 substituent group Chemical group 0.000 description 5
 - UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
 - 238000006243 chemical reaction Methods 0.000 description 4
 - 230000007062 hydrolysis Effects 0.000 description 4
 - 238000006460 hydrolysis reaction Methods 0.000 description 4
 - KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
 - YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
 - XMMJINSTYOLCCA-UHFFFAOYSA-N 1-benzyl-3-[4-(trifluoromethyl)phenyl]-2h-pyrrol-5-one Chemical compound C1=CC(C(F)(F)F)=CC=C1C(C1)=CC(=O)N1CC1=CC=CC=C1 XMMJINSTYOLCCA-UHFFFAOYSA-N 0.000 description 3
 - PDTLMKLERGEENQ-UHFFFAOYSA-N 4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one Chemical compound C1=CC(C(F)(F)F)=CC=C1C1CC(=O)NC1 PDTLMKLERGEENQ-UHFFFAOYSA-N 0.000 description 3
 - QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
 - 239000008346 aqueous phase Substances 0.000 description 3
 - GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
 - 229910052794 bromium Inorganic materials 0.000 description 3
 - BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 3
 - 150000003951 lactams Chemical class 0.000 description 3
 - 239000012299 nitrogen atmosphere Substances 0.000 description 3
 - 150000003235 pyrrolidines Chemical class 0.000 description 3
 - 238000003756 stirring Methods 0.000 description 3
 - KCUJZQHVIDHUQU-UHFFFAOYSA-N 3,4-diphenylpyrrolidine Chemical compound C1NCC(C=2C=CC=CC=2)C1C1=CC=CC=C1 KCUJZQHVIDHUQU-UHFFFAOYSA-N 0.000 description 2
 - XWWQNFOFKPPMHY-UHFFFAOYSA-N 4-(4-chlorophenyl)-1,5-dimethylpyrrolidin-2-one Chemical compound C1C(=O)N(C)C(C)C1C1=CC=C(Cl)C=C1 XWWQNFOFKPPMHY-UHFFFAOYSA-N 0.000 description 2
 - FTSJDURWVUMKDO-UHFFFAOYSA-N 4-amino-3-[4-(trifluoromethyl)phenyl]butanoic acid Chemical compound OC(=O)CC(CN)C1=CC=C(C(F)(F)F)C=C1 FTSJDURWVUMKDO-UHFFFAOYSA-N 0.000 description 2
 - DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
 - CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
 - IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
 - FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
 - ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
 - 230000001476 alcoholic effect Effects 0.000 description 2
 - 150000001413 amino acids Chemical class 0.000 description 2
 - 150000003863 ammonium salts Chemical class 0.000 description 2
 - 239000003637 basic solution Substances 0.000 description 2
 - 230000002051 biphasic effect Effects 0.000 description 2
 - 125000005588 carbonic acid salt group Chemical group 0.000 description 2
 - 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
 - 150000001805 chlorine compounds Chemical class 0.000 description 2
 - MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
 - 238000002425 crystallisation Methods 0.000 description 2
 - 230000008025 crystallization Effects 0.000 description 2
 - 238000000354 decomposition reaction Methods 0.000 description 2
 - 230000000694 effects Effects 0.000 description 2
 - HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 2
 - 238000000605 extraction Methods 0.000 description 2
 - 229910052500 inorganic mineral Inorganic materials 0.000 description 2
 - 239000012280 lithium aluminium hydride Substances 0.000 description 2
 - 239000011777 magnesium Substances 0.000 description 2
 - 229910052749 magnesium Inorganic materials 0.000 description 2
 - 238000002844 melting Methods 0.000 description 2
 - 230000008018 melting Effects 0.000 description 2
 - 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
 - 239000011707 mineral Substances 0.000 description 2
 - 235000010755 mineral Nutrition 0.000 description 2
 - PMOIAJVKYNVHQE-UHFFFAOYSA-N phosphanium;bromide Chemical compound [PH4+].[Br-] PMOIAJVKYNVHQE-UHFFFAOYSA-N 0.000 description 2
 - XUYJLQHKOGNDPB-UHFFFAOYSA-N phosphonoacetic acid Chemical compound OC(=O)CP(O)(O)=O XUYJLQHKOGNDPB-UHFFFAOYSA-N 0.000 description 2
 - 239000011591 potassium Substances 0.000 description 2
 - 229910052700 potassium Inorganic materials 0.000 description 2
 - 238000010992 reflux Methods 0.000 description 2
 - 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
 - 235000017557 sodium bicarbonate Nutrition 0.000 description 2
 - LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
 - 239000002904 solvent Substances 0.000 description 2
 - 239000000725 suspension Substances 0.000 description 2
 - FIQMHBFVRAXMOP-UHFFFAOYSA-N triphenylphosphane oxide Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)(=O)C1=CC=CC=C1 FIQMHBFVRAXMOP-UHFFFAOYSA-N 0.000 description 2
 - IOCYQQQCJYMWDT-UHFFFAOYSA-N (3-ethyl-2-methoxyquinolin-6-yl)-(4-methoxycyclohexyl)methanone Chemical compound C=1C=C2N=C(OC)C(CC)=CC2=CC=1C(=O)C1CCC(OC)CC1 IOCYQQQCJYMWDT-UHFFFAOYSA-N 0.000 description 1
 - RHNBWZZWDAOBQY-UHFFFAOYSA-N 1,2,4-trimethyl-3-phenyl-2h-pyrrol-5-one Chemical compound CC1N(C)C(=O)C(C)=C1C1=CC=CC=C1 RHNBWZZWDAOBQY-UHFFFAOYSA-N 0.000 description 1
 - QLCPYHKRCGVOOA-UHFFFAOYSA-N 1,2-dimethyl-3-phenyl-2h-pyrrol-5-one Chemical compound CC1N(C)C(=O)C=C1C1=CC=CC=C1 QLCPYHKRCGVOOA-UHFFFAOYSA-N 0.000 description 1
 - WPPVBSYWZWZVTN-UHFFFAOYSA-N 1,3,5-trimethyl-4-phenylpyrrolidin-2-one Chemical compound CC1C(=O)N(C)C(C)C1C1=CC=CC=C1 WPPVBSYWZWZVTN-UHFFFAOYSA-N 0.000 description 1
 - ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
 - HOEWCGCSKILLPY-UHFFFAOYSA-N 1,5-dimethyl-4-(4-nitrophenyl)pyrrolidin-2-one Chemical compound C1C(=O)N(C)C(C)C1C1=CC=C([N+]([O-])=O)C=C1 HOEWCGCSKILLPY-UHFFFAOYSA-N 0.000 description 1
 - QCZVVNIEASUBIS-UHFFFAOYSA-N 1,5-dimethyl-4-phenylpyrrolidin-2-one Chemical compound C1C(=O)N(C)C(C)C1C1=CC=CC=C1 QCZVVNIEASUBIS-UHFFFAOYSA-N 0.000 description 1
 - IRVWTVRIFOKBIL-UHFFFAOYSA-N 1-benzyl-4-methyl-3-[4-(trifluoromethyl)phenyl]-2h-pyrrol-5-one Chemical compound O=C1C(C)=C(C=2C=CC(=CC=2)C(F)(F)F)CN1CC1=CC=CC=C1 IRVWTVRIFOKBIL-UHFFFAOYSA-N 0.000 description 1
 - DHMVUKFVGBQDDA-UHFFFAOYSA-N 1-methyl-3-(4-methylphenyl)-4-phenyl-2h-pyrrol-5-one Chemical compound O=C1N(C)CC(C=2C=CC(C)=CC=2)=C1C1=CC=CC=C1 DHMVUKFVGBQDDA-UHFFFAOYSA-N 0.000 description 1
 - QPBIBMGRFHVCJI-UHFFFAOYSA-N 1-methyl-4-(4-methylphenyl)-3-phenylpyrrolidin-2-one Chemical compound O=C1N(C)CC(C=2C=CC(C)=CC=2)C1C1=CC=CC=C1 QPBIBMGRFHVCJI-UHFFFAOYSA-N 0.000 description 1
 - SWLVHCWYTKNOAB-UHFFFAOYSA-N 2-(5-oxo-3-phenyl-1,2-dihydropyrrol-4-yl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1=C(C=2C=CC=CC=2)CNC1=O SWLVHCWYTKNOAB-UHFFFAOYSA-N 0.000 description 1
 - HEQOJEGTZCTHCF-UHFFFAOYSA-N 2-amino-1-phenylethanone Chemical compound NCC(=O)C1=CC=CC=C1 HEQOJEGTZCTHCF-UHFFFAOYSA-N 0.000 description 1
 - SYZRZLUNWVNNNV-UHFFFAOYSA-N 2-bromoacetyl chloride Chemical compound ClC(=O)CBr SYZRZLUNWVNNNV-UHFFFAOYSA-N 0.000 description 1
 - NJBMZYSKLWQXLJ-UHFFFAOYSA-N 3,4-dihydro-2h-pyrrol-5-amine Chemical class NC1=NCCC1 NJBMZYSKLWQXLJ-UHFFFAOYSA-N 0.000 description 1
 - GNWOFDWOUZXQPD-UHFFFAOYSA-N 3,4-diphenyl-1,2-dihydropyrrol-5-one Chemical compound O=C1NCC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 GNWOFDWOUZXQPD-UHFFFAOYSA-N 0.000 description 1
 - RVCBHJGJEHRCCK-UHFFFAOYSA-N 3-(2-fluorophenyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one Chemical compound FC1=CC=CC=C1C1C(=O)NCC1C1=CC=C(C(F)(F)F)C=C1 RVCBHJGJEHRCCK-UHFFFAOYSA-N 0.000 description 1
 - PMGYCIGYLNWVCH-UHFFFAOYSA-N 3-(3,4-dimethoxyphenyl)-4-phenyl-1,2-dihydropyrrol-5-one Chemical compound C1=C(OC)C(OC)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)NC1 PMGYCIGYLNWVCH-UHFFFAOYSA-N 0.000 description 1
 - KEMCZWYPWCUGPE-UHFFFAOYSA-N 3-(4-chlorophenyl)-4-phenyl-1,2-dihydropyrrol-5-one Chemical compound C1=CC(Cl)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)NC1 KEMCZWYPWCUGPE-UHFFFAOYSA-N 0.000 description 1
 - XZWCDKTUYKCMMH-UHFFFAOYSA-N 3-(4-fluorophenyl)-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one Chemical compound C1=CC(F)=CC=C1C1C(=O)NCC1C1=CC=C(C(F)(F)F)C=C1 XZWCDKTUYKCMMH-UHFFFAOYSA-N 0.000 description 1
 - XIAMSSUQNNNXMH-UHFFFAOYSA-N 3-(4-fluorophenyl)-4-phenyl-1,2-dihydropyrrol-5-one Chemical compound C1=CC(F)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)NC1 XIAMSSUQNNNXMH-UHFFFAOYSA-N 0.000 description 1
 - SYUHPEZHTMIRMJ-UHFFFAOYSA-N 3-(4-fluorophenyl)-4-phenylpyrrolidin-2-one Chemical compound C1=CC(F)=CC=C1C1C(=O)NCC1C1=CC=CC=C1 SYUHPEZHTMIRMJ-UHFFFAOYSA-N 0.000 description 1
 - LXZAVFHIIYGLTF-UHFFFAOYSA-N 3-(4-methoxyphenyl)-4-phenyl-1,2-dihydropyrrol-5-one Chemical compound C1=CC(OC)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)NC1 LXZAVFHIIYGLTF-UHFFFAOYSA-N 0.000 description 1
 - XRCJTMJEQCHAOB-UHFFFAOYSA-N 3-(4-methylphenyl)-4-phenyl-1,2-dihydropyrrol-5-one Chemical compound C1=CC(C)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)NC1 XRCJTMJEQCHAOB-UHFFFAOYSA-N 0.000 description 1
 - VNGGQUXNILKHIE-UHFFFAOYSA-N 3-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrol-5-one Chemical compound C1=CC(C(F)(F)F)=CC=C1C1=CC(=O)NC1 VNGGQUXNILKHIE-UHFFFAOYSA-N 0.000 description 1
 - QPGLUEKHBNOAHG-UHFFFAOYSA-N 3-carboxypropylazanium;chloride Chemical class Cl.NCCCC(O)=O QPGLUEKHBNOAHG-UHFFFAOYSA-N 0.000 description 1
 - CVOQOLZRCXIRRT-UHFFFAOYSA-N 3-methyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one Chemical compound C1NC(=O)C(C)C1C1=CC=C(C(F)(F)F)C=C1 CVOQOLZRCXIRRT-UHFFFAOYSA-N 0.000 description 1
 - USRGHTBNRODIGQ-UHFFFAOYSA-N 3-phenyl-4-[4-(trifluoromethyl)phenyl]pyrrolidin-2-one Chemical compound C1=CC(C(F)(F)F)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 USRGHTBNRODIGQ-UHFFFAOYSA-N 0.000 description 1
 - JPMRXLUPEVYCNZ-UHFFFAOYSA-N 4-(2-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrol-5-one Chemical compound FC1=CC=CC=C1C1=C(C=2C=CC(=CC=2)C(F)(F)F)CNC1=O JPMRXLUPEVYCNZ-UHFFFAOYSA-N 0.000 description 1
 - PUUOYNFEZBLMMU-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-3-phenylpyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 PUUOYNFEZBLMMU-UHFFFAOYSA-N 0.000 description 1
 - JBIVTGWLCSEZEU-UHFFFAOYSA-N 4-(4-aminophenyl)-1,5-dimethylpyrrolidin-2-one Chemical compound C1C(=O)N(C)C(C)C1C1=CC=C(N)C=C1 JBIVTGWLCSEZEU-UHFFFAOYSA-N 0.000 description 1
 - QZSANDZKAKLRPX-UHFFFAOYSA-N 4-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrol-5-one Chemical compound C1=CC(F)=CC=C1C1=C(C=2C=CC(=CC=2)C(F)(F)F)CNC1=O QZSANDZKAKLRPX-UHFFFAOYSA-N 0.000 description 1
 - LIOVPXGQAPGNNY-UHFFFAOYSA-N 4-(4-fluorophenyl)-3-phenyl-1,2-dihydropyrrol-5-one Chemical compound C1=CC(F)=CC=C1C1=C(C=2C=CC=CC=2)CNC1=O LIOVPXGQAPGNNY-UHFFFAOYSA-N 0.000 description 1
 - SDVNHWAFTHMIQR-UHFFFAOYSA-N 4-(4-fluorophenyl)-3-phenylpyrrolidin-2-one Chemical class C1=CC(F)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 SDVNHWAFTHMIQR-UHFFFAOYSA-N 0.000 description 1
 - PRNHHUOUMAWRJT-UHFFFAOYSA-N 4-(4-methoxyphenyl)-3-phenylpyrrolidin-2-one Chemical compound C1=CC(OC)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 PRNHHUOUMAWRJT-UHFFFAOYSA-N 0.000 description 1
 - SSNGRNRNPOYPGF-UHFFFAOYSA-N 4-(4-methylphenyl)-3-phenylpyrrolidin-2-one Chemical compound C1=CC(C)=CC=C1C1C(C=2C=CC=CC=2)C(=O)NC1 SSNGRNRNPOYPGF-UHFFFAOYSA-N 0.000 description 1
 - FEAMOVNKFGZAET-UHFFFAOYSA-N 4-(methylamino)-3-phenylpentanoic acid Chemical compound CNC(C)C(CC(O)=O)C1=CC=CC=C1 FEAMOVNKFGZAET-UHFFFAOYSA-N 0.000 description 1
 - CMLJIUSFVCLSEZ-UHFFFAOYSA-N 4-amino-2,3-diphenylbutanoic acid hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(CN)C(C(O)=O)C1=CC=CC=C1 CMLJIUSFVCLSEZ-UHFFFAOYSA-N 0.000 description 1
 - SLELWOSWONKPDI-UHFFFAOYSA-N 4-amino-2-(2-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]butanoic acid Chemical compound C=1C=C(C(F)(F)F)C=CC=1C(CN)C(C(O)=O)C1=CC=CC=C1F SLELWOSWONKPDI-UHFFFAOYSA-N 0.000 description 1
 - OMYHIXODIJKCPW-UHFFFAOYSA-N 4-amino-2-(4-fluorophenyl)-3-[4-(trifluoromethyl)phenyl]butanoic acid Chemical compound C=1C=C(C(F)(F)F)C=CC=1C(CN)C(C(O)=O)C1=CC=C(F)C=C1 OMYHIXODIJKCPW-UHFFFAOYSA-N 0.000 description 1
 - JOYRWNXTZLYBQG-UHFFFAOYSA-N 4-amino-2-(4-fluorophenyl)-3-phenylbutanoic acid Chemical compound C=1C=CC=CC=1C(CN)C(C(O)=O)C1=CC=C(F)C=C1 JOYRWNXTZLYBQG-UHFFFAOYSA-N 0.000 description 1
 - UJURGUWNPZECFJ-UHFFFAOYSA-N 4-amino-2-methyl-3-[4-(trifluoromethyl)phenyl]butanoic acid Chemical compound OC(=O)C(C)C(CN)C1=CC=C(C(F)(F)F)C=C1 UJURGUWNPZECFJ-UHFFFAOYSA-N 0.000 description 1
 - MGNLMDDRHLWILY-UHFFFAOYSA-N 4-amino-3-(4-fluorophenyl)-2-phenylbutanoic acid Chemical compound C=1C=C(F)C=CC=1C(CN)C(C(O)=O)C1=CC=CC=C1 MGNLMDDRHLWILY-UHFFFAOYSA-N 0.000 description 1
 - VFGHAQNYKTWWOM-UHFFFAOYSA-N 4-amino-3-(4-methylphenyl)-2-phenylbutanoic acid Chemical compound C1=CC(C)=CC=C1C(CN)C(C(O)=O)C1=CC=CC=C1 VFGHAQNYKTWWOM-UHFFFAOYSA-N 0.000 description 1
 - DQOSOTIKDZAXKT-UHFFFAOYSA-N 4-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-dihydropyrrol-5-one Chemical compound C1=CC(C(F)(F)F)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)NC1 DQOSOTIKDZAXKT-UHFFFAOYSA-N 0.000 description 1
 - CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
 - BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
 - CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
 - VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
 - 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
 - 101100441092 Danio rerio crlf3 gene Proteins 0.000 description 1
 - LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
 - 229910010082 LiAlH Inorganic materials 0.000 description 1
 - 239000012448 Lithium borohydride Substances 0.000 description 1
 - IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
 - VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
 - 150000001298 alcohols Chemical class 0.000 description 1
 - 150000001412 amines Chemical class 0.000 description 1
 - 150000001450 anions Chemical class 0.000 description 1
 - 239000007864 aqueous solution Substances 0.000 description 1
 - 238000009876 asymmetric hydrogenation reaction Methods 0.000 description 1
 - RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
 - 229910001863 barium hydroxide Inorganic materials 0.000 description 1
 - 150000001555 benzenes Chemical class 0.000 description 1
 - 150000001649 bromium compounds Chemical class 0.000 description 1
 - 239000006227 byproduct Substances 0.000 description 1
 - 239000004202 carbamide Substances 0.000 description 1
 - 229910052799 carbon Inorganic materials 0.000 description 1
 - 210000003169 central nervous system Anatomy 0.000 description 1
 - 239000007795 chemical reaction product Substances 0.000 description 1
 - 239000003795 chemical substances by application Substances 0.000 description 1
 - 239000000460 chlorine Substances 0.000 description 1
 - 238000013375 chromatographic separation Methods 0.000 description 1
 - 238000009833 condensation Methods 0.000 description 1
 - 230000005494 condensation Effects 0.000 description 1
 - 238000001816 cooling Methods 0.000 description 1
 - OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
 - 230000002950 deficient Effects 0.000 description 1
 - 239000012954 diazonium Substances 0.000 description 1
 - IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
 - 238000010790 dilution Methods 0.000 description 1
 - 239000012895 dilution Substances 0.000 description 1
 - 239000000539 dimer Substances 0.000 description 1
 - 238000001035 drying Methods 0.000 description 1
 - 150000002148 esters Chemical class 0.000 description 1
 - SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
 - 125000002541 furyl group Chemical group 0.000 description 1
 - 229960003692 gamma aminobutyric acid Drugs 0.000 description 1
 - 230000008570 general process Effects 0.000 description 1
 - 229930195733 hydrocarbon Natural products 0.000 description 1
 - 150000002430 hydrocarbons Chemical class 0.000 description 1
 - 150000003840 hydrochlorides Chemical class 0.000 description 1
 - 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
 - IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
 - 238000007327 hydrogenolysis reaction Methods 0.000 description 1
 - 150000004679 hydroxides Chemical class 0.000 description 1
 - 239000005457 ice water Substances 0.000 description 1
 - 238000006317 isomerization reaction Methods 0.000 description 1
 - 150000002576 ketones Chemical class 0.000 description 1
 - 150000002596 lactones Chemical class 0.000 description 1
 - UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
 - 238000012986 modification Methods 0.000 description 1
 - 230000004048 modification Effects 0.000 description 1
 - DJEBTLRMBZNIIF-UHFFFAOYSA-N n-phenacyl-2-phenylacetamide Chemical compound C=1C=CC=CC=1C(=O)CNC(=O)CC1=CC=CC=C1 DJEBTLRMBZNIIF-UHFFFAOYSA-N 0.000 description 1
 - 125000001624 naphthyl group Chemical group 0.000 description 1
 - 230000007935 neutral effect Effects 0.000 description 1
 - 239000003208 petroleum Substances 0.000 description 1
 - 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
 - 229910052697 platinum Inorganic materials 0.000 description 1
 - 239000002244 precipitate Substances 0.000 description 1
 - 150000003180 prostaglandins Chemical class 0.000 description 1
 - 125000006239 protecting group Chemical group 0.000 description 1
 - 125000004076 pyridyl group Chemical group 0.000 description 1
 - HNJBEVLQSNELDL-YZRHJBSPSA-N pyrrolidin-2-one Chemical class O=C1CC[14CH2]N1 HNJBEVLQSNELDL-YZRHJBSPSA-N 0.000 description 1
 - 125000005493 quinolyl group Chemical group 0.000 description 1
 - 150000003839 salts Chemical class 0.000 description 1
 - 239000000741 silica gel Substances 0.000 description 1
 - 229910002027 silica gel Inorganic materials 0.000 description 1
 - 235000010288 sodium nitrite Nutrition 0.000 description 1
 - 239000007787 solid Substances 0.000 description 1
 - 239000007858 starting material Substances 0.000 description 1
 - 239000000126 substance Substances 0.000 description 1
 - 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
 - HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
 - 125000001544 thienyl group Chemical group 0.000 description 1
 - 238000005406 washing Methods 0.000 description 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
 - C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
 - C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
 - C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
 - C07D207/24—Oxygen or sulfur atoms
 - C07D207/26—2-Pyrrolidones
 - C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
 - C07D207/267—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atom
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
 - C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
 - C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
 - C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
 - C07D207/24—Oxygen or sulfur atoms
 - C07D207/26—2-Pyrrolidones
 - C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
 - C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07D—HETEROCYCLIC COMPOUNDS
 - C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
 - C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
 - C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
 - C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
 - C07D207/36—Oxygen or sulfur atoms
 - C07D207/38—2-Pyrrolones
 
 - 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
 - C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
 - C07F9/02—Phosphorus compounds
 - C07F9/28—Phosphorus compounds with one or more P—C bonds
 - C07F9/54—Quaternary phosphonium compounds
 - C07F9/5407—Acyclic saturated phosphonium compounds
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Health & Medical Sciences (AREA)
 - Life Sciences & Earth Sciences (AREA)
 - Biochemistry (AREA)
 - General Health & Medical Sciences (AREA)
 - Molecular Biology (AREA)
 - Pyrrole Compounds (AREA)
 - Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
 - Saccharide Compounds (AREA)
 - Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
 
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| US91468278A | 1978-06-12 | 1978-06-12 | |
| US91468278 | 1978-06-12 | ||
| US1249679A | 1979-02-15 | 1979-02-15 | |
| US1249679 | 1979-02-15 | 
Publications (3)
| Publication Number | Publication Date | 
|---|---|
| FI791866A7 FI791866A7 (fi) | 1979-12-13 | 
| FI70209B FI70209B (fi) | 1986-02-28 | 
| FI70209C true FI70209C (fi) | 1986-09-15 | 
Family
ID=26683628
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| FI791866A FI70209C (fi) | 1978-06-12 | 1979-06-12 | Foerfarande foer framstaellning av pyrrolidin-2-oner och 3-pyrrolin-2-oner | 
Country Status (19)
| Country | Link | 
|---|---|
| AR (1) | AR222997A1 (en, 2012) | 
| AT (1) | ATA386679A (en, 2012) | 
| AU (1) | AU529479B2 (en, 2012) | 
| CA (1) | CA1108628A (en, 2012) | 
| CH (1) | CH650772A5 (en, 2012) | 
| DE (3) | DE2954237C2 (en, 2012) | 
| DK (1) | DK157847C (en, 2012) | 
| ES (1) | ES481315A1 (en, 2012) | 
| FI (1) | FI70209C (en, 2012) | 
| FR (1) | FR2434151A1 (en, 2012) | 
| GB (1) | GB2028307B (en, 2012) | 
| GR (1) | GR68438B (en, 2012) | 
| IL (1) | IL57266A (en, 2012) | 
| IT (1) | IT1116891B (en, 2012) | 
| NL (1) | NL7904584A (en, 2012) | 
| NO (1) | NO791943L (en, 2012) | 
| NZ (1) | NZ190705A (en, 2012) | 
| PT (1) | PT69716A (en, 2012) | 
| SE (1) | SE431644B (en, 2012) | 
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US4943640A (en) * | 1983-10-14 | 1990-07-24 | The Dow Chemical Company | Preparation of 5-(1-alkyl-carbonyloxy)alkylpyrrolidin-2-one | 
| WO1990007499A1 (en) * | 1988-12-27 | 1990-07-12 | Ici Americas Inc. | Process for the preparation of 3-carboalkoxypyrrolidones | 
| US5021587A (en) * | 1990-01-24 | 1991-06-04 | Petrolite Corporation | Synthesis of N,3,4-trisubstituted-3-azoline-2-ones | 
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US3272842A (en) * | 1965-06-25 | 1966-09-13 | Lilly Co Eli | Novel pyrrolinones | 
| GB1350582A (en) | 1970-07-24 | 1974-04-18 | Ucb Sa | Cerivatives of 2-pyrrolidinone | 
| DE2413935A1 (de) | 1974-03-20 | 1975-10-16 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone | 
- 
        1979
        
- 1979-05-14 IL IL57266A patent/IL57266A/xx unknown
 - 1979-05-15 GR GR59088A patent/GR68438B/el unknown
 - 1979-05-17 AR AR276559A patent/AR222997A1/es active
 - 1979-05-28 AT AT793866A patent/ATA386679A/de not_active Application Discontinuation
 - 1979-06-01 PT PT69716A patent/PT69716A/pt unknown
 - 1979-06-01 AU AU47670/79A patent/AU529479B2/en not_active Ceased
 - 1979-06-06 ES ES481315A patent/ES481315A1/es not_active Expired
 - 1979-06-08 CA CA329,322A patent/CA1108628A/en not_active Expired
 - 1979-06-09 DE DE2954237A patent/DE2954237C2/de not_active Expired
 - 1979-06-09 DE DE19792923553 patent/DE2923553A1/de active Granted
 - 1979-06-09 DE DE2954236A patent/DE2954236C2/de not_active Expired
 - 1979-06-11 FR FR7914907A patent/FR2434151A1/fr active Granted
 - 1979-06-11 IT IT49373/79A patent/IT1116891B/it active
 - 1979-06-11 GB GB7920275A patent/GB2028307B/en not_active Expired
 - 1979-06-11 SE SE7905079A patent/SE431644B/sv not_active IP Right Cessation
 - 1979-06-11 DK DK241779A patent/DK157847C/da not_active IP Right Cessation
 - 1979-06-11 NO NO791943A patent/NO791943L/no unknown
 - 1979-06-12 NL NL7904584A patent/NL7904584A/xx not_active Application Discontinuation
 - 1979-06-12 NZ NZ190705A patent/NZ190705A/xx unknown
 - 1979-06-12 CH CH5496/79A patent/CH650772A5/de not_active IP Right Cessation
 - 1979-06-12 FI FI791866A patent/FI70209C/fi not_active IP Right Cessation
 
 
Also Published As
| Publication number | Publication date | 
|---|---|
| ATA386679A (de) | 1983-12-15 | 
| IT1116891B (it) | 1986-02-10 | 
| GB2028307A (en) | 1980-03-05 | 
| ES481315A1 (es) | 1980-08-16 | 
| DE2923553A1 (de) | 1979-12-20 | 
| PT69716A (en) | 1979-07-01 | 
| CH650772A5 (de) | 1985-08-15 | 
| NO791943L (no) | 1979-12-13 | 
| DK157847C (da) | 1990-09-17 | 
| IT7949373A0 (it) | 1979-06-11 | 
| IL57266A (en) | 1982-12-31 | 
| DE2954236C2 (en, 2012) | 1988-10-06 | 
| DK241779A (da) | 1979-12-13 | 
| FI791866A7 (fi) | 1979-12-13 | 
| GR68438B (en, 2012) | 1981-12-30 | 
| DE2923553C2 (en, 2012) | 1988-06-01 | 
| AU529479B2 (en) | 1983-06-09 | 
| DK157847B (da) | 1990-02-26 | 
| SE7905079L (sv) | 1979-12-13 | 
| SE431644B (sv) | 1984-02-20 | 
| FI70209B (fi) | 1986-02-28 | 
| FR2434151A1 (fr) | 1980-03-21 | 
| NZ190705A (en) | 1981-10-19 | 
| DE2954237C2 (en, 2012) | 1989-09-21 | 
| IL57266A0 (en) | 1979-09-30 | 
| NL7904584A (nl) | 1979-12-14 | 
| AR222997A1 (es) | 1981-07-15 | 
| CA1108628A (en) | 1981-09-08 | 
| GB2028307B (en) | 1983-01-19 | 
| FR2434151B3 (en, 2012) | 1982-04-30 | 
| AU4767079A (en) | 1979-12-20 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| KR102807521B1 (ko) | 2종의 4-{[(2s)-2-{4-[5-클로로-2-(1h-1,2,3-트리아졸-1-일)페닐]-5-메톡시-2-옥소피리딘-1(2h)-일}부타노일]아미노}-2-플루오로벤즈아미드 유도체의 제조 방법 | |
| NL7908510A (nl) | Bereidingswijze van threo-3-amino-2-hydroxybutanoyl- aminoazijnzuren, nieuwe uitgangsverbindingen daarvoor en bereidingswijze daarvan. | |
| DK143275B (da) | Analogifremgangsmaade til fremstilling af 1-(3-dimethylaminopropyl)-phthalanderivater eller syreadditionssalte deraf | |
| MXPA04010771A (es) | Procedimiento para preparar (-butirolactamas y (-amino acidos muy funcionalizados. | |
| KR20110036055A (ko) | 고순도의 수니티닙 및 이의 약학적으로 허용가능한 염의 개선된 제조 방법 | |
| US4297282A (en) | Resolution of mercaptopropionic acids | |
| IE51409B1 (en) | Amide derivatives | |
| JP2009518335A (ja) | 3−カルボキシ−2−オキソ−1−ピロリジン誘導体及びそれらの使用 | |
| FI70209B (fi) | Foerfarande foer framstaellning av pyrrolidin-2-oner och 3-pyrrolin-2-oner | |
| KR20090110368A (ko) | Glyt-1 억제제의 합성 방법 | |
| EP0053017B1 (en) | Amide derivatives | |
| Maison et al. | Synthesis of novel pipecolic acid derivatives: a multicomponent approach from 3, 4, 5, 6-tetrahydropyridines | |
| US5936098A (en) | Process for producing indoline compounds and intermediates for the production of the same | |
| CH660593A5 (de) | 1,4-dihydropyridindicarbonsaeureester, verfahren zu deren herstellung und pharmazeutische zusammensetzung, enthaltend diese verbindungen als wirkstoff. | |
| Bernard et al. | Technical scale synthesis of a new and highly potent thrombin inhibitor | |
| US5252747A (en) | Chiral quinolone intermediates | |
| Robl et al. | A synthetic route for the generation of C-7 substituted azepinones | |
| KR20070116644A (ko) | 신규 환상 아미노페닐알칸산 유도체 | |
| TW200403222A (en) | Process for the preparation of amino-pyrrolidine derivatives | |
| Cież et al. | Synthesis of optically active isothiazole derivatives from L-(α)-amino acids | |
| US6573384B1 (en) | Process for production of indole derivatives and intermediates therefor | |
| KR101686087B1 (ko) | 광학 활성을 갖는 인돌린 유도체 또는 이의 염의 신규 제조 방법 | |
| ES2205362T3 (es) | Un metodo para la produccion de derivados de pirrolidinona. | |
| GB2036723A (en) | Mercaptoacylpiperazine carboxylic acid compounds | |
| HUT73774A (en) | Novel phenylethyl and phenyl-propyl-amine, pharmaceutical compns. contg. them and process to prepare the said compds | 
Legal Events
| Date | Code | Title | Description | 
|---|---|---|---|
| BB | Publication of examined application | ||
| MM | Patent lapsed | 
             Owner name: MUNDIPHARMA AG  |