FI66831C - Foerfarande foer framstaellning av 4(61-metoxi-21-naftyl)butan-2-on med antiinflammatorisk aktivitet - Google Patents
Foerfarande foer framstaellning av 4(61-metoxi-21-naftyl)butan-2-on med antiinflammatorisk aktivitet Download PDFInfo
- Publication number
- FI66831C FI66831C FI790019A FI790019A FI66831C FI 66831 C FI66831 C FI 66831C FI 790019 A FI790019 A FI 790019A FI 790019 A FI790019 A FI 790019A FI 66831 C FI66831 C FI 66831C
- Authority
- FI
- Finland
- Prior art keywords
- methoxy
- butan
- naphthyl
- formula
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 12
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 title description 27
- 150000001875 compounds Chemical class 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- -1 6-methoxy-2-naphthyl Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 28
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- 239000002904 solvent Substances 0.000 description 12
- 239000007787 solid Substances 0.000 description 11
- VZBLASFLFFMMCM-UHFFFAOYSA-N 6-methoxynaphthalene-2-carbaldehyde Chemical compound C1=C(C=O)C=CC2=CC(OC)=CC=C21 VZBLASFLFFMMCM-UHFFFAOYSA-N 0.000 description 10
- 239000003054 catalyst Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 7
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- BLXXJMDCKKHMKV-UHFFFAOYSA-N Nabumetone Chemical compound C1=C(CCC(C)=O)C=CC2=CC(OC)=CC=C21 BLXXJMDCKKHMKV-UHFFFAOYSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 5
- RAIYODFGMLZUDF-UHFFFAOYSA-N piperidin-1-ium;acetate Chemical compound CC([O-])=O.C1CC[NH2+]CC1 RAIYODFGMLZUDF-UHFFFAOYSA-N 0.000 description 5
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 4
- SCKHRWLYBIIXNO-UHFFFAOYSA-N benzhydryl 3-oxobutanoate Chemical compound C=1C=CC=CC=1C(OC(=O)CC(=O)C)C1=CC=CC=C1 SCKHRWLYBIIXNO-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- KDHRQKPVXJRBIX-UHFFFAOYSA-N (4-methoxyphenyl)methyl 3-oxobutanoate Chemical compound COC1=CC=C(COC(=O)CC(C)=O)C=C1 KDHRQKPVXJRBIX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 3
- BSIUTVXEBSLZFS-UHFFFAOYSA-N (4-methylphenyl)methyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1=CC=C(C)C=C1 BSIUTVXEBSLZFS-UHFFFAOYSA-N 0.000 description 2
- WOFAGNLBCJWEOE-UHFFFAOYSA-N Benzyl acetoacetate Chemical compound CC(=O)CC(=O)OCC1=CC=CC=C1 WOFAGNLBCJWEOE-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 150000005826 halohydrocarbons Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- PJKVFARRVXDXAD-UHFFFAOYSA-N 2-naphthaldehyde Chemical compound C1=CC=CC2=CC(C=O)=CC=C21 PJKVFARRVXDXAD-UHFFFAOYSA-N 0.000 description 1
- MSHFRERJPWKJFX-UHFFFAOYSA-N 4-Methoxybenzyl alcohol Chemical compound COC1=CC=C(CO)C=C1 MSHFRERJPWKJFX-UHFFFAOYSA-N 0.000 description 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- KMTDMTZBNYGUNX-UHFFFAOYSA-N 4-methylbenzyl alcohol Chemical compound CC1=CC=C(CO)C=C1 KMTDMTZBNYGUNX-UHFFFAOYSA-N 0.000 description 1
- VRKYOTLYNBDZQS-UHFFFAOYSA-N 5-(4-methylphenyl)-3-oxopentanoic acid Chemical compound CC1=CC=C(CCC(=O)CC(O)=O)C=C1 VRKYOTLYNBDZQS-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OBQIDRVMBIQJRH-UHFFFAOYSA-N CC1=CC=C(C=C1)COC(=O)C(=CC2=CC=CC3=C2C=C(C=C3)OC)C(=O)C Chemical compound CC1=CC=C(C=C1)COC(=O)C(=CC2=CC=CC3=C2C=C(C=C3)OC)C(=O)C OBQIDRVMBIQJRH-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241001117170 Euplectes Species 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical compound C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000005453 ketone based solvent Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- ZMQHTNSMOHHSCU-UHFFFAOYSA-N methyl acetate;propan-2-one Chemical compound CC(C)=O.COC(C)=O ZMQHTNSMOHHSCU-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- 238000013341 scale-up Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/20—Unsaturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/255—Unsaturated compounds containing keto groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/673—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton
- C07C45/676—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by change of size of the carbon skeleton by elimination of carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB60278 | 1978-01-07 | ||
| GB60278 | 1978-01-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI790019A7 FI790019A7 (fi) | 1979-07-08 |
| FI66831B FI66831B (fi) | 1984-08-31 |
| FI66831C true FI66831C (fi) | 1984-12-10 |
Family
ID=9707279
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI790019A FI66831C (fi) | 1978-01-07 | 1979-01-03 | Foerfarande foer framstaellning av 4(61-metoxi-21-naftyl)butan-2-on med antiinflammatorisk aktivitet |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US4247709A (enExample) |
| EP (1) | EP0003074B1 (enExample) |
| JP (2) | JPS54100358A (enExample) |
| AR (1) | AR216566A1 (enExample) |
| AT (1) | AT362777B (enExample) |
| BG (1) | BG61054B2 (enExample) |
| CA (1) | CA1142547A (enExample) |
| DE (1) | DE2860631D1 (enExample) |
| DK (1) | DK156134C (enExample) |
| ES (1) | ES476627A1 (enExample) |
| FI (1) | FI66831C (enExample) |
| GR (1) | GR65333B (enExample) |
| IE (1) | IE47643B1 (enExample) |
| IL (1) | IL56296A (enExample) |
| NO (1) | NO149957C (enExample) |
| NZ (1) | NZ189278A (enExample) |
| ZA (1) | ZA7955B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK162683C (da) * | 1982-11-26 | 1992-04-27 | Kvikk S F | Apparat til partering af fiskehoveder |
| GB8416638D0 (en) * | 1984-06-29 | 1984-08-01 | Beecham Group Plc | Topical treatment and composition |
| GB8603772D0 (en) * | 1986-02-15 | 1986-03-19 | Beecham Group Plc | Process |
| JPS62163079U (enExample) * | 1986-04-07 | 1987-10-16 | ||
| US5202495A (en) * | 1987-03-26 | 1993-04-13 | Callander Sidney E | Chemical process |
| US5484949A (en) * | 1993-01-29 | 1996-01-16 | Nippon Soda Co., Ltd. | Method for the synthesis of α β-unsaturated ketones |
| IT1285567B1 (it) | 1996-02-21 | 1998-06-18 | Alfa Chem Ital | Nuovo processo per la sintesi del nabumetone |
| US5756851A (en) * | 1996-10-21 | 1998-05-26 | Albemarle Corporation | Production of nabumetone or precursors thereof |
| US5847225A (en) * | 1997-04-25 | 1998-12-08 | Albemarle Corporation | Production of naphthyl-substituted ketones from naphthaldehydes |
| IT1291284B1 (it) * | 1997-04-30 | 1999-01-07 | Secifarma Spa | Processo per la preparazione del 4-(6'-metossi-2'-naftil)butan-2-one (nabumetone). |
| US5861538A (en) * | 1997-08-04 | 1999-01-19 | Albemarle Corporation | Production of alkoxynaphthyl-substituted ketones from naphthaldehydes |
| US6436990B1 (en) | 1999-10-27 | 2002-08-20 | Nobex Corporation | 6-methoxy-2-naphthylacetic acid prodrugs |
| TWI262791B (en) | 1999-10-27 | 2006-10-01 | Nobex Corp | 6-methoxy-2-naphthylacetic acid prodrugs |
| US6552078B2 (en) | 1999-10-27 | 2003-04-22 | Nobex Corp | 6-methoxy-2-naphthylacetic acid prodrugs |
| DE102013216021A1 (de) | 2013-08-13 | 2015-02-19 | Branson Ultraschall Niederlassung Der Emerson Technologies Gmbh & Co. Ohg | Wärmestrahler, Vorrichtung zum Infrarotschweißen und Verfahren zum Erwärmen von Kunststoffbauteilen |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3917718A (en) * | 1972-06-22 | 1975-11-04 | Sterling Drug Inc | Cyclopropyl carbinol derivatives |
| GB1474377A (en) * | 1973-09-11 | 1977-05-25 | Beecham Group Ltd | Naphthalene derivatives |
| US4029713A (en) * | 1974-01-22 | 1977-06-14 | The Goodyear Tire & Rubber Company | Substituted hydroxy-phenyl propanols |
-
1978
- 1978-12-13 EP EP78300809A patent/EP0003074B1/en not_active Expired
- 1978-12-13 DE DE7878300809T patent/DE2860631D1/de not_active Expired
- 1978-12-21 NZ NZ189278A patent/NZ189278A/xx unknown
- 1978-12-22 AR AR274949A patent/AR216566A1/es active
- 1978-12-25 IL IL56296A patent/IL56296A/xx unknown
- 1978-12-26 US US05/973,748 patent/US4247709A/en not_active Expired - Lifetime
- 1978-12-28 GR GR57989A patent/GR65333B/el unknown
-
1979
- 1979-01-03 AT AT0004179A patent/AT362777B/de not_active IP Right Cessation
- 1979-01-03 FI FI790019A patent/FI66831C/fi not_active IP Right Cessation
- 1979-01-05 JP JP92979A patent/JPS54100358A/ja active Granted
- 1979-01-05 ZA ZA00790055A patent/ZA7955B/xx unknown
- 1979-01-05 ES ES476627A patent/ES476627A1/es not_active Expired
- 1979-01-05 DK DK006379A patent/DK156134C/da not_active IP Right Cessation
- 1979-01-05 NO NO790031A patent/NO149957C/no unknown
- 1979-01-05 CA CA000319178A patent/CA1142547A/en not_active Expired
- 1979-01-05 IE IE22/79A patent/IE47643B1/en unknown
- 1979-10-11 US US06/083,837 patent/US4270004A/en not_active Expired - Lifetime
-
1983
- 1983-04-20 JP JP58069873A patent/JPS58189139A/ja active Granted
-
1993
- 1993-12-29 BG BG098344A patent/BG61054B2/bg unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6121460B2 (enExample) | 1986-05-27 |
| DK6379A (da) | 1979-07-08 |
| ATA4179A (de) | 1980-11-15 |
| NZ189278A (en) | 1981-05-01 |
| US4247709A (en) | 1981-01-27 |
| NO149957C (no) | 1984-08-01 |
| NO149957B (no) | 1984-04-16 |
| EP0003074A2 (en) | 1979-07-25 |
| ES476627A1 (es) | 1980-01-16 |
| JPS58189139A (ja) | 1983-11-04 |
| DK156134B (da) | 1989-06-26 |
| AR216566A1 (es) | 1979-12-28 |
| AU521498B2 (en) | 1982-04-08 |
| DK156134C (da) | 1989-11-06 |
| FI66831B (fi) | 1984-08-31 |
| AU4319779A (en) | 1979-07-12 |
| EP0003074B1 (en) | 1981-04-15 |
| JPS629581B2 (enExample) | 1987-02-28 |
| JPS54100358A (en) | 1979-08-08 |
| IE47643B1 (en) | 1984-05-16 |
| GR65333B (en) | 1980-08-13 |
| DE2860631D1 (en) | 1981-05-07 |
| CA1142547A (en) | 1983-03-08 |
| BG61054B2 (bg) | 1996-09-30 |
| FI790019A7 (fi) | 1979-07-08 |
| IE790022L (en) | 1979-07-07 |
| US4270004A (en) | 1981-05-26 |
| NO790031L (no) | 1979-07-10 |
| EP0003074A3 (en) | 1980-01-09 |
| IL56296A0 (en) | 1979-03-12 |
| ZA7955B (en) | 1979-12-27 |
| AT362777B (de) | 1981-06-10 |
| IL56296A (en) | 1982-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66831C (fi) | Foerfarande foer framstaellning av 4(61-metoxi-21-naftyl)butan-2-on med antiinflammatorisk aktivitet | |
| EP0045118B1 (en) | Intermediates for the synthesis of bicyclo (2,2,1) heptanes and bicyclo (2,2,1) hept-2z-enes | |
| FR2476088A2 (fr) | Nouveaux derives du nor-tropane, leur procede de preparation et leur application en therapeutique | |
| CH648314A5 (fr) | Procede de preparation de trans-5-aryl-2,3,4,4a,5,9b-hexahydro-1h-pyrido(4,3-b)-indoles substitues en position 2 et composes permettant de les obtenir. | |
| HU204044B (en) | Process for producing trans-aryltetraloncarboxylic acid derivatives | |
| US5744648A (en) | Process for the manufacture of 1, 3-cyclohexanedione | |
| US5047571A (en) | Process for the preparation of 2-cyano-3,3-diarylacrylates | |
| US5066826A (en) | Process for racemization of optically active 4-phenylbutanoic acid esters | |
| CA1134384A (en) | A1 14777 by hydrogenation | |
| JP2000327659A (ja) | 光学活性ピリジルアルコール類の製造方法 | |
| JP2622651B2 (ja) | 1,3−ジオキサン−4,6−ジオン誘導体の製造方法 | |
| US5087762A (en) | Process for producing vitamin a aldehyde | |
| Uskoković et al. | The Stereoselectivity of Ketone Reduction with Sporotrichum Exile. Resolution of cis‐and trans‐2‐benzoyloctahydro‐6 (2H)‐isoquinolones | |
| SU673167A3 (ru) | Способ получени производных азиридина | |
| US4227015A (en) | Substituted phenylvinyl cyclopropyl ketones | |
| HU205074B (en) | Process for producing 4-(3-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylic acid methyl ethyl ester | |
| JP2002053572A (ja) | 光学活性ピラン類縁体の製造方法 | |
| US6121492A (en) | Method for preparing 2-trifluoro-methoxy-aniline | |
| US5414108A (en) | Process for the preparation of carboxylic acids and derivatives of them | |
| HU208682B (en) | Process for producing optically active quinoxalinyloxy phenoxypropionic acid esters | |
| US4166074A (en) | Dialkylaminophenylethyl (or vinyl) cyclopropyl carbinols | |
| US4189500A (en) | Aryl substituted diketones | |
| Kryshtal' et al. | A novel approach to the synthesis of benzoic and cinnamic acid derivatives with nor-isoprenoid substituents | |
| EP0578850A1 (en) | Process for the preparation of carboxylic acids and derivatives of them | |
| JPH08277256A (ja) | 光学活性な(s)−2−ベンジルオキシカルボニルアミノ−1−(4−メトキシフェニル)エタノール、およびその製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: BEECHAM GROUP LTD |