FI56379C - Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 6-aza-3h-1,4-benzodiazepin-2-oner och deras salter - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 6-aza-3h-1,4-benzodiazepin-2-oner och deras salter Download PDFInfo
- Publication number
- FI56379C FI56379C FI771584A FI771584A FI56379C FI 56379 C FI56379 C FI 56379C FI 771584 A FI771584 A FI 771584A FI 771584 A FI771584 A FI 771584A FI 56379 C FI56379 C FI 56379C
- Authority
- FI
- Finland
- Prior art keywords
- group
- aza
- preparation
- therapeutic
- formula
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 8
- 230000001225 therapeutic effect Effects 0.000 title 2
- 150000001875 compounds Chemical class 0.000 claims description 21
- 239000000203 mixture Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000002252 acyl group Chemical group 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- -1 6-aza-3H-1,1-benzodiazepine ions Chemical class 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 230000003287 optical effect Effects 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 239000000725 suspension Substances 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 150000008065 acid anhydrides Chemical class 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- GGHZKRGOJQUVCL-UHFFFAOYSA-N 1,3-dihydropyrido[3,2-e][1,4]diazepin-2-one Chemical compound N1C(=O)CN=CC2=NC=CC=C21 GGHZKRGOJQUVCL-UHFFFAOYSA-N 0.000 claims 1
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Natural products C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 claims 1
- 235000012000 cholesterol Nutrition 0.000 claims 1
- 239000000376 reactant Substances 0.000 claims 1
- 238000007127 saponification reaction Methods 0.000 claims 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 8
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 8
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 7
- 241001465754 Metazoa Species 0.000 description 7
- CWCWGFVDAUGRRS-UHFFFAOYSA-N [7-chloro-5-(2-chlorophenyl)-1-methyl-2-oxo-3H-pyrido[3,2-e][1,4]diazepin-3-yl] acetate Chemical compound CN1C2=CC=C(Cl)N=C2C(=NC(OC(C)=O)C1=O)C1=C(Cl)C=CC=C1 CWCWGFVDAUGRRS-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229910052731 fluorine Inorganic materials 0.000 description 4
- 239000011737 fluorine Substances 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 229960005152 pentetrazol Drugs 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000035939 shock Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 206010003591 Ataxia Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- ZHYMGSPDEVXULU-UHFFFAOYSA-N 1,2-benzodiazepin-3-one Chemical compound N1=NC(=O)C=CC2=CC=CC=C21 ZHYMGSPDEVXULU-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- CMNORDWRYDHDTE-UHFFFAOYSA-N 7-chloro-5-(2-fluorophenyl)-1,3-dihydropyrido[3,2-e][1,4]diazepin-2-one Chemical compound FC1=C(C=CC=C1)C1=NCC(=O)NC2=CC=C(Cl)N=C12 CMNORDWRYDHDTE-UHFFFAOYSA-N 0.000 description 1
- PMMIUMNVGBRIKB-UHFFFAOYSA-N 7-chloro-5-phenyl-1,3-dihydropyrido[3,2-e][1,4]diazepin-2-one Chemical compound C12=NC(Cl)=CC=C2NC(=O)CN=C1C1=CC=CC=C1 PMMIUMNVGBRIKB-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ABHFDGMIPURLMM-UHFFFAOYSA-N CC(=O)OC1N=C(C2=CC=CC=C2)C2=NC(Cl)=CC=C2N(C(C)=O)C1=O Chemical compound CC(=O)OC1N=C(C2=CC=CC=C2)C2=NC(Cl)=CC=C2N(C(C)=O)C1=O ABHFDGMIPURLMM-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 206010010904 Convulsion Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- RUAKEUDGFALLAY-UHFFFAOYSA-N N1C(CC=CC2=C1C=CC=N2)=O Chemical class N1C(CC=CC2=C1C=CC=N2)=O RUAKEUDGFALLAY-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- OGAHUEVSKIVFRF-UHFFFAOYSA-N [1-acetyl-7-chloro-5-(2-chlorophenyl)-2-oxo-3H-pyrido[3,2-e][1,4]diazepin-3-yl] acetate Chemical compound CC(=O)OC1N=C(C2=C(Cl)C=CC=C2)C2=NC(Cl)=CC=C2N(C(C)=O)C1=O OGAHUEVSKIVFRF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000003973 alkyl amines Chemical group 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002762 monocarboxylic acid derivatives Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001550 time effect Effects 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT1060471 | 1971-12-09 | ||
| AT1060471A AT333284B (de) | 1971-12-09 | 1971-12-09 | Verfahren zur herstellung von neuen 6-aza-3h-1,4-benzodiazepinen, deren optischen isomeren und deren salzen |
| FI339072 | 1972-11-30 | ||
| FI3390/72A FI54710C (fi) | 1971-12-09 | 1972-11-30 | Foerfarande foer framstaellning av nya terapeutiskt aktiva 6-aza-3h-1,4-bensodiazepiner |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI771584A7 FI771584A7 (ref) | 1977-05-18 |
| FI56379B FI56379B (fi) | 1979-09-28 |
| FI56379C true FI56379C (fi) | 1980-01-10 |
Family
ID=25606079
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI771584A FI56379C (fi) | 1971-12-09 | 1977-05-18 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 6-aza-3h-1,4-benzodiazepin-2-oner och deras salter |
Country Status (1)
| Country | Link |
|---|---|
| FI (1) | FI56379C (ref) |
-
1977
- 1977-05-18 FI FI771584A patent/FI56379C/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI771584A7 (ref) | 1977-05-18 |
| FI56379B (fi) | 1979-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2102387C1 (ru) | Производные n-ацил-2,3-бензодиазепина, или их стереоизомеры, или кислые соли присоединения, обладающие биологической активностью, связанной с воздействием на центральную нервную систему, и фармакологически активная композиция на их основе | |
| KR860000847B1 (ko) | 1,2,4-트리아진 및 피라진 유도체의 제조방법 | |
| US3810906A (en) | N1-heteroacylated phenylhydrazines | |
| FR2530247A1 (fr) | Nouveaux derives de la thieno (3, 2-c) pyridine, leur procede de preparation et leur application therapeutique | |
| CS214800B2 (en) | Method of preparation of substituted 4-hydroxypyrrolidine-2-ons | |
| CH648553A5 (de) | Neue 3,4-dihydro-5h-2,3-benzodiazepin-derivate und verfahren zur herstellung derselben. | |
| US4123533A (en) | Fused pyrimidine derivatives and compositions for treating atherosclerosis containing them | |
| RU2058982C1 (ru) | 1-(3-хлорфенил)-4-оксиметил-7,8-диметокси-5н-2,3-бензо-диазепин или его терапевтически приемлемая соль присоединения кислоты | |
| US2776992A (en) | Trifluoromethylsulfonylphenyldichloracetamidopropandiol | |
| HU191586B (en) | Process for preparing new derivatives of pyridazine and pyrimidine | |
| FI56379C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 6-aza-3h-1,4-benzodiazepin-2-oner och deras salter | |
| CS231214B1 (en) | Processing method of 1-substituted n+l8alpha-ergoline+p-n,diethyl urea | |
| US4049816A (en) | Antiviral 2-amino-5-[1-(indol-3-yl)alkyl]-2-thiazolin-4-ones | |
| DK153149B (da) | Analogifremgangsmaade til fremstilling af hydroxyaminoeburnanderivater eller farmaceutisk acceptable syreadditionssalte eller optisk aktiv isomerer deraf, samt octahydroindolokinolizin-monoesterderivater til anvendelse som udgangsmateriale ved fremgangsmaaden | |
| US4367229A (en) | 3-Substituted-tetrahydro-pyrrolo[1,2-a]pyrimidines and pharmaceutical compositions | |
| US3105849A (en) | Bicyclic hydrazinium compounds | |
| CS207398B2 (en) | Method of making the derivates of the benzodiazepine | |
| ES2322463T3 (es) | Preocedimiento para preparar derivados de imidazol sustituidos y productos intermedios utilizados en el procedimiento. | |
| US2762805A (en) | 3-ethyl-3-phenyl-2, 6-piperazinedione and derivatives thereof | |
| SU1331431A3 (ru) | Способ получени (1,2)-анеллированных 1,4-бензодиазепинов или их оптических изомеров или кислотно-аддитивных солей | |
| FR2516509A1 (fr) | Derives benzylideniques, leur preparation et leur application en therapeutique | |
| SU1491335A3 (ru) | Способ получени тиокетеновых производных пиперидина или их фармацевтически приемлемых аддитивных солей кислот | |
| PL96806B1 (pl) | Sposob wytwarzania nowych pochodnych aminopirolu | |
| US2762804A (en) | 3-methyl-5-phenyl-2, 6-piperazinedione and derivatives thereof and method of preparing same | |
| US3036065A (en) | Dioxo-azetidines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: DEUTSCHE GOLD- UND SILBER-SCHEIDEANSTALT |