FI100242B - Menetelmä uusien terapeuttisesti käyttökelpoisten pyrrolo£1,2-a|pyrats iinijohdannaisten valmistamiseksi - Google Patents
Menetelmä uusien terapeuttisesti käyttökelpoisten pyrrolo£1,2-a|pyrats iinijohdannaisten valmistamiseksi Download PDFInfo
- Publication number
- FI100242B FI100242B FI923073A FI923073A FI100242B FI 100242 B FI100242 B FI 100242B FI 923073 A FI923073 A FI 923073A FI 923073 A FI923073 A FI 923073A FI 100242 B FI100242 B FI 100242B
- Authority
- FI
- Finland
- Prior art keywords
- formula
- substituted
- phenyl
- compound
- solution
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 28
- 230000008569 process Effects 0.000 title claims description 19
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 127
- -1 trifluoromethanesulfonyloxy, phenyl Chemical group 0.000 claims description 48
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 40
- 239000002253 acid Substances 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 20
- QSLLFYVBWXWUQT-UHFFFAOYSA-N 7-Azaindolizine Chemical class C1=NC=CN2C=CC=C21 QSLLFYVBWXWUQT-UHFFFAOYSA-N 0.000 claims description 18
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 13
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 claims description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 7
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical group 0.000 claims description 6
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 4
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 4
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 3
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 238000005661 deetherification reaction Methods 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 324
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 244
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 153
- 239000000243 solution Substances 0.000 description 150
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 144
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 130
- 239000000203 mixture Substances 0.000 description 124
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 114
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 111
- 239000002904 solvent Substances 0.000 description 81
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 80
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 69
- 229910052786 argon Inorganic materials 0.000 description 65
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 62
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 58
- 239000003921 oil Substances 0.000 description 56
- 235000019198 oils Nutrition 0.000 description 56
- 238000003756 stirring Methods 0.000 description 53
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 53
- 239000012074 organic phase Substances 0.000 description 44
- 238000006243 chemical reaction Methods 0.000 description 43
- 239000011541 reaction mixture Substances 0.000 description 41
- 238000002844 melting Methods 0.000 description 40
- 230000008018 melting Effects 0.000 description 40
- 238000000354 decomposition reaction Methods 0.000 description 39
- 239000012043 crude product Substances 0.000 description 37
- 239000001530 fumaric acid Substances 0.000 description 36
- 239000012047 saturated solution Substances 0.000 description 35
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 32
- 239000000047 product Substances 0.000 description 32
- 239000000741 silica gel Substances 0.000 description 32
- 229910002027 silica gel Inorganic materials 0.000 description 32
- 239000008346 aqueous phase Substances 0.000 description 31
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 29
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 27
- 239000000284 extract Substances 0.000 description 25
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 23
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 23
- 239000012071 phase Substances 0.000 description 23
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 22
- 239000000725 suspension Substances 0.000 description 18
- GXWNSJYVSIJRLS-UHFFFAOYSA-N 6-bromo-8-methylimidazo[1,2-a]pyrazine Chemical class CC1=NC(Br)=CN2C=CN=C12 GXWNSJYVSIJRLS-UHFFFAOYSA-N 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- 238000010992 reflux Methods 0.000 description 16
- 239000012279 sodium borohydride Substances 0.000 description 16
- 229910000033 sodium borohydride Inorganic materials 0.000 description 16
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 15
- 235000011114 ammonium hydroxide Nutrition 0.000 description 15
- 150000003254 radicals Chemical class 0.000 description 15
- 239000012442 inert solvent Substances 0.000 description 14
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 10
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 10
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- DAKZISABEDGGSV-UHFFFAOYSA-N n-(2-aminoethyl)acetamide Chemical compound CC(=O)NCCN DAKZISABEDGGSV-UHFFFAOYSA-N 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 239000011777 magnesium Substances 0.000 description 8
- 229910052749 magnesium Inorganic materials 0.000 description 8
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 239000000969 carrier Substances 0.000 description 7
- 239000013078 crystal Substances 0.000 description 7
- 230000007062 hydrolysis Effects 0.000 description 7
- 238000006460 hydrolysis reaction Methods 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 238000000746 purification Methods 0.000 description 7
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 7
- GGZQLTVZPOGLCC-UHFFFAOYSA-N 2-(2-bromoethyl)-1,3-dioxolane Chemical compound BrCCC1OCCO1 GGZQLTVZPOGLCC-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 239000003463 adsorbent Substances 0.000 description 6
- 230000029936 alkylation Effects 0.000 description 6
- 238000005804 alkylation reaction Methods 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 210000004556 brain Anatomy 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 230000002401 inhibitory effect Effects 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 229910001629 magnesium chloride Inorganic materials 0.000 description 5
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- SIKHMNJKDIOPAJ-UHFFFAOYSA-N 1-methyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C1=CC=CC=C1 SIKHMNJKDIOPAJ-UHFFFAOYSA-N 0.000 description 4
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 4
- 239000002168 alkylating agent Substances 0.000 description 4
- 229940100198 alkylating agent Drugs 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 4
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 4
- 210000004185 liver Anatomy 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 239000010502 orange oil Substances 0.000 description 4
- 150000002902 organometallic compounds Chemical class 0.000 description 4
- 229920005862 polyol Polymers 0.000 description 4
- 150000003077 polyols Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- RTBJVGAYBAXVPG-UHFFFAOYSA-N (E)-but-2-enedioic acid pyrazine Chemical compound C(C=CC(=O)O)(=O)O.N1=CC=NC=C1 RTBJVGAYBAXVPG-UHFFFAOYSA-N 0.000 description 3
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- QEONMKRFAKEERT-UHFFFAOYSA-N 4-(1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-6-yl)phenol Chemical compound CC1=NCCN2C1=CC=C2C1=CC=C(O)C=C1 QEONMKRFAKEERT-UHFFFAOYSA-N 0.000 description 3
- UQXDWNVWKKVPCS-UHFFFAOYSA-N 6-(4-chlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C1=CC=C(Cl)C=C1 UQXDWNVWKKVPCS-UHFFFAOYSA-N 0.000 description 3
- BPVQEJPXRGFBMM-UHFFFAOYSA-N 6-(4-methoxyphenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound C1=CC(OC)=CC=C1C1=CC=C2N1CCN=C2C BPVQEJPXRGFBMM-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 208000024827 Alzheimer disease Diseases 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 208000020401 Depressive disease Diseases 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000031709 bromination Effects 0.000 description 3
- 238000005893 bromination reaction Methods 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000011976 maleic acid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- KRKPYFLIYNGWTE-UHFFFAOYSA-N n,o-dimethylhydroxylamine Chemical compound CNOC KRKPYFLIYNGWTE-UHFFFAOYSA-N 0.000 description 3
- QMCBXLRPDOOQSU-UHFFFAOYSA-N n-[2-[2-(4-methoxyphenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound C1=CC(OC)=CC=C1C1=CC=CN1CCNC(C)=O QMCBXLRPDOOQSU-UHFFFAOYSA-N 0.000 description 3
- 230000004770 neurodegeneration Effects 0.000 description 3
- 208000015122 neurodegenerative disease Diseases 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229930195734 saturated hydrocarbon Natural products 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- PDVFSPNIEOYOQL-UHFFFAOYSA-N (4-methylphenyl)sulfonyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OS(=O)(=O)C1=CC=C(C)C=C1 PDVFSPNIEOYOQL-UHFFFAOYSA-N 0.000 description 2
- KLFDUOQMSQAZKW-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6-(4-methylphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=C(C)C=C1 KLFDUOQMSQAZKW-WLHGVMLRSA-N 0.000 description 2
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 2
- XSCKGHOVDBDHOU-UHFFFAOYSA-N 1,6-dimethyl-7-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound C1=C2C(C)=NCCN2C(C)=C1C1=CC=CC=C1 XSCKGHOVDBDHOU-UHFFFAOYSA-N 0.000 description 2
- BOECSSSOXHDAQO-UHFFFAOYSA-N 1,7-dimethyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC=1C=C2C(C)=NCCN2C=1C1=CC=CC=C1 BOECSSSOXHDAQO-UHFFFAOYSA-N 0.000 description 2
- CBYNAOPSOKJXSB-UHFFFAOYSA-N 1-(4-phenylfuran-2-yl)ethanone Chemical compound O1C(C(=O)C)=CC(C=2C=CC=CC=2)=C1 CBYNAOPSOKJXSB-UHFFFAOYSA-N 0.000 description 2
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 2
- KMEJHDSWRKHPPI-UHFFFAOYSA-N 1-methyl-6-(4-phenylmethoxyphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C(C=C1)=CC=C1OCC1=CC=CC=C1 KMEJHDSWRKHPPI-UHFFFAOYSA-N 0.000 description 2
- NGKLVTUDUKIBER-UHFFFAOYSA-N 1-methyl-7-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound C1=C2C(C)=NCCN2C=C1C1=CC=CC=C1 NGKLVTUDUKIBER-UHFFFAOYSA-N 0.000 description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 2
- OSCVKOWMUKOLIN-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)propan-1-one Chemical compound C1=CC(OC)=CC=C1C(=O)CCC1OCCO1 OSCVKOWMUKOLIN-UHFFFAOYSA-N 0.000 description 2
- BNJCHGPDDNPTFK-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-1-(4-methylphenyl)propan-1-one Chemical compound C1=CC(C)=CC=C1C(=O)CCC1OCCO1 BNJCHGPDDNPTFK-UHFFFAOYSA-N 0.000 description 2
- BNANPEQZOWHZKY-UHFFFAOYSA-N 3-phenylfuran Chemical compound O1C=CC(C=2C=CC=CC=2)=C1 BNANPEQZOWHZKY-UHFFFAOYSA-N 0.000 description 2
- MAAHHKPDYRMBRV-UHFFFAOYSA-N 6-(4-cyclopentyloxyphenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C(C=C1)=CC=C1OC1CCCC1 MAAHHKPDYRMBRV-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- PZIOOQYGVCRGNX-WLHGVMLRSA-N C(\C=C\C(=O)O)(=O)O.C=1C=2N(C=CN1)C=CC2 Chemical compound C(\C=C\C(=O)O)(=O)O.C=1C=2N(C=CN1)C=CC2 PZIOOQYGVCRGNX-WLHGVMLRSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 102000010909 Monoamine Oxidase Human genes 0.000 description 2
- 108010062431 Monoamine oxidase Proteins 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical class [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- 208000018737 Parkinson disease Diseases 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- NJAPCAIWQRPQPY-UHFFFAOYSA-N benzyl hydrogen carbonate Chemical class OC(=O)OCC1=CC=CC=C1 NJAPCAIWQRPQPY-UHFFFAOYSA-N 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 230000009969 flowable effect Effects 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 231100000053 low toxicity Toxicity 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 230000011987 methylation Effects 0.000 description 2
- 238000007069 methylation reaction Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- DIBKNTYAWRSTMR-UHFFFAOYSA-N n-[2-(2-phenylpyrrol-1-yl)ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=CC=C1 DIBKNTYAWRSTMR-UHFFFAOYSA-N 0.000 description 2
- HHGVVPQZRQOHNH-UHFFFAOYSA-N n-[2-[2-(1,3-benzodioxol-5-yl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(OCO2)C2=C1 HHGVVPQZRQOHNH-UHFFFAOYSA-N 0.000 description 2
- ITLMNJNLJLVYAY-UHFFFAOYSA-N n-[2-[2-(3,4-dichlorophenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(Cl)C(Cl)=C1 ITLMNJNLJLVYAY-UHFFFAOYSA-N 0.000 description 2
- IPIUKSVLHFUUKM-UHFFFAOYSA-N n-[2-[2-(3-chlorophenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=CC(Cl)=C1 IPIUKSVLHFUUKM-UHFFFAOYSA-N 0.000 description 2
- LBQIQPZLLXOIHQ-UHFFFAOYSA-N n-[2-[2-[4-(trifluoromethyl)phenyl]pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(C(F)(F)F)C=C1 LBQIQPZLLXOIHQ-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 208000020861 perceptual disease Diseases 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000000052 vinegar Substances 0.000 description 2
- 235000021419 vinegar Nutrition 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- VLQVFBWDFVCPNO-UHFFFAOYSA-N (1-butyl-5-hydroxycyclohexa-2,4-dien-1-yl)methanesulfonic acid Chemical compound CCCCC1(CC(=CC=C1)O)CS(=O)(=O)O VLQVFBWDFVCPNO-UHFFFAOYSA-N 0.000 description 1
- MHSGOABISYIYKP-UHFFFAOYSA-N (4-nitrophenyl)methyl carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(COC(Cl)=O)C=C1 MHSGOABISYIYKP-UHFFFAOYSA-N 0.000 description 1
- GYUXOKUWXGBLAL-WLHGVMLRSA-N (E)-but-2-enedioic acid 4-(1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-6-yl)phenol Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=C(O)C=C1 GYUXOKUWXGBLAL-WLHGVMLRSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- LSUSBNNJRCMSRP-WLHGVMLRSA-N (e)-but-2-enedioic acid;1,2-dimethyl-6-phenyl-3,4-dihydro-1h-pyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1N(C)CCN2C1=CC=C2C1=CC=CC=C1 LSUSBNNJRCMSRP-WLHGVMLRSA-N 0.000 description 1
- OTSCGMZYQVXSBI-WLHGVMLRSA-N (e)-but-2-enedioic acid;1,6-dimethyl-7-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.C1=C2C(C)NCCN2C(C)=C1C1=CC=CC=C1 OTSCGMZYQVXSBI-WLHGVMLRSA-N 0.000 description 1
- DNHLQYWFZSXSGD-WLHGVMLRSA-N (e)-but-2-enedioic acid;1,7-dimethyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC(C)=C2C1=CC=CC=C1 DNHLQYWFZSXSGD-WLHGVMLRSA-N 0.000 description 1
- SHKVKBKGLALGNG-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C=CC=C12 SHKVKBKGLALGNG-WLHGVMLRSA-N 0.000 description 1
- UOVPNGRLROAWHB-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6,7-diphenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC(C=1C=CC=CC=1)=C2C1=CC=CC=C1 UOVPNGRLROAWHB-WLHGVMLRSA-N 0.000 description 1
- UOTYUVHPYVKSPD-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6,7-diphenyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC(C=1C=CC=CC=1)=C2C1=CC=CC=C1 UOTYUVHPYVKSPD-WLHGVMLRSA-N 0.000 description 1
- AJCSQACQVOKJIP-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6-(4-phenylmethoxyphenyl)-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC=C2C(C=C1)=CC=C1OCC1=CC=CC=C1 AJCSQACQVOKJIP-WLHGVMLRSA-N 0.000 description 1
- PSWQVXUXGGBORJ-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6-[4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC=C2C1=CC=C(C(F)(F)F)C=C1 PSWQVXUXGGBORJ-WLHGVMLRSA-N 0.000 description 1
- KAHQDXJSJDINFU-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC=C2C1=CC=CC=C1 KAHQDXJSJDINFU-WLHGVMLRSA-N 0.000 description 1
- KVZCBFQMPGTZNY-WLHGVMLRSA-N (e)-but-2-enedioic acid;2-(2-phenylpyrrol-1-yl)ethanamine Chemical compound OC(=O)\C=C\C(O)=O.NCCN1C=CC=C1C1=CC=CC=C1 KVZCBFQMPGTZNY-WLHGVMLRSA-N 0.000 description 1
- LXILNCMVXQCYDR-WLHGVMLRSA-N (e)-but-2-enedioic acid;4-[4-(1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-6-yl)phenoxy]butan-2-ol Chemical compound OC(=O)\C=C\C(O)=O.C1=CC(OCCC(O)C)=CC=C1C1=CC=C2N1CCN=C2C LXILNCMVXQCYDR-WLHGVMLRSA-N 0.000 description 1
- GKKZHYJLSISKIF-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(3,4-dichlorophenyl)-1-methyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC=C2C1=CC=C(Cl)C(Cl)=C1 GKKZHYJLSISKIF-WLHGVMLRSA-N 0.000 description 1
- SQECBXIUXFWTDQ-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(3,4-dimethoxyphenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.C1=C(OC)C(OC)=CC=C1C1=CC=C2N1CCN=C2C SQECBXIUXFWTDQ-WLHGVMLRSA-N 0.000 description 1
- SZJWCSCRLNAJJX-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(3-chlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=CC(Cl)=C1 SZJWCSCRLNAJJX-WLHGVMLRSA-N 0.000 description 1
- JBBBLNKPUUMKQO-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(4-chlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=C(Cl)C=C1 JBBBLNKPUUMKQO-WLHGVMLRSA-N 0.000 description 1
- GVLAEJMPOMDGLS-UHFFFAOYSA-M 1,2-dimethyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazin-5-ium;iodide Chemical compound [I-].CC1=[N+](C)CCN2C1=CC=C2C1=CC=CC=C1 GVLAEJMPOMDGLS-UHFFFAOYSA-M 0.000 description 1
- OTKCEEWUXHVZQI-UHFFFAOYSA-N 1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CC=C1 OTKCEEWUXHVZQI-UHFFFAOYSA-N 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- LXYUSXFFUYVKOV-UHFFFAOYSA-N 1,3-dioxole-4-carboxamide Chemical compound NC(=O)C1=COCO1 LXYUSXFFUYVKOV-UHFFFAOYSA-N 0.000 description 1
- KCDPALDJMOYAFO-UHFFFAOYSA-N 1-(1,3-benzodioxol-5-yl)-3-(1,3-dioxol-2-yl)propan-1-one Chemical compound C=1C=C2OCOC2=CC=1C(=O)CCC1OC=CO1 KCDPALDJMOYAFO-UHFFFAOYSA-N 0.000 description 1
- DSAZPVVSIRDFBU-UHFFFAOYSA-N 1-(1,6-dimethylcyclohexa-2,4-dien-1-yl)-3,4-dihydropyrrolo[1,2-a]pyrazin-2-ium iodide Chemical compound [I-].CC1(C(C=CC=C1)C)C=1C=2N(CC[NH+]=1)C=CC=2 DSAZPVVSIRDFBU-UHFFFAOYSA-N 0.000 description 1
- JWLGSVNRTDDKGR-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound C1=C(Cl)C(Cl)=CC=C1C(=O)CCC1OCCO1 JWLGSVNRTDDKGR-UHFFFAOYSA-N 0.000 description 1
- DXIQKQRFGMHJIO-UHFFFAOYSA-N 1-(3,4-dimethoxyphenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)CCC1OCCO1 DXIQKQRFGMHJIO-UHFFFAOYSA-N 0.000 description 1
- OVRLOLCHGXYIJS-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound ClC1=CC=CC(C(=O)CCC2OCCO2)=C1 OVRLOLCHGXYIJS-UHFFFAOYSA-N 0.000 description 1
- FRKQFQHLQQOESK-UHFFFAOYSA-N 1-(3-phenylfuran-2-yl)ethanone Chemical compound O1C=CC(C=2C=CC=CC=2)=C1C(=O)C FRKQFQHLQQOESK-UHFFFAOYSA-N 0.000 description 1
- CIKROGMCCUIOIG-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound C1=CC(Cl)=CC=C1C(=O)CCC1OCCO1 CIKROGMCCUIOIG-UHFFFAOYSA-N 0.000 description 1
- OCFOYCLGYLFXCC-UHFFFAOYSA-N 1-Methylpyrrolo[1,2-a]pyrazine Chemical compound CC1=NC=CN2C=CC=C12 OCFOYCLGYLFXCC-UHFFFAOYSA-N 0.000 description 1
- SLECVQQKYXEQKY-UHFFFAOYSA-N 1-methyl-6,7-diphenyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC(C=1C=CC=CC=1)=C2C1=CC=CC=C1 SLECVQQKYXEQKY-UHFFFAOYSA-N 0.000 description 1
- BGEMQSKXBMXTJP-UHFFFAOYSA-N 1-methyl-6-(4-methylphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C1=CC=C(C)C=C1 BGEMQSKXBMXTJP-UHFFFAOYSA-N 0.000 description 1
- QJHQYGIPULVWJC-UHFFFAOYSA-N 1-methyl-6-[4-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound CC1NCCN2C1=CC=C2C1=CC=C(C(F)(F)F)C=C1 QJHQYGIPULVWJC-UHFFFAOYSA-N 0.000 description 1
- HZOFTAVDPMDJIB-UHFFFAOYSA-N 1-methyl-6-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C1=CC=C(C(F)(F)F)C=C1 HZOFTAVDPMDJIB-UHFFFAOYSA-N 0.000 description 1
- QSBZIBOXWSSNMH-UHFFFAOYSA-N 1-phenylpyrrolo[1,2-a]pyrazine Chemical compound N=1C=CN2C=CC=C2C=1C1=CC=CC=C1 QSBZIBOXWSSNMH-UHFFFAOYSA-N 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- KUGFDGJVAIMWFN-UHFFFAOYSA-N 2-methyl-4-phenylfuran Chemical compound O1C(C)=CC(C=2C=CC=CC=2)=C1 KUGFDGJVAIMWFN-UHFFFAOYSA-N 0.000 description 1
- GCXNJAXHHFZVIM-UHFFFAOYSA-N 2-phenylfuran Chemical compound C1=COC(C=2C=CC=CC=2)=C1 GCXNJAXHHFZVIM-UHFFFAOYSA-N 0.000 description 1
- VIOBGCWEHLRBEP-UHFFFAOYSA-N 3,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1OC VIOBGCWEHLRBEP-UHFFFAOYSA-N 0.000 description 1
- IZYKZNLUKCURMZ-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-2-methyl-1-phenylpropan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C)CC1OCCO1 IZYKZNLUKCURMZ-UHFFFAOYSA-N 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- FALDLHSSPVIMKL-UHFFFAOYSA-N 4,4-dimethoxy-1-phenylbutan-1-one Chemical compound COC(OC)CCC(=O)C1=CC=CC=C1 FALDLHSSPVIMKL-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- FIJGEYXGLINBSJ-WLHGVMLRSA-N 6-(1,3-benzodioxol-5-yl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.C1=C2OCOC2=CC(C2=CC=C3N2CCN=C3C)=C1 FIJGEYXGLINBSJ-WLHGVMLRSA-N 0.000 description 1
- YPCSOSDOHHMHAF-UHFFFAOYSA-N 6-(3,4-dimethoxyphenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC=C2N1CCN=C2C YPCSOSDOHHMHAF-UHFFFAOYSA-N 0.000 description 1
- PKFHBJGERGISNR-UHFFFAOYSA-N 6-(3-chlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C1=CC=CC(Cl)=C1 PKFHBJGERGISNR-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000726103 Atta Species 0.000 description 1
- LOIFULFGIUPITM-UHFFFAOYSA-N C(C1)C2CC1CC2.Br Chemical compound C(C1)C2CC1CC2.Br LOIFULFGIUPITM-UHFFFAOYSA-N 0.000 description 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 description 1
- 101100516554 Caenorhabditis elegans nhr-5 gene Proteins 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- RAGZGIJNEIQQOS-UHFFFAOYSA-N O-aminoperoxyhydroxylamine Chemical compound NOOON RAGZGIJNEIQQOS-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- KYOIPUDHYRWSFO-UHFFFAOYSA-N [Br].[Li] Chemical group [Br].[Li] KYOIPUDHYRWSFO-UHFFFAOYSA-N 0.000 description 1
- YZSKZXUDGLALTQ-UHFFFAOYSA-N [Li][C] Chemical compound [Li][C] YZSKZXUDGLALTQ-UHFFFAOYSA-N 0.000 description 1
- QGZNMXOKPQPNMY-UHFFFAOYSA-N [Mg].[Cl] Chemical compound [Mg].[Cl] QGZNMXOKPQPNMY-UHFFFAOYSA-N 0.000 description 1
- XJUCCGJZENLZSA-UHFFFAOYSA-M [Rh]Cl Chemical compound [Rh]Cl XJUCCGJZENLZSA-UHFFFAOYSA-M 0.000 description 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- MINUDROTNALHCR-WLHGVMLRSA-N benzyl [4-(1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-6-yl)phenyl] carbonate;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C(C=C1)=CC=C1OC(=O)OCC1=CC=CC=C1 MINUDROTNALHCR-WLHGVMLRSA-N 0.000 description 1
- UDYGXWPMSJPFDG-UHFFFAOYSA-M benzyl(tributyl)azanium;bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 UDYGXWPMSJPFDG-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 210000001638 cerebellum Anatomy 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000003426 co-catalyst Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 208000010877 cognitive disease Diseases 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001647 drug administration Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- ZQTYQMYDIHMKQB-UHFFFAOYSA-N exo-norborneol Chemical compound C1CC2C(O)CC1C2 ZQTYQMYDIHMKQB-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- SCZVXVGZMZRGRU-UHFFFAOYSA-N n'-ethylethane-1,2-diamine Chemical compound CCNCCN SCZVXVGZMZRGRU-UHFFFAOYSA-N 0.000 description 1
- DAMIPLNLHLANRQ-UHFFFAOYSA-N n-[2-(2,3-diphenylpyrrol-1-yl)ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 DAMIPLNLHLANRQ-UHFFFAOYSA-N 0.000 description 1
- XKYJBKYELTYGHZ-UHFFFAOYSA-N n-[2-(3-methyl-2-phenylpyrrol-1-yl)ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC(C)=C1C1=CC=CC=C1 XKYJBKYELTYGHZ-UHFFFAOYSA-N 0.000 description 1
- NFOVPSZUBLGLHO-UHFFFAOYSA-N n-[2-[2-(3,4-dimethoxyphenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC=CN1CCNC(C)=O NFOVPSZUBLGLHO-UHFFFAOYSA-N 0.000 description 1
- GXJLBGOHEOYGDV-UHFFFAOYSA-N n-[2-[2-(4-chlorophenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(Cl)C=C1 GXJLBGOHEOYGDV-UHFFFAOYSA-N 0.000 description 1
- OAPYQYBEEXEHKZ-UHFFFAOYSA-N n-[2-[2-(4-methylphenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(C)C=C1 OAPYQYBEEXEHKZ-UHFFFAOYSA-N 0.000 description 1
- ISWNUAFRSGDCAH-UHFFFAOYSA-N n-methoxy-n-methyl-1,3-benzodioxole-5-carboxamide Chemical compound CON(C)C(=O)C1=CC=C2OCOC2=C1 ISWNUAFRSGDCAH-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000008057 potassium phosphate buffer Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 230000005258 radioactive decay Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- AFCAKJKUYFLYFK-UHFFFAOYSA-N tetrabutyltin Chemical compound CCCC[Sn](CCCC)(CCCC)CCCC AFCAKJKUYFLYFK-UHFFFAOYSA-N 0.000 description 1
- VXKWYPOMXBVZSJ-UHFFFAOYSA-N tetramethyltin Chemical compound C[Sn](C)(C)C VXKWYPOMXBVZSJ-UHFFFAOYSA-N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000820 toxicity test Toxicity 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/333—Radicals substituted by oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/60—Naphtho [b] pyrroles; Hydrogenated naphtho [b] pyrroles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/46—Doubly bound oxygen atoms, or two oxygen atoms singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- General Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hospice & Palliative Care (AREA)
- Psychiatry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH195091 | 1991-07-02 | ||
| CH195091 | 1991-07-02 | ||
| CH166792 | 1992-05-22 | ||
| CH166792 | 1992-05-22 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI923073A0 FI923073A0 (fi) | 1992-07-02 |
| FI923073A7 FI923073A7 (fi) | 1993-01-03 |
| FI100242B true FI100242B (fi) | 1997-10-31 |
Family
ID=25688329
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI923073A FI100242B (fi) | 1991-07-02 | 1992-07-02 | Menetelmä uusien terapeuttisesti käyttökelpoisten pyrrolo£1,2-a|pyrats iinijohdannaisten valmistamiseksi |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5292732A (enExample) |
| EP (1) | EP0521368A1 (enExample) |
| JP (1) | JPH0774217B2 (enExample) |
| CN (1) | CN1030986C (enExample) |
| AU (1) | AU654362B2 (enExample) |
| CA (1) | CA2072836A1 (enExample) |
| CS (1) | CS202292A3 (enExample) |
| FI (1) | FI100242B (enExample) |
| HU (1) | HUT70163A (enExample) |
| IE (1) | IE922152A1 (enExample) |
| IL (1) | IL102337A (enExample) |
| NO (1) | NO922604L (enExample) |
| NZ (1) | NZ243310A (enExample) |
| TW (1) | TW224974B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0572863A1 (de) * | 1992-06-05 | 1993-12-08 | F. Hoffmann-La Roche Ag | ZNS Pyrazinoindole |
| US5378846A (en) * | 1993-06-11 | 1995-01-03 | Russian-American Institute For New Drug Development | 1,2,3,4-tetrahydropyrrolo-[1,2-a]-pyrazine derivatives |
| US5352096A (en) * | 1993-09-27 | 1994-10-04 | Chi Wen Chen | Air compressor for automobiles |
| TW334423B (en) * | 1993-10-22 | 1998-06-21 | Hoffmann La Roche | Tricyclic 1-aminoethylpyrrole-derivatives |
| UA66370C2 (en) | 1997-12-16 | 2004-05-17 | Lilly Co Eli | Arylpiperazines having activity to setotonin 1 receptors |
| AP2001002169A0 (en) * | 1998-12-25 | 2001-06-30 | Shionogi & Co | Aromatic heterocycle compounds having hiv intergrase inhibiting activities |
| CN100403900C (zh) * | 2003-06-12 | 2008-07-23 | 麦克公司 | 有丝分裂驱动蛋白抑制剂 |
| EP1741709A1 (en) | 2005-06-28 | 2007-01-10 | Sanofi-Aventis Deutschland GmbH | Heteroaryl-substituted amides comprising a saturated linker group, and their use as pharmaceuticals |
| DE102006049452A1 (de) | 2006-10-17 | 2008-05-08 | Grünenthal GmbH | Substituierte Tetrahydropyrolopiperazin-Verbindungen und deren Verwendung in Arzneimitteln |
| JP5711813B2 (ja) | 2010-06-09 | 2015-05-07 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプJanssen Pharmaceutica Naamloze Vennootschap | βセクレターゼ(BACE)の阻害剤として有用な5,6−ジヒドロ−2H−[1,4]オキサジン−3−イル−アミン誘導体 |
| WO2012085038A1 (en) | 2010-12-22 | 2012-06-28 | Janssen Pharmaceutica Nv | 5,6-DIHYDRO-IMIDAZO[1,2-a]PYRAZIN-8-YLAMINE DERIVATIVES USEFUL AS INHIBITORS OF BETA-SECRETASE (BACE) |
| ES2558779T3 (es) | 2011-03-01 | 2016-02-08 | Janssen Pharmaceutica, N.V. | Derivados de 6,7-dihidro-pirazolo[1,5-a]piracin-4-ilamina útiles como inhibidores de ß-secretasa (BACE) |
| EA023824B1 (ru) | 2011-03-09 | 2016-07-29 | Янссен Фармацевтика Нв | ПРОИЗВОДНЫЕ 3,4-ДИГИДРОПИРРОЛО[1,2-a]ПИРАЗИН-1-ИЛАМИНА, ПРИГОДНЫЕ В КАЧЕСТВЕ ИНГИБИТОРОВ БЕТА-СЕКРЕТАЗЫ (BACE) |
| AU2013365827A1 (en) * | 2012-12-19 | 2015-07-09 | Novartis Ag | Tricyclic compounds as CFTR inhibitors |
| EA032662B1 (ru) | 2013-06-12 | 2019-06-28 | Янссен Фармацевтика Нв | ПРОИЗВОДНЫЕ 4-АМИНО-6-ФЕНИЛ-5,6-ДИГИДРОИМИДАЗО[1,5-а]ПИРАЗИН-3(2H)-ОНА В КАЧЕСТВЕ ИНГИБИТОРОВ БЕТА-СЕКРЕТАЗЫ (BACE) |
| AU2014280124B2 (en) | 2013-06-12 | 2018-11-01 | Janssen Pharmaceutica Nv | 4-amino-6-phenyl-5,6-dihydroimidazo[1,5-a]pyrazine derivatives as inhibitors of beta-secretase (BACE) |
| CN105324383B (zh) | 2013-06-12 | 2017-10-31 | 詹森药业有限公司 | 作为β‑分泌酶(BACE)抑制剂的4‑氨基‑6‑苯基‑6,7‑二氢[1,2,3]三唑并[1,5‑A]吡嗪衍生物 |
| ES2768823T3 (es) | 2014-12-18 | 2020-06-23 | Janssen Pharmaceutica Nv | Derivados de 2,3,4,5-tetrahidropiridin-6-amina y 3,4-dihidro-2H-pirrol-5-amina útiles como inhibidores de beta-secretasa |
| WO2018189214A1 (en) * | 2017-04-12 | 2018-10-18 | F. Hoffmann-La Roche Ag | A method for labeling of aldehyde containing target molecules |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1185080A (en) * | 1967-12-07 | 1970-03-18 | Beecham Group Ltd | Pyrrolidines |
| US3906010A (en) * | 1974-06-17 | 1975-09-16 | Morton Norwich Products Inc | Series of 5-aryl-2-furamidines |
| US3931247A (en) * | 1974-12-11 | 1976-01-06 | Morton-Norwich Products, Inc. | 5-(Substituted)phenylfurfuryl alcohols |
| JPS5811878B2 (ja) * | 1974-12-19 | 1983-03-04 | 大正製薬株式会社 | フロ ( 3 2−b ) インド−ルルイノ セイホウ |
| US4188389A (en) * | 1978-11-03 | 1980-02-12 | Ayerst Mckenna & Harrison, Inc. | 1,2,3,4-Tetrahydropyrrolo(1,2-A)pyrazines |
| JPS5852995B2 (ja) * | 1981-09-28 | 1983-11-26 | 武田薬品工業株式会社 | フルフラ−ル誘導体の製造法 |
| US4882354A (en) * | 1987-12-16 | 1989-11-21 | Norwich Eaton Pharmaceuticals, Inc. | N-hydroxy-5-phenyl-2-furancarboximidamides useful as cardiotonic agents |
-
1992
- 1992-06-12 TW TW081104600A patent/TW224974B/zh active
- 1992-06-23 EP EP92110531A patent/EP0521368A1/de not_active Ceased
- 1992-06-25 NZ NZ243310A patent/NZ243310A/en unknown
- 1992-06-26 US US07/905,584 patent/US5292732A/en not_active Expired - Fee Related
- 1992-06-26 IL IL10233792A patent/IL102337A/en not_active IP Right Cessation
- 1992-06-26 HU HU9202139A patent/HUT70163A/hu unknown
- 1992-06-29 AU AU19309/92A patent/AU654362B2/en not_active Ceased
- 1992-06-29 CS CS922022A patent/CS202292A3/cs unknown
- 1992-06-30 CA CA002072836A patent/CA2072836A1/en not_active Abandoned
- 1992-07-01 NO NO92922604A patent/NO922604L/no unknown
- 1992-07-01 IE IE215292A patent/IE922152A1/en not_active Application Discontinuation
- 1992-07-02 JP JP4197449A patent/JPH0774217B2/ja not_active Expired - Lifetime
- 1992-07-02 CN CN92105314A patent/CN1030986C/zh not_active Expired - Fee Related
- 1992-07-02 FI FI923073A patent/FI100242B/fi active
Also Published As
| Publication number | Publication date |
|---|---|
| CA2072836A1 (en) | 1993-01-03 |
| CS202292A3 (en) | 1993-01-13 |
| HU9202139D0 (en) | 1992-10-28 |
| HUT70163A (en) | 1995-09-28 |
| IL102337A0 (en) | 1993-01-14 |
| FI923073A0 (fi) | 1992-07-02 |
| AU1930992A (en) | 1993-01-07 |
| NO922604D0 (no) | 1992-07-01 |
| US5292732A (en) | 1994-03-08 |
| TW224974B (enExample) | 1994-06-11 |
| IL102337A (en) | 1996-01-31 |
| JPH06239865A (ja) | 1994-08-30 |
| NZ243310A (en) | 1994-11-25 |
| NO922604L (no) | 1993-01-04 |
| JPH0774217B2 (ja) | 1995-08-09 |
| FI923073A7 (fi) | 1993-01-03 |
| CN1030986C (zh) | 1996-02-14 |
| AU654362B2 (en) | 1994-11-03 |
| EP0521368A1 (de) | 1993-01-07 |
| CN1068328A (zh) | 1993-01-27 |
| IE922152A1 (en) | 1993-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI100242B (fi) | Menetelmä uusien terapeuttisesti käyttökelpoisten pyrrolo£1,2-a|pyrats iinijohdannaisten valmistamiseksi | |
| EP1192165B1 (en) | Substituted heterocycle fused gamma-carbolines | |
| EP0430771B1 (fr) | Dérivés de l'isoindolone, leur préparation et leur utilisation comme intermédiaires pour la préparation d'antagonistes de la substance P | |
| US5502072A (en) | Substituted oxindoles | |
| EP0711280B1 (fr) | Derives de perhydroisoindole comme antagonistes de la substance p | |
| FR2493320A1 (fr) | Nouveaux derives de carbostyrile utiles notamment comme cardiotoniques, leurs procedes de preparation et medicaments les contenant | |
| FR2568571A1 (fr) | Derive d'indole | |
| NO327849B1 (no) | 2-iminopyrrolidin-derivater, deres anvendelse samt farmakologisk preparat | |
| EP0586471A1 (fr) | Nouveaux derives de perhydroisoindole et leur preparation. | |
| WO1997000860A1 (fr) | Composes agonistes du recepteur cb¿2? | |
| FR2628108A1 (fr) | Derives de piperazine et leurs sels, leurs procedes de fabrication et compositions pharmaceutiques les comprenant comme ingredients actifs | |
| EP0433149B1 (fr) | Antagonistes de la sérotonine, leur préparation et les médicaments les contenant | |
| US6391891B1 (en) | Bicyclic compounds as ligands for 5-HT1 receptors | |
| EP0350403A1 (fr) | Dérivés de (aza)naphtalènesultame, leurs procédés de préparation et les médicaments les contenant | |
| EP0511074A1 (fr) | Dérivés hétérocycliques antisérotonines, leur préparation et les médicaments les contenant | |
| EP0905136A1 (en) | Tetrahydro gamma-carbolines | |
| SK2498A3 (en) | Heterocyclylcarboxamide derivatives and their use as therapeutic agents | |
| SA91110352B1 (ar) | عملية محسنة لتحضير مشتقات اندولون مستبدلة | |
| FR2649612A1 (fr) | Medicaments a base de derives de 1h-benzoxadiazine-4,1,2 nouveaux derives et leurs procedes de preparation | |
| US5948907A (en) | Synthesis of bisindolylmaleimides | |
| EP0511073A1 (fr) | Antisérotonines, leur préparation et les médicaments les contenant | |
| CA2135811A1 (en) | Tricyclic indole-2-carboxylic acid derivatives | |
| US6136825A (en) | Sulfonamide compounds having 5-HT receptor activity | |
| CZ202292A3 (cs) | Způsob zpracování slupek plodu ostropestřce mariánského | |
| MXPA99005997A (en) | Sulfonamide compounds having 5-ht receptor activity |