ES248095A1 - Un método para preparar carbamatos - Google Patents
Un método para preparar carbamatosInfo
- Publication number
- ES248095A1 ES248095A1 ES0248095A ES248095A ES248095A1 ES 248095 A1 ES248095 A1 ES 248095A1 ES 0248095 A ES0248095 A ES 0248095A ES 248095 A ES248095 A ES 248095A ES 248095 A1 ES248095 A1 ES 248095A1
- Authority
- ES
- Spain
- Prior art keywords
- halo
- butynyl
- hydrogen
- aryl
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 241000209761 Avena Species 0.000 title 1
- 235000007319 Avena orientalis Nutrition 0.000 title 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 title 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 4
- 125000000623 heterocyclic group Chemical group 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 4
- 239000001257 hydrogen Substances 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- -1 aralkenyl Chemical group 0.000 abstract 3
- 125000003118 aryl group Chemical group 0.000 abstract 3
- 229910052736 halogen Inorganic materials 0.000 abstract 3
- 150000002367 halogens Chemical group 0.000 abstract 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 abstract 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 abstract 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000000304 alkynyl group Chemical group 0.000 abstract 2
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 2
- 238000006243 chemical reaction Methods 0.000 abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- 230000002140 halogenating effect Effects 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 2
- 229910052757 nitrogen Inorganic materials 0.000 abstract 2
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 2
- 230000000361 pesticidal effect Effects 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- 125000003107 substituted aryl group Chemical group 0.000 abstract 2
- 125000003568 4-hydroxy-2-butynyl group Chemical group [H]OC([H])([H])C#CC([H])([H])* 0.000 abstract 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 abstract 1
- 125000002252 acyl group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 239000007864 aqueous solution Substances 0.000 abstract 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 230000002363 herbicidal effect Effects 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 239000012442 inert solvent Substances 0.000 abstract 1
- 239000012948 isocyanate Substances 0.000 abstract 1
- 150000002513 isocyanates Chemical class 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 229910052698 phosphorus Inorganic materials 0.000 abstract 1
- 239000011574 phosphorus Substances 0.000 abstract 1
- 230000008635 plant growth Effects 0.000 abstract 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 abstract 1
- 239000000376 reactant Substances 0.000 abstract 1
- 230000001105 regulatory effect Effects 0.000 abstract 1
- 125000001424 substituent group Chemical group 0.000 abstract 1
- 239000004094 surface-active agent Substances 0.000 abstract 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical compound OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/06—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D223/12—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/48—Acylated amino or imino radicals by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof, e.g. carbonylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/82—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/205—Radicals derived from carbonic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
- C09B43/12—Preparation of azo dyes from other azo compounds by acylation of amino groups
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B43/00—Preparation of azo dyes from other azo compounds
- C09B43/12—Preparation of azo dyes from other azo compounds by acylation of amino groups
- C09B43/124—Preparation of azo dyes from other azo compounds by acylation of amino groups with monocarboxylic acids, carbamic esters or halides, mono- isocyanates, or haloformic acid esters
- C09B43/1245—Preparation of azo dyes from other azo compounds by acylation of amino groups with monocarboxylic acids, carbamic esters or halides, mono- isocyanates, or haloformic acid esters with formation of NHCOOR, NHCOSR or NHCSOR groups by acylation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US723133A US2906614A (en) | 1958-03-24 | 1958-03-24 | 4-halo-2-butynyl n-(3-halophenyl) carbamates and use for controlling oats |
| US77026658A | 1958-10-29 | 1958-10-29 | |
| US786674A US3203949A (en) | 1958-03-24 | 1959-01-14 | 4-halo-2-butynyl carbamates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES248095A1 true ES248095A1 (es) | 1959-11-16 |
Family
ID=27419050
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES0248095A Expired ES248095A1 (es) | 1958-03-24 | 1959-03-23 | Un método para preparar carbamatos |
Country Status (13)
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3123463A (en) * | 1964-03-03 | Herbicidal composition and method | ||
| NL103921C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-03-24 | |||
| US3116322A (en) * | 1960-08-24 | 1963-12-31 | Spencer Chem Co | 4-halo-2-butynyl carbamates |
| NL280296A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1961-07-03 | |||
| US3120556A (en) * | 1962-05-18 | 1964-02-04 | Monsanto Chemicals | Halophenyl chloroformate derivatives |
| US3337608A (en) * | 1963-03-18 | 1967-08-22 | Upjohn Co | Phenylacetylphenyl carbamates |
| US3306831A (en) * | 1963-10-30 | 1967-02-28 | Cowles Chem Co | Electroplating electrolytes |
| US3336355A (en) * | 1964-07-02 | 1967-08-15 | Cutter Lab | Urethanes of triarylacrylonitriles |
| DE1542777C3 (de) * | 1965-04-17 | 1978-12-07 | Bayer Ag, 5090 Leverkusen | a-ChIor-ß-(4-chlorphenyl) propionsäruemethylester und Herbizide mit einem Gehalt an einem cx-Chlorß-phenylpropionsäruederivat |
| US3416913A (en) * | 1965-07-30 | 1968-12-17 | Gulf Oil Corp | Barban for wild oat control |
| US3857693A (en) * | 1965-10-14 | 1974-12-31 | Fmc Corp | Anilide carbamates as herbicides |
| US3466374A (en) * | 1966-02-16 | 1969-09-09 | Pennsalt Chemicals Corp | Process for controlling insects with 2-butynylene 1,4-bis(phenylcarbamates) |
| DE1670916A1 (de) * | 1967-08-29 | 1971-04-08 | Bayer Ag | Verfahren zur Herstellung neuartiger Carbamidsaeureester |
| US3790363A (en) * | 1968-04-08 | 1974-02-05 | Stauffer Chemical Co | Cinnamyl carbamates and their utility as herbicides |
| CH505543A (de) * | 1968-11-01 | 1971-04-15 | Ciba Geigy Ag | Schädlingsbekämpfungsmittel |
| CH508339A (de) * | 1969-05-08 | 1971-06-15 | Ciba Geigy Ag | Mittel zur Bekämpfung von Insekten und Vertretern der Ordnung Acarina |
| US3990884A (en) * | 1969-10-23 | 1976-11-09 | Fisons Limited | Herbicidal Composition Comprising 4-chloro-2-butynyl m-chlorocarbanilate |
| GB1386598A (en) * | 1971-06-24 | 1975-03-12 | Fisons Ltd | Herbicides |
| US3963479A (en) * | 1972-04-13 | 1976-06-15 | Basf Aktiengesellschaft | Herbicide mixtures of 3-lower alkyl-2,1,3-benzothiadiazinone-(4)-2,2-dioxides or salts thereof and 4-halobutynyl-N-halophenyl carbamates |
| CA999452A (en) * | 1972-12-04 | 1976-11-09 | Shell Canada Limited | Barban, substituted 2-aminopropionate synergistic composition for controlling wild oat |
| US3923870A (en) * | 1973-07-11 | 1975-12-02 | Troy Chemical Corp | Urethanes of 1-halogen substituted alkynes |
| US4012433A (en) * | 1975-11-24 | 1977-03-15 | Gulf Oil Corporation | Process for manufacturing 4-chloro-2-butynyl m-chlorocarbanilate |
| US4134754A (en) * | 1978-03-23 | 1979-01-16 | Gulf Oil Corporation | Method of combating wild oats |
| AU7199881A (en) * | 1981-06-18 | 1982-12-23 | Gulf Oil Corp. | 4-chloro-1-methyl-2-butynyl carbanilates for combating wild oats |
| DE3216895A1 (de) * | 1982-05-06 | 1983-11-10 | Henkel KGaA, 4000 Düsseldorf | 2-(3-iod-2-propinyloxy)-ethanol-carbamate, ihre herstellung und ihre verwendung als antimikrobielle substanzen |
| US4749812A (en) * | 1985-05-27 | 1988-06-07 | Mitsui Toatsu Chemicals, Inc. | N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| US4945109A (en) * | 1988-08-24 | 1990-07-31 | Buckman Laboratories International, Inc. | Ester of carbamic acid useful as a microbicide and a preservative |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2734911A (en) * | 1956-02-14 | Reaction of chloroaniline and isopropyl | ||
| US2433440A (en) * | 1947-12-30 | Jpyrimidine cosipounds | ||
| USRE22750E (en) * | 1946-04-30 | Disinfectant | ||
| USRE20869E (en) * | 1938-10-04 | Composition toxic to lower forms of | ||
| US1964654A (en) * | 1930-12-27 | 1934-06-26 | Ig Farbenindustrie Ag | Sulphonation products of urethanes and process for making same |
| US2396513A (en) * | 1945-06-12 | 1946-03-12 | American Chem Paint Co | Methods and compositions for killing weeds |
| US2555989A (en) * | 1947-05-10 | 1951-06-05 | Univ Ohio State Res Found | 6-alkoxy-4-methylhexene-2-diol-1, 4 and esters thereof |
| US2610116A (en) * | 1950-01-04 | 1952-09-09 | Phillips Petroleum Co | Herbicide and defoliant |
| US2609286A (en) * | 1951-02-27 | 1952-09-02 | Sharples Chemicals Inc | Plant growth regulation |
| DE1017846B (de) * | 1952-01-25 | 1957-10-17 | Boehringer Sohn Ingelheim | Fungicide und acaricide Mittel |
| US2816910A (en) * | 1952-04-10 | 1957-12-17 | Schering Ag | Esters of carbamic acid and a method of making same |
| US2759935A (en) * | 1953-02-18 | 1956-08-21 | Bristol Lab Inc | Substituted 3-phenyloxindoles |
| US2759934A (en) * | 1953-02-18 | 1956-08-21 | Bristol Lab Inc | Dialkylaminoalkylamides |
| DE1016057B (de) * | 1953-05-26 | 1957-09-19 | Columbia Southern Chem Corp | Phenylcarbaminsaeureester enthaltende herbicide Gemische |
| US2724720A (en) * | 1953-08-03 | 1955-11-22 | Carter Prod Inc | Dicarbamates of substituted propane diols |
| US2789129A (en) * | 1954-01-19 | 1957-04-16 | Columbia Southern Chem Corp | Chlorophenoxyalkyl esters of nu-phenylcarbamic acids |
| US2784071A (en) * | 1954-03-25 | 1957-03-05 | Fmc Corp | Selective herbicide |
| US2788268A (en) * | 1955-03-17 | 1957-04-09 | Columbia Southern Chem Corp | Novel compositions and their use |
| US2819294A (en) * | 1955-04-19 | 1958-01-07 | Columbia Southern Chem Corp | Alpha-carbo (phenoxyalkoxy) ethyl n-phenylcarbamates |
| US2923732A (en) * | 1957-05-20 | 1960-02-02 | Dow Chemical Co | Process for making quinitol bis-chloroformate |
| US2873291A (en) * | 1957-07-05 | 1959-02-10 | Du Pont | Process for preparing bis(chloroformates) of 1, 2-diols |
| NL103921C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1958-03-24 |
-
0
- NL NL103921D patent/NL103921C/xx active
- DK DK102793D patent/DK102793A/da unknown
- CA CA638194A patent/CA638194A/en not_active Expired
- BE BE577003D patent/BE577003A/xx unknown
- CA CA637413A patent/CA637413A/en not_active Expired
- NL NL237426D patent/NL237426A/xx unknown
- ZA ZA591098D patent/ZA591098B/xx unknown
- NL NL108471D patent/NL108471C/xx active
- NL NL272056D patent/NL272056A/xx unknown
- IT IT605841D patent/IT605841A/it unknown
- DK DK100668D patent/DK100668A/da unknown
-
1958
- 1958-03-24 US US723133A patent/US2906614A/en not_active Expired - Lifetime
-
1959
- 1959-01-14 US US786674A patent/US3203949A/en not_active Expired - Lifetime
- 1959-03-19 GB GB9581/59A patent/GB916574A/en not_active Expired
- 1959-03-19 GB GB39958/61A patent/GB916575A/en not_active Expired
- 1959-03-23 ES ES0248095A patent/ES248095A1/es not_active Expired
- 1959-03-23 DE DES62262A patent/DE1137255B/de active Pending
- 1959-03-23 DK DK452159AA patent/DK102793C/da active
- 1959-03-23 AT AT228759A patent/AT239592B/de active
- 1959-03-23 DK DK452059AA patent/DK103179C/da active
- 1959-03-23 CH CH7108859A patent/CH386169A/de unknown
- 1959-03-23 DK DK104159AA patent/DK118817B/da unknown
-
1960
- 1960-01-14 FR FR815618A patent/FR1248201A/fr not_active Expired
-
1961
- 1961-09-05 US US135763A patent/US3155713A/en not_active Expired - Lifetime
-
1962
- 1962-06-05 US US200053A patent/US3226426A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AT239592B (de) | 1965-04-12 |
| US3155713A (en) | 1964-11-03 |
| GB916574A (en) | 1963-01-23 |
| NL108471C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| CA638194A (en) | 1962-03-13 |
| FR1248201A (fr) | 1960-12-09 |
| US3203949A (en) | 1965-08-31 |
| NL237426A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| CA637413A (en) | 1962-02-27 |
| DK102793A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| ZA591098B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| US2906614A (en) | 1959-09-29 |
| GB916575A (en) | 1963-01-23 |
| DK118817B (da) | 1970-10-12 |
| NL103921C (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| DK100668A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| US3226426A (en) | 1965-12-28 |
| BE577003A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| CH386169A (de) | 1964-12-31 |
| DK103179C (da) | 1965-11-29 |
| NL272056A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| DK102793C (da) | 1965-10-11 |
| IT605841A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | |
| DE1137255B (de) | 1962-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES248095A1 (es) | Un método para preparar carbamatos | |
| ES8205764A1 (es) | Un procedimiento para la preparacion de ureas e isoureas, utiles como herbicidas y como reguladores del crecimiento delas plantas. | |
| DK161598C (da) | Nye alfa-azolylglycolderivater, plantevaekstregulerende midler, der indeholder disse, og fremgangsmaade til regulering af plantevaekst | |
| ES449262A1 (es) | Un procedimiento para preparar compuestos de biciclohepteno. | |
| GB849794A (en) | Mixtures of urea derivatives and phenyl carbamic acid esters suitable as herbicidal compositions | |
| GB1093228A (en) | Substituted pyridyl ureas and processes for their preparation | |
| DK266686D0 (da) | 1-aryl-5-alkoximinoalkylaminopyrazoler, fremgangsmaader til fremstilling deraf og deres anvendelse som herbicider og vaekstregulatorer | |
| GB948783A (en) | New thiophosphoric acid ester derivatives having insecticidal properties | |
| GB1418247A (en) | Sulphonyloxy-phenylureas process for their preparation and their use as herbicides | |
| GB1110617A (en) | Benzhydrylcarbamates and process for preparing the same | |
| GB1331201A (en) | Carbamates process for their preparation and their use as insecticides | |
| GB1399670A (en) | Process for preparing adenosine-5-carboxamides | |
| GB823001A (en) | Acaricidal compositions | |
| GB1071507A (en) | Substituted ureas and herbicidal compositions containing them | |
| GB1062680A (en) | New urea derivatives,the manufacture thereof,selective herbicides containing the same and application of said herbicides | |
| GB1287753A (en) | Substituted anilides and preparations containing them | |
| GB917642A (en) | Carbamyl amidines | |
| GB1035469A (en) | Alkenylmercaptophenyl n-methyl-carbamic acid esters | |
| US2695300A (en) | Preparation of a series of new | |
| GB968807A (en) | Fungicides comprising diaryl-azo compounds | |
| ES8407480A1 (es) | Un procedimiento para la preparacion de una nueva piridazina sustituida. | |
| GB1029326A (en) | Isoindoline-2-carboxylic acid amides | |
| GB1301371A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| ES443496A1 (es) | Procedimiento para la preparacion de n-(bencil orto-susti- tuido)-dinitro-trifluorometil-anilinas. | |
| GB920755A (en) | Basically substituted phenyl-thiocarbamic acid-s-esters |