ES2053641T3 - Agentes insecticidas, acaricidas y nematicidas de arilpirrol y metodo para su preparacion. - Google Patents
Agentes insecticidas, acaricidas y nematicidas de arilpirrol y metodo para su preparacion.Info
- Publication number
- ES2053641T3 ES2053641T3 ES88112810T ES88112810T ES2053641T3 ES 2053641 T3 ES2053641 T3 ES 2053641T3 ES 88112810 T ES88112810 T ES 88112810T ES 88112810 T ES88112810 T ES 88112810T ES 2053641 T3 ES2053641 T3 ES 2053641T3
- Authority
- ES
- Spain
- Prior art keywords
- alkyl
- optionally substituted
- alkoxy
- halogen atoms
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000642 acaricide Substances 0.000 title 1
- 239000003795 chemical substances by application Substances 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
- 239000005645 nematicide Substances 0.000 title 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract 6
- 125000005843 halogen group Chemical group 0.000 abstract 6
- 229910052731 fluorine Inorganic materials 0.000 abstract 5
- 229910052794 bromium Inorganic materials 0.000 abstract 4
- 229910052801 chlorine Inorganic materials 0.000 abstract 4
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 abstract 3
- 229910052740 iodine Inorganic materials 0.000 abstract 3
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 2
- 229910052739 hydrogen Inorganic materials 0.000 abstract 2
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 abstract 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 1
- JNCMHMUGTWEVOZ-UHFFFAOYSA-N F[CH]F Chemical compound F[CH]F JNCMHMUGTWEVOZ-UHFFFAOYSA-N 0.000 abstract 1
- 108010081348 HRT1 protein Hairy Proteins 0.000 abstract 1
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 abstract 1
- 230000000895 acaricidal effect Effects 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 125000005167 cycloalkylaminocarbonyl group Chemical group 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 230000000749 insecticidal effect Effects 0.000 abstract 1
- 230000001069 nematicidal effect Effects 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/36—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/42—Nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/208,841 US5010098A (en) | 1987-07-29 | 1988-06-23 | Arylpyrrole insecticidal acaricidal and nematicidal agents and methods for the preparation thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2053641T3 true ES2053641T3 (es) | 1994-08-01 |
Family
ID=22776258
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES88112810T Expired - Lifetime ES2053641T3 (es) | 1988-06-23 | 1988-08-05 | Agentes insecticidas, acaricidas y nematicidas de arilpirrol y metodo para su preparacion. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5010098A (show.php) |
| EP (1) | EP0347488B1 (show.php) |
| AT (1) | ATE106392T1 (show.php) |
| DE (1) | DE3889909T2 (show.php) |
| ES (1) | ES2053641T3 (show.php) |
| PH (1) | PH25760A (show.php) |
Families Citing this family (93)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5187185A (en) * | 1988-12-09 | 1993-02-16 | Rhone-Poulenc Ag Company | Pesticidal 1-arylpyrroles |
| US4929634A (en) | 1987-10-23 | 1990-05-29 | American Cyanamid Company | Method of and bait compositions for controlling mollusks |
| EP0358047A3 (en) * | 1988-09-08 | 1991-05-29 | American Cyanamid Company | Method of controlling phytopathogenic fungi |
| US5371239A (en) * | 1989-12-22 | 1994-12-06 | American Cyanamid Company | Methods and compositions for protecting animals against attack and infestation by helminth, acarid and arthropod endo- and ectoparasites |
| EP0484614B1 (en) * | 1990-05-11 | 1995-05-24 | American Cyanamid Company | N-acylated arylpyrroles useful as insecticidal, acaricidal, nematicidal and molluscicidal agents |
| IL98235A (en) * | 1990-07-31 | 1999-07-14 | American Cyanamid Co | Process for the preparation of insecticidal acaridical and nematicidal 2-aryl-5-(trifluoromethyl) pyrrole compounds and intermediates thereof |
| US5229524A (en) * | 1990-10-18 | 1993-07-20 | American Cyanamid Company | Bis-and tris (trifluoromethyl) arylpyrrole insecticidal and acaricidal agents |
| US5233052A (en) * | 1990-11-30 | 1993-08-03 | American Cyanamid Company | Insecticidal and acaricidal diarylpyrrolecarbonitrile and diarylnitropyrrole compounds |
| US5180734A (en) * | 1990-11-30 | 1993-01-19 | American Cyanamid Company | Insecticidal and acaricidal diarylpyrrolecarbonitrile and diarylnitropyrrole compounds |
| US5128485A (en) * | 1990-12-17 | 1992-07-07 | American Cyanamid Company | Synthesis of 2-aryl-5-(trifluoromethyl)pyrroles useful as pesticidal agents and as intermediates for the preparation of said agents |
| DK0492171T3 (da) * | 1990-12-26 | 2000-09-04 | American Cyanamid Co | 4-Chlor-1-(ethoxymethyl)-2-(p-chlorphenyl)-5-(trifluormethyl)pyrrol-3-carbonitril samt dets anvendelse som insecticid, nema |
| US5194630A (en) * | 1990-12-26 | 1993-03-16 | American Cyanamid Company | Process for the manufacture of insecticidal 2-aryl-1-(alkoxymethyl)-4-halo-5-(trifluoromethyl)pyrroles |
| IL100110A0 (en) * | 1990-12-26 | 1992-08-18 | American Cyanamid Co | Insecticidal and synergistic miticidal compositions |
| DE4117752A1 (de) * | 1991-05-30 | 1992-12-03 | Bayer Ag | Substituierte 2-arylpyrrole |
| US5233051A (en) * | 1991-05-30 | 1993-08-03 | Bayer Aktiengesellschaft | Substituted 2-arylpyrroles |
| YU8592A (sh) * | 1991-08-28 | 1994-06-10 | Flumroc Ag. | Postupak i uređaj za izradu ploča od mineralnih vlakana primenjenih kao nosač zidnog premaza |
| US5130328A (en) * | 1991-09-06 | 1992-07-14 | American Cyanamid Company | N-alkanoylaminomethyl and N-aroylaminomethyl pyrrole insecticidal and acaricidal agents |
| US5145986A (en) * | 1991-09-09 | 1992-09-08 | American Cyanamid Company | Process for the manufacture of insecticidal, nematicidal and acaricidal 2-aryl-3-substituted-5-(trifluoromethyl)pyrrole compounds from N-(substituted benzyl)-2,2,2-trifluoro-acetimidoyl chloride compounds |
| US5280021A (en) * | 1991-12-04 | 1994-01-18 | American Cyanamid Company | Method and composition for the control of phytopathogenic fungi |
| EP0545103A1 (en) * | 1991-12-04 | 1993-06-09 | American Cyanamid Company | Insecticidal, acaricidal and molluscicidal 1-(substituted) thioalkylpyrroles |
| US5306827A (en) * | 1991-12-04 | 1994-04-26 | American Cyanamid Company | Haloalkylthio, -sulfinyl and -sulfonyl arylpyrrole insecticidal and acaricidal agents |
| US5254559A (en) * | 1991-12-04 | 1993-10-19 | American Cyanamid Company | Insecticidal, acaricidal and molluscicidal 1-(substituted)thioalkylpyrroles |
| DE4217722A1 (de) * | 1992-05-29 | 1993-12-02 | Bayer Ag | Substituierte 2-Arylpyrrole |
| DE4217725A1 (de) * | 1992-05-29 | 1993-12-02 | Bayer Ag | Substituierte 2-Arylpyrrole |
| WO1994005633A1 (en) * | 1992-09-01 | 1994-03-17 | Ciba-Geigy Ag | 3-cyano-4-halogeno-2-(subst.phenyl)-pyrroles as pesticides and fungicides |
| DE4233885A1 (de) * | 1992-10-08 | 1994-04-14 | Bayer Ag | Substituierte 2-Arylpyrrole |
| US5286742A (en) * | 1992-11-03 | 1994-02-15 | American Cyanamid Company | Pyrrole thiocarboxamide insecticidal and acaricidal agents |
| US5256796A (en) * | 1992-12-11 | 1993-10-26 | American Cyanamid Company | Method for the preparation of 2-aryl-5-trifluoromethylpyrrole compounds |
| US5225568A (en) * | 1992-11-25 | 1993-07-06 | American Cyanamid Company | Process for the preparation of insecticidal, acaricidal and nematicidal 2-aryl-3-substituted-5-(trifluoromethyl)pyrrole compounds |
| EP0599036B1 (en) * | 1992-11-25 | 1996-12-18 | American Cyanamid Company | Method for the preparation of 2-aryl-5-trifluoromethyl pyrrole compounds |
| US5449789A (en) * | 1992-11-30 | 1995-09-12 | American Cyanamid Company | Debrominative chlorination of pyrroles |
| US5480902A (en) * | 1993-08-31 | 1996-01-02 | American Cyanamid Company | Thienylpyrrole fungicidal agents |
| US5492925A (en) * | 1993-08-31 | 1996-02-20 | American Cyanamid Company | Thienyl-and furylpyrrole insecticidal and acaricidal agents |
| US5359090A (en) * | 1993-12-29 | 1994-10-25 | American Cyanamid Company | Alkoxymethylation of pyrroles |
| US5659046A (en) * | 1993-12-30 | 1997-08-19 | American Cyanamid Company | Method for the preparation of 2-perfluoroalkyl-3-oxazolin-5-one |
| US5426225A (en) * | 1993-12-30 | 1995-06-20 | American Cyanamid Company | Perfluoroalkanoyl aminonitriles |
| US5496845A (en) * | 1994-05-25 | 1996-03-05 | American Cyanamid Co. | Suspension concentrate compositions of arylpyrrole insecticidal and acaricidal agents |
| US6271392B1 (en) | 1994-10-07 | 2001-08-07 | Rhone-Poulenc Inc. | Intermediates useful for the synthesis of 1-arylpyrrole pesticides |
| US5453508A (en) * | 1994-10-11 | 1995-09-26 | American Cyanamid Company | Manufacture of 4-aryl-2-perfluoroalkyl-3-oxazolin-5-one from arylglycine |
| AU722204B2 (en) | 1995-10-31 | 2000-07-27 | Sumitomo Chemical Company, Limited | Pesticidal composition |
| US5908858A (en) * | 1996-04-05 | 1999-06-01 | Sankyo Company, Limited | 1,2-diphenylpyrrole derivatives, their preparation and their therapeutic uses |
| US5750726A (en) * | 1996-06-28 | 1998-05-12 | American Cyanamid Company | Process for the manufacture of 2-aryl-5-perfluoroalkylpyrrole derivatives and intermediates useful therefor |
| US5945538A (en) * | 1996-06-28 | 1999-08-31 | American Cyanamid Company | Ammonium oxazole and amino oxazolium intermediates, methods for the preparation thereof and the use therefor in the manufacture of insecticidal arylpyrroles |
| US5925773A (en) * | 1996-06-28 | 1999-07-20 | American Cyanamid Company | Ammonium oxazole and amino oxazolium intermediates, methods for the preparation thereof and the use thereof in the manufacture of insecticidal arylpyrroles |
| US5777132A (en) * | 1996-06-28 | 1998-07-07 | American Cyanamid Company | Process for the manufacture of 2-aryl-5 perfluoroalkylpyrrole derivatives |
| CZ293077B6 (cs) * | 1996-08-02 | 2004-02-18 | American Cyanamid Company | Stabilní arylpyrrolové částice, způsob jejich přípravy a kompozice tvořené suspenzním koncentrátem, obsahující tyto částice |
| US6242613B1 (en) | 1996-08-02 | 2001-06-05 | American Cyanamid Co. | Stable arylpyrrole particles, process for their preparation and suspension concentrate compositions comprising them |
| JP4126621B2 (ja) * | 1996-11-25 | 2008-07-30 | 日本農薬株式会社 | 殺虫・殺ダニ剤 |
| US5817691A (en) * | 1997-04-09 | 1998-10-06 | American Cyanamid Company | Arylthio, -sulfinyl and -sulfonyl pyrrole insecticidal agents |
| CR5809A (es) * | 1997-08-08 | 2003-10-01 | American Cyanamid Co | Arilpirroles para la proteccion del ataque de los insectos de la madera, productos de madera y estructuras con madera |
| US6077863A (en) * | 1997-08-08 | 2000-06-20 | American Cyanamid Company | 2-aryl-4-halo-5-(trifluoromethyl)pyrrole-3-carbonitriles for the protection of wood, wood products and wooden structures from insect attack |
| US6011161A (en) * | 1998-02-09 | 2000-01-04 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoroalkyl)pyrrole compounds from N-(perfluoro-alkylmethyl)arylimidoyl chloride compounds |
| US5817834A (en) * | 1998-02-09 | 1998-10-06 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoro-alkyl) pyrrole compounds from N-(perfluoroalkyl-methyl) arylimidoyl chloride compounds |
| US6133455A (en) * | 1998-02-09 | 2000-10-17 | American Cyanamid Company | Process for the preparation of 2-aryl-5(perfluoro-alkyl) pyrrole compounds from N-(arylmethylene)-1-chloro-1-(perfluoroalkyl) methylamine compounds |
| US5965773A (en) * | 1998-02-09 | 1999-10-12 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoroalkyl) pyrrole compounds from N-(perfluoroalkylmethyl) arylimidoyl chloride compounds |
| IL145254A0 (en) | 1999-03-12 | 2002-06-30 | Basf Ag | Synergistic insecticidal compositions |
| DE19953775A1 (de) | 1999-11-09 | 2001-05-10 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10007411A1 (de) * | 2000-02-18 | 2001-08-23 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| US6320059B1 (en) | 2000-03-07 | 2001-11-20 | American Cyanamid Company | Process for the preparation of 2-aryl-5-(perfluoro-alkyl) pyrrole compounds from N-[1-chloro-1-(perfluoroalkyl) methyl] arylimidoyl chloride compounds |
| DE10013914A1 (de) | 2000-03-21 | 2001-09-27 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10015310A1 (de) * | 2000-03-28 | 2001-10-04 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10017881A1 (de) * | 2000-04-11 | 2001-10-25 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10018370A1 (de) * | 2000-04-14 | 2001-10-18 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10024934A1 (de) | 2000-05-19 | 2001-11-22 | Bayer Ag | Wirkstoffkombinationen mit insektiziden akariziden Eigenschaften |
| AR029677A1 (es) * | 2000-06-29 | 2003-07-10 | Bayer Ag | Combinaciones de compuestos activos con propiedades insecticidas y acaricidas |
| DE10042736A1 (de) | 2000-08-31 | 2002-03-14 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10043610A1 (de) * | 2000-09-05 | 2002-03-14 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10055941A1 (de) | 2000-11-10 | 2002-05-23 | Bayer Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| ITMI20010446A1 (it) * | 2001-03-05 | 2002-09-05 | Isagro Ricerca Srl | Fenilpirroli ad attivita' erbicida |
| DE10319590A1 (de) | 2003-05-02 | 2004-11-18 | Bayer Cropscience Ag | Wirkstoffkombinationen mit nematiziden und insektiziden Eigenschaften basierend auf Trifluorbutenyl-Verbindungen |
| DE10319591A1 (de) | 2003-05-02 | 2004-11-18 | Bayer Cropscience Ag | Wirkstoffkombinationen mit nematiziden, insektiziden und fungiziden Eigenschaften basierend auf Trifluorbutenyl-Verbindungen |
| DE10330724A1 (de) | 2003-07-08 | 2005-01-27 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE10330723A1 (de) * | 2003-07-08 | 2005-02-03 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| DE102004021564A1 (de) | 2003-11-14 | 2005-07-07 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| DE10353281A1 (de) | 2003-11-14 | 2005-06-16 | Bayer Cropscience Ag | Wirkstoffkombination mit insektiziden und akariziden Eigenschaften |
| DE10356550A1 (de) | 2003-12-04 | 2005-07-07 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| AU2004294259C1 (en) | 2003-12-04 | 2014-07-10 | Bayer Cropscience Aktiengesellschaft | Active substance combination having insecticidal and acaricidal properties |
| CA2547989C (en) | 2003-12-04 | 2012-10-09 | Bayer Cropscience Ag | Active substance combinations having insecticidal properties |
| DE102004001271A1 (de) | 2004-01-08 | 2005-08-04 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| DE102004006324A1 (de) * | 2004-02-10 | 2005-08-25 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden Eigenschaften |
| JP2006076990A (ja) | 2004-03-12 | 2006-03-23 | Bayer Cropscience Ag | 殺虫性ベンゼンジカルボキサミド類 |
| DE102005022147A1 (de) | 2005-04-28 | 2006-11-02 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| DE102006056544A1 (de) | 2006-11-29 | 2008-06-05 | Bayer Cropscience Ag | Insektizide Wirkstoffkombinationen (Formononetin+Insektizide) |
| CA2692977A1 (en) | 2007-07-12 | 2009-01-15 | Tragara Pharmaceuticals, Inc. | Methods and compositions for the treatment of cancer, tumors, and tumor-related disorders |
| DE102007045922A1 (de) | 2007-09-26 | 2009-04-02 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| US8404260B2 (en) | 2008-04-02 | 2013-03-26 | Bayer Cropscience Lp | Synergistic pesticide compositions |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| ES2640931T3 (es) | 2009-02-25 | 2017-11-07 | Takeda Pharmaceutical Company Limited | Intermedios para uso en un procedimiento para producir compuestos de pirrol |
| EP2382865A1 (de) | 2010-04-28 | 2011-11-02 | Bayer CropScience AG | Synergistische Wirkstoffkombinationen |
| WO2011161040A1 (en) | 2010-06-21 | 2011-12-29 | Basf Se | Pesticidal composition comprising a benzoylurea compound and chlorfenapyr and their uses. |
| CR20230186A (es) | 2020-09-30 | 2023-08-24 | Control Solutions Inc | Composiciones en polvo para el control de plagas y métodos de uso |
| AU2022228427A1 (en) | 2021-03-01 | 2023-09-21 | Control Solutions, Inc. | Solid particulate pest control compositions and methods |
| CN115053908B (zh) * | 2022-05-17 | 2023-04-28 | 云南大学 | 吡咯-2-甲醛在防治植物根结线虫中的应用 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL6512721A (show.php) * | 1964-03-25 | 1966-04-13 | ||
| US3864491A (en) * | 1971-11-04 | 1975-02-04 | Sterling Drug Inc | Antibacterial and antifungal 4,5-dihalopyrrole-2-carbonitriles |
| US3963746A (en) * | 1973-03-11 | 1976-06-15 | Sterling Drug Inc. | 4,5 Dihalopyrrol 2-yl di and tri halomethyl ketones |
| DE3268983D1 (en) * | 1981-10-07 | 1986-03-20 | Meiji Seika Kaisha | Heterocyclic compounds and antibacterial and antifungal compositions containing the same as active ingredients |
| JPS58111689A (ja) * | 1981-12-23 | 1983-07-02 | Meiji Seika Kaisha Ltd | 新抗生物質ピロロマイシンeおよびその製造法 |
| US4563472A (en) * | 1982-10-06 | 1986-01-07 | Meiji Seika Kaisha, Ltd. | Iodoallyl and iodopropargyl substituted tetrazoles and anti-microbial compositions thereof |
| EP0130149B1 (de) * | 1983-06-17 | 1989-04-12 | Ciba-Geigy Ag | 3-Phenyl-4-cyanopyrrol-Derivate, Verfahren zu deren Herstellung und deren Verwendung als Mikrobizide |
| FR2569189B1 (fr) * | 1984-08-14 | 1986-12-19 | Roussel Uclaf | Nouveaux derives du pyrrole, leur procede de preparation et leur application comme pesticides |
| US4647576A (en) * | 1984-09-24 | 1987-03-03 | Warner-Lambert Company | Trans-6-[2-(substitutedpyrrol-1-yl)alkyl]-pyran-2-one inhibitors of cholesterol synthesis |
| EP0182737A3 (de) * | 1984-10-16 | 1986-10-08 | Ciba-Geigy Ag | 3-Phenylpyrrolderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Schädlingsbekämpfungsmittel |
| US4705801A (en) * | 1984-10-16 | 1987-11-10 | Ciba-Geigy Corporation | Production for producing 3-cyano-4-phenyl indoles and intermediates |
| DE3682711D1 (de) * | 1985-06-18 | 1992-01-16 | Ici Plc | Als fungizide verwendbare heterocyclische verbindungen. |
| US4705800A (en) * | 1985-06-21 | 1987-11-10 | Ciba-Geigy Corporation | Difluorbenzodioxyl cyanopyrrole microbicidal compositions |
| JPH0650637B2 (ja) * | 1985-10-25 | 1994-06-29 | 三洋電機株式会社 | 二次電池 |
| EP0300688A1 (en) * | 1987-07-21 | 1989-01-25 | FISONS plc | Pyrrole derivatives, process for their preparation and pharmaceutical compositions containing them |
-
1988
- 1988-06-23 US US07/208,841 patent/US5010098A/en not_active Expired - Lifetime
- 1988-07-29 PH PH37318A patent/PH25760A/en unknown
- 1988-08-05 ES ES88112810T patent/ES2053641T3/es not_active Expired - Lifetime
- 1988-08-05 DE DE3889909T patent/DE3889909T2/de not_active Expired - Lifetime
- 1988-08-05 AT AT88112810T patent/ATE106392T1/de not_active IP Right Cessation
- 1988-08-05 EP EP88112810A patent/EP0347488B1/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE3889909T2 (de) | 1995-01-19 |
| EP0347488A1 (en) | 1989-12-27 |
| HK1001059A1 (en) | 1998-05-22 |
| PH25760A (show.php) | 1991-10-18 |
| ATE106392T1 (de) | 1994-06-15 |
| EP0347488B1 (en) | 1994-06-01 |
| DE3889909D1 (de) | 1994-07-07 |
| US5010098A (en) | 1991-04-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2053641T3 (es) | Agentes insecticidas, acaricidas y nematicidas de arilpirrol y metodo para su preparacion. | |
| MX185699B (es) | N-acetonilbenzamidas y su uso como fungicidas. | |
| MY104174A (en) | Insecticidal compounds. | |
| MY101877A (en) | Benzoylurea compounds and pesticidal and pharmaceutical compositions comprising same | |
| MY101140A (en) | Benzoylurea compounds, and pesticidal and pharmaceutical compositions comprising same | |
| ES552975A0 (es) | Un procedimiento para la preparacion de derivados de triazol con actividad antifungica. | |
| BR9006417A (pt) | Composto,processo para a preparacao do mesmo,composicao herbicida e processo para combater o crescimento indesejado de plantas | |
| MY116103A (en) | Pyridine-2, 3-dicarboxylic acid diamide derivatives and herbicides comprising said derivatives as active ingredient | |
| PT99703A (pt) | Processo para a preparacao de compostos 2-halo-3-substituido-5-arilpirrole insecticidas nematicidas e acaricidas | |
| GB1483617A (en) | Pesticidal thiophosphoric acid esteramides | |
| AR008278A1 (es) | Proceso para la preparación de partículas de arilpirrol, partículas de arilpirrol estables, composiciones, y composiciones de concentrado en suspensión. | |
| HUT48091A (en) | Herbicides comprising oximino ether derivatives as active ingredient and process for producing the active ingredients | |
| ES2115602T3 (es) | Procedimiento para la preparacion de compuestos de 2-halopirrol-3-carbonitrilo insecticidas, acaricidas y molusquicidas. | |
| IL68418A0 (en) | 2,2-dihalogeno-3,3-dimethylcyclopropane derivatives,their preparation and their use as fungicides | |
| ES2070200T3 (es) | Derivados hetero-aril-buteno y -butano, procedimiento para su obtencion, productos que los contienen y uso de los mismos como productos plaguicidas. | |
| DE68901528D1 (de) | Heterozyklische pestizide verbindungen. | |
| DK0381291T3 (da) | Oximino-etherforbindelser | |
| RU2000112900A (ru) | Производные бензамидоксимов, промежуточные продукты и способ их получения и их применение в качестве фунгицидов |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG2A | Definitive protection |
Ref document number: 347488 Country of ref document: ES |