EA030196B1 - Ингибиторы энхансера zeste гомолога 2 - Google Patents
Ингибиторы энхансера zeste гомолога 2 Download PDFInfo
- Publication number
- EA030196B1 EA030196B1 EA201592068A EA201592068A EA030196B1 EA 030196 B1 EA030196 B1 EA 030196B1 EA 201592068 A EA201592068 A EA 201592068A EA 201592068 A EA201592068 A EA 201592068A EA 030196 B1 EA030196 B1 EA 030196B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- methyl
- alkyl
- oxo
- dihydropyridin
- dimethyl
- Prior art date
Links
- 239000003112 inhibitor Substances 0.000 title abstract description 34
- 102000058017 Enhancer of Zeste Homolog 2 Human genes 0.000 title abstract 3
- 101710196274 Histone-lysine N-methyltransferase EZH2 Proteins 0.000 title abstract 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 223
- -1 (4,6-dimethyl-2-oxo-1,2-dihydropyridin-3-yl) methyl Chemical group 0.000 claims description 418
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 139
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 111
- 229910052736 halogen Inorganic materials 0.000 claims description 76
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 74
- 229910052739 hydrogen Inorganic materials 0.000 claims description 74
- 239000001257 hydrogen Substances 0.000 claims description 74
- 125000000217 alkyl group Chemical group 0.000 claims description 64
- 150000003839 salts Chemical class 0.000 claims description 63
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 60
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 54
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 53
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 52
- 150000002367 halogens Chemical class 0.000 claims description 50
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 46
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 45
- DAUYIKBTMNZABP-UHFFFAOYSA-N thiophene-3-carboxamide Chemical compound NC(=O)C=1C=CSC=1 DAUYIKBTMNZABP-UHFFFAOYSA-N 0.000 claims description 33
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 32
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 26
- 229910052760 oxygen Inorganic materials 0.000 claims description 21
- 150000002431 hydrogen Chemical class 0.000 claims description 18
- 239000001301 oxygen Substances 0.000 claims description 18
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 18
- 125000003386 piperidinyl group Chemical group 0.000 claims description 17
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 16
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000005842 heteroatom Chemical group 0.000 claims description 15
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 claims description 14
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 claims description 13
- 229910052717 sulfur Inorganic materials 0.000 claims description 13
- 239000011593 sulfur Substances 0.000 claims description 13
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 125000002541 furyl group Chemical group 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 10
- 125000002757 morpholinyl group Chemical group 0.000 claims description 10
- 125000004193 piperazinyl group Chemical group 0.000 claims description 10
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 9
- 125000006238 prop-1-en-1-yl group Chemical group [H]\C(*)=C(/[H])C([H])([H])[H] 0.000 claims description 9
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 6
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 125000006376 (C3-C10) cycloalkyl group Chemical group 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- ISUJAGQKWSTODG-UHFFFAOYSA-N tert-butyl 4-[1-[4-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methylcarbamoyl]-3-methylthiophen-2-yl]propyl]piperidine-1-carboxylate Chemical compound S1C=C(C(=O)NCC=2C(NC(C)=CC=2C)=O)C(C)=C1C(CC)C1CCN(C(=O)OC(C)(C)C)CC1 ISUJAGQKWSTODG-UHFFFAOYSA-N 0.000 claims description 2
- FRTKPKWRJMIGMN-UHFFFAOYSA-N 2-cyano-n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxamide Chemical compound S1C(C#N)=C(C(=O)NCC=2C(NC(C)=CC=2C)=O)C(C)=C1N(CC)C1CCOCC1 FRTKPKWRJMIGMN-UHFFFAOYSA-N 0.000 claims 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 claims 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims 1
- AHMAQXSPEKRSCD-UHFFFAOYSA-N tert-butyl 3-[3-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methylcarbamoyl]-5-[ethyl(oxan-4-yl)amino]-4-methylthiophen-2-yl]pyrrolidine-1-carboxylate Chemical compound S1C(C2CN(CC2)C(=O)OC(C)(C)C)=C(C(=O)NCC=2C(NC(C)=CC=2C)=O)C(C)=C1N(CC)C1CCOCC1 AHMAQXSPEKRSCD-UHFFFAOYSA-N 0.000 claims 1
- 238000000034 method Methods 0.000 abstract description 65
- 206010028980 Neoplasm Diseases 0.000 abstract description 47
- 238000011282 treatment Methods 0.000 abstract description 47
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 25
- 201000011510 cancer Diseases 0.000 abstract description 22
- 238000002360 preparation method Methods 0.000 abstract description 10
- 238000002560 therapeutic procedure Methods 0.000 abstract description 8
- 230000008569 process Effects 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 358
- 239000000243 solution Substances 0.000 description 236
- 239000000203 mixture Substances 0.000 description 215
- 239000011541 reaction mixture Substances 0.000 description 191
- 238000005481 NMR spectroscopy Methods 0.000 description 141
- 239000007787 solid Substances 0.000 description 140
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 125
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 117
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 110
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 61
- 235000002639 sodium chloride Nutrition 0.000 description 54
- 239000000741 silica gel Substances 0.000 description 51
- 229910002027 silica gel Inorganic materials 0.000 description 51
- 238000006243 chemical reaction Methods 0.000 description 49
- 125000001072 heteroaryl group Chemical group 0.000 description 49
- 239000000126 substance Substances 0.000 description 45
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 44
- 125000003118 aryl group Chemical group 0.000 description 42
- 239000012044 organic layer Substances 0.000 description 42
- 239000000725 suspension Substances 0.000 description 41
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 41
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 40
- 238000004587 chromatography analysis Methods 0.000 description 37
- 239000012071 phase Substances 0.000 description 37
- 230000000694 effects Effects 0.000 description 35
- 239000003921 oil Substances 0.000 description 35
- 235000019198 oils Nutrition 0.000 description 33
- 239000012267 brine Substances 0.000 description 32
- 239000003795 chemical substances by application Substances 0.000 description 31
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 30
- 229910052700 potassium Inorganic materials 0.000 description 29
- 239000000047 product Substances 0.000 description 29
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 26
- 238000000746 purification Methods 0.000 description 25
- 239000000377 silicon dioxide Substances 0.000 description 24
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 23
- 239000002246 antineoplastic agent Substances 0.000 description 22
- 150000002989 phenols Chemical class 0.000 description 21
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 20
- 210000004027 cell Anatomy 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 239000000546 pharmaceutical excipient Substances 0.000 description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 19
- 239000003826 tablet Substances 0.000 description 19
- 108020004414 DNA Proteins 0.000 description 18
- 238000002347 injection Methods 0.000 description 18
- 239000007924 injection Substances 0.000 description 18
- 239000011734 sodium Substances 0.000 description 18
- ZMDPNGUJHPRAMG-UHFFFAOYSA-N 3-(aminomethyl)-4,6-dimethyl-1h-pyridin-2-one;hydrochloride Chemical compound Cl.CC1=CC(C)=C(CN)C(=O)N1 ZMDPNGUJHPRAMG-UHFFFAOYSA-N 0.000 description 17
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 17
- 230000015572 biosynthetic process Effects 0.000 description 17
- 239000000843 powder Substances 0.000 description 17
- 239000012047 saturated solution Substances 0.000 description 17
- 239000007788 liquid Substances 0.000 description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 16
- 238000004007 reversed phase HPLC Methods 0.000 description 16
- 229920006395 saturated elastomer Polymers 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- 238000003786 synthesis reaction Methods 0.000 description 16
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 15
- 206010065553 Bone marrow failure Diseases 0.000 description 15
- 239000007864 aqueous solution Substances 0.000 description 15
- 239000002552 dosage form Substances 0.000 description 15
- 238000004128 high performance liquid chromatography Methods 0.000 description 15
- 239000000543 intermediate Substances 0.000 description 15
- 239000010410 layer Substances 0.000 description 15
- FCKSGPKSSPUXOP-UHFFFAOYSA-N methyl 4-methylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC=C1C FCKSGPKSSPUXOP-UHFFFAOYSA-N 0.000 description 15
- 125000002971 oxazolyl group Chemical group 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 13
- 239000004480 active ingredient Substances 0.000 description 13
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 13
- 239000003814 drug Substances 0.000 description 13
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 12
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 12
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 102100037580 Sesquipedalian-1 Human genes 0.000 description 12
- 101710169844 Sesquipedalian-1 Proteins 0.000 description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 12
- 239000012299 nitrogen atmosphere Substances 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 206010006187 Breast cancer Diseases 0.000 description 11
- 206010025323 Lymphomas Diseases 0.000 description 11
- 150000001412 amines Chemical class 0.000 description 11
- 238000004440 column chromatography Methods 0.000 description 11
- 229940127089 cytotoxic agent Drugs 0.000 description 11
- 125000004043 oxo group Chemical group O=* 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- WYWHKKSPHMUBEB-UHFFFAOYSA-N tioguanine Chemical compound N1C(N)=NC(=S)C2=C1N=CN2 WYWHKKSPHMUBEB-UHFFFAOYSA-N 0.000 description 11
- 208000026310 Breast neoplasm Diseases 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 229910052786 argon Inorganic materials 0.000 description 10
- 239000012298 atmosphere Substances 0.000 description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 10
- 229940079593 drug Drugs 0.000 description 10
- 239000012458 free base Substances 0.000 description 10
- 230000002401 inhibitory effect Effects 0.000 description 10
- IUYHWZFSGMZEOG-UHFFFAOYSA-M magnesium;propane;chloride Chemical compound [Mg+2].[Cl-].C[CH-]C IUYHWZFSGMZEOG-UHFFFAOYSA-M 0.000 description 10
- MBNIQASQLNRJAV-UHFFFAOYSA-N methyl 5-iodo-4-methylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC(I)=C1C MBNIQASQLNRJAV-UHFFFAOYSA-N 0.000 description 10
- PCJPGNCABBDNJU-UHFFFAOYSA-N 3-(aminomethyl)-4,6-dimethyl-1h-pyridin-2-one Chemical compound CC1=CC(C)=C(CN)C(=O)N1 PCJPGNCABBDNJU-UHFFFAOYSA-N 0.000 description 9
- 108010033040 Histones Proteins 0.000 description 9
- 206010039491 Sarcoma Diseases 0.000 description 9
- 125000004429 atom Chemical group 0.000 description 9
- 239000002775 capsule Substances 0.000 description 9
- 210000003238 esophagus Anatomy 0.000 description 9
- 230000006870 function Effects 0.000 description 9
- 208000005017 glioblastoma Diseases 0.000 description 9
- 239000000314 lubricant Substances 0.000 description 9
- 230000001404 mediated effect Effects 0.000 description 9
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 8
- 125000006564 (C4-C8) cycloalkyl group Chemical group 0.000 description 8
- 201000009030 Carcinoma Diseases 0.000 description 8
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 8
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 8
- 102000006947 Histones Human genes 0.000 description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- RJURFGZVJUQBHK-UHFFFAOYSA-N actinomycin D Natural products CC1OC(=O)C(C(C)C)N(C)C(=O)CN(C)C(=O)C2CCCN2C(=O)C(C(C)C)NC(=O)C1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)NC4C(=O)NC(C(N5CCCC5C(=O)N(C)CC(=O)N(C)C(C(C)C)C(=O)OC4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-UHFFFAOYSA-N 0.000 description 8
- 150000001602 bicycloalkyls Chemical group 0.000 description 8
- 239000011230 binding agent Substances 0.000 description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- 238000000576 coating method Methods 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- 238000003818 flash chromatography Methods 0.000 description 8
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- CQZPEBDZIWYWEL-UHFFFAOYSA-N methyl 5-amino-4-methylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC(N)=C1C CQZPEBDZIWYWEL-UHFFFAOYSA-N 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- 108090000623 proteins and genes Proteins 0.000 description 8
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 7
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 7
- 108010092160 Dactinomycin Proteins 0.000 description 7
- 208000017604 Hodgkin disease Diseases 0.000 description 7
- 208000009956 adenocarcinoma Diseases 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 239000012300 argon atmosphere Substances 0.000 description 7
- 150000001721 carbon Chemical group 0.000 description 7
- 230000030833 cell death Effects 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 7
- 201000010099 disease Diseases 0.000 description 7
- 150000002148 esters Chemical class 0.000 description 7
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 description 7
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 7
- 239000012535 impurity Substances 0.000 description 7
- 125000001786 isothiazolyl group Chemical group 0.000 description 7
- 125000000842 isoxazolyl group Chemical group 0.000 description 7
- 201000002364 leukopenia Diseases 0.000 description 7
- 231100001022 leukopenia Toxicity 0.000 description 7
- MQSUJFMBRLFJQD-UHFFFAOYSA-N methyl 5-[1-[4-(dimethylamino)piperidin-1-yl]propyl]-4-methylthiophene-3-carboxylate Chemical compound CCC(N1CCC(CC1)N(C)C)c1scc(C(=O)OC)c1C MQSUJFMBRLFJQD-UHFFFAOYSA-N 0.000 description 7
- 230000019491 signal transduction Effects 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHDGCWIWMRVCDJ-CCXZUQQUSA-N Cytarabine Chemical compound O=C1N=C(N)C=CN1[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O1 UHDGCWIWMRVCDJ-CCXZUQQUSA-N 0.000 description 6
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 6
- 102000029749 Microtubule Human genes 0.000 description 6
- 108091022875 Microtubule Proteins 0.000 description 6
- 206010033128 Ovarian cancer Diseases 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229940122803 Vinca alkaloid Drugs 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 230000022131 cell cycle Effects 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 6
- 229960004316 cisplatin Drugs 0.000 description 6
- 229960000684 cytarabine Drugs 0.000 description 6
- 208000035475 disorder Diseases 0.000 description 6
- 150000004141 diterpene derivatives Chemical class 0.000 description 6
- 229960002949 fluorouracil Drugs 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- 229960005277 gemcitabine Drugs 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 125000002883 imidazolyl group Chemical group 0.000 description 6
- 229960004768 irinotecan Drugs 0.000 description 6
- GURKHSYORGJETM-WAQYZQTGSA-N irinotecan hydrochloride (anhydrous) Chemical compound Cl.C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 GURKHSYORGJETM-WAQYZQTGSA-N 0.000 description 6
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 6
- 210000004688 microtubule Anatomy 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 125000003373 pyrazinyl group Chemical group 0.000 description 6
- 125000004076 pyridyl group Chemical group 0.000 description 6
- 125000000714 pyrimidinyl group Chemical group 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 235000000346 sugar Nutrition 0.000 description 6
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 description 6
- 125000003831 tetrazolyl group Chemical group 0.000 description 6
- 125000001544 thienyl group Chemical group 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 206010043554 thrombocytopenia Diseases 0.000 description 6
- 125000001425 triazolyl group Chemical group 0.000 description 6
- 239000001993 wax Substances 0.000 description 6
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 5
- DGHHQBMTXTWTJV-BQAIUKQQSA-N 119413-54-6 Chemical compound Cl.C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 DGHHQBMTXTWTJV-BQAIUKQQSA-N 0.000 description 5
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 5
- XHROKJJCFRMCBT-UHFFFAOYSA-N 5-[[4-(dimethylamino)cyclohexyl]-ethylamino]-n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-4-methylthiophene-3-carboxamide Chemical compound S1C=C(C(=O)NCC=2C(NC(C)=CC=2C)=O)C(C)=C1N(CC)C1CCC(N(C)C)CC1 XHROKJJCFRMCBT-UHFFFAOYSA-N 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 5
- 206010000830 Acute leukaemia Diseases 0.000 description 5
- 108010006654 Bleomycin Proteins 0.000 description 5
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 5
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 description 5
- 230000006820 DNA synthesis Effects 0.000 description 5
- 102100029721 DnaJ homolog subfamily B member 1 Human genes 0.000 description 5
- 108010010803 Gelatin Proteins 0.000 description 5
- 208000010747 Hodgkins lymphoma Diseases 0.000 description 5
- 101000866018 Homo sapiens DnaJ homolog subfamily B member 1 Proteins 0.000 description 5
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 5
- 208000034578 Multiple myelomas Diseases 0.000 description 5
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 description 5
- 229930012538 Paclitaxel Natural products 0.000 description 5
- 206010035226 Plasma cell myeloma Diseases 0.000 description 5
- 150000001336 alkenes Chemical class 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 5
- 239000002168 alkylating agent Substances 0.000 description 5
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 5
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 210000001185 bone marrow Anatomy 0.000 description 5
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical compound C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 238000002648 combination therapy Methods 0.000 description 5
- 229960003668 docetaxel Drugs 0.000 description 5
- 238000011049 filling Methods 0.000 description 5
- 239000000499 gel Substances 0.000 description 5
- 239000008273 gelatin Substances 0.000 description 5
- 229920000159 gelatin Polymers 0.000 description 5
- 235000019322 gelatine Nutrition 0.000 description 5
- 235000011852 gelatine desserts Nutrition 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 5
- 230000014759 maintenance of location Effects 0.000 description 5
- 230000007246 mechanism Effects 0.000 description 5
- 229960001428 mercaptopurine Drugs 0.000 description 5
- 229960000485 methotrexate Drugs 0.000 description 5
- KKVQOGKNTIPURG-UHFFFAOYSA-N methyl 2-bromo-5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylate Chemical compound CCN(C1CCOCC1)c1sc(Br)c(C(=O)OC)c1C KKVQOGKNTIPURG-UHFFFAOYSA-N 0.000 description 5
- ILXOPPNQRPAUJA-UHFFFAOYSA-N methyl 5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylate Chemical compound CCN(C1CCOCC1)c1scc(C(=O)OC)c1C ILXOPPNQRPAUJA-UHFFFAOYSA-N 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 5
- 125000001715 oxadiazolyl group Chemical group 0.000 description 5
- 229960001592 paclitaxel Drugs 0.000 description 5
- 238000002638 palliative care Methods 0.000 description 5
- 238000002953 preparative HPLC Methods 0.000 description 5
- 210000002307 prostate Anatomy 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- 230000002441 reversible effect Effects 0.000 description 5
- 238000007127 saponification reaction Methods 0.000 description 5
- 235000012239 silicon dioxide Nutrition 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 230000001629 suppression Effects 0.000 description 5
- 239000006188 syrup Substances 0.000 description 5
- 235000020357 syrup Nutrition 0.000 description 5
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 description 5
- 229960001278 teniposide Drugs 0.000 description 5
- HFPTVKCVVCVGRX-UHFFFAOYSA-N tert-butyl 4-[hydroxy-(4-methoxycarbonyl-3-methylthiophen-2-yl)methyl]piperidine-1-carboxylate Chemical compound COC(=O)c1csc(C(O)C2CCN(CC2)C(=O)OC(C)(C)C)c1C HFPTVKCVVCVGRX-UHFFFAOYSA-N 0.000 description 5
- 229960003087 tioguanine Drugs 0.000 description 5
- 229960000303 topotecan Drugs 0.000 description 5
- 125000006582 (C5-C6) heterocycloalkyl group Chemical group 0.000 description 4
- BVVHNDKLDKPYCI-UHFFFAOYSA-N 1,2-dimethylpiperidin-4-amine Chemical compound CC1CC(N)CCN1C BVVHNDKLDKPYCI-UHFFFAOYSA-N 0.000 description 4
- XFFFLLBGIZETLB-UHFFFAOYSA-N 3-(aminomethyl)-1,4,6-trimethylpyridin-2-one hydrochloride Chemical compound Cl.Cc1cc(C)n(C)c(=O)c1CN XFFFLLBGIZETLB-UHFFFAOYSA-N 0.000 description 4
- RCXNMZXMDKINRV-UHFFFAOYSA-N 5-[[4-(dimethylamino)cyclohexyl]-ethylamino]-4-methylthiophene-3-carboxylic acid Chemical compound CCN(C1CCC(CC1)N(C)C)c1scc(C(O)=O)c1C RCXNMZXMDKINRV-UHFFFAOYSA-N 0.000 description 4
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 description 4
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 4
- 229920001817 Agar Polymers 0.000 description 4
- IDUHGUNBWPHVAI-ORXZLVCASA-N CCC([C@H]1CC[C@@H](CC1)N(C)C)c1scc(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C Chemical compound CCC([C@H]1CC[C@@H](CC1)N(C)C)c1scc(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C IDUHGUNBWPHVAI-ORXZLVCASA-N 0.000 description 4
- KCDCTRRFNHNAFI-MRJYIUEKSA-N CCC([C@H]1CC[C@@H](CC1)NC(=O)OC(C)(C)C)c1scc(C(=O)OC)c1C Chemical compound CCC([C@H]1CC[C@@H](CC1)NC(=O)OC(C)(C)C)c1scc(C(=O)OC)c1C KCDCTRRFNHNAFI-MRJYIUEKSA-N 0.000 description 4
- SAXCTRDTDXBDBL-JOQLWKCKSA-N COC(=O)c1csc(C(O)[C@H]2CC[C@@H](CC2)NC(=O)OC(C)(C)C)c1C Chemical compound COC(=O)c1csc(C(O)[C@H]2CC[C@@H](CC2)NC(=O)OC(C)(C)C)c1C SAXCTRDTDXBDBL-JOQLWKCKSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 4
- AIIOKHOKGAEZOV-HFCKKAISSA-N Cc1c(C(=O)OC)csc1\C(=C\C)[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1 Chemical compound Cc1c(C(=O)OC)csc1\C(=C\C)[C@H]1CC[C@H](NC(=O)OC(C)(C)C)CC1 AIIOKHOKGAEZOV-HFCKKAISSA-N 0.000 description 4
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 4
- 102000003915 DNA Topoisomerases Human genes 0.000 description 4
- 108090000323 DNA Topoisomerases Proteins 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Divinylene sulfide Natural products C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 206010024612 Lipoma Diseases 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 229910017976 MgO 4 Inorganic materials 0.000 description 4
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 4
- 206010061535 Ovarian neoplasm Diseases 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 102000004243 Tubulin Human genes 0.000 description 4
- 108090000704 Tubulin Proteins 0.000 description 4
- RJURFGZVJUQBHK-IIXSONLDSA-N actinomycin D Chemical compound C[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)CN(C)C(=O)[C@@H]2CCCN2C(=O)[C@@H](C(C)C)NC(=O)[C@H]1NC(=O)C1=C(N)C(=O)C(C)=C2OC(C(C)=CC=C3C(=O)N[C@@H]4C(=O)N[C@@H](C(N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)=O)C(C)C)=C3N=C21 RJURFGZVJUQBHK-IIXSONLDSA-N 0.000 description 4
- 235000010419 agar Nutrition 0.000 description 4
- 208000007502 anemia Diseases 0.000 description 4
- 230000033115 angiogenesis Effects 0.000 description 4
- 230000000340 anti-metabolite Effects 0.000 description 4
- 229940100197 antimetabolite Drugs 0.000 description 4
- 239000002256 antimetabolite Substances 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical compound [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 description 4
- 235000012216 bentonite Nutrition 0.000 description 4
- 239000000440 bentonite Substances 0.000 description 4
- 229910000278 bentonite Inorganic materials 0.000 description 4
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 4
- 229960001561 bleomycin Drugs 0.000 description 4
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 4
- 210000004556 brain Anatomy 0.000 description 4
- 210000000481 breast Anatomy 0.000 description 4
- 229960004562 carboplatin Drugs 0.000 description 4
- 239000001768 carboxy methyl cellulose Substances 0.000 description 4
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 4
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 4
- 229960005243 carmustine Drugs 0.000 description 4
- 230000001413 cellular effect Effects 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 229960004630 chlorambucil Drugs 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 229960004397 cyclophosphamide Drugs 0.000 description 4
- 229960003901 dacarbazine Drugs 0.000 description 4
- 229960000640 dactinomycin Drugs 0.000 description 4
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 description 4
- 229960000975 daunorubicin Drugs 0.000 description 4
- 238000001514 detection method Methods 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 239000007884 disintegrant Substances 0.000 description 4
- 229960004679 doxorubicin Drugs 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 4
- 229960005420 etoposide Drugs 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- SGDBTWWWUNNDEQ-LBPRGKRZSA-N melphalan Chemical compound OC(=O)[C@@H](N)CC1=CC=C(N(CCCl)CCCl)C=C1 SGDBTWWWUNNDEQ-LBPRGKRZSA-N 0.000 description 4
- 229960001924 melphalan Drugs 0.000 description 4
- AYSPSKFMQGCFBG-UHFFFAOYSA-N methyl 2-bromo-5-[[4-(dimethylamino)cyclohexyl]-ethylamino]-4-methylthiophene-3-carboxylate Chemical compound CCN(C1CCC(CC1)N(C)C)c1sc(Br)c(C(=O)OC)c1C AYSPSKFMQGCFBG-UHFFFAOYSA-N 0.000 description 4
- NTYZTQQHTCEMPU-UHFFFAOYSA-N methyl 4-[ethyl(oxan-4-yl)amino]-3-methylthiophene-2-carboxylate Chemical compound CCN(C1CCOCC1)c1csc(C(=O)OC)c1C NTYZTQQHTCEMPU-UHFFFAOYSA-N 0.000 description 4
- YRIRKBDOBLYWCY-UHFFFAOYSA-N methyl 4-amino-3-methylthiophene-2-carboxylate Chemical compound COC(=O)c1scc(N)c1C YRIRKBDOBLYWCY-UHFFFAOYSA-N 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- DYUMLJSJISTVPV-UHFFFAOYSA-N phenyl propanoate Chemical class CCC(=O)OC1=CC=CC=C1 DYUMLJSJISTVPV-UHFFFAOYSA-N 0.000 description 4
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000003755 preservative agent Substances 0.000 description 4
- 230000035755 proliferation Effects 0.000 description 4
- UCIWHYOLUNVRJP-UHFFFAOYSA-N prop-1-enyl trifluoromethanesulfonate Chemical compound CC=COS(=O)(=O)C(F)(F)F UCIWHYOLUNVRJP-UHFFFAOYSA-N 0.000 description 4
- 125000002098 pyridazinyl group Chemical group 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 125000000168 pyrrolyl group Chemical group 0.000 description 4
- 206010041823 squamous cell carcinoma Diseases 0.000 description 4
- 150000008163 sugars Chemical class 0.000 description 4
- 230000004083 survival effect Effects 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 description 4
- 125000000335 thiazolyl group Chemical group 0.000 description 4
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 4
- 125000004306 triazinyl group Chemical group 0.000 description 4
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 4
- 229960004528 vincristine Drugs 0.000 description 4
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 4
- FKBHRUQOROFRGD-IELIFDKJSA-N vinorelbine Chemical compound C1N(CC=2[C]3C=CC=CC3=NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC FKBHRUQOROFRGD-IELIFDKJSA-N 0.000 description 4
- 229960002066 vinorelbine Drugs 0.000 description 4
- 239000003039 volatile agent Substances 0.000 description 4
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 description 3
- UAWDKMRDEOZXDX-UHFFFAOYSA-N 2,4-dimethoxy-6-methylpyridine-3-carbonitrile Chemical compound COC1=CC(C)=NC(OC)=C1C#N UAWDKMRDEOZXDX-UHFFFAOYSA-N 0.000 description 3
- LGUXSTAZEGBINJ-UHFFFAOYSA-N 2-bromo-5-(diethylamino)-4-methylthiophene-3-carboxylic acid Chemical compound CCN(CC)c1sc(Br)c(C(O)=O)c1C LGUXSTAZEGBINJ-UHFFFAOYSA-N 0.000 description 3
- DLGUGHVRKSRQGE-UHFFFAOYSA-N 2-chloro-5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylic acid Chemical compound CCN(C1CCOCC1)c1sc(Cl)c(C(O)=O)c1C DLGUGHVRKSRQGE-UHFFFAOYSA-N 0.000 description 3
- VUVUPVFBHQFTPZ-UHFFFAOYSA-N 2-cyano-5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylic acid Chemical compound CCN(C1CCOCC1)c1sc(C#N)c(C(O)=O)c1C VUVUPVFBHQFTPZ-UHFFFAOYSA-N 0.000 description 3
- ZBAMKZKIRUUXSL-UHFFFAOYSA-N 3-(aminomethyl)-4-methoxy-6-methyl-1h-pyridin-2-one;hydrochloride Chemical compound Cl.COC=1C=C(C)NC(=O)C=1CN ZBAMKZKIRUUXSL-UHFFFAOYSA-N 0.000 description 3
- LMBFUMXVHAJSNJ-UHFFFAOYSA-N 4-(dimethylamino)cyclohexan-1-one Chemical compound CN(C)C1CCC(=O)CC1 LMBFUMXVHAJSNJ-UHFFFAOYSA-N 0.000 description 3
- WOBFDEIRBQPEIG-UHFFFAOYSA-N 4-methyl-5-(2-methylpyrrolidin-1-yl)thiophene-3-carboxylic acid Chemical compound CC1CCCN1c1scc(C(O)=O)c1C WOBFDEIRBQPEIG-UHFFFAOYSA-N 0.000 description 3
- VIWQDZXKKOQDTB-UHFFFAOYSA-N 4-methyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]thiophene-3-carboxylic acid Chemical compound Cc1c(scc1C(O)=O)C1CCN(C1)C(=O)OC(C)(C)C VIWQDZXKKOQDTB-UHFFFAOYSA-N 0.000 description 3
- COZGGBVQPZPQFX-UHFFFAOYSA-N 5-[ethyl(oxan-4-yl)amino]-1,4-dimethylpyrazole-3-carboxylic acid Chemical compound CCN(C1CCOCC1)c1c(C)c(nn1C)C(O)=O COZGGBVQPZPQFX-UHFFFAOYSA-N 0.000 description 3
- ZOVDMQIGZGEXDX-UHFFFAOYSA-N 5-[ethyl(oxan-4-yl)amino]-2,4-dimethylthiophene-3-carboxylic acid Chemical compound CCN(C1CCOCC1)c1sc(C)c(C(O)=O)c1C ZOVDMQIGZGEXDX-UHFFFAOYSA-N 0.000 description 3
- CQIQPABTDAYBGE-UHFFFAOYSA-N 5-[ethyl(oxan-4-yl)amino]-4-methyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxylic acid Chemical compound CCN(C1CCOCC1)c1sc(N2CCN(C)CC2)c(C(O)=O)c1C CQIQPABTDAYBGE-UHFFFAOYSA-N 0.000 description 3
- VZKAGIMBGYYFJQ-UHFFFAOYSA-N 5-[ethyl(oxan-4-yl)amino]thiophene-2-carboxylic acid Chemical compound CCN(C1CCOCC1)c1ccc(s1)C(O)=O VZKAGIMBGYYFJQ-UHFFFAOYSA-N 0.000 description 3
- NMUSYJAQQFHJEW-KVTDHHQDSA-N 5-azacytidine Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-KVTDHHQDSA-N 0.000 description 3
- XXEAVIQHEGQVSD-UHFFFAOYSA-N 6-methyl-2-oxo-4-propyl-1h-pyridine-3-carbonitrile Chemical compound CCCC=1C=C(C)NC(=O)C=1C#N XXEAVIQHEGQVSD-UHFFFAOYSA-N 0.000 description 3
- 244000215068 Acacia senegal Species 0.000 description 3
- VVPHGWHNCRCJBJ-YEFDVDDDSA-N CCC([C@H]1CC[C@@H](CC1)N(C)C)c1scc(C(=O)OC)c1C Chemical compound CCC([C@H]1CC[C@@H](CC1)N(C)C)c1scc(C(=O)OC)c1C VVPHGWHNCRCJBJ-YEFDVDDDSA-N 0.000 description 3
- YTCDDVHOZLILNH-HDJSIYSDSA-N CN([C@@H]1CC[C@H](CC1)N(C=1C(=C(SC1)C(=O)OC)C)CC)C Chemical compound CN([C@@H]1CC[C@H](CC1)N(C=1C(=C(SC1)C(=O)OC)C)CC)C YTCDDVHOZLILNH-HDJSIYSDSA-N 0.000 description 3
- YTCDDVHOZLILNH-OKILXGFUSA-N CN([C@H]1CC[C@H](CC1)N(C=1C(=C(SC1)C(=O)OC)C)CC)C Chemical compound CN([C@H]1CC[C@H](CC1)N(C=1C(=C(SC1)C(=O)OC)C)CC)C YTCDDVHOZLILNH-OKILXGFUSA-N 0.000 description 3
- MOQQINCGKBJCCL-JOCQHMNTSA-N COC(=O)c1csc(C(=O)[C@H]2CC[C@@H](CC2)NC(=O)OC(C)(C)C)c1C Chemical compound COC(=O)c1csc(C(=O)[C@H]2CC[C@@H](CC2)NC(=O)OC(C)(C)C)c1C MOQQINCGKBJCCL-JOCQHMNTSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 3
- DYHSDKLCOJIUFX-UHFFFAOYSA-N Di-tert-butyl dicarbonate Substances CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 208000032612 Glial tumor Diseases 0.000 description 3
- 206010018338 Glioma Diseases 0.000 description 3
- 229920000084 Gum arabic Polymers 0.000 description 3
- 208000007766 Kaposi sarcoma Diseases 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 206010028116 Mucosal inflammation Diseases 0.000 description 3
- 201000010927 Mucositis Diseases 0.000 description 3
- 206010028813 Nausea Diseases 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 208000024313 Testicular Neoplasms Diseases 0.000 description 3
- 206010057644 Testis cancer Diseases 0.000 description 3
- 101710183280 Topoisomerase Proteins 0.000 description 3
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 description 3
- 206010047700 Vomiting Diseases 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 235000010489 acacia gum Nutrition 0.000 description 3
- 239000000205 acacia gum Substances 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229930183665 actinomycin Natural products 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 230000000259 anti-tumor effect Effects 0.000 description 3
- 229960002756 azacitidine Drugs 0.000 description 3
- 125000002393 azetidinyl group Chemical group 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 201000002143 bronchus adenoma Diseases 0.000 description 3
- 229960002092 busulfan Drugs 0.000 description 3
- 229940127093 camptothecin Drugs 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 230000004663 cell proliferation Effects 0.000 description 3
- 210000000038 chest Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000011260 co-administration Methods 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- 125000000000 cycloalkoxy group Chemical group 0.000 description 3
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 3
- 125000005043 dihydropyranyl group Chemical group O1C(CCC=C1)* 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- ZXKRFHYXZHNKJQ-UHFFFAOYSA-N ethyl 5-[ethyl(oxan-4-yl)amino]-1,4-dimethylpyrazole-3-carboxylate Chemical compound CCOC(=O)c1nn(C)c(N(CC)C2CCOCC2)c1C ZXKRFHYXZHNKJQ-UHFFFAOYSA-N 0.000 description 3
- GHHMJDRTUAPOKV-UHFFFAOYSA-N ethyl 5-amino-1,4-dimethylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=NN(C)C(N)=C1C GHHMJDRTUAPOKV-UHFFFAOYSA-N 0.000 description 3
- LOZNPODNOYMUKZ-UHFFFAOYSA-N ethyl 5-methyl-1-(oxan-4-ylmethyl)pyrazole-4-carboxylate Chemical compound CCOC(=O)c1cnn(CC2CCOCC2)c1C LOZNPODNOYMUKZ-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 206010016629 fibroma Diseases 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 238000005469 granulation Methods 0.000 description 3
- 230000003179 granulation Effects 0.000 description 3
- 239000003102 growth factor Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 201000011066 hemangioma Diseases 0.000 description 3
- 206010073071 hepatocellular carcinoma Diseases 0.000 description 3
- MNWFXJYAOYHMED-UHFFFAOYSA-N heptanoic acid Chemical class CCCCCCC(O)=O MNWFXJYAOYHMED-UHFFFAOYSA-N 0.000 description 3
- 239000008241 heterogeneous mixture Substances 0.000 description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 150000002690 malonic acid derivatives Chemical class 0.000 description 3
- 206010061289 metastatic neoplasm Diseases 0.000 description 3
- ZTDYZXWQADNRRI-UHFFFAOYSA-N methyl 4-bromo-3-methylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC=C(Br)C=1C ZTDYZXWQADNRRI-UHFFFAOYSA-N 0.000 description 3
- QRWJPHCVNZHHNB-UHFFFAOYSA-N methyl 4-methyl-5-(1-morpholin-4-ylethyl)thiophene-3-carboxylate Chemical compound COC(=O)c1csc(C(C)N2CCOCC2)c1C QRWJPHCVNZHHNB-UHFFFAOYSA-N 0.000 description 3
- RQSIAANKDQCDHF-UHFFFAOYSA-N methyl 4-methyl-5-(2-methylpyrrolidin-1-yl)thiophene-3-carboxylate Chemical compound COC(=O)c1csc(N2CCCC2C)c1C RQSIAANKDQCDHF-UHFFFAOYSA-N 0.000 description 3
- NQZCQILJZQSNHY-UHFFFAOYSA-N methyl 4-methyl-5-[1-(oxan-4-yl)pyrrolidin-2-yl]thiophene-3-carboxylate Chemical compound COC(=O)c1csc(C2CCCN2C2CCOCC2)c1C NQZCQILJZQSNHY-UHFFFAOYSA-N 0.000 description 3
- RQWZJZLXHIPBPL-UHFFFAOYSA-N methyl 4-methyl-5-propanoylthiophene-3-carboxylate Chemical compound CCC(=O)c1scc(C(=O)OC)c1C RQWZJZLXHIPBPL-UHFFFAOYSA-N 0.000 description 3
- CHYKQJNGGRRADW-UHFFFAOYSA-N methyl 5-(1-hydroxyethyl)-4-methylthiophene-3-carboxylate Chemical compound COC(=O)c1csc(C(C)O)c1C CHYKQJNGGRRADW-UHFFFAOYSA-N 0.000 description 3
- DASMNPQOGKWRPR-UHFFFAOYSA-N methyl 5-(1-hydroxypropyl)-4-methylthiophene-3-carboxylate Chemical compound CCC(O)c1scc(C(=O)OC)c1C DASMNPQOGKWRPR-UHFFFAOYSA-N 0.000 description 3
- YNGGJVVWIZFUEU-UHFFFAOYSA-N methyl 5-(4-chlorobutanoyl)-4-methylthiophene-3-carboxylate Chemical compound COC(=O)c1csc(C(=O)CCCCl)c1C YNGGJVVWIZFUEU-UHFFFAOYSA-N 0.000 description 3
- MSCWXYGKOYHJHU-UHFFFAOYSA-N methyl 5-(ethylamino)-4-methylthiophene-3-carboxylate Chemical compound CCNc1scc(C(=O)OC)c1C MSCWXYGKOYHJHU-UHFFFAOYSA-N 0.000 description 3
- WKHKMYQRALBRRB-UHFFFAOYSA-N methyl 5-(oxan-4-ylamino)thiophene-2-carboxylate Chemical compound COC(=O)c1ccc(NC2CCOCC2)s1 WKHKMYQRALBRRB-UHFFFAOYSA-N 0.000 description 3
- OYJLQIMAFQAPEE-UHFFFAOYSA-N methyl 5-[[4-(dimethylamino)cyclohexyl]-ethylamino]-4-methylthiophene-3-carboxylate Chemical compound CCN(C1CCC(CC1)N(C)C)c1scc(C(=O)OC)c1C OYJLQIMAFQAPEE-UHFFFAOYSA-N 0.000 description 3
- OBFFSDKBFPXIGW-UHFFFAOYSA-N methyl 5-[ethyl(oxan-4-yl)amino]thiophene-2-carboxylate Chemical compound CCN(C1CCOCC1)c1ccc(s1)C(=O)OC OBFFSDKBFPXIGW-UHFFFAOYSA-N 0.000 description 3
- HLXOUVJDWYCDHC-UHFFFAOYSA-N methyl 5-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylthiophene-3-carboxylate Chemical compound CCN(C(=O)OC(C)(C)C)c1scc(C(=O)OC)c1C HLXOUVJDWYCDHC-UHFFFAOYSA-N 0.000 description 3
- ZDIWSICUBDWNBI-UHFFFAOYSA-N methyl 5-acetyl-4-methylthiophene-3-carboxylate Chemical compound COC(=O)c1csc(C(C)=O)c1C ZDIWSICUBDWNBI-UHFFFAOYSA-N 0.000 description 3
- FABUZMORWYTDNQ-UHFFFAOYSA-N methyl 5-chloro-4-[ethyl(oxan-4-yl)amino]-3-methylthiophene-2-carboxylate Chemical compound CCN(C1CCOCC1)c1c(Cl)sc(C(=O)OC)c1C FABUZMORWYTDNQ-UHFFFAOYSA-N 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- 235000010446 mineral oil Nutrition 0.000 description 3
- 230000011278 mitosis Effects 0.000 description 3
- 230000008693 nausea Effects 0.000 description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 3
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 3
- 239000002777 nucleoside Substances 0.000 description 3
- 150000003833 nucleoside derivatives Chemical class 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 210000001672 ovary Anatomy 0.000 description 3
- 150000003901 oxalic acid esters Chemical class 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000002304 perfume Substances 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 230000000750 progressive effect Effects 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical class OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 3
- 235000018102 proteins Nutrition 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 3
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 3
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 3
- 230000011664 signaling Effects 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- KZIIEUKMVYSEHM-UHFFFAOYSA-N tert-butyl 3-(4-methoxycarbonyl-3-methylthiophen-2-yl)-2,5-dihydropyrrole-1-carboxylate Chemical compound COC(=O)c1csc(C2=CCN(C2)C(=O)OC(C)(C)C)c1C KZIIEUKMVYSEHM-UHFFFAOYSA-N 0.000 description 3
- IHTOYNHWGNUOPL-UHFFFAOYSA-N tert-butyl 4-(4-methoxycarbonyl-3-methylthiophene-2-carbonyl)piperidine-1-carboxylate Chemical compound COC(=O)c1csc(C(=O)C2CCN(CC2)C(=O)OC(C)(C)C)c1C IHTOYNHWGNUOPL-UHFFFAOYSA-N 0.000 description 3
- RAKHLLIVAPXABV-UHFFFAOYSA-N tert-butyl 4-[(E)-1-(4-methoxycarbonyl-3-methylthiophen-2-yl)prop-1-enyl]piperidine-1-carboxylate Chemical compound COC(=O)C=1C(=C(SC1)C(=CC)C1CCN(CC1)C(=O)OC(C)(C)C)C RAKHLLIVAPXABV-UHFFFAOYSA-N 0.000 description 3
- XMUHXCSEGGVFHB-UHFFFAOYSA-N tert-butyl 4-[1-(4-methoxycarbonyl-3-methylthiophen-2-yl)propyl]piperidine-1-carboxylate Chemical compound CCC(C1CCN(CC1)C(=O)OC(C)(C)C)c1scc(C(=O)OC)c1C XMUHXCSEGGVFHB-UHFFFAOYSA-N 0.000 description 3
- KRMXYOABAHJBJQ-UHFFFAOYSA-N tert-butyl 4-[1-(4-methoxycarbonyl-3-methylthiophen-2-yl)propylidene]piperidine-1-carboxylate Chemical compound CCC(c1scc(C(=O)OC)c1C)=C1CCN(CC1)C(=O)OC(C)(C)C KRMXYOABAHJBJQ-UHFFFAOYSA-N 0.000 description 3
- ZASAZMPROUJDHA-UHFFFAOYSA-N tert-butyl 4-[[4-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methylcarbamoyl]-3-methylthiophen-2-yl]-ethylamino]piperidine-1-carboxylate Chemical compound S1C=C(C(=O)NCC=2C(NC(C)=CC=2C)=O)C(C)=C1N(CC)C1CCN(C(=O)OC(C)(C)C)CC1 ZASAZMPROUJDHA-UHFFFAOYSA-N 0.000 description 3
- UVKAXCAVTAJIHC-UHFFFAOYSA-N tert-butyl 4-[[4-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methylcarbamoyl]-3-methylthiophen-2-yl]-hydroxymethyl]piperidine-1-carboxylate Chemical compound CC=1C(C(=O)NCC=2C(NC(C)=CC=2C)=O)=CSC=1C(O)C1CCN(C(=O)OC(C)(C)C)CC1 UVKAXCAVTAJIHC-UHFFFAOYSA-N 0.000 description 3
- VCYMEIIREZLGFN-UHFFFAOYSA-N tert-butyl n-[4-[methoxy(methyl)carbamoyl]cyclohexyl]carbamate Chemical compound CON(C)C(=O)C1CCC(NC(=O)OC(C)(C)C)CC1 VCYMEIIREZLGFN-UHFFFAOYSA-N 0.000 description 3
- 201000003120 testicular cancer Diseases 0.000 description 3
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 3
- 229930192474 thiophene Natural products 0.000 description 3
- YNVOMSDITJMNET-UHFFFAOYSA-M thiophene-3-carboxylate Chemical compound [O-]C(=O)C=1C=CSC=1 YNVOMSDITJMNET-UHFFFAOYSA-M 0.000 description 3
- 150000003577 thiophenes Chemical class 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 description 3
- 210000003932 urinary bladder Anatomy 0.000 description 3
- HOFQVRTUGATRFI-XQKSVPLYSA-N vinblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1N=C1[C]2C=CC=C1 HOFQVRTUGATRFI-XQKSVPLYSA-N 0.000 description 3
- 229960003048 vinblastine Drugs 0.000 description 3
- 230000008673 vomiting Effects 0.000 description 3
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- DCSKAVJDRSTGDL-UHFFFAOYSA-N (4,6-dimethylpyridin-3-yl)methanamine Chemical compound CC1=CC(C)=C(CN)C=N1 DCSKAVJDRSTGDL-UHFFFAOYSA-N 0.000 description 2
- FOVRGQUEGRCWPD-UHFFFAOYSA-N (5aR)-9t-beta-D-Glucopyranosyloxy-5t-(4-hydroxy-3,5-dimethoxy-phenyl)-(5ar,8at)-5,8,8a,9-tetrahydro-5aH-furo[3',4';6,7]naphtho[2,3-d][1,3]dioxol-6-on Natural products COC1=C(O)C(OC)=CC(C2C3=CC=4OCOC=4C=C3C(OC3C(C(O)C(O)C(CO)O3)O)C3C2C(OC3)=O)=C1 FOVRGQUEGRCWPD-UHFFFAOYSA-N 0.000 description 2
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 description 2
- 125000006625 (C3-C8) cycloalkyloxy group Chemical group 0.000 description 2
- 125000006530 (C4-C6) alkyl group Chemical group 0.000 description 2
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 2
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 2
- KFHQOZXAFUKFNB-UHFFFAOYSA-N 1,3-oxathiolanyl Chemical group [CH]1OCCS1 KFHQOZXAFUKFNB-UHFFFAOYSA-N 0.000 description 2
- HKDFRDIIELOLTJ-UHFFFAOYSA-N 1,4-dithianyl Chemical group [CH]1CSCCS1 HKDFRDIIELOLTJ-UHFFFAOYSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 2
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 2
- WQHDTHDJPDGYLZ-UHFFFAOYSA-N 3-(aminomethyl)-6-methyl-4-(trifluoromethyl)-1h-pyridin-2-one Chemical compound CC1=CC(C(F)(F)F)=C(CN)C(=O)N1 WQHDTHDJPDGYLZ-UHFFFAOYSA-N 0.000 description 2
- CMURGBNOIOKFRI-UHFFFAOYSA-N 3-(aminomethyl)-6-methyl-4-propyl-1h-pyridin-2-one;hydrochloride Chemical compound Cl.CCCC=1C=C(C)NC(=O)C=1CN CMURGBNOIOKFRI-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- MBUSOPVRLCFJCS-UHFFFAOYSA-N 3-bromo-4-methylthiophene Chemical compound CC1=CSC=C1Br MBUSOPVRLCFJCS-UHFFFAOYSA-N 0.000 description 2
- MLJBNEHGEYYNFM-UHFFFAOYSA-N 3-methyl-4-propan-2-yloxythiophene-2-carboxylic acid Chemical compound CC(C)Oc1csc(C(O)=O)c1C MLJBNEHGEYYNFM-UHFFFAOYSA-N 0.000 description 2
- YVCVYCSAAZQOJI-JHQYFNNDSA-N 4'-demethylepipodophyllotoxin Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O)[C@@H]3[C@@H]2C(OC3)=O)=C1 YVCVYCSAAZQOJI-JHQYFNNDSA-N 0.000 description 2
- UCFSYHMCKWNKAH-UHFFFAOYSA-N 4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical compound CC1(C)OBOC1(C)C UCFSYHMCKWNKAH-UHFFFAOYSA-N 0.000 description 2
- TUVDPNVBUMLEHW-UHFFFAOYSA-N 4-bromo-3-methylthiophene-2-carboxylic acid Chemical compound CC=1C(Br)=CSC=1C(O)=O TUVDPNVBUMLEHW-UHFFFAOYSA-N 0.000 description 2
- HJZFPRVFLBBAMU-UHFFFAOYSA-N 4-bromothiophene-2-carboxylic acid Chemical class OC(=O)C1=CC(Br)=CS1 HJZFPRVFLBBAMU-UHFFFAOYSA-N 0.000 description 2
- MWONWWCIJMXSPK-UHFFFAOYSA-N 4-chloro-2-methoxy-6-methylpyridine-3-carbonitrile Chemical compound COc1nc(C)cc(Cl)c1C#N MWONWWCIJMXSPK-UHFFFAOYSA-N 0.000 description 2
- SAPSRQJMZHFDOW-UHFFFAOYSA-N 4-chloro-6-methyl-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(Cl)=C(C#N)C(=O)N1 SAPSRQJMZHFDOW-UHFFFAOYSA-N 0.000 description 2
- WAVBYYIPGWUVJV-UHFFFAOYSA-N 4-methyl-5-[1-(oxan-4-yl)pyrrolidin-2-yl]thiophene-3-carboxylic acid Chemical compound Cc1c(scc1C(O)=O)C1CCCN1C1CCOCC1 WAVBYYIPGWUVJV-UHFFFAOYSA-N 0.000 description 2
- HROLHLXMGDWYKN-UHFFFAOYSA-N 4-methyl-5-[1-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]pyrazol-4-yl]thiophene-3-carboxylic acid Chemical compound Cc1c(csc1-c1cnn(c1)C1CCN(CC1)C(=O)OC(C)(C)C)C(O)=O HROLHLXMGDWYKN-UHFFFAOYSA-N 0.000 description 2
- BMGPRFQPACSOQX-UHFFFAOYSA-N 4-methylthiophene-3-carboxamide Chemical compound CC1=CSC=C1C(N)=O BMGPRFQPACSOQX-UHFFFAOYSA-N 0.000 description 2
- LRFIHWGUGBXFEC-UHFFFAOYSA-N 4-methylthiophene-3-carboxylic acid Chemical compound CC1=CSC=C1C(O)=O LRFIHWGUGBXFEC-UHFFFAOYSA-N 0.000 description 2
- XAUDJQYHKZQPEU-KVQBGUIXSA-N 5-aza-2'-deoxycytidine Chemical compound O=C1N=C(N)N=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 XAUDJQYHKZQPEU-KVQBGUIXSA-N 0.000 description 2
- YWLXLRUDGLRYDR-ZHPRIASZSA-N 5beta,20-epoxy-1,7beta,10beta,13alpha-tetrahydroxy-9-oxotax-11-ene-2alpha,4alpha-diyl 4-acetate 2-benzoate Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](O)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 YWLXLRUDGLRYDR-ZHPRIASZSA-N 0.000 description 2
- RGBUBXPAZXBNMI-UHFFFAOYSA-N 6,8,11-trihydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione;hydrochloride Chemical compound Cl.C1C(O)CCC2=C1C(O)=C1C(=O)C(C=CC=C3OC)=C3C(=O)C1=C2O RGBUBXPAZXBNMI-UHFFFAOYSA-N 0.000 description 2
- LLEZATCTDGWSJC-HXUWFJFHSA-N 6-[2-[3-fluoro-5-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]phenyl]ethyl]-4-methylpyridin-2-amine Chemical compound CN1CCC[C@@H]1CCc1cc(F)cc(CCc2cc(C)cc(N)n2)c1 LLEZATCTDGWSJC-HXUWFJFHSA-N 0.000 description 2
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 101150072179 ATP1 gene Proteins 0.000 description 2
- 208000031261 Acute myeloid leukaemia Diseases 0.000 description 2
- 201000004384 Alopecia Diseases 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 201000003076 Angiosarcoma Diseases 0.000 description 2
- 101100003366 Arabidopsis thaliana ATPA gene Proteins 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 description 2
- GUBGYTABKSRVRQ-DCSYEGIMSA-N Beta-Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-DCSYEGIMSA-N 0.000 description 2
- RFHPJKYGYQZFJI-HDJSIYSDSA-N CCN([C@H]1CC[C@@H](CC1)N(C)C)c1sc(C#N)c(C(=O)OC)c1C Chemical compound CCN([C@H]1CC[C@@H](CC1)N(C)C)c1sc(C#N)c(C(=O)OC)c1C RFHPJKYGYQZFJI-HDJSIYSDSA-N 0.000 description 2
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 208000006332 Choriocarcinoma Diseases 0.000 description 2
- 108010077544 Chromatin Proteins 0.000 description 2
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229940124087 DNA topoisomerase II inhibitor Drugs 0.000 description 2
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 102100021649 Elongator complex protein 6 Human genes 0.000 description 2
- 206010014967 Ependymoma Diseases 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 230000005526 G1 to G0 transition Effects 0.000 description 2
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 2
- 206010064147 Gastrointestinal inflammation Diseases 0.000 description 2
- 241000206672 Gelidium Species 0.000 description 2
- 208000000527 Germinoma Diseases 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 102000009465 Growth Factor Receptors Human genes 0.000 description 2
- 108010009202 Growth Factor Receptors Proteins 0.000 description 2
- 208000001258 Hemangiosarcoma Diseases 0.000 description 2
- 102100039869 Histone H2B type F-S Human genes 0.000 description 2
- 101100065219 Homo sapiens ELP6 gene Proteins 0.000 description 2
- 101001035372 Homo sapiens Histone H2B type F-S Proteins 0.000 description 2
- 101000587820 Homo sapiens Selenide, water dikinase 1 Proteins 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- 206010058467 Lung neoplasm malignant Diseases 0.000 description 2
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 239000004472 Lysine Substances 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 206010027476 Metastases Diseases 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 description 2
- 208000033776 Myeloid Acute Leukemia Diseases 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- 238000012565 NMR experiment Methods 0.000 description 2
- 201000004404 Neurofibroma Diseases 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 108010047956 Nucleosomes Proteins 0.000 description 2
- 102000043276 Oncogene Human genes 0.000 description 2
- 108700020796 Oncogene Proteins 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 102100031163 Selenide, water dikinase 1 Human genes 0.000 description 2
- 229920001800 Shellac Polymers 0.000 description 2
- 206010041067 Small cell lung cancer Diseases 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- BCKXLBQYZLBQEK-KVVVOXFISA-M Sodium oleate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC([O-])=O BCKXLBQYZLBQEK-KVVVOXFISA-M 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 241001116498 Taxus baccata Species 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 239000000317 Topoisomerase II Inhibitor Substances 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- 108010046308 Type II DNA Topoisomerases Proteins 0.000 description 2
- 102000007537 Type II DNA Topoisomerases Human genes 0.000 description 2
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 230000001594 aberrant effect Effects 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229940072056 alginate Drugs 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 231100000360 alopecia Toxicity 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 208000022531 anorexia Diseases 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000003080 antimitotic agent Substances 0.000 description 2
- 229940045719 antineoplastic alkylating agent nitrosoureas Drugs 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 230000006907 apoptotic process Effects 0.000 description 2
- 239000008122 artificial sweetener Substances 0.000 description 2
- 235000021311 artificial sweeteners Nutrition 0.000 description 2
- 101150105046 atpI gene Proteins 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 229960000397 bevacizumab Drugs 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 229940045348 brown mixture Drugs 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 229940105329 carboxymethylcellulose Drugs 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000024245 cell differentiation Effects 0.000 description 2
- 208000006990 cholangiocarcinoma Diseases 0.000 description 2
- 210000003483 chromatin Anatomy 0.000 description 2
- 238000002983 circular dichroism Methods 0.000 description 2
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 239000012045 crude solution Substances 0.000 description 2
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 2
- OPTASPLRGRRNAP-UHFFFAOYSA-N cytosine Chemical compound NC=1C=CNC(=O)N=1 OPTASPLRGRRNAP-UHFFFAOYSA-N 0.000 description 2
- 230000001472 cytotoxic effect Effects 0.000 description 2
- GYOZYWVXFNDGLU-XLPZGREQSA-N dTMP Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)C1 GYOZYWVXFNDGLU-XLPZGREQSA-N 0.000 description 2
- 229960003603 decitabine Drugs 0.000 description 2
- 206010061428 decreased appetite Diseases 0.000 description 2
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 2
- 229940038472 dicalcium phosphate Drugs 0.000 description 2
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 2
- SXZIXHOMFPUIRK-UHFFFAOYSA-N diphenylmethanimine Chemical compound C=1C=CC=CC=1C(=N)C1=CC=CC=C1 SXZIXHOMFPUIRK-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 2
- 231100000371 dose-limiting toxicity Toxicity 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 230000004049 epigenetic modification Effects 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- JHYNXXDQQHTCHJ-UHFFFAOYSA-M ethyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CC)C1=CC=CC=C1 JHYNXXDQQHTCHJ-UHFFFAOYSA-M 0.000 description 2
- 238000000105 evaporative light scattering detection Methods 0.000 description 2
- 239000003205 fragrance Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 208000018925 gastrointestinal mucositis Diseases 0.000 description 2
- 201000003115 germ cell cancer Diseases 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 239000004220 glutamic acid Substances 0.000 description 2
- 210000003128 head Anatomy 0.000 description 2
- 201000003911 head and neck carcinoma Diseases 0.000 description 2
- 230000003054 hormonal effect Effects 0.000 description 2
- 239000005556 hormone Substances 0.000 description 2
- 229940088597 hormone Drugs 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000002636 imidazolinyl group Chemical group 0.000 description 2
- 239000002955 immunomodulating agent Substances 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 238000007918 intramuscular administration Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 230000009545 invasion Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 238000010829 isocratic elution Methods 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 201000010260 leiomyoma Diseases 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- MHCFAGZWMAWTNR-UHFFFAOYSA-M lithium perchlorate Chemical compound [Li+].[O-]Cl(=O)(=O)=O MHCFAGZWMAWTNR-UHFFFAOYSA-M 0.000 description 2
- 229910001486 lithium perchlorate Inorganic materials 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 206010027191 meningioma Diseases 0.000 description 2
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 2
- 230000001394 metastastic effect Effects 0.000 description 2
- AYDLNBWOWCPCFP-UHFFFAOYSA-N methyl 2-bromo-5-(diethylamino)-4-methylthiophene-3-carboxylate Chemical compound CCN(CC)c1sc(Br)c(C(=O)OC)c1C AYDLNBWOWCPCFP-UHFFFAOYSA-N 0.000 description 2
- AGOAQPLGSNHQQL-UHFFFAOYSA-N methyl 2-chloro-5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylate Chemical compound CCN(C1CCOCC1)c1sc(Cl)c(C(=O)OC)c1C AGOAQPLGSNHQQL-UHFFFAOYSA-N 0.000 description 2
- SMVBETUVIRKVHX-UHFFFAOYSA-N methyl 2-cyano-5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylate Chemical compound CCN(C1CCOCC1)c1sc(C#N)c(C(=O)OC)c1C SMVBETUVIRKVHX-UHFFFAOYSA-N 0.000 description 2
- WRRICSQAWOXPJT-UHFFFAOYSA-N methyl 4-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate Chemical compound COC(=O)c1csc(NC(=O)OC(C)(C)C)c1C WRRICSQAWOXPJT-UHFFFAOYSA-N 0.000 description 2
- VRVPLRIEWRBUFJ-UHFFFAOYSA-N methyl 4-methyl-5-nitrothiophene-3-carboxylate Chemical compound COC(=O)C1=CSC([N+]([O-])=O)=C1C VRVPLRIEWRBUFJ-UHFFFAOYSA-N 0.000 description 2
- WAUYOOANGDXOEM-UHFFFAOYSA-N methyl 5-[ethyl(oxan-4-yl)amino]-2,4-dimethylthiophene-3-carboxylate Chemical compound CCN(C1CCOCC1)c1sc(C)c(C(=O)OC)c1C WAUYOOANGDXOEM-UHFFFAOYSA-N 0.000 description 2
- IGYRPGJLRYHDLG-UHFFFAOYSA-N methyl 5-[ethyl(oxan-4-yl)amino]-4-methyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxylate Chemical compound C(C)N(C1=C(C(=C(S1)N1CCN(CC1)C)C(=O)OC)C)C1CCOCC1 IGYRPGJLRYHDLG-UHFFFAOYSA-N 0.000 description 2
- KCEGSCLXZUDMMM-UHFFFAOYSA-N methyl 5-bromo-4-methylthiophene-3-carboxylate Chemical compound COC(=O)C1=CSC(Br)=C1C KCEGSCLXZUDMMM-UHFFFAOYSA-N 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 230000011987 methylation Effects 0.000 description 2
- 238000007069 methylation reaction Methods 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 238000000199 molecular distillation Methods 0.000 description 2
- 230000035772 mutation Effects 0.000 description 2
- OBWHFTGGXGNDQX-UHFFFAOYSA-N n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-4-methyl-5-(1-piperidin-4-ylidenepropyl)thiophene-3-carboxamide Chemical compound C1CNCCC1=C(CC)C(=C1C)SC=C1C(=O)NCC1=C(C)C=C(C)NC1=O OBWHFTGGXGNDQX-UHFFFAOYSA-N 0.000 description 2
- DWNBXLZQSMCDBO-UHFFFAOYSA-N n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-5-[ethyl(oxan-4-yl)amino]-4-methyl-2-(4-methylpiperazin-1-yl)thiophene-3-carboxamide Chemical compound S1C(N2CCN(C)CC2)=C(C(=O)NCC=2C(NC(C)=CC=2C)=O)C(C)=C1N(CC)C1CCOCC1 DWNBXLZQSMCDBO-UHFFFAOYSA-N 0.000 description 2
- YGPOYOZOXJDGSV-UHFFFAOYSA-N n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-5-[hydroxy(piperidin-4-yl)methyl]-4-methylthiophene-3-carboxamide Chemical compound CC=1C(C(=O)NCC=2C(NC(C)=CC=2C)=O)=CSC=1C(O)C1CCNCC1 YGPOYOZOXJDGSV-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 235000021096 natural sweeteners Nutrition 0.000 description 2
- 210000003739 neck Anatomy 0.000 description 2
- 208000004235 neutropenia Diseases 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 102000037979 non-receptor tyrosine kinases Human genes 0.000 description 2
- 108091008046 non-receptor tyrosine kinases Proteins 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000007523 nucleic acids Chemical group 0.000 description 2
- 210000001623 nucleosome Anatomy 0.000 description 2
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 230000003534 oscillatory effect Effects 0.000 description 2
- 208000008798 osteoma Diseases 0.000 description 2
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical compound O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 2
- 125000005968 oxazolinyl group Chemical group 0.000 description 2
- 125000003566 oxetanyl group Chemical group 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 210000000496 pancreas Anatomy 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 235000019477 peppermint oil Nutrition 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 125000005498 phthalate group Chemical class 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 238000002600 positron emission tomography Methods 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 230000002062 proliferating effect Effects 0.000 description 2
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000011253 protective coating Substances 0.000 description 2
- 239000011241 protective layer Substances 0.000 description 2
- 150000003212 purines Chemical class 0.000 description 2
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 2
- 125000002755 pyrazolinyl group Chemical group 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000001959 radiotherapy Methods 0.000 description 2
- 238000005932 reductive alkylation reaction Methods 0.000 description 2
- 230000010076 replication Effects 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 201000009410 rhabdomyosarcoma Diseases 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 235000019204 saccharin Nutrition 0.000 description 2
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 2
- 229940081974 saccharin Drugs 0.000 description 2
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 2
- 238000011519 second-line treatment Methods 0.000 description 2
- 239000004208 shellac Substances 0.000 description 2
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 2
- 229940113147 shellac Drugs 0.000 description 2
- 235000013874 shellac Nutrition 0.000 description 2
- 210000003491 skin Anatomy 0.000 description 2
- 239000004055 small Interfering RNA Substances 0.000 description 2
- 208000000587 small cell lung carcinoma Diseases 0.000 description 2
- 235000010413 sodium alginate Nutrition 0.000 description 2
- 239000000661 sodium alginate Substances 0.000 description 2
- 229940005550 sodium alginate Drugs 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- PODWXQQNRWNDGD-UHFFFAOYSA-L sodium thiosulfate pentahydrate Chemical compound O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O PODWXQQNRWNDGD-UHFFFAOYSA-L 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 150000003890 succinate salts Chemical class 0.000 description 2
- 238000001356 surgical procedure Methods 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- MNCXGBBUODZXES-UHFFFAOYSA-N tert-butyl 3-(4-methoxycarbonyl-3-methylthiophen-2-yl)pyrrolidine-1-carboxylate Chemical compound COC(=O)c1csc(C2CCN(C2)C(=O)OC(C)(C)C)c1C MNCXGBBUODZXES-UHFFFAOYSA-N 0.000 description 2
- IWFUYTDGNXGZMQ-UHFFFAOYSA-N tert-butyl 4-[4-(4-methoxycarbonyl-3-methylthiophen-2-yl)pyrazol-1-yl]piperidine-1-carboxylate Chemical compound COC(=O)c1csc(-c2cnn(c2)C2CCN(CC2)C(=O)OC(C)(C)C)c1C IWFUYTDGNXGZMQ-UHFFFAOYSA-N 0.000 description 2
- JYUQEWCJWDGCRX-UHFFFAOYSA-N tert-butyl 4-formylpiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(C=O)CC1 JYUQEWCJWDGCRX-UHFFFAOYSA-N 0.000 description 2
- LBSZABVZAJRHQC-UHFFFAOYSA-N tert-butyl N-[(2,4-dimethoxy-6-methylpyridin-3-yl)methyl]carbamate Chemical compound COc1cc(C)nc(OC)c1CNC(=O)OC(C)(C)C LBSZABVZAJRHQC-UHFFFAOYSA-N 0.000 description 2
- 230000002381 testicular Effects 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 125000002769 thiazolinyl group Chemical group 0.000 description 2
- GLQWRXYOTXRDNH-UHFFFAOYSA-N thiophen-2-amine Chemical compound NC1=CC=CS1 GLQWRXYOTXRDNH-UHFFFAOYSA-N 0.000 description 2
- YNVOMSDITJMNET-UHFFFAOYSA-N thiophene-3-carboxylic acid Chemical class OC(=O)C=1C=CSC=1 YNVOMSDITJMNET-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 238000011269 treatment regimen Methods 0.000 description 2
- 150000004654 triazenes Chemical class 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- 235000010493 xanthan gum Nutrition 0.000 description 2
- 239000000230 xanthan gum Substances 0.000 description 2
- 229920001285 xanthan gum Polymers 0.000 description 2
- 229940082509 xanthan gum Drugs 0.000 description 2
- 229930195724 β-lactose Natural products 0.000 description 2
- QEJQAPYSVNHDJF-UHFFFAOYSA-N $l^{1}-oxidanylethyne Chemical compound [O]C#C QEJQAPYSVNHDJF-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- SPFAOPCHYIJPHJ-MOMXNFOMSA-N (4r,4as,12ar)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4h-tetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1=CC(O)=C2C(O)=C(C(=O)[C@@]3(O)[C@H]([C@H](C(C(C(N)=O)=C3O)=O)N(C)C)C3)C3=C(C)C2=C1 SPFAOPCHYIJPHJ-MOMXNFOMSA-N 0.000 description 1
- FPVKHBSQESCIEP-UHFFFAOYSA-N (8S)-3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol Natural products C1C(O)C(CO)OC1N1C(NC=NCC2O)=C2N=C1 FPVKHBSQESCIEP-UHFFFAOYSA-N 0.000 description 1
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 125000006002 1,1-difluoroethyl group Chemical group 0.000 description 1
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 1
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 1
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 1
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 1
- YHNFRZWVZUMYEJ-UHFFFAOYSA-N 1,4,6-trimethyl-2-oxopyridine-3-carbonitrile Chemical compound CC=1C=C(C)N(C)C(=O)C=1C#N YHNFRZWVZUMYEJ-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- BPIKOYBYKRUSRF-UHFFFAOYSA-N 1-(oxan-4-yl)pyrrolidine Chemical compound C1CCCN1C1CCOCC1 BPIKOYBYKRUSRF-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- VCGFSKNCUIRVDA-UHFFFAOYSA-N 1-[methyl(nitroso)amino]butyl acetate Chemical compound CCCC(OC(C)=O)N(C)N=O VCGFSKNCUIRVDA-UHFFFAOYSA-N 0.000 description 1
- FPIRBHDGWMWJEP-UHFFFAOYSA-N 1-hydroxy-7-azabenzotriazole Chemical compound C1=CN=C2N(O)N=NC2=C1 FPIRBHDGWMWJEP-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical class OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- GBBSAMQTQCPOBF-UHFFFAOYSA-N 2,4,6-trimethyl-1,3,5,2,4,6-trioxatriborinane Chemical compound CB1OB(C)OB(C)O1 GBBSAMQTQCPOBF-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- JAEAPVGSHPPFCQ-UHFFFAOYSA-N 2-bromo-5-[[4-(dimethylamino)cyclohexyl]-ethylamino]-4-methylthiophene-3-carboxylic acid Chemical compound CCN(C1CCC(CC1)N(C)C)c1sc(Br)c(C(O)=O)c1C JAEAPVGSHPPFCQ-UHFFFAOYSA-N 0.000 description 1
- MLSWJKJFCLQZPE-UHFFFAOYSA-N 2-bromo-5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylic acid Chemical compound CCN(C1CCOCC1)c1sc(Br)c(C(O)=O)c1C MLSWJKJFCLQZPE-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- ROIMNSWDOJCBFR-UHFFFAOYSA-N 2-iodothiophene Chemical compound IC1=CC=CS1 ROIMNSWDOJCBFR-UHFFFAOYSA-N 0.000 description 1
- RCIGPOBMYPKFBY-UHFFFAOYSA-N 2-methoxynaphthalene-1-carboximidamide Chemical compound C1=CC=CC2=C(C(N)=N)C(OC)=CC=C21 RCIGPOBMYPKFBY-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- JWUJQDFVADABEY-UHFFFAOYSA-N 2-methyltetrahydrofuran Chemical compound CC1CCCO1 JWUJQDFVADABEY-UHFFFAOYSA-N 0.000 description 1
- ZDEWSZZMQVGWCA-UHFFFAOYSA-N 2-methylthiophene-3-carboxamide Chemical compound CC=1SC=CC=1C(N)=O ZDEWSZZMQVGWCA-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- ZZVDXRCAGGQFAK-UHFFFAOYSA-N 2h-oxazaphosphinine Chemical class N1OC=CC=P1 ZZVDXRCAGGQFAK-UHFFFAOYSA-N 0.000 description 1
- PBGAZQLIFHVHCX-UHFFFAOYSA-N 3-(aminomethyl)-4-cyclohexyl-6-methyl-1h-pyridin-2-one Chemical compound O=C1NC(C)=CC(C2CCCCC2)=C1CN PBGAZQLIFHVHCX-UHFFFAOYSA-N 0.000 description 1
- FTDZPHJQICCMEG-UHFFFAOYSA-N 3-(aminomethyl)-4-methyl-6-(trifluoromethyl)-1H-pyridin-2-one hydrochloride Chemical compound Cl.NCC=1C(NC(=CC1C)C(F)(F)F)=O FTDZPHJQICCMEG-UHFFFAOYSA-N 0.000 description 1
- ATIZGVDXSOWZJE-UHFFFAOYSA-N 3-(aminomethyl)-6-methyl-4-(trifluoromethyl)-1h-pyridin-2-one;hydrochloride Chemical compound Cl.CC1=CC(C(F)(F)F)=C(CN)C(=O)N1 ATIZGVDXSOWZJE-UHFFFAOYSA-N 0.000 description 1
- JBKWKHWTUAUEFI-UHFFFAOYSA-N 3-(aminomethyl)-6-methyl-4-propyl-1h-pyridin-2-one Chemical compound CCCC=1C=C(C)NC(=O)C=1CN JBKWKHWTUAUEFI-UHFFFAOYSA-N 0.000 description 1
- JHHZQADGLDKIPM-AATRIKPKSA-N 3-Hepten-2-one Chemical compound CCC\C=C\C(C)=O JHHZQADGLDKIPM-AATRIKPKSA-N 0.000 description 1
- HYJVYOWKYPNSTK-UHFFFAOYSA-N 3-benzamido-2-hydroxy-3-phenylpropanoic acid Chemical compound C=1C=CC=CC=1C(C(O)C(O)=O)NC(=O)C1=CC=CC=C1 HYJVYOWKYPNSTK-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- IYTJRMRETHPZAC-UHFFFAOYSA-N 4,4-dibenzylpiperidine Chemical compound C1CNCCC1(CC=1C=CC=CC=1)CC1=CC=CC=C1 IYTJRMRETHPZAC-UHFFFAOYSA-N 0.000 description 1
- OCYMJCILWYHKAU-UHFFFAOYSA-N 4,6-dimethyl-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(C)=C(C#N)C(O)=N1 OCYMJCILWYHKAU-UHFFFAOYSA-N 0.000 description 1
- KXMRDHPZQHAXML-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid Chemical compound CC(C)(C)OC(=O)NC1CCC(C(O)=O)CC1 KXMRDHPZQHAXML-UHFFFAOYSA-N 0.000 description 1
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 1
- WMPRWVSFHGPPNE-UHFFFAOYSA-N 4-hydroxy-6-methyl-2-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(O)=C(C#N)C(=O)N1 WMPRWVSFHGPPNE-UHFFFAOYSA-N 0.000 description 1
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- NMUSYJAQQFHJEW-UHFFFAOYSA-N 5-Azacytidine Natural products O=C1N=C(N)N=CN1C1C(O)C(O)C(CO)O1 NMUSYJAQQFHJEW-UHFFFAOYSA-N 0.000 description 1
- KCXYXNRPRRXYDO-UHFFFAOYSA-N 5-[[4-(dimethylamino)cyclohexyl]-ethylamino]-4-methyl-n-[(6-methyl-2-oxo-4-propyl-1h-pyridin-3-yl)methyl]thiophene-3-carboxamide Chemical compound C1=C(C)NC(=O)C(CNC(=O)C=2C(=C(N(CC)C3CCC(CC3)N(C)C)SC=2)C)=C1CCC KCXYXNRPRRXYDO-UHFFFAOYSA-N 0.000 description 1
- CGJODYOOVBWYST-UHFFFAOYSA-N 5-[ethyl(oxan-4-yl)amino]-4-methylthiophene-3-carboxylic acid Chemical compound CCN(C1CCOCC1)c1scc(C(O)=O)c1C CGJODYOOVBWYST-UHFFFAOYSA-N 0.000 description 1
- OMDURWPYADSYHC-UHFFFAOYSA-N 5-[ethyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]-4-methylthiophene-3-carboxylic acid Chemical compound CCN(C1CCN(CC1)C(=O)OC(C)(C)C)c1scc(C(O)=O)c1C OMDURWPYADSYHC-UHFFFAOYSA-N 0.000 description 1
- GSPVECVNXXJOGI-UHFFFAOYSA-N 5-acetylthiophene-3-carboxylic acid Chemical compound CC(=O)C1=CC(C(O)=O)=CS1 GSPVECVNXXJOGI-UHFFFAOYSA-N 0.000 description 1
- XVRIEWDDMODMGA-UHFFFAOYSA-N 5-chloropentan-2-one Chemical compound CC(=O)CCCCl XVRIEWDDMODMGA-UHFFFAOYSA-N 0.000 description 1
- HFEKDTCAMMOLQP-RRKCRQDMSA-N 5-fluorodeoxyuridine monophosphate Chemical compound O1[C@H](COP(O)(O)=O)[C@@H](O)C[C@@H]1N1C(=O)NC(=O)C(F)=C1 HFEKDTCAMMOLQP-RRKCRQDMSA-N 0.000 description 1
- IAPCNWNYBBFSJQ-UHFFFAOYSA-N 5-methyl-1-(oxan-4-ylmethyl)pyrazole-4-carboxamide Chemical compound CC1=C(C=NN1CC1CCOCC1)C(=O)N IAPCNWNYBBFSJQ-UHFFFAOYSA-N 0.000 description 1
- IMPQPQKUDMOZHV-UHFFFAOYSA-N 6-methyl-2-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile Chemical compound CC1=CC(C(F)(F)F)=C(C#N)C(=O)N1 IMPQPQKUDMOZHV-UHFFFAOYSA-N 0.000 description 1
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 1
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 1
- 206010001233 Adenoma benign Diseases 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 102400000068 Angiostatin Human genes 0.000 description 1
- 108010079709 Angiostatins Proteins 0.000 description 1
- 108020000948 Antisense Oligonucleotides Proteins 0.000 description 1
- 108091023037 Aptamer Proteins 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 206010003571 Astrocytoma Diseases 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 1
- MLDQJTXFUGDVEO-UHFFFAOYSA-N BAY-43-9006 Chemical compound C1=NC(C(=O)NC)=CC(OC=2C=CC(NC(=O)NC=3C=C(C(Cl)=CC=3)C(F)(F)F)=CC=2)=C1 MLDQJTXFUGDVEO-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 206010005003 Bladder cancer Diseases 0.000 description 1
- GCEUXFQCDVZSFJ-HDJSIYSDSA-N BrC=1SC(=C(C1C(=O)OCC)C)N(CC)[C@@H]1CC[C@H](CC1)N(C)C Chemical compound BrC=1SC(=C(C1C(=O)OCC)C)N(CC)[C@@H]1CC[C@H](CC1)N(C)C GCEUXFQCDVZSFJ-HDJSIYSDSA-N 0.000 description 1
- 208000003174 Brain Neoplasms Diseases 0.000 description 1
- 206010048962 Brain oedema Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ACGOAXWVTLGMPO-UHFFFAOYSA-N C=C(C1CCNCC1)C1=CC=CS1 Chemical compound C=C(C1CCNCC1)C1=CC=CS1 ACGOAXWVTLGMPO-UHFFFAOYSA-N 0.000 description 1
- XCDDMQLPMMUTOY-WGSAOQKQSA-N CC1=C(C(NC(=C1)C)=O)CNC(=O)C1=CSC(=C1C)C(=CC)[C@@H]1CC[C@H](CC1)N(C)C Chemical compound CC1=C(C(NC(=C1)C)=O)CNC(=O)C1=CSC(=C1C)C(=CC)[C@@H]1CC[C@H](CC1)N(C)C XCDDMQLPMMUTOY-WGSAOQKQSA-N 0.000 description 1
- OEOBFVJMSOTVQD-KDURUIRLSA-N CC1=C(C(NC(=C1)C)=O)CNC(=O)C=1SC=C(C1C)N(CC)[C@@H]1CC[C@@H](CC1)N(C)C Chemical compound CC1=C(C(NC(=C1)C)=O)CNC(=O)C=1SC=C(C1C)N(CC)[C@@H]1CC[C@@H](CC1)N(C)C OEOBFVJMSOTVQD-KDURUIRLSA-N 0.000 description 1
- LQRSUXVZQNCRKZ-JHJOSGQCSA-N CCC([C@H]1CC[C@H](N)CC1)c1scc(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C Chemical compound CCC([C@H]1CC[C@H](N)CC1)c1scc(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C LQRSUXVZQNCRKZ-JHJOSGQCSA-N 0.000 description 1
- PDHLHMHPAJMYGF-JOCQHMNTSA-N CCN([C@H]1CC[C@@H](CC1)N(C)C)c1sc(C#N)c(C(O)=O)c1C Chemical compound CCN([C@H]1CC[C@@H](CC1)N(C)C)c1sc(C#N)c(C(O)=O)c1C PDHLHMHPAJMYGF-JOCQHMNTSA-N 0.000 description 1
- OPQWDNJKKMJJBB-IYARVYRRSA-N CN([C@@H]1CC[C@H](CC1)N(C1=C(C(=CS1)C(=O)NCC=1C(NC(=CC1OC)C)=O)C)CC)C Chemical compound CN([C@@H]1CC[C@H](CC1)N(C1=C(C(=CS1)C(=O)NCC=1C(NC(=CC1OC)C)=O)C)CC)C OPQWDNJKKMJJBB-IYARVYRRSA-N 0.000 description 1
- AIIOKHOKGAEZOV-SHTZXODSSA-N COC(=O)c1csc(C(=CC)[C@H]2CC[C@@H](CC2)NC(=O)OC(C)(C)C)c1C Chemical compound COC(=O)c1csc(C(=CC)[C@H]2CC[C@@H](CC2)NC(=O)OC(C)(C)C)c1C AIIOKHOKGAEZOV-SHTZXODSSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241001164374 Calyx Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000001258 Cinchona calisaya Nutrition 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- NBSSGVZRNDWKRO-YHSIFKNPSA-N Cl.CCN([C@H]1CC[C@@H](CC1)N(C)C)c1sc(Br)c(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C Chemical compound Cl.CCN([C@H]1CC[C@@H](CC1)N(C)C)c1sc(Br)c(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C NBSSGVZRNDWKRO-YHSIFKNPSA-N 0.000 description 1
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 1
- 206010048832 Colon adenoma Diseases 0.000 description 1
- 206010055114 Colon cancer metastatic Diseases 0.000 description 1
- 206010010356 Congenital anomaly Diseases 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 102000053602 DNA Human genes 0.000 description 1
- 230000007067 DNA methylation Effects 0.000 description 1
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 206010012735 Diarrhoea Diseases 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 101100520660 Drosophila melanogaster Poc1 gene Proteins 0.000 description 1
- 208000000471 Dysplastic Nevus Syndrome Diseases 0.000 description 1
- 102000001301 EGF receptor Human genes 0.000 description 1
- 108060006698 EGF receptor Proteins 0.000 description 1
- 239000001692 EU approved anti-caking agent Substances 0.000 description 1
- 102400001047 Endostatin Human genes 0.000 description 1
- 108010079505 Endostatins Proteins 0.000 description 1
- 241000792859 Enema Species 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 208000007659 Fibroadenoma Diseases 0.000 description 1
- 201000008808 Fibrosarcoma Diseases 0.000 description 1
- 206010053717 Fibrous histiocytoma Diseases 0.000 description 1
- 208000007569 Giant Cell Tumors Diseases 0.000 description 1
- 201000005409 Gliomatosis cerebri Diseases 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- 206010019629 Hepatic adenoma Diseases 0.000 description 1
- 102000003964 Histone deacetylase Human genes 0.000 description 1
- 108090000353 Histone deacetylase Proteins 0.000 description 1
- 101000615488 Homo sapiens Methyl-CpG-binding domain protein 2 Proteins 0.000 description 1
- 101001109426 Homo sapiens Nitric oxide-associated protein 1 Proteins 0.000 description 1
- 101001059454 Homo sapiens Serine/threonine-protein kinase MARK2 Proteins 0.000 description 1
- 101000701815 Homo sapiens Spermidine synthase Proteins 0.000 description 1
- 102000004157 Hydrolases Human genes 0.000 description 1
- 108090000604 Hydrolases Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- 208000005016 Intestinal Neoplasms Diseases 0.000 description 1
- 208000002260 Keloid Diseases 0.000 description 1
- 208000008839 Kidney Neoplasms Diseases 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 1
- 239000002147 L01XE04 - Sunitinib Substances 0.000 description 1
- 239000005511 L01XE05 - Sorafenib Substances 0.000 description 1
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 1
- 239000003798 L01XE11 - Pazopanib Substances 0.000 description 1
- 208000031671 Large B-Cell Diffuse Lymphoma Diseases 0.000 description 1
- 208000035561 Leukaemic infiltration brain Diseases 0.000 description 1
- 206010061523 Lip and/or oral cavity cancer Diseases 0.000 description 1
- 208000002404 Liver Cell Adenoma Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 208000000172 Medulloblastoma Diseases 0.000 description 1
- 206010027480 Metastatic malignant melanoma Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 102100021299 Methyl-CpG-binding domain protein 2 Human genes 0.000 description 1
- 102000016397 Methyltransferase Human genes 0.000 description 1
- 108060004795 Methyltransferase Proteins 0.000 description 1
- 239000004909 Moisturizer Substances 0.000 description 1
- 101100098955 Mus musculus Tbrg1 gene Proteins 0.000 description 1
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 1
- 208000014767 Myeloproliferative disease Diseases 0.000 description 1
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-Chlorosuccinimide Substances ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 1
- LOBUJWWMWGQOSH-UHFFFAOYSA-N N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-5-[ethyl(oxan-4-yl)amino]-2,4-dimethylthiophene-3-carboxamide hydrochloride Chemical compound Cl.CCN(C1CCOCC1)c1sc(C)c(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C LOBUJWWMWGQOSH-UHFFFAOYSA-N 0.000 description 1
- 206010029098 Neoplasm skin Diseases 0.000 description 1
- 206010029155 Nephropathy toxic Diseases 0.000 description 1
- 206010029260 Neuroblastoma Diseases 0.000 description 1
- 102100022495 Nitric oxide-associated protein 1 Human genes 0.000 description 1
- ILUJQPXNXACGAN-UHFFFAOYSA-N O-methylsalicylic acid Chemical class COC1=CC=CC=C1C(O)=O ILUJQPXNXACGAN-UHFFFAOYSA-N 0.000 description 1
- NMYZDFOXORHONG-UHFFFAOYSA-N OBO.C=1C=CSC=1 Chemical class OBO.C=1C=CSC=1 NMYZDFOXORHONG-UHFFFAOYSA-N 0.000 description 1
- 206010033109 Ototoxicity Diseases 0.000 description 1
- 206010061902 Pancreatic neoplasm Diseases 0.000 description 1
- 102100039298 Phosphatidylserine synthase 1 Human genes 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- 244000236480 Podophyllum peltatum Species 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 102000001253 Protein Kinase Human genes 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 108091005682 Receptor kinases Proteins 0.000 description 1
- 208000015634 Rectal Neoplasms Diseases 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- 208000005678 Rhabdomyoma Diseases 0.000 description 1
- 101150056203 SGS3 gene Proteins 0.000 description 1
- 108091006629 SLC13A2 Proteins 0.000 description 1
- 101100520662 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PBA1 gene Proteins 0.000 description 1
- 101100190847 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) PMP3 gene Proteins 0.000 description 1
- 229940124639 Selective inhibitor Drugs 0.000 description 1
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 1
- 102100028904 Serine/threonine-protein kinase MARK2 Human genes 0.000 description 1
- 208000000453 Skin Neoplasms Diseases 0.000 description 1
- 108091027967 Small hairpin RNA Proteins 0.000 description 1
- 108020004459 Small interfering RNA Proteins 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 101710138331 Somatostatin-1 Proteins 0.000 description 1
- 101100073352 Streptomyces halstedii sch1 gene Proteins 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 208000031673 T-Cell Cutaneous Lymphoma Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229940123237 Taxane Drugs 0.000 description 1
- 206010043276 Teratoma Diseases 0.000 description 1
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 1
- 239000004473 Threonine Substances 0.000 description 1
- 208000024770 Thyroid neoplasm Diseases 0.000 description 1
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 206010052779 Transplant rejections Diseases 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- 102000001742 Tumor Suppressor Proteins Human genes 0.000 description 1
- 108010040002 Tumor Suppressor Proteins Proteins 0.000 description 1
- 241001584775 Tunga penetrans Species 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 241000863480 Vinca Species 0.000 description 1
- 208000008383 Wilms tumor Diseases 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 206010048214 Xanthoma Diseases 0.000 description 1
- 206010048215 Xanthomatosis Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 208000002718 adenomatoid tumor Diseases 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- IAJILQKETJEXLJ-RSJOWCBRSA-N aldehydo-D-galacturonic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-RSJOWCBRSA-N 0.000 description 1
- IAJILQKETJEXLJ-QTBDOELSSA-N aldehydo-D-glucuronic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-QTBDOELSSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004450 alkenylene group Chemical group 0.000 description 1
- 229940061720 alpha hydroxy acid Drugs 0.000 description 1
- 150000001280 alpha hydroxy acids Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 201000007434 ampulla of Vater carcinoma Diseases 0.000 description 1
- 239000004037 angiogenesis inhibitor Substances 0.000 description 1
- 229940121369 angiogenesis inhibitor Drugs 0.000 description 1
- 238000002399 angioplasty Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- HOPRXXXSABQWAV-UHFFFAOYSA-N anhydrous collidine Natural products CC1=CC=NC(C)=C1C HOPRXXXSABQWAV-UHFFFAOYSA-N 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 229940045799 anthracyclines and related substance Drugs 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000003432 anti-folate effect Effects 0.000 description 1
- 230000000692 anti-sense effect Effects 0.000 description 1
- 239000002839 antibiotic anticancer agent Substances 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 229940127074 antifolate Drugs 0.000 description 1
- 229940045686 antimetabolites antineoplastic purine analogs Drugs 0.000 description 1
- 239000000074 antisense oligonucleotide Substances 0.000 description 1
- 238000012230 antisense oligonucleotides Methods 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- FZCSTZYAHCUGEM-UHFFFAOYSA-N aspergillomarasmine B Natural products OC(=O)CNC(C(O)=O)CNC(C(O)=O)CC(O)=O FZCSTZYAHCUGEM-UHFFFAOYSA-N 0.000 description 1
- 230000003140 astrocytic effect Effects 0.000 description 1
- 229960002170 azathioprine Drugs 0.000 description 1
- LMEKQMALGUDUQG-UHFFFAOYSA-N azathioprine Chemical compound CN1C=NC([N+]([O-])=O)=C1SC1=NC=NC2=C1NC=N2 LMEKQMALGUDUQG-UHFFFAOYSA-N 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 125000003828 azulenyl group Chemical group 0.000 description 1
- 230000003385 bacteriostatic effect Effects 0.000 description 1
- 208000001119 benign fibrous histiocytoma Diseases 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 208000036815 beta tubulin Diseases 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 210000003445 biliary tract Anatomy 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000003124 biologic agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 208000006752 brain edema Diseases 0.000 description 1
- 201000008275 breast carcinoma Diseases 0.000 description 1
- 201000003149 breast fibroadenoma Diseases 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 208000003362 bronchogenic carcinoma Diseases 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 230000005907 cancer growth Effects 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 150000001723 carbon free-radicals Chemical class 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 208000002458 carcinoid tumor Diseases 0.000 description 1
- 208000011825 carcinoma of the ampulla of vater Diseases 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 230000004709 cell invasion Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 208000019065 cervical carcinoma Diseases 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 1
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 229960002436 cladribine Drugs 0.000 description 1
- 238000010549 co-Evaporation Methods 0.000 description 1
- UTBIMNXEDGNJFE-UHFFFAOYSA-N collidine Natural products CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 201000007241 cutaneous T cell lymphoma Diseases 0.000 description 1
- 201000010305 cutaneous fibrous histiocytoma Diseases 0.000 description 1
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 description 1
- 208000035255 cutaneous malignant susceptibility to 2 melanoma Diseases 0.000 description 1
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 1
- 239000002875 cyclin dependent kinase inhibitor Substances 0.000 description 1
- 229940043378 cyclin-dependent kinase inhibitor Drugs 0.000 description 1
- CCQPAEQGAVNNIA-UHFFFAOYSA-L cyclobutane-1,1-dicarboxylate(2-) Chemical compound [O-]C(=O)C1(C([O-])=O)CCC1 CCQPAEQGAVNNIA-UHFFFAOYSA-L 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004410 cyclooctyloxy group Chemical group C1(CCCCCCC1)O* 0.000 description 1
- PWOQRKCAHTVFLB-UHFFFAOYSA-N cyclophosphamide hydrate Chemical compound O.ClCCN(CCCl)P1(=O)NCCCO1 PWOQRKCAHTVFLB-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- UHDGCWIWMRVCDJ-ZAKLUEHWSA-N cytidine Chemical class O=C1N=C(N)C=CN1[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O1 UHDGCWIWMRVCDJ-ZAKLUEHWSA-N 0.000 description 1
- 229940104302 cytosine Drugs 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 230000003013 cytotoxicity Effects 0.000 description 1
- 231100000135 cytotoxicity Toxicity 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 238000013480 data collection Methods 0.000 description 1
- 125000005508 decahydronaphthalenyl group Chemical group 0.000 description 1
- 125000005534 decanoate group Chemical class 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007682 dermal toxicity Effects 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- OZRNSSUDZOLUSN-LBPRGKRZSA-N dihydrofolic acid Chemical compound N=1C=2C(=O)NC(N)=NC=2NCC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OZRNSSUDZOLUSN-LBPRGKRZSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 229930004069 diterpene Natural products 0.000 description 1
- 230000035619 diuresis Effects 0.000 description 1
- 239000003968 dna methyltransferase inhibitor Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000008482 dysregulation Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 230000002357 endometrial effect Effects 0.000 description 1
- 239000007920 enema Substances 0.000 description 1
- 229940079360 enema for constipation Drugs 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000008995 epigenetic change Effects 0.000 description 1
- 208000037828 epithelial carcinoma Diseases 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 229960001433 erlotinib Drugs 0.000 description 1
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- VDDXQSUSMHZCLS-UHFFFAOYSA-N ethenyl trifluoromethanesulfonate Chemical compound FC(F)(F)S(=O)(=O)OC=C VDDXQSUSMHZCLS-UHFFFAOYSA-N 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- FNASCUBBFNCFQO-SOFGYWHQSA-N ethyl (2e)-2-(ethoxymethylidene)-3-oxobutanoate Chemical compound CCO\C=C(/C(C)=O)C(=O)OCC FNASCUBBFNCFQO-SOFGYWHQSA-N 0.000 description 1
- SHQNGLYXRFCPGZ-UHFFFAOYSA-N ethyl 2-(2-amino-1,3-thiazol-4-yl)acetate Chemical compound CCOC(=O)CC1=CSC(N)=N1 SHQNGLYXRFCPGZ-UHFFFAOYSA-N 0.000 description 1
- 210000003527 eukaryotic cell Anatomy 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- ODKNJVUHOIMIIZ-RRKCRQDMSA-N floxuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(F)=C1 ODKNJVUHOIMIIZ-RRKCRQDMSA-N 0.000 description 1
- GIUYCYHIANZCFB-FJFJXFQQSA-N fludarabine phosphate Chemical compound C1=NC=2C(N)=NC(F)=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O GIUYCYHIANZCFB-FJFJXFQQSA-N 0.000 description 1
- 229960005304 fludarabine phosphate Drugs 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 150000005699 fluoropyrimidines Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000004052 folic acid antagonist Substances 0.000 description 1
- 201000003444 follicular lymphoma Diseases 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 201000007487 gallbladder carcinoma Diseases 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- OKKDEIYWILRZIA-OSZBKLCCSA-N gemcitabine hydrochloride Chemical compound [H+].[Cl-].O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 OKKDEIYWILRZIA-OSZBKLCCSA-N 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 230000030279 gene silencing Effects 0.000 description 1
- 229940097043 glucuronic acid Drugs 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 239000003979 granulating agent Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 201000000459 head and neck squamous cell carcinoma Diseases 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 201000005787 hematologic cancer Diseases 0.000 description 1
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 1
- 208000006359 hepatoblastoma Diseases 0.000 description 1
- 201000002735 hepatocellular adenoma Diseases 0.000 description 1
- 231100000844 hepatocellular carcinoma Toxicity 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000005984 hexahydro-1H-1,4-diazepinyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940121372 histone deacetylase inhibitor Drugs 0.000 description 1
- 239000003276 histone deacetylase inhibitor Substances 0.000 description 1
- 230000006197 histone deacetylation Effects 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 208000018821 hormone-resistant prostate carcinoma Diseases 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229960002411 imatinib Drugs 0.000 description 1
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000006882 induction of apoptosis Effects 0.000 description 1
- CDAISMWEOUEBRE-GPIVLXJGSA-N inositol Chemical compound O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O CDAISMWEOUEBRE-GPIVLXJGSA-N 0.000 description 1
- 229960000367 inositol Drugs 0.000 description 1
- 102000006495 integrins Human genes 0.000 description 1
- 108010044426 integrins Proteins 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 210000002570 interstitial cell Anatomy 0.000 description 1
- 201000009019 intestinal benign neoplasm Diseases 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 210000001117 keloid Anatomy 0.000 description 1
- 208000022013 kidney Wilms tumor Diseases 0.000 description 1
- 229960004891 lapatinib Drugs 0.000 description 1
- BCFGMOOMADDAQU-UHFFFAOYSA-N lapatinib Chemical compound O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 BCFGMOOMADDAQU-UHFFFAOYSA-N 0.000 description 1
- 210000002429 large intestine Anatomy 0.000 description 1
- 201000005264 laryngeal carcinoma Diseases 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 208000012987 lip and oral cavity carcinoma Diseases 0.000 description 1
- 206010024627 liposarcoma Diseases 0.000 description 1
- 230000033001 locomotion Effects 0.000 description 1
- 230000009063 long-term regulation Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 201000005202 lung cancer Diseases 0.000 description 1
- 208000020816 lung neoplasm Diseases 0.000 description 1
- 230000000527 lymphocytic effect Effects 0.000 description 1
- 208000025036 lymphosarcoma Diseases 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- YCCXQARVHOPWFJ-UHFFFAOYSA-M magnesium;ethane;chloride Chemical compound [Mg+2].[Cl-].[CH2-]C YCCXQARVHOPWFJ-UHFFFAOYSA-M 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- WFFQYWAAEWLHJC-UHFFFAOYSA-N mercaptopurine hydrate Chemical compound O.S=C1NC=NC2=C1NC=N2 WFFQYWAAEWLHJC-UHFFFAOYSA-N 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 230000031864 metaphase Effects 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- 208000011645 metastatic carcinoma Diseases 0.000 description 1
- 208000021039 metastatic melanoma Diseases 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- BKBBTCORRZMASO-ZOWNYOTGSA-M methotrexate monosodium Chemical compound [Na+].C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C([O-])=O)C=C1 BKBBTCORRZMASO-ZOWNYOTGSA-M 0.000 description 1
- 229960003058 methotrexate sodium Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- ZUVAACFIEPYYOP-UHFFFAOYSA-N methoxycyclopropane Chemical compound COC1CC1 ZUVAACFIEPYYOP-UHFFFAOYSA-N 0.000 description 1
- QHNQZPFKGBKHQM-UHFFFAOYSA-N methyl 5-(diethylamino)-4-methylthiophene-3-carboxylate Chemical compound CCN(CC)c1scc(C(=O)OC)c1C QHNQZPFKGBKHQM-UHFFFAOYSA-N 0.000 description 1
- NNQTUMGJWXJMIR-UHFFFAOYSA-N methyl 5-aminothiophene-2-carboxylate Chemical compound COC(=O)C1=CC=C(N)S1 NNQTUMGJWXJMIR-UHFFFAOYSA-N 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical class COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000035773 mitosis phase Effects 0.000 description 1
- 230000001333 moisturizer Effects 0.000 description 1
- 201000005962 mycosis fungoides Diseases 0.000 description 1
- 208000009091 myxoma Diseases 0.000 description 1
- BXGTVNLGPMZLAZ-UHFFFAOYSA-N n'-ethylmethanediimine;hydrochloride Chemical compound Cl.CCN=C=N BXGTVNLGPMZLAZ-UHFFFAOYSA-N 0.000 description 1
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 description 1
- ZZWWTDIYKHELAP-UHFFFAOYSA-N n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-3-methyl-4-propan-2-yloxythiophene-2-carboxamide Chemical compound CC(C)OC1=CSC(C(=O)NCC=2C(NC(C)=CC=2C)=O)=C1C ZZWWTDIYKHELAP-UHFFFAOYSA-N 0.000 description 1
- KVWSOQMUSXAHGJ-YAXRCOADSA-N n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-4-methyl-5-[(e)-1-piperidin-4-ylprop-1-enyl]thiophene-3-carboxamide Chemical compound S1C=C(C(=O)NCC=2C(NC(C)=CC=2C)=O)C(C)=C1C(=C/C)/C1CCNCC1 KVWSOQMUSXAHGJ-YAXRCOADSA-N 0.000 description 1
- IESJTEZXBWQDBI-UHFFFAOYSA-N n-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methyl]-5-[ethyl(oxan-4-yl)amino]-1,4-dimethylpyrazole-3-carboxamide Chemical compound CC=1C(C(=O)NCC=2C(NC(C)=CC=2C)=O)=NN(C)C=1N(CC)C1CCOCC1 IESJTEZXBWQDBI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical class C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 201000008026 nephroblastoma Diseases 0.000 description 1
- 231100000417 nephrotoxicity Toxicity 0.000 description 1
- 230000007694 nephrotoxicity Effects 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- 108091027963 non-coding RNA Proteins 0.000 description 1
- 102000042567 non-coding RNA Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical class CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 201000008482 osteoarthritis Diseases 0.000 description 1
- 231100000262 ototoxicity Toxicity 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 229940116315 oxalic acid Drugs 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- AHVQYHFYQWKUKB-UHFFFAOYSA-N oxan-4-amine Chemical compound NC1CCOCC1 AHVQYHFYQWKUKB-UHFFFAOYSA-N 0.000 description 1
- NIEBLDGMZQPDKD-UHFFFAOYSA-N oxan-4-ylmethylhydrazine;dihydrochloride Chemical compound Cl.Cl.NNCC1CCOCC1 NIEBLDGMZQPDKD-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 238000006385 ozonation reaction Methods 0.000 description 1
- 235000012771 pancakes Nutrition 0.000 description 1
- 201000002528 pancreatic cancer Diseases 0.000 description 1
- 208000008443 pancreatic carcinoma Diseases 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 229960000639 pazopanib Drugs 0.000 description 1
- CUIHSIWYWATEQL-UHFFFAOYSA-N pazopanib Chemical compound C1=CC2=C(C)N(C)N=C2C=C1N(C)C(N=1)=CC=NC=1NC1=CC=C(C)C(S(N)(=O)=O)=C1 CUIHSIWYWATEQL-UHFFFAOYSA-N 0.000 description 1
- FPVKHBSQESCIEP-JQCXWYLXSA-N pentostatin Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(N=CNC[C@H]2O)=C2N=C1 FPVKHBSQESCIEP-JQCXWYLXSA-N 0.000 description 1
- 229960002340 pentostatin Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000035790 physiological processes and functions Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 150000003057 platinum Chemical class 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 231100000374 pneumotoxicity Toxicity 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 208000030761 polycystic kidney disease Diseases 0.000 description 1
- 239000003910 polypeptide antibiotic agent Substances 0.000 description 1
- 230000004481 post-translational protein modification Effects 0.000 description 1
- KPVDCSQDMWNKQQ-UHFFFAOYSA-M potassium;3-cyano-1-ethoxy-1-oxobut-2-en-2-olate Chemical compound [K+].CCOC(=O)C([O-])=C(C)C#N KPVDCSQDMWNKQQ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 208000025638 primary cutaneous T-cell non-Hodgkin lymphoma Diseases 0.000 description 1
- 230000000861 pro-apoptotic effect Effects 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical class CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000006410 propenylene group Chemical group 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 201000001514 prostate carcinoma Diseases 0.000 description 1
- 238000011471 prostatectomy Methods 0.000 description 1
- 108060006633 protein kinase Proteins 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 230000007047 pulmonary toxicity Effects 0.000 description 1
- 239000002213 purine nucleotide Substances 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- NYCVCXMSZNOGDH-UHFFFAOYSA-N pyrrolidine-1-carboxylic acid Chemical compound OC(=O)N1CCCC1 NYCVCXMSZNOGDH-UHFFFAOYSA-N 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 229960000948 quinine Drugs 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 206010038038 rectal cancer Diseases 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 201000001275 rectum cancer Diseases 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- 230000003362 replicative effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- CDAISMWEOUEBRE-UHFFFAOYSA-N scyllo-inosotol Natural products OC1C(O)C(O)C(O)C(O)C1O CDAISMWEOUEBRE-UHFFFAOYSA-N 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000009094 second-line therapy Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 238000002603 single-photon emission computed tomography Methods 0.000 description 1
- 230000005783 single-strand break Effects 0.000 description 1
- 231100000438 skin toxicity Toxicity 0.000 description 1
- 210000003625 skull Anatomy 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- WGRULTCAYDOGQK-UHFFFAOYSA-M sodium;sodium;hydroxide Chemical compound [OH-].[Na].[Na+] WGRULTCAYDOGQK-UHFFFAOYSA-M 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 229960003787 sorafenib Drugs 0.000 description 1
- 210000000278 spinal cord Anatomy 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- LZCVVMQABORALM-UHFFFAOYSA-N spiro[2.5]octyl Chemical group [CH]1CC11CCCCC1 LZCVVMQABORALM-UHFFFAOYSA-N 0.000 description 1
- LMUMMJCCZMWLEN-UHFFFAOYSA-N spiro[3.3]heptyl Chemical group [CH]1CCC11CCC1 LMUMMJCCZMWLEN-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical group S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 229910052815 sulfur oxide Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- WINHZLLDWRZWRT-ATVHPVEESA-N sunitinib Chemical compound CCN(CC)CCNC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C WINHZLLDWRZWRT-ATVHPVEESA-N 0.000 description 1
- 229960001796 sunitinib Drugs 0.000 description 1
- 230000003319 supportive effect Effects 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- DKPFODGZWDEEBT-QFIAKTPHSA-N taxane Chemical class C([C@]1(C)CCC[C@@H](C)[C@H]1C1)C[C@H]2[C@H](C)CC[C@@H]1C2(C)C DKPFODGZWDEEBT-QFIAKTPHSA-N 0.000 description 1
- 150000004579 taxol derivatives Chemical class 0.000 description 1
- 208000001608 teratocarcinoma Diseases 0.000 description 1
- 150000003505 terpenes Chemical class 0.000 description 1
- 235000007586 terpenes Nutrition 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WEWBQPFPCRBHDO-UHFFFAOYSA-N tert-butyl 3-[4-[(4,6-dimethyl-2-oxo-1h-pyridin-3-yl)methylcarbamoyl]-3-methylthiophen-2-yl]pyrrolidine-1-carboxylate Chemical compound CC=1C(C(=O)NCC=2C(NC(C)=CC=2C)=O)=CSC=1C1CCN(C(=O)OC(C)(C)C)C1 WEWBQPFPCRBHDO-UHFFFAOYSA-N 0.000 description 1
- JBWDZHQUEVDQTA-UHFFFAOYSA-N tert-butyl 4-[1-[4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylcarbamoyl]-3-methylthiophen-2-yl]propylidene]piperidine-1-carboxylate Chemical compound CCC(c1scc(C(=O)NCc2c(C)cc(C)[nH]c2=O)c1C)=C1CCN(CC1)C(=O)OC(C)(C)C JBWDZHQUEVDQTA-UHFFFAOYSA-N 0.000 description 1
- HWTFKGHPEWQQLA-UHFFFAOYSA-N tert-butyl 4-[4-[4-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methylcarbamoyl]-3-methylthiophen-2-yl]pyrazol-1-yl]piperidine-1-carboxylate Chemical compound Cc1c(csc1-c1cnn(c1)C1CCN(CC1)C(=O)OC(C)(C)C)C(=O)NCc1c(C)cc(C)[nH]c1=O HWTFKGHPEWQQLA-UHFFFAOYSA-N 0.000 description 1
- LZRDHSFPLUWYAX-UHFFFAOYSA-N tert-butyl 4-aminopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(N)CC1 LZRDHSFPLUWYAX-UHFFFAOYSA-N 0.000 description 1
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 1
- GPDBIGSFXXKWQR-UHFFFAOYSA-N tert-butyl n-(4-formylcyclohexyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1CCC(C=O)CC1 GPDBIGSFXXKWQR-UHFFFAOYSA-N 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 238000011285 therapeutic regimen Methods 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- GYICYQJEVCIYJY-UHFFFAOYSA-N thiophen-1-ylidenemethanone Chemical compound O=C=S1C=CC=C1 GYICYQJEVCIYJY-UHFFFAOYSA-N 0.000 description 1
- DENPQNAWGQXKCU-UHFFFAOYSA-N thiophene-2-carboxamide Chemical compound NC(=O)C1=CC=CS1 DENPQNAWGQXKCU-UHFFFAOYSA-N 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000003325 tomography Methods 0.000 description 1
- JHHZQADGLDKIPM-UHFFFAOYSA-N trans-hept-3-en-2-one Natural products CCCC=CC(C)=O JHHZQADGLDKIPM-UHFFFAOYSA-N 0.000 description 1
- 206010044412 transitional cell carcinoma Diseases 0.000 description 1
- 229960000575 trastuzumab Drugs 0.000 description 1
- OVCXRBARSPBVMC-UHFFFAOYSA-N triazolopyridine Chemical compound C=1N2C(C(C)C)=NN=C2C=CC=1C=1OC=NC=1C1=CC=C(F)C=C1 OVCXRBARSPBVMC-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 235000011178 triphosphate Nutrition 0.000 description 1
- 125000002264 triphosphate group Chemical class [H]OP(=O)(O[H])OP(=O)(O[H])OP(=O)(O[H])O* 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- 208000022271 tubular adenoma Diseases 0.000 description 1
- 230000004614 tumor growth Effects 0.000 description 1
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 1
- 239000005483 tyrosine kinase inhibitor Substances 0.000 description 1
- 238000000825 ultraviolet detection Methods 0.000 description 1
- 210000003708 urethra Anatomy 0.000 description 1
- 201000005112 urinary bladder cancer Diseases 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 229960005486 vaccine Drugs 0.000 description 1
- 229950000578 vatalanib Drugs 0.000 description 1
- YCOYDOIWSSHVCK-UHFFFAOYSA-N vatalanib Chemical compound C1=CC(Cl)=CC=C1NC(C1=CC=CC=C11)=NN=C1CC1=CC=NC=C1 YCOYDOIWSSHVCK-UHFFFAOYSA-N 0.000 description 1
- 208000009540 villous adenoma Diseases 0.000 description 1
- 229960002166 vinorelbine tartrate Drugs 0.000 description 1
- GBABOYUKABKIAF-IWWDSPBFSA-N vinorelbinetartrate Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC(C23[C@H]([C@@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-IWWDSPBFSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- WAEXFXRVDQXREF-UHFFFAOYSA-N vorinostat Chemical compound ONC(=O)CCCCCCC(=O)NC1=CC=CC=C1 WAEXFXRVDQXREF-UHFFFAOYSA-N 0.000 description 1
- 229960000237 vorinostat Drugs 0.000 description 1
- 235000012773 waffles Nutrition 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 1
- GDJZZWYLFXAGFH-UHFFFAOYSA-M xylenesulfonate group Chemical group C1(C(C=CC=C1)C)(C)S(=O)(=O)[O-] GDJZZWYLFXAGFH-UHFFFAOYSA-M 0.000 description 1
- CITILBVTAYEWKR-UHFFFAOYSA-L zinc trifluoromethanesulfonate Substances [Zn+2].[O-]S(=O)(=O)C(F)(F)F.[O-]S(=O)(=O)C(F)(F)F CITILBVTAYEWKR-UHFFFAOYSA-L 0.000 description 1
- ZMLPZCGHASSGEA-UHFFFAOYSA-M zinc trifluoromethanesulfonate Chemical compound [Zn+2].[O-]S(=O)(=O)C(F)(F)F ZMLPZCGHASSGEA-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Hematology (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Epidemiology (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201361817436P | 2013-04-30 | 2013-04-30 | |
| US201361842038P | 2013-07-02 | 2013-07-02 | |
| US201361907024P | 2013-11-21 | 2013-11-21 | |
| US201461936460P | 2014-02-06 | 2014-02-06 | |
| PCT/IB2014/061012 WO2014177982A1 (en) | 2013-04-30 | 2014-04-25 | Enhancer of zeste homolog 2 inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA201592068A1 EA201592068A1 (ru) | 2016-05-31 |
| EA030196B1 true EA030196B1 (ru) | 2018-07-31 |
Family
ID=50877537
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA201592068A EA030196B1 (ru) | 2013-04-30 | 2014-04-25 | Ингибиторы энхансера zeste гомолога 2 |
Country Status (20)
| Country | Link |
|---|---|
| US (2) | US9505745B2 (enExample) |
| EP (1) | EP2991980B1 (enExample) |
| JP (1) | JP6373973B2 (enExample) |
| KR (1) | KR20160003115A (enExample) |
| CN (1) | CN105308038B (enExample) |
| AU (1) | AU2014261075B2 (enExample) |
| BR (1) | BR112015027527A2 (enExample) |
| CA (1) | CA2910873A1 (enExample) |
| CL (1) | CL2015003200A1 (enExample) |
| DO (1) | DOP2015000270A (enExample) |
| EA (1) | EA030196B1 (enExample) |
| ES (1) | ES2717680T3 (enExample) |
| HK (1) | HK1214815A1 (enExample) |
| MX (1) | MX2015015144A (enExample) |
| NZ (1) | NZ630205A (enExample) |
| PE (1) | PE20151981A1 (enExample) |
| PH (1) | PH12015502414A1 (enExample) |
| SG (1) | SG11201508203TA (enExample) |
| WO (1) | WO2014177982A1 (enExample) |
| ZA (1) | ZA201507398B (enExample) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013120104A2 (en) * | 2012-02-10 | 2013-08-15 | Constellation Pharmaceuticals | Modulators of methyl modifying enzymes, compositions and uses thereof |
| CA2887243C (en) | 2012-10-15 | 2024-04-09 | Epizyme, Inc. | Methods of treating cancer |
| US9505745B2 (en) * | 2013-04-30 | 2016-11-29 | Glaxosmithkline Intellectual Property (No. 2) Limited | Enhancer of zeste homolog 2 inhibitors |
| ES2640386T3 (es) | 2013-07-10 | 2017-11-02 | Glaxosmithkline Intellectual Property (No. 2) Limited | Potenciador de inhibidores del homólogo Zeste 2 |
| PL3102568T3 (pl) | 2014-02-06 | 2019-01-31 | Heptares Therapeutics Limited | Bicykliczne związki aza w postaci agonistów receptorów muskarynowych m1 |
| CN107148419A (zh) * | 2014-10-28 | 2017-09-08 | 葛兰素史密斯克莱知识产权(第2 号)有限公司 | Zeste增强子同源物2抑制剂 |
| AR102767A1 (es) * | 2014-12-05 | 2017-03-22 | Lilly Co Eli | Inhibidores de ezh2 |
| TW201708210A (zh) * | 2015-06-30 | 2017-03-01 | 葛蘭素史克智慧財產(第二)有限公司 | Zeste同源物2增強子之抑制劑 |
| MX2018002344A (es) | 2015-08-24 | 2018-07-06 | Epizyme Inc | Metodo para tratar el cancer. |
| TW201718598A (zh) | 2015-08-27 | 2017-06-01 | 美國禮來大藥廠 | Ezh2抑制劑 |
| US20190070188A1 (en) * | 2015-11-06 | 2019-03-07 | Epizyme, Inc. | Pediatric dosing for treatment of cancer with an ezh2 inhibitor |
| DK3378859T3 (da) | 2015-11-19 | 2020-01-20 | Jiangsu Hengrui Medicine Co | Benzofuranderivater, fremgangsmåde til fremstilling deraf og anvendelse deraf i medicin |
| SG11201809560QA (en) * | 2016-05-05 | 2018-11-29 | Glaxosmithkline Ip No 2 Ltd | Enhancer of zeste homolog 2 inhibitors |
| US20170337814A1 (en) * | 2016-05-20 | 2017-11-23 | Donald Edward Morgan | Safety alerting drivers device and system |
| US10968215B2 (en) | 2016-09-07 | 2021-04-06 | Shanghai Haihe Pharmaceutical Co., Ltd. | Pyrido five-element aromatic ring compound, preparation method therefor and use thereof |
| US20190367457A1 (en) | 2016-12-30 | 2019-12-05 | Mitobridge, Inc. | Oxopyridine derivatives useful as aminocarboxymuconate semialdehyde decarboxylase (acmsd) inhibitors |
| US10266542B2 (en) | 2017-03-15 | 2019-04-23 | Mirati Therapeutics, Inc. | EZH2 inhibitors |
| NZ766447A (en) | 2018-01-31 | 2021-12-24 | Mirati Therapeutics Inc | Prc2 inhibitors |
| EP3823671B1 (en) | 2018-07-09 | 2024-02-07 | Fondation Asile Des Aveugles | Inhibition of prc2 subunits to treat eye disorders |
| WO2020219448A1 (en) | 2019-04-22 | 2020-10-29 | Mirati Therapeutics, Inc. | Naphthyridine derivatives as prc2 inhibitors |
| SG11202110085TA (en) * | 2019-05-31 | 2021-10-28 | Sichuan Haisco Pharmaceutical Co Ltd | Btk inhibitor ring derivative, preparation method therefor and pharmaceutical application thereof |
| JP7541538B2 (ja) | 2019-06-05 | 2024-08-28 | ミラティ セラピューティクス,インク. | 癌を処置するためのprc2阻害剤としてのイミダゾ[1,2-c]ピリミジン誘導体 |
| US20220298222A1 (en) | 2019-08-22 | 2022-09-22 | Juno Therapeutics, Inc. | Combination therapy of a t cell therapy and an enhancer of zeste homolog 2 (ezh2) inhibitor and related methods |
| CN110964200A (zh) * | 2019-12-19 | 2020-04-07 | 新纳奇材料科技江苏有限公司 | 一种基于聚硅氧烷馏出物的羟基封端聚硅氧烷的制备方法 |
| WO2021129629A1 (zh) * | 2019-12-23 | 2021-07-01 | 四川海思科制药有限公司 | Zeste增强子同源物2抑制剂及其用途 |
| CN111233768B (zh) * | 2020-03-18 | 2021-08-03 | 徐州圣元化工有限公司 | 一种3-(二氟甲基)-1-甲基-1h-吡唑-4-羧酸乙酯的制备方法 |
| TW202404581A (zh) | 2022-05-25 | 2024-02-01 | 美商醫肯納腫瘤學公司 | Mek抑制劑及其用途 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013049770A2 (en) * | 2011-09-30 | 2013-04-04 | Glaxosmithkline Llc | Methods of treating cancer |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1708697A4 (en) * | 2004-01-30 | 2007-11-28 | Smithkline Beecham Corp | CHEMICAL COMPOUNDS |
| RU2006138036A (ru) * | 2004-03-30 | 2008-05-10 | Чирон Корпорейшн (Us) | Производные замещенного тиофена в качестве противораковых средств |
| US7696352B2 (en) * | 2004-06-18 | 2010-04-13 | Millennium Pharmaceuticals, Inc. | Factor Xa inhibitors |
| JP2009519966A (ja) | 2005-12-14 | 2009-05-21 | ブリストル−マイヤーズ スクイブ カンパニー | セリンプロテアーゼ阻害剤として有用な6員ヘテロ環 |
| US9023847B2 (en) * | 2009-08-07 | 2015-05-05 | Merck Patent Gmbh | Azaheterocyclic compounds |
| EA023788B1 (ru) | 2010-05-07 | 2016-07-29 | ГЛЭКСОСМИТКЛАЙН ЭлЭлСи | Производные индола и фармацевтические композиции на их основе |
| ES2528269T3 (es) | 2010-05-07 | 2015-02-06 | Glaxosmithkline Llc | Azaindazoles |
| JP5864546B2 (ja) | 2010-05-07 | 2016-02-17 | グラクソスミスクライン・リミテッド・ライアビリティ・カンパニーGlaxoSmithKline LLC | インダゾール |
| JP5908493B2 (ja) | 2010-12-01 | 2016-04-26 | グラクソスミスクライン・リミテッド・ライアビリティ・カンパニーGlaxoSmithKline LLC | インドール |
| EP3323820B1 (en) * | 2011-02-28 | 2023-05-10 | Epizyme, Inc. | Substituted 6,5-fused bicyclic heteroaryl compounds |
| TW201733984A (zh) | 2011-04-13 | 2017-10-01 | 雅酶股份有限公司 | 經取代之苯化合物 |
| JO3438B1 (ar) | 2011-04-13 | 2019-10-20 | Epizyme Inc | مركبات بنزين مستبدلة بأريل أو أريل غير متجانس |
| WO2013120104A2 (en) | 2012-02-10 | 2013-08-15 | Constellation Pharmaceuticals | Modulators of methyl modifying enzymes, compositions and uses thereof |
| IL296199B2 (en) | 2012-04-13 | 2024-12-01 | Eisai R&D Man Co Ltd | Salt form of a human hi stone methyltransf erase ezh2 inhibitor |
| US9562041B2 (en) | 2012-05-16 | 2017-02-07 | Glaxosmithkline Llc | Enhancer of zeste homolog 2 inhibitors |
| US9505745B2 (en) * | 2013-04-30 | 2016-11-29 | Glaxosmithkline Intellectual Property (No. 2) Limited | Enhancer of zeste homolog 2 inhibitors |
-
2014
- 2014-04-25 US US14/787,866 patent/US9505745B2/en not_active Expired - Fee Related
- 2014-04-25 ES ES14727619T patent/ES2717680T3/es active Active
- 2014-04-25 NZ NZ630205A patent/NZ630205A/en not_active IP Right Cessation
- 2014-04-25 WO PCT/IB2014/061012 patent/WO2014177982A1/en not_active Ceased
- 2014-04-25 CN CN201480033093.6A patent/CN105308038B/zh not_active Expired - Fee Related
- 2014-04-25 CA CA2910873A patent/CA2910873A1/en not_active Abandoned
- 2014-04-25 AU AU2014261075A patent/AU2014261075B2/en not_active Ceased
- 2014-04-25 KR KR1020157033651A patent/KR20160003115A/ko not_active Ceased
- 2014-04-25 MX MX2015015144A patent/MX2015015144A/es unknown
- 2014-04-25 BR BR112015027527A patent/BR112015027527A2/pt not_active IP Right Cessation
- 2014-04-25 PE PE2015002298A patent/PE20151981A1/es not_active Application Discontinuation
- 2014-04-25 SG SG11201508203TA patent/SG11201508203TA/en unknown
- 2014-04-25 HK HK16102708.1A patent/HK1214815A1/zh unknown
- 2014-04-25 EA EA201592068A patent/EA030196B1/ru not_active IP Right Cessation
- 2014-04-25 JP JP2016511152A patent/JP6373973B2/ja not_active Expired - Fee Related
- 2014-04-25 EP EP14727619.0A patent/EP2991980B1/en active Active
-
2015
- 2015-10-06 ZA ZA2015/07398A patent/ZA201507398B/en unknown
- 2015-10-19 PH PH12015502414A patent/PH12015502414A1/en unknown
- 2015-10-30 DO DO2015000270A patent/DOP2015000270A/es unknown
- 2015-10-30 CL CL2015003200A patent/CL2015003200A1/es unknown
-
2016
- 2016-10-13 US US15/292,200 patent/US9790212B2/en not_active Expired - Fee Related
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2013049770A2 (en) * | 2011-09-30 | 2013-04-04 | Glaxosmithkline Llc | Methods of treating cancer |
Non-Patent Citations (6)
| Title |
|---|
| CHEMICAL ABSTRACTS, Columbus, Ohio, US; XP002726952 * |
| CHEMICAL ABSTRACTS, Columbus, Ohio, US; XP002726953 * |
| CHEMICAL ABSTRACTS, Columbus, Ohio, US; XP002726954 * |
| CHEMICAL ABSTRACTS, Columbus, Ohio, US; XP002726956 * |
| CHEMICAL ABSTRACTS, Columbus, Ohio, US; XP002726957 * |
| DATABASE REGISTRY [online] CHEMICAL ABSTRACTS SERVICE, COLUMBUS, OHIO, US; XP002726955, retrieved from STN * |
Also Published As
| Publication number | Publication date |
|---|---|
| CA2910873A1 (en) | 2014-11-06 |
| JP6373973B2 (ja) | 2018-08-15 |
| BR112015027527A2 (pt) | 2017-07-25 |
| PE20151981A1 (es) | 2016-01-14 |
| EA201592068A1 (ru) | 2016-05-31 |
| ES2717680T3 (es) | 2019-06-24 |
| JP2016517878A (ja) | 2016-06-20 |
| HK1214815A1 (zh) | 2016-08-05 |
| US9790212B2 (en) | 2017-10-17 |
| PH12015502414A1 (en) | 2016-02-22 |
| US20170029412A1 (en) | 2017-02-02 |
| US20160102083A1 (en) | 2016-04-14 |
| AU2014261075A1 (en) | 2015-11-05 |
| EP2991980A1 (en) | 2016-03-09 |
| ZA201507398B (en) | 2017-01-25 |
| US9505745B2 (en) | 2016-11-29 |
| CL2015003200A1 (es) | 2016-04-22 |
| NZ630205A (en) | 2017-03-31 |
| MX2015015144A (es) | 2016-02-18 |
| DOP2015000270A (es) | 2016-02-15 |
| EP2991980B1 (en) | 2019-01-02 |
| SG11201508203TA (en) | 2015-11-27 |
| WO2014177982A1 (en) | 2014-11-06 |
| KR20160003115A (ko) | 2016-01-08 |
| AU2014261075B2 (en) | 2017-01-19 |
| CN105308038B (zh) | 2018-05-29 |
| CN105308038A (zh) | 2016-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EA030196B1 (ru) | Ингибиторы энхансера zeste гомолога 2 | |
| AU2017283790B2 (en) | Substituted pyridines as inhibitors of DNMT1 | |
| JP6133291B2 (ja) | ピラゾロ[3,4−c]ピリジン化合物と使用方法 | |
| CN109715634B (zh) | Menin-mll相互作用的稠合二环抑制剂 | |
| AU2021202973B2 (en) | Isoindolinone inhibitors of the MDM2-p53 interaction having anticancer activity | |
| TW202146412A (zh) | 用於標靶降解brd9之化合物 | |
| ES2905118T3 (es) | Inhibidores de la c-fms quinasa | |
| AU2014276417B2 (en) | Enhancer of Zeste Homolog 2 inhibitors | |
| SA518391218B1 (ar) | مثبطات أيزو إندولينون لتفاعل mdm2-p53 ذات نشاط مضاد للسرطان | |
| RS63201B1 (sr) | Antibakterijska jedinjenja | |
| EP2566327A1 (en) | Indoles | |
| CN102086211A (zh) | 作为蛋白激酶抑制剂的芳杂环化合物 | |
| AU2020400010B2 (en) | Heterocyclic compounds as modulators of Stimulator of Interferon Genes (STING) | |
| AU2015334914A1 (en) | New thienopyrimidine derivatives as NIK inhibitors | |
| JP2023535932A (ja) | 三環式のヘテロ環 | |
| KR20260023023A (ko) | Wrn 억제제 | |
| TW202317087A (zh) | 用於治療與sting活性相關病況之化合物及組合物 | |
| JP2007530645A (ja) | 新規なピロロ(2,3−b)ピリジン誘導体、製造およびキナーゼ阻害薬の形態でのそれの医薬的使用 | |
| RU2831403C1 (ru) | Соединение, имеющее ингибирующую активность в отношении киназ | |
| EA045404B1 (ru) | Конденсированные бициклические ингибиторы взаимодействия менин-mll | |
| EA045364B1 (ru) | Спиробициклические ингибиторы взаимодействия менин-mll | |
| NZ747748A (en) | Substituted pyridines as inhibitors of dnmt1 | |
| HK1259899A1 (en) | Substituted thiohydantoin derivatives as androgen receptor antagonists | |
| SA108290827B1 (ar) | مشتقات ثنائية الحلقة من أجل الاستخدام في علاج الحالات المتعلقة بمستقبل الأندروجين - 155 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG TJ TM |
|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): RU |