EA027544B1 - Способ получения замещенных триазолопиридинов - Google Patents
Способ получения замещенных триазолопиридинов Download PDFInfo
- Publication number
- EA027544B1 EA027544B1 EA201590116A EA201590116A EA027544B1 EA 027544 B1 EA027544 B1 EA 027544B1 EA 201590116 A EA201590116 A EA 201590116A EA 201590116 A EA201590116 A EA 201590116A EA 027544 B1 EA027544 B1 EA 027544B1
- Authority
- EA
- Eurasian Patent Office
- Prior art keywords
- amino
- phenyl
- triazolo
- compound
- pyridin
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 78
- 150000008523 triazolopyridines Chemical class 0.000 title abstract description 7
- 150000001875 compounds Chemical class 0.000 claims description 557
- 239000000203 mixture Substances 0.000 claims description 226
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 215
- -1 methoxy, ethoxy Chemical group 0.000 claims description 213
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 182
- 238000004519 manufacturing process Methods 0.000 claims description 79
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 71
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 60
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 49
- 238000006243 chemical reaction Methods 0.000 claims description 41
- 125000004939 6-pyridyl group Chemical group N1=CC=CC=C1* 0.000 claims description 26
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 25
- 229910052801 chlorine Inorganic materials 0.000 claims description 24
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims description 14
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 10
- LKJPYSCBVHEWIU-UHFFFAOYSA-N N-[4-cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)sulfonyl]-2-hydroxy-2-methylpropanamide Chemical compound C=1C=C(C#N)C(C(F)(F)F)=CC=1NC(=O)C(O)(C)CS(=O)(=O)C1=CC=C(F)C=C1 LKJPYSCBVHEWIU-UHFFFAOYSA-N 0.000 claims description 10
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 10
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 7
- 125000004793 2,2,2-trifluoroethoxy group Chemical group FC(CO*)(F)F 0.000 claims description 6
- IMNDHOCGZLYMRO-UHFFFAOYSA-N n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=CC=C1 IMNDHOCGZLYMRO-UHFFFAOYSA-N 0.000 claims description 6
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 5
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- MWDZXUOUTGAFAL-UHFFFAOYSA-N n-(2,2,2-trifluoroethyl)benzamide Chemical compound FC(F)(F)CNC(=O)C1=CC=CC=C1 MWDZXUOUTGAFAL-UHFFFAOYSA-N 0.000 claims description 2
- 238000009472 formulation Methods 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 174
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 162
- 239000002904 solvent Substances 0.000 description 132
- 230000015572 biosynthetic process Effects 0.000 description 126
- 239000000543 intermediate Substances 0.000 description 126
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 118
- 238000003786 synthesis reaction Methods 0.000 description 114
- 239000000243 solution Substances 0.000 description 111
- 229910052736 halogen Inorganic materials 0.000 description 109
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 88
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 88
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 77
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 75
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 69
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 57
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 57
- 238000010898 silica gel chromatography Methods 0.000 description 53
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 50
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 50
- 239000007787 solid Substances 0.000 description 49
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 48
- 238000005160 1H NMR spectroscopy Methods 0.000 description 46
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 46
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 46
- 229910052938 sodium sulfate Inorganic materials 0.000 description 46
- 235000011152 sodium sulphate Nutrition 0.000 description 46
- 125000005843 halogen group Chemical group 0.000 description 45
- 239000012074 organic phase Substances 0.000 description 45
- 238000005481 NMR spectroscopy Methods 0.000 description 44
- 210000004027 cell Anatomy 0.000 description 43
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 42
- 239000000725 suspension Substances 0.000 description 42
- 239000012047 saturated solution Substances 0.000 description 41
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 40
- 150000002367 halogens Chemical class 0.000 description 39
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 37
- 150000001412 amines Chemical class 0.000 description 36
- 239000012071 phase Substances 0.000 description 36
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 36
- 239000011780 sodium chloride Substances 0.000 description 33
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 32
- 238000002474 experimental method Methods 0.000 description 32
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 30
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 30
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 30
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 29
- 108091000080 Phosphotransferase Proteins 0.000 description 29
- 102000020233 phosphotransferase Human genes 0.000 description 29
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 29
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 28
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 26
- 229910052786 argon Inorganic materials 0.000 description 25
- 125000004432 carbon atom Chemical group C* 0.000 description 24
- 229910000027 potassium carbonate Inorganic materials 0.000 description 24
- 239000011541 reaction mixture Substances 0.000 description 24
- 230000014759 maintenance of location Effects 0.000 description 21
- 238000002360 preparation method Methods 0.000 description 21
- 238000010992 reflux Methods 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 20
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 20
- 125000001424 substituent group Chemical group 0.000 description 20
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 19
- 125000003118 aryl group Chemical group 0.000 description 19
- 238000000746 purification Methods 0.000 description 19
- 239000011877 solvent mixture Substances 0.000 description 19
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- 206010028980 Neoplasm Diseases 0.000 description 18
- 239000000460 chlorine Substances 0.000 description 18
- 229910000160 potassium phosphate Inorganic materials 0.000 description 18
- 235000011009 potassium phosphates Nutrition 0.000 description 18
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 17
- 239000000741 silica gel Substances 0.000 description 17
- 229910002027 silica gel Inorganic materials 0.000 description 17
- 239000003153 chemical reaction reagent Substances 0.000 description 16
- 238000001914 filtration Methods 0.000 description 16
- 229910052763 palladium Inorganic materials 0.000 description 16
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 16
- 235000017557 sodium bicarbonate Nutrition 0.000 description 16
- HUPVBFQYJHFONM-UHFFFAOYSA-N 2-(4-fluorophenyl)acetamide Chemical compound NC(=O)CC1=CC=C(F)C=C1 HUPVBFQYJHFONM-UHFFFAOYSA-N 0.000 description 15
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 15
- 238000007259 addition reaction Methods 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- 235000019253 formic acid Nutrition 0.000 description 15
- 230000000394 mitotic effect Effects 0.000 description 15
- 125000006239 protecting group Chemical group 0.000 description 15
- GWRSATNRNFYMDI-UHFFFAOYSA-N 4-[(9-cyclopentyl-7,7-difluoro-5-methyl-6-oxo-8h-pyrimido[4,5-b][1,4]diazepin-2-yl)amino]-2-fluoro-5-methoxy-n-(1-methylpiperidin-4-yl)benzamide Chemical compound FC=1C=C(NC=2N=C3N(C4CCCC4)CC(F)(F)C(=O)N(C)C3=CN=2)C(OC)=CC=1C(=O)NC1CCN(C)CC1 GWRSATNRNFYMDI-UHFFFAOYSA-N 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- IXSCGBODJGIJNN-UHFFFAOYSA-N 2-(4-fluorophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(F)C=C1 IXSCGBODJGIJNN-UHFFFAOYSA-N 0.000 description 13
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 13
- 150000001733 carboxylic acid esters Chemical class 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 13
- 229920006395 saturated elastomer Polymers 0.000 description 13
- FAQPQGSUTUTAGS-UHFFFAOYSA-N 3-(2,2,2-trifluoroethoxy)benzamide Chemical compound NC(=O)C1=CC=CC(OCC(F)(F)F)=C1 FAQPQGSUTUTAGS-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 12
- 125000004429 atom Chemical group 0.000 description 12
- GGXVVYDASQNSSG-UHFFFAOYSA-N 2-(4-fluorophenyl)propanamide Chemical compound NC(=O)C(C)C1=CC=C(F)C=C1 GGXVVYDASQNSSG-UHFFFAOYSA-N 0.000 description 11
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 11
- 229910052799 carbon Inorganic materials 0.000 description 11
- 125000004093 cyano group Chemical group *C#N 0.000 description 11
- 239000000758 substrate Substances 0.000 description 11
- UGOMMVLRQDMAQQ-UHFFFAOYSA-N xphos Chemical group CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 UGOMMVLRQDMAQQ-UHFFFAOYSA-N 0.000 description 11
- ZKHQWZAMYRWXGA-UHFFFAOYSA-N Adenosine triphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(=O)OP(O)(O)=O)C(O)C1O ZKHQWZAMYRWXGA-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 10
- 239000004327 boric acid Substances 0.000 description 10
- 125000001183 hydrocarbyl group Chemical group 0.000 description 10
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 10
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- XXUNIGZDNWWYED-UHFFFAOYSA-N 2-methylbenzamide Chemical compound CC1=CC=CC=C1C(N)=O XXUNIGZDNWWYED-UHFFFAOYSA-N 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 230000004663 cell proliferation Effects 0.000 description 9
- 239000012043 crude product Substances 0.000 description 9
- 201000010099 disease Diseases 0.000 description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 9
- 125000000524 functional group Chemical group 0.000 description 9
- 239000012442 inert solvent Substances 0.000 description 9
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical group COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 9
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 8
- 125000003545 alkoxy group Chemical group 0.000 description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 8
- 238000005859 coupling reaction Methods 0.000 description 8
- 125000005842 heteroatom Chemical group 0.000 description 8
- 239000003112 inhibitor Substances 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- 230000011278 mitosis Effects 0.000 description 8
- 108090000765 processed proteins & peptides Proteins 0.000 description 8
- 230000009466 transformation Effects 0.000 description 8
- 125000006714 (C3-C10) heterocyclyl group Chemical group 0.000 description 7
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 7
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 7
- 108010033040 Histones Proteins 0.000 description 7
- 229910052794 bromium Inorganic materials 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 238000001514 detection method Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000012634 fragment Substances 0.000 description 7
- 125000001072 heteroaryl group Chemical group 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 125000000037 tert-butyldiphenylsilyl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1[Si]([H])([*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 6
- VKPLPDIMEREJJF-UHFFFAOYSA-N 3-methoxybenzamide Chemical compound COC1=CC=CC(C(N)=O)=C1 VKPLPDIMEREJJF-UHFFFAOYSA-N 0.000 description 6
- UEVXVBKBOFGKIN-UHFFFAOYSA-N 4-bromo-3-methoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC=C1Br UEVXVBKBOFGKIN-UHFFFAOYSA-N 0.000 description 6
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 6
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 6
- 229910052693 Europium Inorganic materials 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 230000024932 T cell mediated immunity Effects 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- 229940098773 bovine serum albumin Drugs 0.000 description 6
- 230000010261 cell growth Effects 0.000 description 6
- 230000001413 cellular effect Effects 0.000 description 6
- 238000004296 chiral HPLC Methods 0.000 description 6
- 210000000349 chromosome Anatomy 0.000 description 6
- 239000013256 coordination polymer Substances 0.000 description 6
- 238000010790 dilution Methods 0.000 description 6
- 239000012895 dilution Substances 0.000 description 6
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 6
- 230000028709 inflammatory response Effects 0.000 description 6
- 210000004185 liver Anatomy 0.000 description 6
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 230000004083 survival effect Effects 0.000 description 6
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 5
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 5
- KYRVNWMVYQXFEU-UHFFFAOYSA-N Nocodazole Chemical compound C1=C2NC(NC(=O)OC)=NC2=CC=C1C(=O)C1=CC=CS1 KYRVNWMVYQXFEU-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 239000000872 buffer Substances 0.000 description 5
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 5
- 229910000024 caesium carbonate Inorganic materials 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 5
- 238000011534 incubation Methods 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 230000000155 isotopic effect Effects 0.000 description 5
- 125000002950 monocyclic group Chemical group 0.000 description 5
- 229950006344 nocodazole Drugs 0.000 description 5
- 239000011698 potassium fluoride Substances 0.000 description 5
- 235000003270 potassium fluoride Nutrition 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 5
- 238000000844 transformation Methods 0.000 description 5
- RMYYCPPLIIKPBI-UHFFFAOYSA-N 4-bromo-3-(2,2,2-trifluoroethoxy)benzoic acid Chemical compound OC(=O)C1=CC=C(Br)C(OCC(F)(F)F)=C1 RMYYCPPLIIKPBI-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 208000003174 Brain Neoplasms Diseases 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 4
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 4
- 206010027476 Metastases Diseases 0.000 description 4
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000001502 aryl halides Chemical class 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 230000008878 coupling Effects 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 125000000753 cycloalkyl group Chemical class 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 4
- 230000003301 hydrolyzing effect Effects 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 210000001853 liver microsome Anatomy 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 4
- 235000019345 sodium thiosulphate Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 3
- QDZZDVQGBKTLHV-UHFFFAOYSA-N (2,4-difluorophenyl)methanamine Chemical compound NCC1=CC=C(F)C=C1F QDZZDVQGBKTLHV-UHFFFAOYSA-N 0.000 description 3
- 125000006536 (C1-C2)alkoxy group Chemical group 0.000 description 3
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 3
- HUVAOAVBKOVPBZ-UHFFFAOYSA-N 2-bromo-5-fluorophenol Chemical compound OC1=CC(F)=CC=C1Br HUVAOAVBKOVPBZ-UHFFFAOYSA-N 0.000 description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 3
- 208000026310 Breast neoplasm Diseases 0.000 description 3
- 102100033636 Histone H3.2 Human genes 0.000 description 3
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 3
- 102000029749 Microtubule Human genes 0.000 description 3
- 108091022875 Microtubule Proteins 0.000 description 3
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-diisopropylethylamine Substances CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 3
- WXUONTNYMXVXLP-UHFFFAOYSA-N N-[4-[2-(2-methoxy-4-methylsulfonylanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]phenyl]propanamide Chemical compound CCC(=O)Nc1ccc(cc1)-c1ccc2nc(Nc3ccc(cc3OC)S(C)(=O)=O)nn2c1 WXUONTNYMXVXLP-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 206010039491 Sarcoma Diseases 0.000 description 3
- 108010090804 Streptavidin Proteins 0.000 description 3
- AYFVYJQAPQTCCC-UHFFFAOYSA-N Threonine Natural products CC(O)C(N)C(O)=O AYFVYJQAPQTCCC-UHFFFAOYSA-N 0.000 description 3
- 239000004473 Threonine Substances 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000008527 [1,2,4]triazolo-[1,5-a]pyridines Chemical class 0.000 description 3
- PHTMVIAGTMTVSK-UHFFFAOYSA-N [1,2,4]triazolo[1,5-a]pyridin-2-amine Chemical compound C1=CC=CN2N=C(N)N=C21 PHTMVIAGTMTVSK-UHFFFAOYSA-N 0.000 description 3
- DACWQSNZECJJGG-UHFFFAOYSA-N [1,2,4]triazolo[1,5-a]pyridine Chemical compound C1=CC=CN2N=CN=C21 DACWQSNZECJJGG-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 230000031016 anaphase Effects 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000010586 diagram Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 3
- BDTDECDAHYOJRO-UHFFFAOYSA-N ethyl n-(sulfanylidenemethylidene)carbamate Chemical compound CCOC(=O)N=C=S BDTDECDAHYOJRO-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- FATAVLOOLIRUNA-UHFFFAOYSA-N formylmethyl Chemical group [CH2]C=O FATAVLOOLIRUNA-UHFFFAOYSA-N 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 210000002415 kinetochore Anatomy 0.000 description 3
- 208000032839 leukemia Diseases 0.000 description 3
- 210000005265 lung cell Anatomy 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- 230000002503 metabolic effect Effects 0.000 description 3
- 230000003228 microsomal effect Effects 0.000 description 3
- 210000004688 microtubule Anatomy 0.000 description 3
- 239000008363 phosphate buffer Substances 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical class [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 230000002062 proliferating effect Effects 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 125000004076 pyridyl group Chemical group 0.000 description 3
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 3
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 3
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 3
- RMNIZOOYFMNEJJ-UHFFFAOYSA-K tripotassium;phosphate;hydrate Chemical compound O.[K+].[K+].[K+].[O-]P([O-])([O-])=O RMNIZOOYFMNEJJ-UHFFFAOYSA-K 0.000 description 3
- 125000004737 (C1-C6) haloalkoxy group Chemical group 0.000 description 2
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XPBAUEMRAAGQAJ-UHFFFAOYSA-N 1-bromo-2-methoxy-4-methylsulfanylbenzene Chemical compound COC1=CC(SC)=CC=C1Br XPBAUEMRAAGQAJ-UHFFFAOYSA-N 0.000 description 2
- KGYXKRGMSUHYCY-UHFFFAOYSA-N 1-bromo-4-fluoro-2-methoxybenzene Chemical compound COC1=CC(F)=CC=C1Br KGYXKRGMSUHYCY-UHFFFAOYSA-N 0.000 description 2
- NLWCWEGVNJVLAX-UHFFFAOYSA-N 1-methoxy-2-phenylbenzene Chemical compound COC1=CC=CC=C1C1=CC=CC=C1 NLWCWEGVNJVLAX-UHFFFAOYSA-N 0.000 description 2
- RTMMSCJWQYWMNK-UHFFFAOYSA-N 2,2,2-trifluoroethyl trifluoromethanesulfonate Chemical compound FC(F)(F)COS(=O)(=O)C(F)(F)F RTMMSCJWQYWMNK-UHFFFAOYSA-N 0.000 description 2
- 125000006507 2,4-difluorobenzyl group Chemical group [H]C1=C(F)C([H])=C(F)C(=C1[H])C([H])([H])* 0.000 description 2
- MNWSGMTUGXNYHJ-UHFFFAOYSA-N 2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(N)=O MNWSGMTUGXNYHJ-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- PXFUWRWCKSLCLS-UHFFFAOYSA-N 3-fluoroazetidine;hydron;chloride Chemical compound Cl.FC1CNC1 PXFUWRWCKSLCLS-UHFFFAOYSA-N 0.000 description 2
- FVOAKYSSAARGKC-UHFFFAOYSA-N 3-methylbenzamide Chemical compound [CH2]C1=CC=CC(C(N)=O)=C1 FVOAKYSSAARGKC-UHFFFAOYSA-N 0.000 description 2
- 125000001963 4 membered heterocyclic group Chemical group 0.000 description 2
- YHMZDFBWPAFJOJ-UHFFFAOYSA-N 4-bromo-3-methoxybenzamide Chemical compound COC1=CC(C(N)=O)=CC=C1Br YHMZDFBWPAFJOJ-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- ZKHQWZAMYRWXGA-KQYNXXCUSA-J ATP(4-) Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O ZKHQWZAMYRWXGA-KQYNXXCUSA-J 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VUWBMXNMKRWSEI-UHFFFAOYSA-N C1(CCCCC1)P(C1=C(C=CC=C1)C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)C1CCCCC1.[Cl] Chemical group C1(CCCCC1)P(C1=C(C=CC=C1)C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)C1CCCCC1.[Cl] VUWBMXNMKRWSEI-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 201000009030 Carcinoma Diseases 0.000 description 2
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 208000002699 Digestive System Neoplasms Diseases 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- 208000001976 Endocrine Gland Neoplasms Diseases 0.000 description 2
- 208000009849 Female Genital Neoplasms Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 206010025323 Lymphomas Diseases 0.000 description 2
- 206010059282 Metastases to central nervous system Diseases 0.000 description 2
- 201000003793 Myelodysplastic syndrome Diseases 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- 101100261999 Rattus norvegicus Tpsab1 gene Proteins 0.000 description 2
- 101100129592 Schizosaccharomyces pombe (strain 972 / ATCC 24843) mcp7 gene Proteins 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 2
- UWXWBBBBYNXERN-UHFFFAOYSA-N [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenoxy]boronic acid Chemical compound C(C)(C)(C)OC(=O)NC1=CC=C(C=C1)OB(O)O UWXWBBBBYNXERN-UHFFFAOYSA-N 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 108010004469 allophycocyanin Proteins 0.000 description 2
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 2
- 150000001413 amino acids Chemical group 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000001499 aryl bromides Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000002393 azetidinyl group Chemical group 0.000 description 2
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 210000004899 c-terminal region Anatomy 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 208000019065 cervical carcinoma Diseases 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 210000000038 chest Anatomy 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- USVZFSNDGFNNJT-UHFFFAOYSA-N cyclopenta-1,4-dien-1-yl(diphenyl)phosphane (2,3-dichlorocyclopenta-1,4-dien-1-yl)-diphenylphosphane iron(2+) Chemical compound [Fe++].c1cc[c-](c1)P(c1ccccc1)c1ccccc1.Clc1c(cc[c-]1Cl)P(c1ccccc1)c1ccccc1 USVZFSNDGFNNJT-UHFFFAOYSA-N 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 229910052805 deuterium Inorganic materials 0.000 description 2
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 description 2
- 229950006137 dexfosfoserine Drugs 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000010894 electron beam technology Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 238000003821 enantio-separation Methods 0.000 description 2
- 201000011523 endocrine gland cancer Diseases 0.000 description 2
- 238000006911 enzymatic reaction Methods 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 230000005284 excitation Effects 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 201000005787 hematologic cancer Diseases 0.000 description 2
- 229940088597 hormone Drugs 0.000 description 2
- 239000005556 hormone Substances 0.000 description 2
- ARRNBPCNZJXHRJ-UHFFFAOYSA-M hydron;tetrabutylazanium;phosphate Chemical compound OP(O)([O-])=O.CCCC[N+](CCCC)(CCCC)CCCC ARRNBPCNZJXHRJ-UHFFFAOYSA-M 0.000 description 2
- WCYJQVALWQMJGE-UHFFFAOYSA-M hydroxylammonium chloride Chemical compound [Cl-].O[NH3+] WCYJQVALWQMJGE-UHFFFAOYSA-M 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 210000003734 kidney Anatomy 0.000 description 2
- 229940043355 kinase inhibitor Drugs 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- 239000003550 marker Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- AJPPKGMEHMXPMC-UHFFFAOYSA-N methyl 2-(4-fluorophenyl)acetate Chemical compound COC(=O)CC1=CC=C(F)C=C1 AJPPKGMEHMXPMC-UHFFFAOYSA-N 0.000 description 2
- VYOFPLOREOHCDP-UHFFFAOYSA-N methyl 4-bromo-3-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(Br)C(O)=C1 VYOFPLOREOHCDP-UHFFFAOYSA-N 0.000 description 2
- XLKDKHRGIJWOSN-UHFFFAOYSA-N methyl 4-bromo-3-methoxybenzoate Chemical compound COC(=O)C1=CC=C(Br)C(OC)=C1 XLKDKHRGIJWOSN-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- JHEFOJNPLXSWNZ-UHFFFAOYSA-N n-(4-fluorophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(F)C=C1 JHEFOJNPLXSWNZ-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 150000003905 phosphatidylinositols Chemical class 0.000 description 2
- BZQFBWGGLXLEPQ-REOHCLBHSA-N phosphoserine Chemical compound OC(=O)[C@@H](N)COP(O)(O)=O BZQFBWGGLXLEPQ-REOHCLBHSA-N 0.000 description 2
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 229920001983 poloxamer Polymers 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 238000002953 preparative HPLC Methods 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 210000002307 prostate Anatomy 0.000 description 2
- 108060006633 protein kinase Proteins 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- LXNHXLLTXMVWPM-UHFFFAOYSA-N pyridoxine Chemical compound CC1=NC=C(CO)C(CO)=C1O LXNHXLLTXMVWPM-UHFFFAOYSA-N 0.000 description 2
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- DAEPDZWVDSPTHF-UHFFFAOYSA-M sodium pyruvate Chemical compound [Na+].CC(=O)C([O-])=O DAEPDZWVDSPTHF-UHFFFAOYSA-M 0.000 description 2
- MFRIHAYPQRLWNB-UHFFFAOYSA-N sodium tert-butoxide Chemical compound [Na+].CC(C)(C)[O-] MFRIHAYPQRLWNB-UHFFFAOYSA-N 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 150000003456 sulfonamides Chemical class 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 238000002877 time resolved fluorescence resonance energy transfer Methods 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 125000001425 triazolyl group Chemical group 0.000 description 2
- WTVXIBRMWGUIMI-UHFFFAOYSA-N trifluoro($l^{1}-oxidanylsulfonyl)methane Chemical group [O]S(=O)(=O)C(F)(F)F WTVXIBRMWGUIMI-UHFFFAOYSA-N 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- IHIXIJGXTJIKRB-UHFFFAOYSA-N trisodium vanadate Chemical compound [Na+].[Na+].[Na+].[O-][V]([O-])([O-])=O IHIXIJGXTJIKRB-UHFFFAOYSA-N 0.000 description 2
- BWHDROKFUHTORW-UHFFFAOYSA-N tritert-butylphosphane Chemical compound CC(C)(C)P(C(C)(C)C)C(C)(C)C BWHDROKFUHTORW-UHFFFAOYSA-N 0.000 description 2
- 229910052722 tritium Inorganic materials 0.000 description 2
- 210000004881 tumor cell Anatomy 0.000 description 2
- 210000003932 urinary bladder Anatomy 0.000 description 2
- 208000024719 uterine cervix neoplasm Diseases 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- HBENZIXOGRCSQN-VQWWACLZSA-N (1S,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-16-[(2S)-2-hydroxy-3,3-dimethylpentan-2-yl]-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol Chemical compound N1([C@@H]2CC=3C4=C(C(=CC=3)O)O[C@H]3[C@@]5(OC)CC[C@@]2([C@@]43CC1)C[C@@H]5[C@](C)(O)C(C)(C)CC)CC1CC1 HBENZIXOGRCSQN-VQWWACLZSA-N 0.000 description 1
- UKSZBOKPHAQOMP-SVLSSHOZSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 UKSZBOKPHAQOMP-SVLSSHOZSA-N 0.000 description 1
- DNISEZBAYYIQFB-PHDIDXHHSA-N (2r,3r)-2,3-diacetyloxybutanedioic acid Chemical compound CC(=O)O[C@@H](C(O)=O)[C@H](C(O)=O)OC(C)=O DNISEZBAYYIQFB-PHDIDXHHSA-N 0.000 description 1
- ROYMIBPTRHCVIB-UHFFFAOYSA-N (4-bromo-3-methoxyphenyl)-(3-fluoroazetidin-1-yl)methanone Chemical compound C1=C(Br)C(OC)=CC(C(=O)N2CC(F)C2)=C1 ROYMIBPTRHCVIB-UHFFFAOYSA-N 0.000 description 1
- ZXPZEXSSPDSBKD-UHFFFAOYSA-N (4-bromo-3-methoxyphenyl)-pyrrolidin-1-ylmethanone Chemical compound C1=C(Br)C(OC)=CC(C(=O)N2CCCC2)=C1 ZXPZEXSSPDSBKD-UHFFFAOYSA-N 0.000 description 1
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 description 1
- 125000006592 (C2-C3) alkenyl group Chemical group 0.000 description 1
- 125000006584 (C3-C10) heterocycloalkyl group Chemical group 0.000 description 1
- 125000006708 (C5-C14) heteroaryl group Chemical group 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 1
- 125000005918 1,2-dimethylbutyl group Chemical group 0.000 description 1
- VUMCUSHVMYIRMB-UHFFFAOYSA-N 1,3,5-tri(propan-2-yl)benzene Chemical compound CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1 VUMCUSHVMYIRMB-UHFFFAOYSA-N 0.000 description 1
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 1
- BIGUXWKHRGHFMJ-UHFFFAOYSA-N 1,5-dimethylcyclohexa-2,4-diene-1-carboxamide Chemical compound CC1(C(=O)N)CC(=CC=C1)C BIGUXWKHRGHFMJ-UHFFFAOYSA-N 0.000 description 1
- AGRIQBHIKABLPJ-UHFFFAOYSA-N 1-Pyrrolidinecarboxaldehyde Chemical compound O=CN1CCCC1 AGRIQBHIKABLPJ-UHFFFAOYSA-N 0.000 description 1
- DDWKPDDWQKXELH-UHFFFAOYSA-N 1-bromo-2-cyclopropyloxy-4-fluorobenzene Chemical compound FC1=CC=C(Br)C(OC2CC2)=C1 DDWKPDDWQKXELH-UHFFFAOYSA-N 0.000 description 1
- BNLMHIWPPSPPIQ-UHFFFAOYSA-N 1-bromo-2-cyclopropyloxy-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(Br)C(OC2CC2)=C1 BNLMHIWPPSPPIQ-UHFFFAOYSA-N 0.000 description 1
- ADKYONRAMNWPKN-UHFFFAOYSA-N 1-bromo-2-cyclopropyloxy-4-methylsulfonylbenzene Chemical compound CS(=O)(=O)C1=CC=C(Br)C(OC2CC2)=C1 ADKYONRAMNWPKN-UHFFFAOYSA-N 0.000 description 1
- MCLBVTBTDQSOSY-UHFFFAOYSA-N 1-bromo-2-ethoxy-4-fluorobenzene Chemical compound CCOC1=CC(F)=CC=C1Br MCLBVTBTDQSOSY-UHFFFAOYSA-N 0.000 description 1
- BQDVHQDTMHIRTO-UHFFFAOYSA-N 1-bromo-2-ethoxy-4-methylsulfanylbenzene Chemical compound CCOC1=CC(SC)=CC=C1Br BQDVHQDTMHIRTO-UHFFFAOYSA-N 0.000 description 1
- RIIPQBVKRKWNFS-UHFFFAOYSA-N 1-bromo-2-ethoxy-4-methylsulfonylbenzene Chemical compound CCOC1=CC(S(C)(=O)=O)=CC=C1Br RIIPQBVKRKWNFS-UHFFFAOYSA-N 0.000 description 1
- WTVKPGMTQBHSQS-UHFFFAOYSA-N 1-bromo-2-methoxy-4-methylsulfonylbenzene Chemical compound COC1=CC(S(C)(=O)=O)=CC=C1Br WTVKPGMTQBHSQS-UHFFFAOYSA-N 0.000 description 1
- BEJOCBPQBFEUNB-UHFFFAOYSA-N 1-bromo-4-fluoro-2-(2,2,2-trifluoroethoxy)benzene Chemical compound FC1=CC=C(Br)C(OCC(F)(F)F)=C1 BEJOCBPQBFEUNB-UHFFFAOYSA-N 0.000 description 1
- JKACTTARRNDIGL-UHFFFAOYSA-N 1-bromo-4-methylsulfanyl-2-(2,2,2-trifluoroethoxy)benzene Chemical compound CSC1=CC=C(Br)C(OCC(F)(F)F)=C1 JKACTTARRNDIGL-UHFFFAOYSA-N 0.000 description 1
- PLULOZSQQAESJA-UHFFFAOYSA-N 1-bromo-4-methylsulfonyl-2-(2,2,2-trifluoroethoxy)benzene Chemical compound CS(=O)(=O)C1=CC=C(Br)C(OCC(F)(F)F)=C1 PLULOZSQQAESJA-UHFFFAOYSA-N 0.000 description 1
- 125000004972 1-butynyl group Chemical group [H]C([H])([H])C([H])([H])C#C* 0.000 description 1
- 125000006218 1-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- YYKBFGMYHQMXIL-UHFFFAOYSA-N 1-phenyl-2,3,4-tri(propan-2-yl)benzene Chemical group CC(C)C1=C(C(C)C)C(C(C)C)=CC=C1C1=CC=CC=C1 YYKBFGMYHQMXIL-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical compound NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 1
- MGKPFALCNDRSQD-UHFFFAOYSA-N 2-(4-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(F)C=C1 MGKPFALCNDRSQD-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- IVZSPJZYISIMBV-UHFFFAOYSA-N 2-anilinopurin-8-one Chemical class N=1C2=NC(=O)N=C2C=NC=1NC1=CC=CC=C1 IVZSPJZYISIMBV-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- SVDDJQGVOFZBNX-UHFFFAOYSA-N 2-chloroethyl carbonochloridate Chemical compound ClCCOC(Cl)=O SVDDJQGVOFZBNX-UHFFFAOYSA-N 0.000 description 1
- GKTFLKJXZOYBRW-UHFFFAOYSA-N 2-ethylbenzamide Chemical compound CCC1=CC=CC=C1C(N)=O GKTFLKJXZOYBRW-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical compound NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 1
- 125000001698 2H-pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- ZVQIKYMMLMYCJW-UHFFFAOYSA-N 3-(4-bromo-3-methoxyphenyl)-1,3-oxazolidin-2-one Chemical compound C1=C(Br)C(OC)=CC(N2C(OCC2)=O)=C1 ZVQIKYMMLMYCJW-UHFFFAOYSA-N 0.000 description 1
- NBWVEWXIOUFNKD-UHFFFAOYSA-N 3-(methoxymethyl)benzamide Chemical compound COCC1=CC=CC(C(N)=O)=C1 NBWVEWXIOUFNKD-UHFFFAOYSA-N 0.000 description 1
- RRANUIMYSXUNCN-UHFFFAOYSA-N 3-(trifluoromethoxy)benzamide Chemical compound NC(=O)C1=CC=CC(OC(F)(F)F)=C1 RRANUIMYSXUNCN-UHFFFAOYSA-N 0.000 description 1
- JBBOAHOUCOFCFI-UHFFFAOYSA-N 3-[4-[[6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxyphenyl]-1,3-oxazolidin-2-one Chemical compound COC1=CC(N2C(OCC2)=O)=CC=C1NC(=NN1C=2)N=C1C=CC=2C1=CC=C(N)C=C1 JBBOAHOUCOFCFI-UHFFFAOYSA-N 0.000 description 1
- CEOWONGGYSTPKZ-UHFFFAOYSA-N 3-[tert-butyl(diphenyl)silyl]oxy-2-(4-fluorophenyl)propanoic acid Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(C(C)(C)C)OCC(C(O)=O)C1=CC=C(F)C=C1 CEOWONGGYSTPKZ-UHFFFAOYSA-N 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000005917 3-methylpentyl group Chemical group 0.000 description 1
- YELMWJNXDALKFE-UHFFFAOYSA-N 3h-imidazo[4,5-f]quinoxaline Chemical class N1=CC=NC2=C(NC=N3)C3=CC=C21 YELMWJNXDALKFE-UHFFFAOYSA-N 0.000 description 1
- ZANPJXNYBVVNSD-UHFFFAOYSA-N 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC=C(N)C=C1 ZANPJXNYBVVNSD-UHFFFAOYSA-N 0.000 description 1
- KVLRLNPRTWQZJA-UHFFFAOYSA-N 4-[2-(2-methoxy-4-methylsulfonylanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzoic acid Chemical compound COC1=CC(S(C)(=O)=O)=CC=C1NC1=NN2C=C(C=3C=CC(=CC=3)C(O)=O)C=CC2=N1 KVLRLNPRTWQZJA-UHFFFAOYSA-N 0.000 description 1
- WSGQWOKMSGHCBI-UHFFFAOYSA-N 4-[[6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-(2,2,2-trifluoroethoxy)benzamide Chemical compound FC(F)(F)COC1=CC(C(=O)N)=CC=C1NC1=NN2C=C(C=3C=CC(N)=CC=3)C=CC2=N1 WSGQWOKMSGHCBI-UHFFFAOYSA-N 0.000 description 1
- QOCBTXYGFBJPAY-UHFFFAOYSA-N 4-[[6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxybenzamide Chemical compound COC1=CC(C(N)=O)=CC=C1NC1=NN2C=C(C=3C=CC(N)=CC=3)C=CC2=N1 QOCBTXYGFBJPAY-UHFFFAOYSA-N 0.000 description 1
- VYOHTXLQUJUBNI-UHFFFAOYSA-N 4-[[6-[4-[2-(4-fluorophenyl)propanoylamino]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxybenzamide Chemical compound COC1=CC(C(N)=O)=CC=C1NC1=NN2C=C(C=3C=CC(NC(=O)C(C)C=4C=CC(F)=CC=4)=CC=3)C=CC2=N1 VYOHTXLQUJUBNI-UHFFFAOYSA-N 0.000 description 1
- CFRDJNOBCVXNRR-UHFFFAOYSA-N 4-bromo-3-(2,2,2-trifluoroethoxy)benzamide Chemical compound NC(=O)C1=CC=C(Br)C(OCC(F)(F)F)=C1 CFRDJNOBCVXNRR-UHFFFAOYSA-N 0.000 description 1
- RUTNWXBHRAIQSP-UHFFFAOYSA-N 4-bromo-3-methoxyaniline Chemical compound COC1=CC(N)=CC=C1Br RUTNWXBHRAIQSP-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- SIAVMDKGVRXFAX-UHFFFAOYSA-N 4-carboxyphenylboronic acid Chemical compound OB(O)C1=CC=C(C(O)=O)C=C1 SIAVMDKGVRXFAX-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000001826 4H-pyranyl group Chemical group O1C(=CCC=C1)* 0.000 description 1
- WGOLHUGPTDEKCF-UHFFFAOYSA-N 5-bromopyridin-2-amine Chemical compound NC1=CC=C(Br)C=N1 WGOLHUGPTDEKCF-UHFFFAOYSA-N 0.000 description 1
- MAXBVGJEFDMHNV-UHFFFAOYSA-N 5-chloropyridin-2-amine Chemical compound NC1=CC=C(Cl)C=N1 MAXBVGJEFDMHNV-UHFFFAOYSA-N 0.000 description 1
- MOKRVGLBQJHEJC-UHFFFAOYSA-N 6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine Chemical compound C=1N2N=C(N)N=C2C=CC=1C1=CC=C(N)C=C1 MOKRVGLBQJHEJC-UHFFFAOYSA-N 0.000 description 1
- XHBQNLHFUPSZNL-UHFFFAOYSA-N 6-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-amine Chemical compound C1=CC(Br)=CN2N=C(N)N=C21 XHBQNLHFUPSZNL-UHFFFAOYSA-N 0.000 description 1
- LXNPYPUQZKXAIW-UHFFFAOYSA-N 6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-amine Chemical compound C1=CC(Cl)=CN2N=C(N)N=C21 LXNPYPUQZKXAIW-UHFFFAOYSA-N 0.000 description 1
- 102100031126 6-phosphogluconolactonase Human genes 0.000 description 1
- 108010029731 6-phosphogluconolactonase Proteins 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000611184 Amphora Species 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 235000006692 Bouea Nutrition 0.000 description 1
- 241000693990 Bouea Species 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- KLNUEOYQQCDIDH-UHFFFAOYSA-N C(C)(C)(C)P(C1=C(C=CC=C1)C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)C(C)(C)C.[Cl] Chemical group C(C)(C)(C)P(C1=C(C=CC=C1)C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)C(C)(C)C.[Cl] KLNUEOYQQCDIDH-UHFFFAOYSA-N 0.000 description 1
- 101100324465 Caenorhabditis elegans arr-1 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- VBLVLTCOPYJUFH-UHFFFAOYSA-N Cl.B(OC1=CC=C(C=C1)N)(O)O Chemical compound Cl.B(OC1=CC=C(C=C1)N)(O)O VBLVLTCOPYJUFH-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
- NBSCHQHZLSJFNQ-GASJEMHNSA-N D-Glucose 6-phosphate Chemical compound OC1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]1O NBSCHQHZLSJFNQ-GASJEMHNSA-N 0.000 description 1
- 108020004414 DNA Proteins 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 101100012466 Drosophila melanogaster Sras gene Proteins 0.000 description 1
- 108090000371 Esterases Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- VFRROHXSMXFLSN-UHFFFAOYSA-N Glc6P Natural products OP(=O)(O)OCC(O)C(O)C(O)C(O)C=O VFRROHXSMXFLSN-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 108010018962 Glucosephosphate Dehydrogenase Proteins 0.000 description 1
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
- 102100039121 Histone-lysine N-methyltransferase MECOM Human genes 0.000 description 1
- 101001033728 Homo sapiens Histone-lysine N-methyltransferase MECOM Proteins 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 229930182555 Penicillin Natural products 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 108010009341 Protein Serine-Threonine Kinases Proteins 0.000 description 1
- 102000009516 Protein Serine-Threonine Kinases Human genes 0.000 description 1
- 101150076031 RAS1 gene Proteins 0.000 description 1
- 101000953909 Streptomyces viridifaciens Isobutylamine N-hydroxylase Proteins 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- QLOWGDIISXJREF-UHFFFAOYSA-N [1,2,4]triazolo[1,5-c]pyrimidine Chemical class C1=CN=CN2N=CN=C21 QLOWGDIISXJREF-UHFFFAOYSA-N 0.000 description 1
- ICWADCIRKVJQJW-UHFFFAOYSA-N [4-[(6-chloro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]-3-methoxyphenyl]-(3-fluoroazetidin-1-yl)methanone Chemical compound C=1C=C(NC2=NN3C=C(Cl)C=CC3=N2)C(OC)=CC=1C(=O)N1CC(F)C1 ICWADCIRKVJQJW-UHFFFAOYSA-N 0.000 description 1
- HKDLJWHVTCVVOC-UHFFFAOYSA-N [4-[[6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-(2,2,2-trifluoroethoxy)phenyl]-(3-fluoroazetidin-1-yl)methanone Chemical compound C1=CC(N)=CC=C1C1=CN2N=C(NC=3C(=CC(=CC=3)C(=O)N3CC(F)C3)OCC(F)(F)F)N=C2C=C1 HKDLJWHVTCVVOC-UHFFFAOYSA-N 0.000 description 1
- OXOKWCYRLSCZGM-UHFFFAOYSA-N [4-[[6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-(2,2,2-trifluoroethoxy)phenyl]-(3-hydroxyazetidin-1-yl)methanone Chemical compound C1=CC(N)=CC=C1C1=CN2N=C(NC=3C(=CC(=CC=3)C(=O)N3CC(O)C3)OCC(F)(F)F)N=C2C=C1 OXOKWCYRLSCZGM-UHFFFAOYSA-N 0.000 description 1
- XEZWXSBGKPXYQO-UHFFFAOYSA-N [4-[[6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-(2,2,2-trifluoroethoxy)phenyl]-pyrrolidin-1-ylmethanone Chemical compound C1=CC(N)=CC=C1C1=CN2N=C(NC=3C(=CC(=CC=3)C(=O)N3CCCC3)OCC(F)(F)F)N=C2C=C1 XEZWXSBGKPXYQO-UHFFFAOYSA-N 0.000 description 1
- KXKWPFABOBXHMD-UHFFFAOYSA-N [4-[[6-(4-aminophenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]-3-methoxyphenyl]-(3-fluoroazetidin-1-yl)methanone Chemical compound COC1=CC(C(=O)N2CC(F)C2)=CC=C1NC(=NN1C=2)N=C1C=CC=2C1=CC=C(N)C=C1 KXKWPFABOBXHMD-UHFFFAOYSA-N 0.000 description 1
- QQZKRNFQLGYWJR-UHFFFAOYSA-N [4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]-(3-fluoroazetidin-1-yl)methanone Chemical compound C1C(F)CN1C(=O)C1=CC=C(Br)C(OCC(F)(F)F)=C1 QQZKRNFQLGYWJR-UHFFFAOYSA-N 0.000 description 1
- VZSJTPYRZCDTSZ-UHFFFAOYSA-N [4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]-(3-hydroxyazetidin-1-yl)methanone Chemical compound C1C(O)CN1C(=O)C1=CC=C(Br)C(OCC(F)(F)F)=C1 VZSJTPYRZCDTSZ-UHFFFAOYSA-N 0.000 description 1
- WCQIXDALKPDGFT-UHFFFAOYSA-N [4-bromo-3-(2,2,2-trifluoroethoxy)phenyl]-pyrrolidin-1-ylmethanone Chemical compound C1=C(Br)C(OCC(F)(F)F)=CC(C(=O)N2CCCC2)=C1 WCQIXDALKPDGFT-UHFFFAOYSA-N 0.000 description 1
- ZVQOOHYFBIDMTQ-UHFFFAOYSA-N [methyl(oxido){1-[6-(trifluoromethyl)pyridin-3-yl]ethyl}-lambda(6)-sulfanylidene]cyanamide Chemical compound N#CN=S(C)(=O)C(C)C1=CC=C(C(F)(F)F)N=C1 ZVQOOHYFBIDMTQ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 238000010976 amide bond formation reaction Methods 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 208000036878 aneuploidy Diseases 0.000 description 1
- 231100001075 aneuploidy Toxicity 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 125000005427 anthranyl group Chemical group 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012062 aqueous buffer Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- UQUPQEUNHVVNKW-UHFFFAOYSA-N azetidin-1-ium-3-ol;chloride Chemical compound Cl.OC1CNC1 UQUPQEUNHVVNKW-UHFFFAOYSA-N 0.000 description 1
- AQAYYJFLJZKWCR-UHFFFAOYSA-N azetidin-1-yl-(4-bromo-3-methoxyphenyl)methanone Chemical compound C1=C(Br)C(OC)=CC(C(=O)N2CCC2)=C1 AQAYYJFLJZKWCR-UHFFFAOYSA-N 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical group C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- HTJWUNNIRKDDIV-UHFFFAOYSA-N bis(1-adamantyl)-butylphosphane Chemical compound C1C(C2)CC(C3)CC2CC13P(CCCC)C1(C2)CC(C3)CC2CC3C1 HTJWUNNIRKDDIV-UHFFFAOYSA-N 0.000 description 1
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 1
- LKXYJYDRLBPHRS-UHFFFAOYSA-N bromocyclopropane Chemical compound BrC1CC1 LKXYJYDRLBPHRS-UHFFFAOYSA-N 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- DLIJPAHLBJIQHE-UHFFFAOYSA-N butylphosphane Chemical compound CCCCP DLIJPAHLBJIQHE-UHFFFAOYSA-N 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- UPJWAKUNQVOESN-UHFFFAOYSA-N carbonisothiocyanatidic acid Chemical class OC(=O)N=C=S UPJWAKUNQVOESN-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000034303 cell budding Effects 0.000 description 1
- 230000022131 cell cycle Effects 0.000 description 1
- 230000011712 cell development Effects 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 239000013000 chemical inhibitor Substances 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 230000024321 chromosome segregation Effects 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 210000004748 cultured cell Anatomy 0.000 description 1
- 210000000448 cultured tumor cell Anatomy 0.000 description 1
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000030609 dephosphorylation Effects 0.000 description 1
- 238000006209 dephosphorylation reaction Methods 0.000 description 1
- WDVGNXKCFBOKDF-UHFFFAOYSA-N dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane Chemical group COC1=CC=C(OC)C(C=2C(=CC(=CC=2C(C)C)C(C)C)C(C)C)=C1P(C1CCCCC1)C1CCCCC1 WDVGNXKCFBOKDF-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical group OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 125000005046 dihydronaphthyl group Chemical group 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- LOKCTEFSRHRXRJ-UHFFFAOYSA-I dipotassium trisodium dihydrogen phosphate hydrogen phosphate dichloride Chemical compound P(=O)(O)(O)[O-].[K+].P(=O)(O)([O-])[O-].[Na+].[Na+].[Cl-].[K+].[Cl-].[Na+] LOKCTEFSRHRXRJ-UHFFFAOYSA-I 0.000 description 1
- 230000006806 disease prevention Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- SACNIGZYDTUHKB-UHFFFAOYSA-N ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane Chemical group CC(C)C1=CC(C(C)C)=CC(C(C)C)=C1C1=CC=CC=C1P(C(C)(C)C)C(C)(C)C SACNIGZYDTUHKB-UHFFFAOYSA-N 0.000 description 1
- 125000005883 dithianyl group Chemical group 0.000 description 1
- UZZWBUYVTBPQIV-UHFFFAOYSA-N dme dimethoxyethane Chemical compound COCCOC.COCCOC UZZWBUYVTBPQIV-UHFFFAOYSA-N 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- CWUSWANRIVVXCI-UHFFFAOYSA-N ethyl n-[(5-bromopyridin-2-yl)carbamothioyl]carbamate Chemical compound CCOC(=O)NC(=S)NC1=CC=C(Br)C=N1 CWUSWANRIVVXCI-UHFFFAOYSA-N 0.000 description 1
- SUDFDUAHBQUCKX-UHFFFAOYSA-N ethyl n-[(5-chloropyridin-2-yl)carbamothioyl]carbamate Chemical compound CCOC(=O)NC(=S)NC1=CC=C(Cl)C=N1 SUDFDUAHBQUCKX-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012894 fetal calf serum Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 230000030279 gene silencing Effects 0.000 description 1
- FVIZARNDLVOMSU-UHFFFAOYSA-N ginsenoside K Natural products C1CC(C2(CCC3C(C)(C)C(O)CCC3(C)C2CC2O)C)(C)C2C1C(C)(CCC=C(C)C)OC1OC(CO)C(O)C(O)C1O FVIZARNDLVOMSU-UHFFFAOYSA-N 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 208000024200 hematopoietic and lymphoid system neoplasm Diseases 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000011141 high resolution liquid chromatography Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000010191 image analysis Methods 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000001900 immune effect Effects 0.000 description 1
- 208000026278 immune system disease Diseases 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000006882 induction of apoptosis Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N iso-butyl alcohol Natural products CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000001294 liquid chromatography-tandem mass spectrometry Methods 0.000 description 1
- 238000007477 logistic regression Methods 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 1
- CJGWNNKCEBLFSR-UHFFFAOYSA-N methyl 2-(4-fluorophenyl)-3-hydroxypropanoate Chemical compound COC(=O)C(CO)C1=CC=C(F)C=C1 CJGWNNKCEBLFSR-UHFFFAOYSA-N 0.000 description 1
- HRSNKYJSOMIHNH-UHFFFAOYSA-N methyl 2-(4-fluorophenyl)propanoate Chemical compound COC(=O)C(C)C1=CC=C(F)C=C1 HRSNKYJSOMIHNH-UHFFFAOYSA-N 0.000 description 1
- KIUAWNHTCCQVBP-UHFFFAOYSA-N methyl 4-bromo-3-(2,2,2-trifluoroethoxy)benzoate Chemical compound COC(=O)C1=CC=C(Br)C(OCC(F)(F)F)=C1 KIUAWNHTCCQVBP-UHFFFAOYSA-N 0.000 description 1
- 210000001589 microsome Anatomy 0.000 description 1
- 230000008600 mitotic progression Effects 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- 125000006578 monocyclic heterocycloalkyl group Chemical group 0.000 description 1
- PYLWMHQQBFSUBP-UHFFFAOYSA-N monofluorobenzene Chemical compound FC1=CC=CC=C1 PYLWMHQQBFSUBP-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000001298 n-hexoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000004770 neurodegeneration Effects 0.000 description 1
- 208000015122 neurodegenerative disease Diseases 0.000 description 1
- 150000002829 nitrogen Chemical class 0.000 description 1
- 229920002113 octoxynol Polymers 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003585 oxepinyl group Chemical group 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- LVSJDHGRKAEGLX-UHFFFAOYSA-N oxolane;2,2,2-trifluoroacetic acid Chemical compound C1CCOC1.OC(=O)C(F)(F)F LVSJDHGRKAEGLX-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 239000002953 phosphate buffered saline Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000007015 preclinical effect Effects 0.000 description 1
- 238000004237 preparative chromatography Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 201000001514 prostate carcinoma Diseases 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 235000008160 pyridoxine Nutrition 0.000 description 1
- 239000011677 pyridoxine Substances 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- YOWAEZWWQFSEJD-UHFFFAOYSA-N quinoxalin-2-amine Chemical class C1=CC=CC2=NC(N)=CN=C21 YOWAEZWWQFSEJD-UHFFFAOYSA-N 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZJMWRROPUADPEA-UHFFFAOYSA-N sec-butylbenzene Chemical compound CCC(C)C1=CC=CC=C1 ZJMWRROPUADPEA-UHFFFAOYSA-N 0.000 description 1
- 125000003548 sec-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229940054269 sodium pyruvate Drugs 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000013112 stability test Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000012086 standard solution Substances 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 230000016853 telophase Effects 0.000 description 1
- HNUHNECIEYXPJH-UHFFFAOYSA-N tert-butyl n-[4-(2-amino-[1,2,4]triazolo[1,5-a]pyridin-6-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC(C)(C)C)=CC=C1C1=CN2N=C(N)N=C2C=C1 HNUHNECIEYXPJH-UHFFFAOYSA-N 0.000 description 1
- MHYGQXWCZAYSLJ-UHFFFAOYSA-N tert-butyl-chloro-diphenylsilane Chemical compound C=1C=CC=CC=1[Si](Cl)(C(C)(C)C)C1=CC=CC=C1 MHYGQXWCZAYSLJ-UHFFFAOYSA-N 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005329 tetralinyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 description 1
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 229940011671 vitamin b6 Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP12175640 | 2012-07-10 | ||
| EP12185590 | 2012-09-24 | ||
| EP13170585 | 2013-06-05 | ||
| PCT/EP2013/064017 WO2014009219A1 (en) | 2012-07-10 | 2013-07-03 | Method for preparing substituted triazolopyridines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| EA201590116A1 EA201590116A1 (ru) | 2015-07-30 |
| EA027544B1 true EA027544B1 (ru) | 2017-08-31 |
Family
ID=48793197
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| EA201590116A EA027544B1 (ru) | 2012-07-10 | 2013-07-03 | Способ получения замещенных триазолопиридинов |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US9388177B2 (enExample) |
| EP (1) | EP2872506A1 (enExample) |
| JP (1) | JP6238979B2 (enExample) |
| KR (1) | KR20150040845A (enExample) |
| CN (1) | CN104603136B (enExample) |
| AP (1) | AP3778A (enExample) |
| AU (1) | AU2013289381A1 (enExample) |
| BR (1) | BR112015000308A2 (enExample) |
| CA (1) | CA2878481A1 (enExample) |
| CL (1) | CL2015000038A1 (enExample) |
| CO (1) | CO7160002A2 (enExample) |
| CR (1) | CR20150006A (enExample) |
| DO (1) | DOP2015000007A (enExample) |
| EA (1) | EA027544B1 (enExample) |
| HK (1) | HK1206731A1 (enExample) |
| IL (1) | IL236265A (enExample) |
| IN (1) | IN2015DN00085A (enExample) |
| MX (1) | MX2015000348A (enExample) |
| NZ (1) | NZ703020A (enExample) |
| PE (1) | PE20150354A1 (enExample) |
| PH (1) | PH12015500061A1 (enExample) |
| SG (1) | SG11201408419QA (enExample) |
| TN (1) | TN2015000008A1 (enExample) |
| WO (1) | WO2014009219A1 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2014195276A1 (en) * | 2013-06-07 | 2014-12-11 | Bayer Pharma Aktiengesellschaft | Substituted triazolopyridines having activity as mps-1 inhibitors |
| PT3008062T (pt) * | 2013-06-11 | 2017-06-07 | Bayer Pharma AG | Derivados de profármaco de triazolopiridinas substituídas |
| MA38656A1 (fr) | 2013-06-11 | 2018-05-31 | Bayer Pharma AG | Combinaisons pour le traitement du cancer comprenant un inhibiteur de la kinase mps-1 et un inhibiteur de la mitose |
| CN107567503B (zh) | 2015-04-17 | 2022-03-22 | 荷兰转化研究中心有限责任公司 | 用于ttk抑制剂化疗的预后生物标记 |
| TW201800408A (zh) | 2016-06-15 | 2018-01-01 | 拜耳製藥公司 | Mps-1抑制劑 |
Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1438973A1 (en) * | 2001-10-05 | 2004-07-21 | Ono Pharmaceutical Co., Ltd. | Remedies for stress diseases comprising mitochondrial benzodiazepine receptor antagonists |
| WO2005110410A2 (en) * | 2004-05-14 | 2005-11-24 | Abbott Laboratories | Kinase inhibitors as therapeutic agents |
| WO2006029623A1 (en) * | 2004-09-13 | 2006-03-23 | H. Lundbeck A/S | Substituted aniline derivatives |
| US20060194823A1 (en) * | 2004-12-22 | 2006-08-31 | Georg Kettschau | Sulfonamido-macrocycles as Tie2 inhibitors and the salts thereof, a pharmaceutical composition comprising these compounds, the method of preparing and the use thereof |
| WO2007145921A1 (en) * | 2006-06-06 | 2007-12-21 | Schering Corporation | Imidazopyrazines as protein kinase inhibitors |
| EP1870416A1 (en) * | 2006-06-21 | 2007-12-26 | Bayer Schering Pharma Aktiengesellschaft | Sulphonamido-macrocycles as tie2 inhibitors |
| WO2008063300A2 (en) * | 2006-10-10 | 2008-05-29 | Infinity Pharmaceuticals, Inc. | Boronic acids and esters as inhibitors of fatty acid amide hydrolase |
| WO2009137322A2 (en) * | 2008-05-05 | 2009-11-12 | The Trustees Of The University Of Pennsylvania | Processes for the preparation of biphenyl compounds |
| WO2011063908A1 (en) * | 2009-11-30 | 2011-06-03 | Bayer Schering Pharma Aktiengesellschaft | Triazolopyridines |
| WO2011064328A1 (en) * | 2009-11-30 | 2011-06-03 | Bayer Schering Pharma Aktiengesellschaft | Triazolopyridine derivatives |
| WO2011157688A1 (en) * | 2010-06-16 | 2011-12-22 | Bayer Pharma Aktiengesellschaft | Substituted triazolopyridines |
| WO2012143329A1 (en) * | 2011-04-21 | 2012-10-26 | Bayer Intellectual Property Gmbh | Triazolopyridines |
| WO2012160029A1 (en) * | 2011-05-23 | 2012-11-29 | Bayer Intellectual Property Gmbh | Substituted triazolopyridines |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7524860B2 (en) * | 2004-10-07 | 2009-04-28 | Pfizer Inc. | Antibacterial agents |
| SG174086A1 (en) | 2006-08-30 | 2011-09-29 | Cellzome Ltd | Triazole derivatives as kinase inhibitors |
| KR20100049073A (ko) | 2007-07-18 | 2010-05-11 | 노파르티스 아게 | 비시클릭 헤테로아릴 화합물 및 키나제 억제제로서의 그의 용도 |
| JP2010536841A (ja) | 2007-08-23 | 2010-12-02 | アストラゼネカ アクチボラグ | 増殖性疾患治療のためのttk/mps1阻害剤としての2−アニリノプリン−8−オン類 |
| JP2010536917A (ja) | 2007-08-31 | 2010-12-02 | メルク セローノ ソシエテ アノニム | トリアゾロピリジン化合物と、ask阻害剤としてのその化合物の利用法 |
| GB0719803D0 (en) | 2007-10-10 | 2007-11-21 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| GB0724342D0 (en) * | 2007-12-13 | 2008-01-30 | Prolysis Ltd | Anitbacterial compositions |
| WO2009155527A2 (en) * | 2008-06-19 | 2009-12-23 | Progenics Pharmaceuticals, Inc. | Phosphatidylinositol 3 kinase inhibitors |
| KR20110116160A (ko) | 2009-02-13 | 2011-10-25 | 포비어 파마수티칼스 | 카이네이스 저해제로서의 〔1,2,4〕트리아졸로〔1,5-a〕피리딘 |
| CN102413831B (zh) | 2009-04-29 | 2014-06-04 | 拜耳知识产权有限责任公司 | 取代的咪唑并喹喔啉 |
| WO2010141360A1 (en) * | 2009-06-05 | 2010-12-09 | Merck Sharp & Dohme Corp. | Biaryl benzotriazole derivatives |
| MX2011012961A (es) * | 2009-06-05 | 2012-01-30 | Cephalon Inc | Preparacion y usos de derivados de 1,2,4-triazolo[1,5a]-piridina. |
| CA2772790C (en) | 2009-09-04 | 2017-06-27 | Benjamin Bader | Substituted aminoquinoxalines as tyrosine threonine kinase inhibitors |
| EP2343294A1 (en) * | 2009-11-30 | 2011-07-13 | Bayer Schering Pharma AG | Substituted triazolopyridines |
| WO2012044567A2 (en) * | 2010-09-30 | 2012-04-05 | Merck Sharp & Dohme Corp. | Imidazole derivatives |
| UA112096C2 (uk) * | 2011-12-12 | 2016-07-25 | Байєр Інтеллектуал Проперті Гмбх | Заміщені триазолопіридини та їх застосування як інгібіторів ttk |
-
2013
- 2013-07-03 NZ NZ703020A patent/NZ703020A/en not_active IP Right Cessation
- 2013-07-03 US US14/414,164 patent/US9388177B2/en not_active Expired - Fee Related
- 2013-07-03 BR BR112015000308A patent/BR112015000308A2/pt not_active IP Right Cessation
- 2013-07-03 WO PCT/EP2013/064017 patent/WO2014009219A1/en not_active Ceased
- 2013-07-03 HK HK15107242.4A patent/HK1206731A1/xx unknown
- 2013-07-03 MX MX2015000348A patent/MX2015000348A/es unknown
- 2013-07-03 IN IN85DEN2015 patent/IN2015DN00085A/en unknown
- 2013-07-03 EP EP13737181.1A patent/EP2872506A1/en not_active Withdrawn
- 2013-07-03 SG SG11201408419QA patent/SG11201408419QA/en unknown
- 2013-07-03 EA EA201590116A patent/EA027544B1/ru not_active IP Right Cessation
- 2013-07-03 JP JP2015520907A patent/JP6238979B2/ja not_active Expired - Fee Related
- 2013-07-03 KR KR20157000338A patent/KR20150040845A/ko not_active Withdrawn
- 2013-07-03 AU AU2013289381A patent/AU2013289381A1/en not_active Abandoned
- 2013-07-03 CA CA2878481A patent/CA2878481A1/en not_active Abandoned
- 2013-07-03 PE PE2015000017A patent/PE20150354A1/es not_active Application Discontinuation
- 2013-07-03 AP AP2014008177A patent/AP3778A/en active
- 2013-07-03 CN CN201380045913.9A patent/CN104603136B/zh not_active Expired - Fee Related
-
2014
- 2014-12-15 IL IL236265A patent/IL236265A/en not_active IP Right Cessation
-
2015
- 2015-01-07 TN TNP2015000008A patent/TN2015000008A1/fr unknown
- 2015-01-08 CL CL2015000038A patent/CL2015000038A1/es unknown
- 2015-01-09 CO CO15004251A patent/CO7160002A2/es unknown
- 2015-01-09 DO DO2015000007A patent/DOP2015000007A/es unknown
- 2015-01-09 CR CR20150006A patent/CR20150006A/es unknown
- 2015-01-09 PH PH12015500061A patent/PH12015500061A1/en unknown
Patent Citations (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1438973A1 (en) * | 2001-10-05 | 2004-07-21 | Ono Pharmaceutical Co., Ltd. | Remedies for stress diseases comprising mitochondrial benzodiazepine receptor antagonists |
| WO2005110410A2 (en) * | 2004-05-14 | 2005-11-24 | Abbott Laboratories | Kinase inhibitors as therapeutic agents |
| WO2006029623A1 (en) * | 2004-09-13 | 2006-03-23 | H. Lundbeck A/S | Substituted aniline derivatives |
| US20060194823A1 (en) * | 2004-12-22 | 2006-08-31 | Georg Kettschau | Sulfonamido-macrocycles as Tie2 inhibitors and the salts thereof, a pharmaceutical composition comprising these compounds, the method of preparing and the use thereof |
| WO2007145921A1 (en) * | 2006-06-06 | 2007-12-21 | Schering Corporation | Imidazopyrazines as protein kinase inhibitors |
| EP1870416A1 (en) * | 2006-06-21 | 2007-12-26 | Bayer Schering Pharma Aktiengesellschaft | Sulphonamido-macrocycles as tie2 inhibitors |
| WO2008063300A2 (en) * | 2006-10-10 | 2008-05-29 | Infinity Pharmaceuticals, Inc. | Boronic acids and esters as inhibitors of fatty acid amide hydrolase |
| WO2009137322A2 (en) * | 2008-05-05 | 2009-11-12 | The Trustees Of The University Of Pennsylvania | Processes for the preparation of biphenyl compounds |
| WO2011063908A1 (en) * | 2009-11-30 | 2011-06-03 | Bayer Schering Pharma Aktiengesellschaft | Triazolopyridines |
| WO2011064328A1 (en) * | 2009-11-30 | 2011-06-03 | Bayer Schering Pharma Aktiengesellschaft | Triazolopyridine derivatives |
| WO2011157688A1 (en) * | 2010-06-16 | 2011-12-22 | Bayer Pharma Aktiengesellschaft | Substituted triazolopyridines |
| WO2012143329A1 (en) * | 2011-04-21 | 2012-10-26 | Bayer Intellectual Property Gmbh | Triazolopyridines |
| WO2012160029A1 (en) * | 2011-05-23 | 2012-11-29 | Bayer Intellectual Property Gmbh | Substituted triazolopyridines |
Non-Patent Citations (3)
| Title |
|---|
| GARY A. MOLANDER AND NOEL M. ELLIS: "Linchpin Synthons: Metalation of Aryl Bromides Bearing a Potassium Trifluoroborate Moiety", THE JOURNAL OF ORGANIC CHEMISTRY, AMERICAN CHEMICAL SOCIETY ^ETC.|, vol. 71, no. 19, 15 September 2006 (2006-09-15), pages 7491 - 7493, XP009172463, ISSN: 0022-3263, DOI: 10.1021/jo061324u * |
| JARED H. DELCAMP, ALEXANDRIA P. BRUCKS AND M. CHRISTINA WHITE: "A General and Highly Selective Chelate-Controlled Intermolecular Oxidative Heck Reaction", JOURNAL OF THE AMERICAN CHEMICAL SOCIETY, AMERICAN CHEMICAL SOCIETY, US, vol. 130, no. 34, 27 August 2008 (2008-08-27), US, pages 11270 - 11271, XP009172460, ISSN: 0002-7863, DOI: 10.1021/ja804120r * |
| MIN-LIANG YAO, MAREPALLY SRINIVASA REDDY, LI YONG, INGRID WALFISH, DAVID W. BLEVINS, GEORGE W. KABALKA: "Chemoselective Bromodeboronation of Organotrifluoroborates Using Tetrabutylammonium Tribromide: Application in ( Z )-Dibromoalkene Syntheses", ORGANIC LETTERS , 14(23), 6012-6015 CODEN: ORLEF7; ISSN: 1523-7052, vol. 12, no. 4, 19 February 2010 (2010-02-19), pages 700 - 703, XP055078635, ISSN: 1523-7060, DOI: 10.1021/ol9027144 * |
Also Published As
| Publication number | Publication date |
|---|---|
| CA2878481A1 (en) | 2014-01-16 |
| AP2014008177A0 (en) | 2014-12-31 |
| PH12015500061A1 (en) | 2015-03-02 |
| CN104603136B (zh) | 2017-06-27 |
| JP2015523372A (ja) | 2015-08-13 |
| US9388177B2 (en) | 2016-07-12 |
| CR20150006A (es) | 2015-02-16 |
| SG11201408419QA (en) | 2015-01-29 |
| AP3778A (en) | 2016-08-31 |
| DOP2015000007A (es) | 2015-02-15 |
| CL2015000038A1 (es) | 2015-03-13 |
| AU2013289381A1 (en) | 2015-01-22 |
| PE20150354A1 (es) | 2015-03-21 |
| CN104603136A (zh) | 2015-05-06 |
| WO2014009219A1 (en) | 2014-01-16 |
| US20150148542A1 (en) | 2015-05-28 |
| HK1206731A1 (en) | 2016-01-15 |
| CO7160002A2 (es) | 2015-01-15 |
| KR20150040845A (ko) | 2015-04-15 |
| IL236265A0 (en) | 2015-02-26 |
| TN2015000008A1 (en) | 2016-06-29 |
| JP6238979B2 (ja) | 2017-11-29 |
| BR112015000308A2 (pt) | 2017-06-27 |
| EP2872506A1 (en) | 2015-05-20 |
| IL236265A (en) | 2017-07-31 |
| MX2015000348A (es) | 2015-04-14 |
| NZ703020A (en) | 2017-08-25 |
| EA201590116A1 (ru) | 2015-07-30 |
| IN2015DN00085A (enExample) | 2015-05-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP7340100B2 (ja) | Kras g12c変異型の小分子阻害薬 | |
| RU2632464C1 (ru) | Замещенные триазолопиридины и их применение в качестве ингибиторов тирозин треонин киназы (ттк) | |
| EA023766B1 (ru) | Триазолопиридины | |
| EP3992197A1 (en) | Nitrogen-containing polycyclic fused ring compounds, and pharmaceutical composition thereof, preparation method therefor and application thereof | |
| EA027544B1 (ru) | Способ получения замещенных триазолопиридинов | |
| KR20160019426A (ko) | 암의 치료를 위한 신규 화합물 | |
| CN116023368A (zh) | Crbn免疫调节剂 | |
| CN116891437B (zh) | 氨基酸衍生物、药物组合物及其制备方法和应用 | |
| CN113943275B (zh) | 嘧啶类化合物及其用途 | |
| EP3008062B1 (en) | Prodrug derivatives of substituted triazolopyridines | |
| HK1222849A1 (zh) | 具有作爲mps-1抑制剂的活性的取代的三唑并吡啶类 | |
| CN105408332B (zh) | 取代的三唑并吡啶类 | |
| WO2025114875A1 (en) | Er degraders and uses thereof | |
| HK1222652B (en) | Substituted triazolopyridines | |
| HK1203200B (en) | Substituted triazolopyridines and their use as ttk inhibitors | |
| JP2020518574A (ja) | 発明の名称アミノアルコール誘導体、その医薬組成物および使用 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Lapse of a eurasian patent due to non-payment of renewal fees within the time limit in the following designated state(s) |
Designated state(s): AM AZ BY KZ KG TJ TM RU |