DK156648C - Fremgangsmaade til fremstilling af 4-methoxy-2'-(2-(1-methyl-2-piperidyl)ethyl)benzanilid (encainid) - Google Patents
Fremgangsmaade til fremstilling af 4-methoxy-2'-(2-(1-methyl-2-piperidyl)ethyl)benzanilid (encainid)Info
- Publication number
- DK156648C DK156648C DK551582A DK551582A DK156648C DK 156648 C DK156648 C DK 156648C DK 551582 A DK551582 A DK 551582A DK 551582 A DK551582 A DK 551582A DK 156648 C DK156648 C DK 156648C
- Authority
- DK
- Denmark
- Prior art keywords
- encainid
- benzanilide
- piperidyl
- methoxy
- ethyl
- Prior art date
Links
- PJWPNDMDCLXCOM-UHFFFAOYSA-N encainide Chemical compound C1=CC(OC)=CC=C1C(=O)NC1=CC=CC=C1CCC1N(C)CCCC1 PJWPNDMDCLXCOM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/50—Ketonic radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/330,298 US4394507A (en) | 1981-12-14 | 1981-12-14 | Process for production of encainide |
| US33029881 | 1981-12-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK551582A DK551582A (da) | 1983-06-15 |
| DK156648B DK156648B (da) | 1989-09-18 |
| DK156648C true DK156648C (da) | 1990-03-05 |
Family
ID=23289147
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK551582A DK156648C (da) | 1981-12-14 | 1982-12-10 | Fremgangsmaade til fremstilling af 4-methoxy-2'-(2-(1-methyl-2-piperidyl)ethyl)benzanilid (encainid) |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4394507A (de) |
| JP (1) | JPS6058231B2 (de) |
| KR (1) | KR890000419B1 (de) |
| AT (1) | AT378182B (de) |
| CA (1) | CA1213282A (de) |
| CH (1) | CH655101A5 (de) |
| DK (1) | DK156648C (de) |
| ES (2) | ES8405767A1 (de) |
| FI (1) | FI76561C (de) |
| GR (1) | GR77107B (de) |
| HU (1) | HU186190B (de) |
| IT (1) | IT1149399B (de) |
| NL (1) | NL8204775A (de) |
| PT (1) | PT75980B (de) |
| SE (1) | SE454442B (de) |
| YU (1) | YU44035B (de) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4800226A (en) * | 1986-02-25 | 1989-01-24 | Bristol-Myers Company | Process intermediate for the preparation of encainide |
| US4675409A (en) * | 1986-02-25 | 1987-06-23 | Bristol-Myers Company | Process for the preparation of encainide |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2317303A (en) * | 1940-12-07 | 1943-04-20 | Merck & Co Inc | Heterocyclic nitrogen containing compounds, and processes for making the same |
| US4064254A (en) * | 1971-03-03 | 1977-12-20 | Mead Johnson & Company | Substituted piperidines therapeutic process and compositions |
| US3931195A (en) * | 1971-03-03 | 1976-01-06 | Mead Johnson & Company | Substituted piperidines |
| CA961038A (en) * | 1971-03-03 | 1975-01-14 | Joseph L. Minielli | Substituted piperidines |
| US4000143A (en) * | 1971-03-03 | 1976-12-28 | Mead Johnson & Company | Substituted piperidines |
| SE7607114L (sv) * | 1976-06-22 | 1977-12-23 | Bofors Ab | Sett att framstella hydrokloriden av n-metylpiperidin-2-karbonsyra-2,6-xyllidid |
-
1981
- 1981-12-14 US US06/330,298 patent/US4394507A/en not_active Expired - Fee Related
-
1982
- 1982-11-18 GR GR69848A patent/GR77107B/el unknown
- 1982-11-22 CA CA000416079A patent/CA1213282A/en not_active Expired
- 1982-11-25 KR KR8205318A patent/KR890000419B1/ko not_active Expired
- 1982-12-02 IT IT49608/82A patent/IT1149399B/it active
- 1982-12-07 ES ES517996A patent/ES8405767A1/es not_active Expired
- 1982-12-07 YU YU2710/82A patent/YU44035B/xx unknown
- 1982-12-09 NL NL8204775A patent/NL8204775A/nl unknown
- 1982-12-09 JP JP57214747A patent/JPS6058231B2/ja not_active Expired
- 1982-12-09 FI FI824234A patent/FI76561C/fi not_active IP Right Cessation
- 1982-12-10 DK DK551582A patent/DK156648C/da not_active IP Right Cessation
- 1982-12-13 HU HU824018A patent/HU186190B/hu not_active IP Right Cessation
- 1982-12-13 CH CH7245/82A patent/CH655101A5/de not_active IP Right Cessation
- 1982-12-13 SE SE8207112A patent/SE454442B/sv not_active IP Right Cessation
- 1982-12-13 PT PT75980A patent/PT75980B/pt not_active IP Right Cessation
- 1982-12-14 AT AT0454082A patent/AT378182B/de not_active IP Right Cessation
-
1984
- 1984-03-01 ES ES530218A patent/ES530218A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CH655101A5 (de) | 1986-03-27 |
| NL8204775A (nl) | 1983-07-01 |
| SE8207112L (sv) | 1983-06-15 |
| ES517996A0 (es) | 1984-06-16 |
| SE454442B (sv) | 1988-05-02 |
| PT75980B (en) | 1985-12-20 |
| YU271082A (en) | 1985-03-20 |
| IT1149399B (it) | 1986-12-03 |
| ES8506274A1 (es) | 1985-07-01 |
| FI824234A0 (fi) | 1982-12-09 |
| KR840002355A (ko) | 1984-06-25 |
| JPS6058231B2 (ja) | 1985-12-19 |
| ATA454082A (de) | 1984-11-15 |
| CA1213282A (en) | 1986-10-28 |
| DK551582A (da) | 1983-06-15 |
| FI76561B (fi) | 1988-07-29 |
| PT75980A (en) | 1983-01-01 |
| JPS58105963A (ja) | 1983-06-24 |
| US4394507A (en) | 1983-07-19 |
| YU44035B (en) | 1990-02-28 |
| FI76561C (fi) | 1988-11-10 |
| GR77107B (de) | 1984-09-06 |
| SE8207112D0 (sv) | 1982-12-13 |
| HU186190B (en) | 1985-06-28 |
| ES530218A0 (es) | 1985-07-01 |
| KR890000419B1 (ko) | 1989-03-17 |
| ES8405767A1 (es) | 1984-06-16 |
| FI824234L (fi) | 1983-06-15 |
| IT8249608A0 (it) | 1982-12-02 |
| DK156648B (da) | 1989-09-18 |
| AT378182B (de) | 1985-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK280182A (da) | Fremgangsmaade til fremstilling af n-aryl-piperazinalkanamider | |
| DK301986D0 (da) | Fremgangsmaade til fremstilling af 1-hydroxyvitamin-d-forbindelser | |
| DK280083D0 (da) | Fremgangsmade til fremstilling af 2-(4-puridyl)-thiazolderivater | |
| DK302086A (da) | Fremgangsmaade til fremstilling af 1 alfa-hydroxyvitamin-d-forbindelser | |
| DK525481A (da) | Fremgangsmaade til fremstilling af pyrimidoner | |
| DK497682A (da) | Fremgangsmaade til fremstilling af 7-oxabicycloheptan- og 7-oxabicycloheptenprostaglandinanaloge | |
| DK79882A (da) | Fremgangsmaade til fremstilling af substituerede n-(4-indolyl-piperidino-alkyl)-benzimidazoloner | |
| DK149846C (da) | Analogifremgangsmaade til fremstilling af n,n'-bis-tetrahydro-isoquinolyldisulfonylimider | |
| DK262782A (da) | Fremgangsmaade til fremstilling af n-dihydrothiazolyl-3-quinolincarboxamidderivater | |
| DK379985A (da) | Fremgangsmaade til fremstilling af 6-chlor-n-methyl-2,3,4,5-tetrahydro-lh-benzazepin | |
| DK416082A (da) | Fremgangsmaade til fremstilling af aminopropanolderivater af 2-hydroxy-beta-phenylpropiophenoner | |
| DK157855C (da) | Fremgangsmaade til fremstilling af 2,3-dichlor-5-trichlormethylpyridin | |
| DK312082A (da) | Fremgangsmaade til fremstilling af benzothiazolsulfonamidderivater | |
| DK40482A (da) | Fremgangsmaade til fremstilling af 2-(2-(1,4-benzodioxanyl))-2-imidazolinderivater | |
| DK218183D0 (da) | Fremgangsmade til fremstilling af 2(1h)-pyridinon-derivater | |
| DK370582A (da) | Fremgangsmaade til fremstilling af 2-beta-d-ribofuranosylthiazol-4-carboxamid | |
| DK553582A (da) | Fremgangsmaade til fremstilling af naphthoxyalkylaminer | |
| DK174380A (da) | Fremgangsmaade til fremstilling af 2!,6!adialkyl-n-alkoxymethyl-2-chlor-acetanillider | |
| DK113483A (da) | Fremgangsmaade til fremstilling af 3,4-diphenyl-5-methylpyrazolderivater | |
| DK24083D0 (da) | Fremgangsmade til fremstilling af 0,0'-dithiodibenzoesyrer | |
| DK154207C (da) | Fremgangsmaade til fremstilling af 1,8-dihydroxy-10-acyl-9-anthroner | |
| DK156648C (da) | Fremgangsmaade til fremstilling af 4-methoxy-2'-(2-(1-methyl-2-piperidyl)ethyl)benzanilid (encainid) | |
| DK153488C (da) | Fremgangsmaade til fremstilling af 5,6,7,7a-tetrahydro-4h-thieno(3,2-c-)-pyridin-2-onderivater | |
| DK105082A (da) | Fremgangsmaade til fremstilling af substituerede trifluormethylphenyl-tetrahydropyridiner | |
| DK501582A (da) | Fremgangsmaade til fremstilling af acylcyanider |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |