DK153841C - Fremgangsmaade til fremstilling af ranitidin - Google Patents
Fremgangsmaade til fremstilling af ranitidinInfo
- Publication number
- DK153841C DK153841C DK582081A DK582081A DK153841C DK 153841 C DK153841 C DK 153841C DK 582081 A DK582081 A DK 582081A DK 582081 A DK582081 A DK 582081A DK 153841 C DK153841 C DK 153841C
- Authority
- DK
- Denmark
- Prior art keywords
- ranitidin
- procedure
- preparation
- Prior art date
Links
- VMXUWOKSQNHOCA-UHFFFAOYSA-N N1'-[2-[[5-[(dimethylamino)methyl]-2-furanyl]methylthio]ethyl]-N1-methyl-2-nitroethene-1,1-diamine Chemical compound [O-][N+](=O)C=C(NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/46—Doubly bound oxygen atoms, or two oxygen atoms singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8041493 | 1980-12-30 | ||
| GB8041493 | 1980-12-30 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK582081A DK582081A (da) | 1982-07-01 |
| DK153841B DK153841B (da) | 1988-09-12 |
| DK153841C true DK153841C (da) | 1989-02-20 |
Family
ID=10518248
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK582081A DK153841C (da) | 1980-12-30 | 1981-12-30 | Fremgangsmaade til fremstilling af ranitidin |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4399294A (Direct) |
| EP (1) | EP0055625B1 (Direct) |
| JP (1) | JPS57134475A (Direct) |
| KR (1) | KR850001935B1 (Direct) |
| AR (2) | AR230275A1 (Direct) |
| AT (1) | ATE13057T1 (Direct) |
| DE (1) | DE3170346D1 (Direct) |
| DK (1) | DK153841C (Direct) |
| ES (1) | ES8301955A1 (Direct) |
| FI (1) | FI82241C (Direct) |
| PT (1) | PT74235B (Direct) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5988458A (ja) * | 1982-11-12 | 1984-05-22 | Toyama Chem Co Ltd | アミン誘導体およびその塩 |
| CA1279328C (en) * | 1983-07-15 | 1991-01-22 | Janos Borvendeg | Process for preparing basic thioethers and the salts thereof |
| DK153758B (da) * | 1985-09-27 | 1988-08-29 | Gea Farmaceutisk Fabrik As | Fremgangsmaade til fremstilling af ranitidin eller syreadditionssalte deraf samt derivat af 5-((2-aminoethyl)thiomethyl)-2-furanmethanol til brug som udgangsmateriale for fremgangsmaaden |
| KR950009825B1 (ko) * | 1986-03-28 | 1995-08-29 | 자누스 화마스티씨 에스.알.엘. | 치료학적 항궤양 활성이 있는 니페로티딘의 합성방법 |
| YU52598A (sh) * | 1998-11-19 | 2001-05-28 | D.D. Zdravlje- sektor za istraživanje i razvoj | POSTUPAK ZA sintezu N-[2[[[5=[(DIALKILAMINO)METIL]-2= FURANIL]METIL]TIO]ETIL]-N'-ALKIL-2-NITRO 1,1 ALKENDIAMINA I NJIHOVIH HIDROHLORIDA |
| CN108864001A (zh) * | 2018-06-30 | 2018-11-23 | 郑州明泽医药科技有限公司 | 一种合成雷尼替丁的新方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1565966A (en) * | 1976-08-04 | 1980-04-23 | Allen & Hanburys Ltd | Aminoalkyl furan derivatives |
| AR228941A1 (es) * | 1978-04-26 | 1983-05-13 | Glaxo Group Ltd | Procedimiento para preparar nuevos derivados de 3,5-diamino-1,2,4-triazol que son activos contra receptores histaminicos |
| GB2067991B (en) * | 1980-01-08 | 1983-10-19 | Glaxo Group Ltd | Process for the preparation of a furan derivative |
-
1981
- 1981-12-30 DE DE8181306164T patent/DE3170346D1/de not_active Expired
- 1981-12-30 PT PT74235A patent/PT74235B/pt unknown
- 1981-12-30 DK DK582081A patent/DK153841C/da not_active IP Right Cessation
- 1981-12-30 ES ES508474A patent/ES8301955A1/es not_active Expired
- 1981-12-30 AR AR288012A patent/AR230275A1/es active
- 1981-12-30 KR KR1019810005251A patent/KR850001935B1/ko not_active Expired
- 1981-12-30 JP JP56216182A patent/JPS57134475A/ja active Granted
- 1981-12-30 AT AT81306164T patent/ATE13057T1/de not_active IP Right Cessation
- 1981-12-30 AR AR288011A patent/AR230442A1/es active
- 1981-12-30 FI FI814215A patent/FI82241C/fi not_active IP Right Cessation
- 1981-12-30 US US06/335,686 patent/US4399294A/en not_active Expired - Lifetime
- 1981-12-30 EP EP81306164A patent/EP0055625B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PT74235A (en) | 1982-01-02 |
| FI82241C (fi) | 1991-02-11 |
| US4399294A (en) | 1983-08-16 |
| AR230275A1 (es) | 1984-03-01 |
| EP0055625B1 (en) | 1985-05-02 |
| DE3170346D1 (en) | 1985-06-05 |
| JPS57134475A (en) | 1982-08-19 |
| ES508474A0 (es) | 1983-01-01 |
| PT74235B (en) | 1984-01-04 |
| JPH038349B2 (Direct) | 1991-02-05 |
| EP0055625A1 (en) | 1982-07-07 |
| ATE13057T1 (de) | 1985-05-15 |
| FI82241B (fi) | 1990-10-31 |
| KR830007614A (ko) | 1983-11-04 |
| KR850001935B1 (ko) | 1985-12-31 |
| FI814215L (fi) | 1982-07-01 |
| DK582081A (da) | 1982-07-01 |
| ES8301955A1 (es) | 1983-01-01 |
| AR230442A1 (es) | 1984-04-30 |
| DK153841B (da) | 1988-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK534481A (da) | Fremgangsmaade til fremstilling af 1-sulfo-2-oxoazetidinderivater | |
| DK99781A (da) | Fremgangsmaade til fremstilling af carboxtyrilderivater | |
| DK2281A (da) | Fremgangsmaade til fremstilling af tiazolinderivater | |
| DK1183D0 (da) | Fremgangsmade til fremstilling af tiazolidinderivater | |
| DK300981A (da) | Fremgangsmaade til fremstilling af imidazolderivater | |
| DK161581A (da) | Fremgangsmaade til fremstilling af imidazolderivater | |
| DK150903C (da) | Analogifremgangsmaade til fremstilling af benzisoselenazoloner | |
| DK100281A (da) | Fremgangsmaade til fremstilling af imidazolderivater | |
| DK153282A (da) | Fremgangsmaade til fremstilling af bismethinisoindoliner | |
| DK239382A (da) | Fremgangsmaade til fremstilling af anthracyclinglycosider | |
| DK305982A (da) | Fremgangsmaade til fremstilling af amidobenzamider | |
| DK564781A (da) | Fremgangsmaade til fremstilling af pyrazoloindazolderivater | |
| DK554581A (da) | Fremgangsmaade til fremstilling af alkylendioxybenzenderivater | |
| DK172181A (da) | Fremgangsmaade til fremstilling af 9-carbamoyl-9-aminoalkylfluoren-derivater | |
| DK364481A (da) | Fremgangsmaade til fremstilling af caprylolactamer | |
| DK565281A (da) | Fremgangsmaade til fremstilling af quinolon-derivater | |
| DK296281A (da) | Fremgangsmaade til fremstilling af aminocyklopentanonamider | |
| DK85281A (da) | Fremgangsmaade til fremstilling af phenoxyderivater | |
| DK424781A (da) | Fremgangsmaade til fremstilling af quinolonderivater | |
| DK448981A (da) | Fremgangsmaade til fremstilling af 4-chinolinmethanderivater | |
| DK579181A (da) | Fremgangsmaade til fremstilling af diarylthiophener | |
| DK551481A (da) | Fremgangsmaade til fremstilling af triazolderivater | |
| DK153841C (da) | Fremgangsmaade til fremstilling af ranitidin | |
| DK12581A (da) | Fremgangsmaade til fremstilling af kijanimicin | |
| DK504881A (da) | Fremgangsmaade til fremstilling af oxadiazolopyrimidinderivater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |