DK140697B - Fremgangsmåde til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin. - Google Patents
Fremgangsmåde til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin.Info
- Publication number
- DK140697B DK140697B DK38570AA DK38570A DK140697B DK 140697 B DK140697 B DK 140697B DK 38570A A DK38570A A DK 38570AA DK 38570 A DK38570 A DK 38570A DK 140697 B DK140697 B DK 140697B
- Authority
- DK
- Denmark
- Prior art keywords
- dihydropteridine
- hydroxymethyl
- hydroxy
- dimethyl
- amino
- Prior art date
Links
- JWNVZJZMJXISNG-UHFFFAOYSA-N 2-amino-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin-4-one Chemical compound N1C(N)=NC(=O)C2=C1NC(C)(C)C(CO)=N2 JWNVZJZMJXISNG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D475/00—Heterocyclic compounds containing pteridine ring systems
- C07D475/02—Heterocyclic compounds containing pteridine ring systems with an oxygen atom directly attached in position 4
- C07D475/04—Heterocyclic compounds containing pteridine ring systems with an oxygen atom directly attached in position 4 with a nitrogen atom directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Indole Compounds (AREA)
- Furan Compounds (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK503576A DK140549B (da) | 1969-01-28 | 1976-11-08 | Pyrimidinderivat til anvendelse som mellemprodukt til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7, 7-dimethyl-7, 8-dihydropteridin. |
| DK209379A DK209379A (da) | 1969-01-28 | 1979-05-22 | Fremgangsmaade til fremstilling af et laegemiddel med antimikrobiel virkning |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US79478669A | 1969-01-28 | 1969-01-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK140697B true DK140697B (da) | 1979-10-29 |
Family
ID=25163682
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK38570AA DK140697B (da) | 1969-01-28 | 1970-01-27 | Fremgangsmåde til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin. |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3635978A (enExample) |
| JP (1) | JPS4813555B1 (enExample) |
| AR (1) | AR192568A1 (enExample) |
| BE (1) | BE745104A (enExample) |
| BR (1) | BR6915073D0 (enExample) |
| CA (1) | CA959490A (enExample) |
| CH (1) | CH535249A (enExample) |
| DE (2) | DE2003859A1 (enExample) |
| DK (1) | DK140697B (enExample) |
| ES (1) | ES375933A1 (enExample) |
| FI (1) | FI50979C (enExample) |
| FR (1) | FR2034499B1 (enExample) |
| GB (5) | GB1303171A (enExample) |
| HU (1) | HU162913B (enExample) |
| IL (2) | IL33783A (enExample) |
| NL (1) | NL169880C (enExample) |
| PL (2) | PL87801B1 (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1363064A (en) * | 1970-07-27 | 1974-08-14 | Wellcome Found | Pyrimidine derivatives as intermediates in the synthesis of pteridines |
| US3959278A (en) * | 1970-07-27 | 1976-05-25 | Burroughs Wellcome Co. | Method of synthesis of pteridines |
| ZA725322B (en) * | 1971-08-05 | 1974-03-27 | Wellcome Found | Potentiating formulations |
| GB1453831A (en) * | 1972-08-01 | 1976-10-27 | Wellcome Found | Biologically active compounds and compositions |
| US4156725A (en) * | 1972-08-01 | 1979-05-29 | Burroughs Wellcome Co. | Bacteriostatic biologically active compositions |
| GB1454165A (en) * | 1972-08-01 | 1976-10-27 | Wellcome Found | Biologically active compounds and compositions |
| GB1451043A (en) * | 1972-08-01 | 1976-09-29 | Wellcome Found | Biologicylly acitve compounds and compositions |
| US4036961A (en) * | 1972-08-01 | 1977-07-19 | Burroughs Wellcome Co. | Pharmaceutical compositions containing pteridines |
| US4073786A (en) * | 1973-07-30 | 1978-02-14 | Burroughs Wellcome Co. | 2-Amino-4-hydroxy-6-hydroxymethyl-7,7-diethyl-7,8-dihydropteridine and the 7-spirocyclohexyl analogue thereof |
| JP3181375B2 (ja) * | 1992-05-30 | 2001-07-03 | 株式会社豊夢 | 接合具及びそれを用いた構造部材の接合方法並びに構造部材間の接合構造 |
| WO2000023448A1 (en) * | 1998-10-22 | 2000-04-27 | Moheno Phillip B B | Novel pterin antineoplastic agents |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2547501A (en) * | 1946-12-10 | 1951-04-03 | American Cyanamid Co | Method of preparing 2-amino-4-hydroxy-6-methylol pteridine |
-
1969
- 1969-01-28 US US794786*A patent/US3635978A/en not_active Expired - Lifetime
- 1969-12-12 BR BR215073/69A patent/BR6915073D0/pt unknown
-
1970
- 1970-01-23 GB GB330170A patent/GB1303171A/en not_active Expired
- 1970-01-23 GB GB4173072A patent/GB1303172A/en not_active Expired
- 1970-01-23 GB GB4173172A patent/GB1303173A/en not_active Expired
- 1970-01-26 PL PL1970166422A patent/PL87801B1/pl unknown
- 1970-01-26 PL PL1970138382A patent/PL82983B1/pl unknown
- 1970-01-27 IL IL33783A patent/IL33783A/en unknown
- 1970-01-27 HU HUUI150A patent/HU162913B/hu unknown
- 1970-01-27 CH CH114870A patent/CH535249A/de not_active IP Right Cessation
- 1970-01-27 CA CA073,270A patent/CA959490A/en not_active Expired
- 1970-01-27 FI FI700217A patent/FI50979C/fi active
- 1970-01-27 NL NLAANVRAGE7001122,A patent/NL169880C/xx not_active IP Right Cessation
- 1970-01-27 ES ES375933A patent/ES375933A1/es not_active Expired
- 1970-01-27 IL IL39672A patent/IL39672A/en unknown
- 1970-01-27 DK DK38570AA patent/DK140697B/da unknown
- 1970-01-28 BE BE745104D patent/BE745104A/xx unknown
- 1970-01-28 FR FR7002913A patent/FR2034499B1/fr not_active Expired
- 1970-01-28 DE DE19702003859 patent/DE2003859A1/de not_active Ceased
- 1970-01-28 DE DE2056569A patent/DE2056569B2/de active Granted
- 1970-09-01 GB GB4173372A patent/GB1303175A/en not_active Expired
- 1970-09-01 GB GB4173272A patent/GB1303174A/en not_active Expired
-
1971
- 1971-02-15 AR AR234009A patent/AR192568A1/es active
- 1971-10-27 JP JP46085457A patent/JPS4813555B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2003859A1 (de) | 1971-04-08 |
| AR192568A1 (es) | 1973-02-28 |
| PL87801B1 (en) | 1976-07-31 |
| FI50979B (enExample) | 1976-05-31 |
| CH535249A (de) | 1973-03-31 |
| GB1303172A (enExample) | 1973-01-17 |
| FR2034499B1 (enExample) | 1973-12-21 |
| DE2056569C3 (enExample) | 1980-02-21 |
| US3635978A (en) | 1972-01-18 |
| NL7001122A (enExample) | 1970-07-30 |
| JPS4813555B1 (enExample) | 1973-04-27 |
| PL82983B1 (en) | 1975-12-31 |
| IL33783A0 (en) | 1970-03-22 |
| BR6915073D0 (pt) | 1973-07-17 |
| DE2056569B2 (de) | 1979-06-13 |
| IL33783A (en) | 1972-09-28 |
| IL39672A (en) | 1972-12-29 |
| CA959490A (en) | 1974-12-17 |
| DE2056569A1 (de) | 1971-08-12 |
| GB1303175A (enExample) | 1973-01-17 |
| BE745104A (fr) | 1970-07-28 |
| FI50979C (fi) | 1976-09-10 |
| GB1303174A (enExample) | 1973-01-17 |
| GB1303173A (enExample) | 1973-01-17 |
| GB1303171A (enExample) | 1973-01-17 |
| HU162913B (enExample) | 1973-04-28 |
| FR2034499A1 (enExample) | 1970-12-11 |
| ES375933A1 (es) | 1972-09-01 |
| NL169880C (nl) | 1982-09-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK130306B (da) | Analogifremgangsmåde til fremstilling af S-trialkylphosphinguld-1-thio-β-D-glucopyranosider. | |
| DK136314B (da) | Analogifremgangsmåde til fremstilling af benzamidoethylpiperaziner. | |
| DK140697B (da) | Fremgangsmåde til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin. | |
| DK133375B (da) | Analogifremgangsmåde til fremstilling af 1-carbamoyl-3-phenylpyrrolidiner. | |
| DK126944B (da) | Analogifremgangsmåde til fremstilling af hexahydrobenzindolderivater. | |
| DK125089B (da) | Analogifremgangsmåde til fremstilling af evomonosidderivater. | |
| DK128006B (da) | Analogifremgangsmåde til fremstilling af 11-desacetoxy-wortmannin. | |
| DK123236B (da) | Fremgangsmåde til fremstilling af 2-alkyl-3-hydoxy-4,5-dihydrofuran-4-oner. | |
| DK121052B (da) | Fremgangsmåde til fremstilling af steroid-17α,21-orthocarbonater. | |
| DK128737B (da) | Analogifremgangsmåde til fremstilling af 6α-methyl-17α-caproyloxy-19-norprogesteron. | |
| DK123096B (da) | Analogifremgangsmåde til fremstilling af neriifolinderivater. | |
| DK122456B (da) | Fremgangsmåde til fremstilling af quinoxalin-di-N-oxid-aldehyd. | |
| DK123816B (da) | Analogifremgangsmåde til fremstilling af N-phenacylcarbamater. | |
| DK122127B (da) | Analogifremgangsmåde til fremstilling af 3-phenyl-4-acyloxycarbostyriler. | |
| DK124331B (da) | Analogifremgangsmåde til fremstilling af 14β-hydroksy-15α-acyloksy-4,20(22)-kardadienolider. | |
| DK124686B (da) | Analogifremgangsmåde til fremstilling af bis-thiachromonylforbindelser. | |
| DK139071B (da) | Fremgangsmåde til fremstilling af copolymerisater. | |
| DK125790B (da) | Fremgangsmåde til fremstilling af L-β-3,4-dihydroxyphenyl-α-alanin. | |
| DK126186B (da) | Fremgangsmåde til fremstilling af 13β-alkylgona-4,9-diener. | |
| DK128777B (da) | Fremgangsmåde til fremstilling af 3β-alkanoyloxy-6-halogen-pregna-4,6-dien-20-oner. | |
| DK126190B (da) | Fremgangsmåde til fremstilling af 4-chlor-14β-hydroxy-carda-4,20(22)-dienolider. | |
| DK127474B (da) | Fremgangsmåde til fremstilling af steroid-spirocyclobutanoner. | |
| DK122958B (da) | Fremgangsmåde til fremstilling af 4-alkoxypiperidiner. | |
| DK124552B (da) | Fremgangsmåde til fremstilling af α-aminobenzylpenicillin. | |
| DK126945B (da) | Fremgangsmåde til fremstilling af 3-phenyl-5-tert.butyl-oxadiazol-2-on. |