DK140635B - Fremgangsmåde til fremstilling ag 1-(tetrahydro-2-furyl)-5-fluoruracil, 1,3-bis-(tetrahydro)-2-furyl)-5-fluoruracil eller en blanding deraf. - Google Patents
Fremgangsmåde til fremstilling ag 1-(tetrahydro-2-furyl)-5-fluoruracil, 1,3-bis-(tetrahydro)-2-furyl)-5-fluoruracil eller en blanding deraf.Info
- Publication number
- DK140635B DK140635B DK528576AA DK528576A DK140635B DK 140635 B DK140635 B DK 140635B DK 528576A A DK528576A A DK 528576AA DK 528576 A DK528576 A DK 528576A DK 140635 B DK140635 B DK 140635B
- Authority
- DK
- Denmark
- Prior art keywords
- fluorouracil
- furyl
- tetrahydro
- bis
- mixture
- Prior art date
Links
- WFWLQNSHRPWKFK-UHFFFAOYSA-N Tegafur Chemical compound O=C1NC(=O)C(F)=CN1C1OCCC1 WFWLQNSHRPWKFK-UHFFFAOYSA-N 0.000 title 1
- 229960002949 fluorouracil Drugs 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14271775A JPS5268188A (en) | 1975-11-28 | 1975-11-28 | Preparation of 1-(tetrahydro-2-furyl)-5-fluorouracil |
| JP526076A JPS5289679A (en) | 1976-01-19 | 1976-01-19 | Preparation of 5-fluorouracil derivatives |
| JP8386376A JPS539778A (en) | 1976-07-13 | 1976-07-13 | Preparation of 5-fluorouracil derivativds |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK528576A DK528576A (online.php) | 1977-05-29 |
| DK140635B true DK140635B (da) | 1979-10-15 |
| DK140635C DK140635C (online.php) | 1980-03-10 |
Family
ID=27276677
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK528576AA DK140635B (da) | 1975-11-28 | 1976-11-24 | Fremgangsmåde til fremstilling ag 1-(tetrahydro-2-furyl)-5-fluoruracil, 1,3-bis-(tetrahydro)-2-furyl)-5-fluoruracil eller en blanding deraf. |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4249006A (online.php) |
| AT (1) | AT346858B (online.php) |
| AU (1) | AU501833B2 (online.php) |
| BE (1) | BE848662A (online.php) |
| CA (1) | CA1122983A (online.php) |
| CH (1) | CH616936A5 (online.php) |
| DE (1) | DE2653398C2 (online.php) |
| DK (1) | DK140635B (online.php) |
| FR (1) | FR2332991A1 (online.php) |
| GB (1) | GB1570219A (online.php) |
| GR (1) | GR62855B (online.php) |
| HK (1) | HK11283A (online.php) |
| HU (1) | HU176890B (online.php) |
| IE (1) | IE45046B1 (online.php) |
| MX (1) | MX3873E (online.php) |
| MY (1) | MY8400088A (online.php) |
| NL (1) | NL7613285A (online.php) |
| NO (1) | NO144887C (online.php) |
| PH (1) | PH12998A (online.php) |
| PL (1) | PL104613B1 (online.php) |
| PT (1) | PT65883B (online.php) |
| SE (1) | SE423389B (online.php) |
| SG (1) | SG783G (online.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20080050425A1 (en) * | 2003-05-20 | 2008-02-28 | Jonathan Lewis | Combination Chemotherapy Comprising 5-Fluorouracil or a Derivative Thereof and a Liposomal Platinum Complex |
| CN103159746B (zh) * | 2011-12-12 | 2015-09-02 | 山东新时代药业有限公司 | 一种工业法合成替加氟的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1695297C3 (de) * | 1968-01-10 | 1978-12-07 | Institut Organitscheskogo Sinteza, Riga (Sowjetunion) | 5-Fluor-l-(2-tetrahydrofuryl)-uracil und dessen Alkal'imetaUsalze, Verfahren zu deren Herstellung und diese enthaltende Mittel |
| US3912734A (en) * | 1972-11-20 | 1975-10-14 | Solomon Aronovich Giller | Method for preparing N{HD 1{B -(2{40 -furanidyl)-and N{HD 1{B -2(2{40 -pyranidyl) uracils |
| US3960864A (en) * | 1974-05-06 | 1976-06-01 | The University Of Utah | Method of synthesizing 1-(tetrahydro-2-furanyl)-5-fluorouracil |
| DE2519079A1 (de) * | 1975-04-29 | 1976-11-11 | Inst Orch Sintesa Akademii Nau | Verfahren zur herstellung von n tief 1-(2'-furanicyl)-5-substituierten uracilen |
| JPS5259174A (en) * | 1975-11-10 | 1977-05-16 | Asahi Chem Ind Co Ltd | Preparation of n-substituted uracil compounds |
-
1976
- 1976-11-04 IE IE2461/76A patent/IE45046B1/en unknown
- 1976-11-05 GR GR52112A patent/GR62855B/el unknown
- 1976-11-05 CA CA265,062A patent/CA1122983A/en not_active Expired
- 1976-11-08 CH CH1402276A patent/CH616936A5/fr not_active IP Right Cessation
- 1976-11-12 GB GB47197/76A patent/GB1570219A/en not_active Expired
- 1976-11-15 AU AU19655/76A patent/AU501833B2/en not_active Expired
- 1976-11-15 FR FR7634249A patent/FR2332991A1/fr active Granted
- 1976-11-23 BE BE6045773A patent/BE848662A/xx not_active IP Right Cessation
- 1976-11-24 PT PT65883A patent/PT65883B/pt unknown
- 1976-11-24 PL PL1976193890A patent/PL104613B1/pl unknown
- 1976-11-24 MX MX765150U patent/MX3873E/es unknown
- 1976-11-24 US US05/744,929 patent/US4249006A/en not_active Expired - Lifetime
- 1976-11-24 DE DE2653398A patent/DE2653398C2/de not_active Expired
- 1976-11-24 DK DK528576AA patent/DK140635B/da not_active IP Right Cessation
- 1976-11-25 AT AT874876A patent/AT346858B/de not_active IP Right Cessation
- 1976-11-26 PH PH19171A patent/PH12998A/en unknown
- 1976-11-26 NO NO764048A patent/NO144887C/no unknown
- 1976-11-26 SE SE7613305A patent/SE423389B/xx not_active IP Right Cessation
- 1976-11-26 HU HU76TA1418A patent/HU176890B/hu unknown
- 1976-11-29 NL NL7613285A patent/NL7613285A/xx not_active Application Discontinuation
-
1983
- 1983-01-10 SG SG7/83A patent/SG783G/en unknown
- 1983-03-24 HK HK112/83A patent/HK11283A/xx unknown
-
1984
- 1984-12-30 MY MY88/84A patent/MY8400088A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| HK11283A (en) | 1983-03-24 |
| IE45046L (en) | 1977-05-28 |
| CA1122983A (en) | 1982-05-04 |
| US4249006A (en) | 1981-02-03 |
| NO144887C (no) | 1981-12-02 |
| ATA874876A (de) | 1978-04-15 |
| DE2653398A1 (de) | 1977-06-08 |
| BE848662A (fr) | 1977-05-23 |
| CH616936A5 (online.php) | 1980-04-30 |
| FR2332991A1 (fr) | 1977-06-24 |
| DE2653398C2 (de) | 1986-07-17 |
| FR2332991B1 (online.php) | 1980-03-21 |
| HU176890B (en) | 1981-05-28 |
| MY8400088A (en) | 1984-12-31 |
| PT65883B (en) | 1978-10-12 |
| AU501833B2 (en) | 1979-06-28 |
| DK528576A (online.php) | 1977-05-29 |
| DK140635C (online.php) | 1980-03-10 |
| SE423389B (sv) | 1982-05-03 |
| AU1965576A (en) | 1978-05-25 |
| NO144887B (no) | 1981-08-24 |
| SG783G (en) | 1983-09-09 |
| PL104613B1 (pl) | 1979-08-31 |
| SE7613305L (sv) | 1977-05-29 |
| PH12998A (en) | 1979-10-29 |
| AT346858B (de) | 1978-11-27 |
| IE45046B1 (en) | 1982-06-16 |
| GB1570219A (en) | 1980-06-25 |
| GR62855B (en) | 1979-06-23 |
| NO764048L (online.php) | 1977-06-01 |
| MX3873E (es) | 1981-08-26 |
| NL7613285A (nl) | 1977-06-01 |
| PT65883A (en) | 1976-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL50431A (en) | Pharmacologically active 5-acetoxy-3-ethenyl dodecahydro-6,10,10b-trihydroxy-3,4,7,7,10a-pentamethyl-1h-naphtho-(2,1b)pyran-1-one obtainined from the plant coleus forkskohlii | |
| NO145433C (no) | Fremgangsmaate til fremstilling av 1,3-butadien. | |
| NL7613240A (nl) | Filmvormend, zonnebrand werend preparaat. | |
| ZA746138B (en) | Antiviral, substituted 1,3-dimethyl-1 h-pyryzolo(3,4b) quinolines | |
| OA05474A (fr) | Nouvelles compositions rodenticides. | |
| SE429237B (sv) | Forfarande for framstellning av 9,3",4"-tri-alkanoyl sf-837 m,-derivat | |
| NL7803720A (nl) | (1,5)pyrido2,3-bbenzothiazepine-derivaten. | |
| NL7506544A (nl) | 1,4-benzopyron-6-carbonzuurderivaten. | |
| ZA763977B (en) | "4-imino-1,3-diazobicyclo(3.1.0)hexan-2-one" | |
| BE848521Q (fr) | Procede d'epoxydation, | |
| DK140635B (da) | Fremgangsmåde til fremstilling ag 1-(tetrahydro-2-furyl)-5-fluoruracil, 1,3-bis-(tetrahydro)-2-furyl)-5-fluoruracil eller en blanding deraf. | |
| SU674671A3 (ru) | Способ получени производных пирролидина | |
| IT1065800B (it) | Procedimento per preparare trimetil-3,5,5 cicloesen-2 dione-1,4 | |
| DK135167B (da) | Analogifremgangsmåde til fremstilling af 7,7'-ditheophyllinderivater. | |
| NO142302C (no) | Fremgangsmaate for fremstilling av 1,3-bis(klor- eller brommetyl)fenobarbitaler | |
| PH13008A (en) | 9-hydroxy-7,8,9,10-tetrahydro-6h-dibenzo(b)(d)pyrans | |
| DK138319B (da) | Analogifremgangsmåde til fremstilling af 6-fluoralkyl-2(1H), 3(4H)-quinoxalindionforbindelser. | |
| DK140636B (da) | Fremgangsmåde til fremstilling ag N1-(2-tetrahydrofuryl)-5-fluoruracil. | |
| CA1025448A (en) | 1,3-benzodioxole derivatives | |
| MX4958E (es) | Procedimiento para preparar 2,9 dioxatriciclo(4,3,1,03,7)decano | |
| IT1065785B (it) | Procedimento per preparare dicloro 3.5 fenil 3 idantoina | |
| NL7411003A (nl) | Werkwijze om 3.3'-thiobis(2-methoxy-1-aza- benanthron) te bereiden. | |
| PL206901A1 (pl) | Sposob wytwarzania nowych pochodnych 5,6-dwuwodoroimidazo(5,1-a)-izochinoliny | |
| SU580187A1 (ru) | Стекло | |
| SU573169A1 (ru) | Электродегидратор |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |