DK135127B - Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. - Google Patents
Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre.Info
- Publication number
- DK135127B DK135127B DK565070AA DK565070A DK135127B DK 135127 B DK135127 B DK 135127B DK 565070A A DK565070A A DK 565070AA DK 565070 A DK565070 A DK 565070A DK 135127 B DK135127 B DK 135127B
- Authority
- DK
- Denmark
- Prior art keywords
- derivatives
- preparation
- aminopenicillanic acid
- analogous process
- analogous
- Prior art date
Links
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5520969 | 1969-11-11 | ||
| GB33211/70A GB1293590A (en) | 1969-11-11 | 1969-11-11 | New penicillanic acid derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK135127B true DK135127B (da) | 1977-03-07 |
| DK135127C DK135127C (esLanguage) | 1977-08-15 |
Family
ID=26261769
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK565070AA DK135127B (da) | 1969-11-11 | 1970-11-06 | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. |
Country Status (22)
| Country | Link |
|---|---|
| JP (1) | JPS518955B1 (esLanguage) |
| AT (1) | AT301026B (esLanguage) |
| BE (1) | BE758782A (esLanguage) |
| BG (1) | BG18619A3 (esLanguage) |
| CH (2) | CH559752A5 (esLanguage) |
| CS (1) | CS166020B2 (esLanguage) |
| DE (1) | DE2055531C3 (esLanguage) |
| DK (1) | DK135127B (esLanguage) |
| ES (1) | ES385437A1 (esLanguage) |
| FI (1) | FI54601C (esLanguage) |
| FR (1) | FR2073338A1 (esLanguage) |
| HU (1) | HU162440B (esLanguage) |
| IE (1) | IE34620B1 (esLanguage) |
| IL (1) | IL35490A (esLanguage) |
| IT (1) | IT1044209B (esLanguage) |
| LU (1) | LU62031A1 (esLanguage) |
| NL (1) | NL168227C (esLanguage) |
| NO (1) | NO137826C (esLanguage) |
| PL (1) | PL90581B1 (esLanguage) |
| RO (2) | RO56878A (esLanguage) |
| SE (1) | SE397355B (esLanguage) |
| SU (1) | SU406362A3 (esLanguage) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL79157B1 (esLanguage) * | 1970-12-22 | 1975-06-30 | ||
| GB1364672A (en) * | 1971-06-09 | 1974-08-29 | Beecham Group Ltd | Penicillins |
| GB1427139A (en) * | 1972-03-13 | 1976-03-10 | Astra Laekemedel Ab | Penicillins |
| GB1417099A (en) * | 1973-02-02 | 1975-12-10 | Leo Pharm Prod Ltd | Method for the production of derivatives of 6-aminopenicillanic acid |
| SU566843A1 (ru) * | 1975-01-06 | 1977-07-30 | Ордена Трудового Красного Знамени Институт Органической Синтеза Ан Латвийской Сср | Способ получени производных 6- -амидинопенициллановой кислоты |
| GB1579931A (en) * | 1976-04-15 | 1980-11-26 | Leo Pharm Prod Ltd | Bis-penicillanoyl-oxy-alkanes |
| TWI375678B (en) | 2005-06-09 | 2012-11-01 | Yakult Honsha Kk | A method of preparation of a tricyclic ketone |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3135755A (en) * | 1961-11-20 | 1964-06-02 | Hoffmann La Roche | Pyrimidine formamidines of primary amines |
| US3322781A (en) * | 1963-10-18 | 1967-05-30 | Bristol Myers Co | 6-(substituted-hydroxyamidino)-penicillanic acids |
| CH480792A (de) * | 1967-01-26 | 1969-11-15 | Ciba Geigy | Schädlingsbekämpfungsmittel |
-
0
- BE BE758782D patent/BE758782A/xx not_active IP Right Cessation
-
1970
- 1970-10-20 IL IL35490A patent/IL35490A/xx unknown
- 1970-10-22 IE IE1359/70A patent/IE34620B1/xx unknown
- 1970-11-05 CH CH1644070A patent/CH559752A5/xx not_active IP Right Cessation
- 1970-11-05 CH CH1113074A patent/CH559753A5/xx not_active IP Right Cessation
- 1970-11-05 AT AT995970A patent/AT301026B/de not_active IP Right Cessation
- 1970-11-06 DK DK565070AA patent/DK135127B/da not_active IP Right Cessation
- 1970-11-09 SU SU1489793A patent/SU406362A3/ru active
- 1970-11-10 NO NO4290/70A patent/NO137826C/no unknown
- 1970-11-10 PL PL1970144350A patent/PL90581B1/pl unknown
- 1970-11-10 IT IT70739/70A patent/IT1044209B/it active
- 1970-11-10 RO RO64921A patent/RO56878A/ro unknown
- 1970-11-10 RO RO72470A patent/RO60563A/ro unknown
- 1970-11-10 FR FR7040428A patent/FR2073338A1/fr active Granted
- 1970-11-10 NL NLAANVRAGE7016435,A patent/NL168227C/xx not_active IP Right Cessation
- 1970-11-10 CS CS7560A patent/CS166020B2/cs unknown
- 1970-11-10 SE SE7015181A patent/SE397355B/xx unknown
- 1970-11-10 LU LU62031D patent/LU62031A1/xx unknown
- 1970-11-11 BG BG016025A patent/BG18619A3/xx unknown
- 1970-11-11 DE DE2055531A patent/DE2055531C3/de not_active Expired
- 1970-11-11 JP JP45099009A patent/JPS518955B1/ja active Pending
- 1970-11-11 ES ES385437A patent/ES385437A1/es not_active Expired
- 1970-11-11 HU HULO372A patent/HU162440B/hu not_active IP Right Cessation
- 1970-11-11 FI FI3032/70A patent/FI54601C/fi active
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK120749B (da) | Analogifremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. | |
| DK125794B (da) | Analogifremgangsmåde til fremstilling af 2,3-dichlorphenoxyeddikesyrederivater. | |
| DK134602B (da) | Analogifremgangsmåde til fremstilling af benzimidazolderivater. | |
| DK133046C (da) | Fremgangsmade til fremstilling af 6-aminopenicillansyre | |
| DK128320B (da) | Analogifremgangsmåde til fremstilling af pyrazinderivater. | |
| DK139302B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK133870B (da) | Analogifremgangsmåde til fremstilling af substituerede phenoxycarboxylsyrederivater. | |
| DK122965B (da) | Analogifremgangsmåde til fremstilling af derivater af thiazolylbenzoesyre. | |
| DK118021B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. | |
| DK138315B (da) | Fremgangsmåde til fremstilling af pleuromutilin-derivater. | |
| DK125326B (da) | Analogifremgangsmåde til fremstilling af phenylthiazol-2-ylmalonsyrederivater. | |
| DK124195B (da) | Fremgangsmåde til fremstilling af cis-chrysantheminsyrer. | |
| DK132434B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK123471B (da) | Analogifremgangsmåde til fremstilling af benzyliden-amino-oxyalkylcarboxylsyrederivater. | |
| DK124946B (da) | Analogifremgangsmåde til fremstilling af evomonosidderivater. | |
| DK126944B (da) | Analogifremgangsmåde til fremstilling af hexahydrobenzindolderivater. | |
| DK135127B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK128778B (da) | Analogifremgangsmåde til fremstilling af bis-2-carboxy-chromonylderivater. | |
| DK139778B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK131863B (da) | Analogifremgangsmåde til fremstilling af thiazolino- eller thiazidino-pyrimidinderivater. | |
| DK126203B (da) | Analogifremgangsmåde til fremstilling af thiophenddikesyrederivater. | |
| DK123302B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK134154B (da) | Analogifremgangsmåde til fremstilling af 5-cyklohexyl-1-indankarboxylsyrederivater. | |
| DK138490B (da) | Fremgangsmåde til fremstilling af prostadiensyrederivater. | |
| DK129045B (da) | Analogifremgangsmåde til fremstilling af (p-fluorpheny)-pyridincarboxylsyrer. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |