DK120749B - Analogifremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. - Google Patents
Analogifremgangsmåde til fremstilling af 6-aminopenicillansyrederivater.Info
- Publication number
- DK120749B DK120749B DK219767AA DK219767A DK120749B DK 120749 B DK120749 B DK 120749B DK 219767A A DK219767A A DK 219767AA DK 219767 A DK219767 A DK 219767A DK 120749 B DK120749 B DK 120749B
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- acid derivatives
- aminopenicillanic acid
- analogous process
- analogous
- Prior art date
Links
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical class [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB18130/66A GB1130445A (en) | 1966-04-26 | 1966-04-26 | Penicillins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK120749B true DK120749B (da) | 1971-07-12 |
Family
ID=10107167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK219767AA DK120749B (da) | 1966-04-26 | 1967-04-25 | Analogifremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3433784A (da) |
| AT (1) | AT270866B (da) |
| BE (1) | BE697623A (da) |
| CH (1) | CH473837A (da) |
| DE (1) | DE1670218A1 (da) |
| DK (1) | DK120749B (da) |
| ES (1) | ES339835A1 (da) |
| FR (1) | FR6212M (da) |
| GB (1) | GB1130445A (da) |
| NL (1) | NL6705842A (da) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL107361C (da) * | 1955-04-22 | 1900-01-01 | ||
| US3864329A (en) * | 1970-12-29 | 1975-02-04 | Sumitomo Chemical Co | Penicillins substituted with heterocyclic groups |
| DE2165462C2 (de) * | 1971-12-29 | 1984-12-13 | Sumitomo Chemical Co., Ltd., Osaka | Penicilline, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| US3933797A (en) * | 1972-02-22 | 1976-01-20 | Pfizer Inc. | 6-[α-(ω-QUANIDINOALKANOYLAMIDO)ACYLAMIDO]PENICILLANIC ACIDS |
| US4202900A (en) * | 1972-09-27 | 1980-05-13 | Ciba-Geigy Corporation | Derivatives of penam-3-carboxylic acid and a pharmaceutical composition containing the same |
| US3982011A (en) * | 1972-12-08 | 1976-09-21 | Bayer Aktiengesellschaft | Penicillins |
| DE2260118C2 (de) * | 1972-12-08 | 1982-06-03 | Bayer Ag, 5090 Leverkusen | Penicilline sowie ihre Verwendung als Arzneimittel |
| US4001218A (en) * | 1972-12-08 | 1977-01-04 | Bayer Aktiengesellschaft | Penicillins |
| US4003887A (en) * | 1972-12-15 | 1977-01-18 | Sumitomo Chemical Company, Limited | Novel penicillins and their preparation |
| JPS5417754B2 (da) * | 1972-12-15 | 1979-07-02 | ||
| US3948903A (en) * | 1972-12-15 | 1976-04-06 | Parke, Davis & Company | Substituted N-(1,2-dihydro-2-oxonicotinyl)-cephalexins and -cephaloglycins |
| US4005075A (en) * | 1973-04-05 | 1977-01-25 | Sumitomo Chemical Company, Limited | Penicillins and their preparation |
| JPS5751837B2 (da) * | 1973-04-05 | 1982-11-04 | ||
| US3993642A (en) * | 1973-04-19 | 1976-11-23 | Bayer Aktiengesellschaft | Penicillins |
| DE2320039C3 (de) * | 1973-04-19 | 1981-04-23 | Bayer Ag, 5090 Leverkusen | Penicilline und ihre Verwendung als Arzneimittel |
| US3974288A (en) * | 1973-04-19 | 1976-08-10 | Bayer Aktiengesellschaft | Penicillins |
| US3993770A (en) * | 1973-04-19 | 1976-11-23 | Bayer Aktiengesellschaft | Penicillins |
| US3917644A (en) * | 1973-08-03 | 1975-11-04 | Lilly Co Eli | Azetidinesulfenic acids |
| US3939150A (en) * | 1973-10-19 | 1976-02-17 | Yamanouchi Pharmaceutical Co., Ltd. | Penicillin derivatives |
| US3954734A (en) * | 1974-01-21 | 1976-05-04 | Parke, Davis & Company | Novel antibacterial amide compounds and process means for producing the same |
| US4110327A (en) * | 1974-05-09 | 1978-08-29 | Toyama Chemical Co., Ltd. | 2,3 Diketo-piperazinocarbonylamino alkanoic acids and derivatives |
| GB1568962A (en) * | 1975-10-31 | 1980-06-11 | Beecham Group Ltd | Reparation and compositions containing them (heterocyclic-carbonylamino)pencillins methods for their p |
| US4130559A (en) * | 1976-05-17 | 1978-12-19 | Tsinker Maia G | Method for the preparation of 6-aminopenicillinic acid derivatives |
| NZ184434A (en) * | 1976-06-30 | 1979-03-28 | Dainippon Pharmaceutical Co | Penicillins with a substituted p-hydroxy-benzyl side-chain, and injectable pharmaceutical compositions |
| GB1579362A (en) * | 1977-03-16 | 1980-11-19 | Beecham Group Ltd | 6-(a-heterocyclylcarbonyl amino-acetamido)-penicillins and compositions containing them |
| JPS53124295A (en) * | 1977-04-04 | 1978-10-30 | Mitsubishi Chem Ind Ltd | Penicillin derivatives |
| GB1582217A (en) * | 1978-02-27 | 1981-01-07 | Teijin Ltd | Penicillin derivatives medicines containing the same and process for producing the same |
| US4159268A (en) * | 1978-03-24 | 1979-06-26 | American Cyanamid Company | 3-Chromonecarboxamido derivatives of penicillins |
| US4317774A (en) * | 1978-03-24 | 1982-03-02 | American Cyanamid Company | 6-[D-α-(Coumarin-3-carboxamido)arylacetamido]-penicillanic acids or salts |
| US4341703A (en) * | 1978-03-24 | 1982-07-27 | American Cyanamid Company | 6-[D-α-(Coumarin-3-carboxamido)arylacetamido]-penicillanic acids or salts |
| JPS58177994A (ja) * | 1982-04-12 | 1983-10-18 | Ajinomoto Co Inc | 5−置換−イソオキサゾ−ル−3−カルボン酸誘導体 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3252851A (en) * | 1963-02-18 | 1966-05-24 | Jewell R Benson | Membrane-liner and process of manufacture |
-
1966
- 1966-04-26 GB GB18130/66A patent/GB1130445A/en not_active Expired
-
1967
- 1967-04-19 US US631850A patent/US3433784A/en not_active Expired - Lifetime
- 1967-04-21 CH CH572467A patent/CH473837A/de not_active IP Right Cessation
- 1967-04-21 AT AT378167A patent/AT270866B/de active
- 1967-04-25 DK DK219767AA patent/DK120749B/da unknown
- 1967-04-25 NL NL6705842A patent/NL6705842A/xx unknown
- 1967-04-25 FR FR104034A patent/FR6212M/fr not_active Expired
- 1967-04-26 BE BE697623D patent/BE697623A/xx not_active IP Right Cessation
- 1967-04-26 ES ES339835A patent/ES339835A1/es not_active Expired
- 1967-04-26 DE DE19671670218 patent/DE1670218A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AT270866B (de) | 1969-05-12 |
| GB1130445A (en) | 1968-10-16 |
| NL6705842A (da) | 1967-10-27 |
| DE1670218A1 (de) | 1971-01-21 |
| BE697623A (da) | 1967-10-26 |
| US3433784A (en) | 1969-03-18 |
| FR6212M (da) | 1968-07-29 |
| CH473837A (de) | 1969-06-15 |
| ES339835A1 (es) | 1968-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK120749B (da) | Analogifremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. | |
| DK137854B (da) | Analogifremgangsmåde til fremstilling af 2-nitroimidazolderivater. | |
| DK136901B (da) | Analogifremgangsmåde til fremstilling af 2-anilinonikotinsyrederivater. | |
| DK122766B (da) | Analogifremgangsmåde til fremstilling af oksazolalkansyrederivater. | |
| DK118021B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. | |
| DK122965B (da) | Analogifremgangsmåde til fremstilling af derivater af thiazolylbenzoesyre. | |
| DK120075B (da) | Analogifremgangsmåde til fremstilling af N-aromatisk substituerede syreamider. | |
| DK125251B (da) | Analogifremgangsmåde til fremstilling af thiazolylmalonsyrederivater. | |
| DK123471B (da) | Analogifremgangsmåde til fremstilling af benzyliden-amino-oxyalkylcarboxylsyrederivater. | |
| DK132434B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK130585B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK135127B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK130347B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK129938B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK123302B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK118767B (da) | Fremgangsmåde til fremstilling af N-hydroxyimidothiocarboxylsyreestere. | |
| DK120392B (da) | Analogifremgangsmåde til fremstilling af quinazolinderivater. | |
| DK119561B (da) | Analogifremgangsmåde til fremstilling af dicarboxylsyrederivater af s-triazin. | |
| DK123764B (da) | Analogifremgangsmåde til fremstilling af syreamider. | |
| DK122761B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylurinstofderivater. | |
| DK136644B (da) | Fremgangsmåde til fremstilling af 1-p-chlorbenzoyl-2-methyl-3-indolyl-eddikesyre-forbindelser. | |
| DK115705B (da) | Fremgangsmåde til fremstilling af derivater af tropasyre. | |
| DK120388B (da) | Analogifremgangsmåde til fremstilling af 6-klor-2-(5-nitro-2-furyl)-cinkoninsyre. | |
| DK117703B (da) | Analogifremgangsmåde til fremstilling af anticoccidielt aktive quinolinderivater. | |
| DK118240B (da) | Fremgangsmåde til fremstilling af 1-p-chlorbenzoyl-2-methyl-5-methoxy- eller dimethylamino-3-indolyl-eddikesyre. |