DK127478B - N-Phenylmaleimidderivater med mikrobicid virkning. - Google Patents
N-Phenylmaleimidderivater med mikrobicid virkning.Info
- Publication number
- DK127478B DK127478B DK501969AA DK501969A DK127478B DK 127478 B DK127478 B DK 127478B DK 501969A A DK501969A A DK 501969AA DK 501969 A DK501969 A DK 501969A DK 127478 B DK127478 B DK 127478B
- Authority
- DK
- Denmark
- Prior art keywords
- microbicidal action
- phenylmaleimide derivatives
- phenylmaleimide
- derivatives
- microbicidal
- Prior art date
Links
- HIDBROSJWZYGSZ-UHFFFAOYSA-N 1-phenylpyrrole-2,5-dione Chemical class O=C1C=CC(=O)N1C1=CC=CC=C1 HIDBROSJWZYGSZ-UHFFFAOYSA-N 0.000 title 1
- 230000003641 microbiacidal effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/448—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide
- C07D207/452—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms, e.g. maleimide with hydrocarbon radicals, substituted by hetero atoms, directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/44—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members
- C07D207/444—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5
- C07D207/456—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having three double bonds between ring members or between ring members and non-ring members having two doubly-bound oxygen atoms directly attached in positions 2 and 5 with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7380068 | 1968-10-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK127478B true DK127478B (da) | 1973-11-12 |
Family
ID=13528597
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK501969AA DK127478B (da) | 1968-10-09 | 1969-09-19 | N-Phenylmaleimidderivater med mikrobicid virkning. |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3743654A (enFirst) |
| BE (1) | BE739960A (enFirst) |
| CH (1) | CH514283A (enFirst) |
| CS (1) | CS181654B2 (enFirst) |
| DE (1) | DE1949435C3 (enFirst) |
| DK (1) | DK127478B (enFirst) |
| ES (1) | ES371932A1 (enFirst) |
| FR (1) | FR2020206A1 (enFirst) |
| GB (1) | GB1238123A (enFirst) |
| IL (1) | IL33040A (enFirst) |
| NL (1) | NL143919B (enFirst) |
| PL (2) | PL80867B1 (enFirst) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179444A (en) * | 1976-02-11 | 1979-12-18 | Ciba-Geigy Corporation | Process for the manufacture of iso-imides or mixtures of iso-imides and imides |
| JPS6017764B2 (ja) * | 1976-07-10 | 1985-05-07 | イハラケミカル工業株式会社 | 水中生物忌避剤 |
| CN111316986B (zh) * | 2019-12-31 | 2021-10-15 | 浙江工业大学 | 顺丁烯二酰亚胺类化合物作为几丁质合成酶抑制剂的应用 |
-
1969
- 1969-09-11 US US00857217A patent/US3743654A/en not_active Expired - Lifetime
- 1969-09-19 DK DK501969AA patent/DK127478B/da unknown
- 1969-09-21 IL IL33040A patent/IL33040A/en unknown
- 1969-09-26 ES ES371932A patent/ES371932A1/es not_active Expired
- 1969-09-26 GB GB1238123D patent/GB1238123A/en not_active Expired
- 1969-09-30 DE DE1949435A patent/DE1949435C3/de not_active Expired
- 1969-10-02 CS CS6900006622A patent/CS181654B2/cs unknown
- 1969-10-06 FR FR6934028A patent/FR2020206A1/fr not_active Withdrawn
- 1969-10-08 CH CH1512369A patent/CH514283A/fr not_active IP Right Cessation
- 1969-10-08 BE BE739960D patent/BE739960A/xx unknown
- 1969-10-08 PL PL1969138858A patent/PL80867B1/pl unknown
- 1969-10-08 NL NL696915212A patent/NL143919B/xx not_active IP Right Cessation
- 1969-10-08 PL PL1969136215A patent/PL80283B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1949435A1 (de) | 1970-04-23 |
| CH514283A (fr) | 1971-10-31 |
| GB1238123A (enFirst) | 1971-07-07 |
| PL80283B1 (enFirst) | 1975-08-30 |
| ES371932A1 (es) | 1972-04-01 |
| DE1949435C3 (de) | 1974-01-24 |
| IL33040A (en) | 1973-01-30 |
| CS181654B2 (en) | 1978-03-31 |
| FR2020206A1 (enFirst) | 1970-07-10 |
| BE739960A (enFirst) | 1970-03-16 |
| US3743654A (en) | 1973-07-03 |
| NL6915212A (enFirst) | 1970-04-13 |
| PL80867B1 (enFirst) | 1975-08-30 |
| IL33040A0 (en) | 1969-11-30 |
| DE1949435B2 (de) | 1973-06-28 |
| NL143919B (nl) | 1974-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK127555B (da) | N-phenylsuccinimidderivater med mikrobiocid virkning. | |
| DK127478B (da) | N-Phenylmaleimidderivater med mikrobicid virkning. | |
| DK121081B (da) | Herbicidt virksomme N-arylurinstoffer. | |
| ES136525Y (es) | Columpio perfeccionado. | |
| ES143495Y (es) | Zumbador perfeccionado. | |
| ES141833Y (es) | Zumbador perfeccionado. | |
| ES144375Y (es) | Pasaporte-minuta perfeccionado. | |
| ES135102Y (es) | Mueble-cama perfeccionado. | |
| ES136695Y (es) | Bandeja-envase perfeccionada. | |
| ES181667Y (es) | Albitana perfeccionada. | |
| ES144179Y (es) | Parrilla-plancha perfeccionada. | |
| ES144054Y (es) | Armario-canastilla perfeccionado. | |
| ES144030Y (es) | Desatrancador perfeccionado. | |
| ES143995Y (es) | Caja-envase perfeccionada. | |
| ES143964Y (es) | Muneco perfeccionado. | |
| ES142956Y (es) | Llavero-carnet perfeccionado. | |
| ES142591Y (es) | Medalla-carnet perfeccionada. | |
| ES142315Y (es) | Braga-pantalon perfeccionada. | |
| ES137192Y (es) | Limpia-cristales perfeccionado. | |
| ES142311Y (es) | Butaca-sillon perfeccionada. | |
| ES141716Y (es) | Castanuela perfeccionada. | |
| ES141559Y (es) | Muneco perfeccionado. | |
| ES141087Y (es) | Calendario-llavero perfeccionado. | |
| ES140390Y (es) | Cama-cuna perfeccionada. | |
| ES140249Y (es) | Muneco perfeccionado. |