DK120801B - Fungicidt aktive 1-trityl-1,2,4-triazoler og syreadditionssalte deraf. - Google Patents
Fungicidt aktive 1-trityl-1,2,4-triazoler og syreadditionssalte deraf.Info
- Publication number
- DK120801B DK120801B DK459369AA DK459369A DK120801B DK 120801 B DK120801 B DK 120801B DK 459369A A DK459369A A DK 459369AA DK 459369 A DK459369 A DK 459369A DK 120801 B DK120801 B DK 120801B
- Authority
- DK
- Denmark
- Prior art keywords
- triazoles
- trityl
- acid addition
- addition salts
- fungicidally active
- Prior art date
Links
- HAGYXNVNFOULKK-UHFFFAOYSA-N 1-trityl-1,2,4-triazole Chemical class N1=CN=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 HAGYXNVNFOULKK-UHFFFAOYSA-N 0.000 title 1
- RXCMFQDTWCCLBL-UHFFFAOYSA-N 4-amino-3-hydroxynaphthalene-1-sulfonic acid Chemical class C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 RXCMFQDTWCCLBL-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681795249 DE1795249C3 (de) | 1968-08-28 | 1-Trityl-1,2,4-triazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK120801B true DK120801B (da) | 1971-07-19 |
Family
ID=5708114
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK459369AA DK120801B (da) | 1968-08-28 | 1969-08-27 | Fungicidt aktive 1-trityl-1,2,4-triazoler og syreadditionssalte deraf. |
Country Status (20)
| Country | Link |
|---|---|
| US (2) | US3682950A (cs) |
| JP (1) | JPS4828057B1 (cs) |
| AT (2) | AT291257B (cs) |
| BE (1) | BE738095A (cs) |
| BG (2) | BG16340A3 (cs) |
| BR (1) | BR6911924D0 (cs) |
| CH (1) | CH488713A (cs) |
| CS (1) | CS153050B2 (cs) |
| DK (1) | DK120801B (cs) |
| ES (1) | ES370939A1 (cs) |
| FR (1) | FR2016526A1 (cs) |
| GB (1) | GB1237509A (cs) |
| IL (1) | IL32758A (cs) |
| MY (1) | MY7400100A (cs) |
| NL (1) | NL165159C (cs) |
| PL (1) | PL80204B1 (cs) |
| RO (1) | RO56688A (cs) |
| SE (1) | SE349037B (cs) |
| TR (1) | TR18610A (cs) |
| YU (1) | YU35362B (cs) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1964995A1 (de) * | 1969-12-24 | 1971-07-01 | Bayer Ag | N-Benzyltriazole,Verfahren zu ihrer Herstellung und ihre Verwendung zur Regulierung des Pflanzenwachstums |
| DE2247186A1 (de) * | 1972-09-26 | 1974-03-28 | Bayer Ag | Antimykotisches mittel |
| DE2324424A1 (de) * | 1973-05-15 | 1974-12-05 | Bayer Ag | Antimikrobielle mittel |
| DE2407305C2 (de) * | 1974-02-15 | 1984-06-28 | Bayer Ag, 5090 Leverkusen | Triphenyl-1,2,3-triazol-1-yl-methane, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| US3922162A (en) * | 1974-03-28 | 1975-11-25 | Velsicol Chemical Corp | 2-Alkyl-4-aryl-1,2,4-triazolidin-3-ones |
| DE2502932C2 (de) * | 1975-01-24 | 1985-04-18 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von N-Trityl-azolen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2652313A1 (de) * | 1976-11-17 | 1978-05-18 | Basf Ag | Triazolderivate |
| WO1988007813A1 (en) * | 1987-04-14 | 1988-10-20 | Greencare Pty. Limited | Soil spreader |
| DE3931303A1 (de) * | 1989-09-20 | 1991-03-28 | Desowag Materialschutz Gmbh | Verfahren zum vorbeugenden materialschutz gegenueber staendig und/oder temporaer im boden lebenden schaedlingen, insbesondere termiten |
| GB9202779D0 (en) * | 1992-02-10 | 1992-03-25 | Ici Plc | Novel compounds |
| DE10248335A1 (de) * | 2002-10-17 | 2004-05-06 | Bayer Ag | Fungizide Wirkstoffkombinationen |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1215164B (de) * | 1964-01-25 | 1966-04-28 | Bayer Ag | Verfahren zur Herstellung von 1, 2, 4-Triazolen |
| US3321366A (en) * | 1965-11-15 | 1967-05-23 | Dow Chemical Co | Fungicidal methods and compositions |
-
1969
- 1969-07-24 CH CH1132969A patent/CH488713A/de not_active IP Right Cessation
- 1969-08-03 IL IL32758A patent/IL32758A/en unknown
- 1969-08-06 TR TR18610A patent/TR18610A/xx unknown
- 1969-08-08 US US848738A patent/US3682950A/en not_active Expired - Lifetime
- 1969-08-09 RO RO60763A patent/RO56688A/ro unknown
- 1969-08-18 BG BG012889A patent/BG16340A3/bg unknown
- 1969-08-25 GB GB42265/69A patent/GB1237509A/en not_active Expired
- 1969-08-25 SE SE11783/69A patent/SE349037B/xx unknown
- 1969-08-26 NL NL6913028.A patent/NL165159C/xx not_active IP Right Cessation
- 1969-08-27 YU YU2202/69A patent/YU35362B/xx unknown
- 1969-08-27 PL PL1969135558A patent/PL80204B1/pl unknown
- 1969-08-27 DK DK459369AA patent/DK120801B/da not_active IP Right Cessation
- 1969-08-28 ES ES370939A patent/ES370939A1/es not_active Expired
- 1969-08-28 BE BE738095A patent/BE738095A/fr not_active IP Right Cessation
- 1969-08-28 FR FR6929493A patent/FR2016526A1/fr not_active Withdrawn
- 1969-08-28 BR BR211924/69A patent/BR6911924D0/pt unknown
- 1969-08-28 AT AT823069A patent/AT291257B/de not_active IP Right Cessation
- 1969-08-28 JP JP44067634A patent/JPS4828057B1/ja active Pending
- 1969-08-28 AT AT760970A patent/AT295923B/de not_active IP Right Cessation
- 1969-08-28 CS CS590169A patent/CS153050B2/cs unknown
-
1970
- 1970-01-21 BG BG013789A patent/BG16166A3/bg unknown
-
1972
- 1972-04-19 US US00245603A patent/US3723622A/en not_active Expired - Lifetime
-
1974
- 1974-12-30 MY MY100/74A patent/MY7400100A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1237509A (en) | 1971-06-30 |
| NL165159C (nl) | 1981-03-16 |
| US3682950A (en) | 1972-08-08 |
| IL32758A0 (en) | 1969-11-12 |
| CH488713A (de) | 1970-04-15 |
| JPS4828057B1 (cs) | 1973-08-29 |
| CS153050B2 (cs) | 1974-02-22 |
| TR18610A (tr) | 1977-05-13 |
| FR2016526A1 (cs) | 1970-05-08 |
| YU35362B (en) | 1980-12-31 |
| BR6911924D0 (pt) | 1973-04-17 |
| IL32758A (en) | 1973-03-30 |
| NL6913028A (cs) | 1970-03-03 |
| BG16340A3 (bg) | 1972-08-20 |
| MY7400100A (en) | 1974-12-31 |
| AT295923B (de) | 1972-01-25 |
| DE1795249A1 (de) | 1971-12-30 |
| ES370939A1 (es) | 1971-11-01 |
| RO56688A (cs) | 1974-09-01 |
| DE1795249B2 (de) | 1975-11-06 |
| PL80204B1 (cs) | 1975-08-30 |
| YU220269A (en) | 1980-06-30 |
| SE349037B (cs) | 1972-09-18 |
| US3723622A (en) | 1973-03-27 |
| BG16166A3 (bg) | 1972-07-20 |
| NL165159B (nl) | 1980-10-15 |
| BE738095A (cs) | 1970-03-02 |
| AT291257B (de) | 1971-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK139357B (da) | Herbicidt virksomme 1,3,4-tiadiazolyl-(2)-urinstoffer. | |
| DK121676B (da) | Insekticid. | |
| DK120801B (da) | Fungicidt aktive 1-trityl-1,2,4-triazoler og syreadditionssalte deraf. | |
| CH558142A (de) | Herbizides mittel. | |
| DK128782B (da) | Herbicidt virksomme 1-(1,3,4-thiadiazol-2-yl)-imidazolidinon-(2)-derivater. | |
| DK127787B (da) | Herbicidt virksomme 1,3,4-thiadiazolyl-(5)-urinstofderivater. | |
| CH510393A (de) | Fungicides Mittel | |
| DK126498B (da) | Fungicidt aktive ureidophenylguanider. | |
| DK125506B (da) | Fungicid. | |
| DK125130B (da) | Thioureidobenzolderivater til anvendelse i fungicider og acaricider. | |
| DK123063B (da) | Fungicid. | |
| DK126499B (da) | Fungicidt aktive amidophenylguanidiner. | |
| DK129287B (da) | Fungicidt virksomme hydantoin-derivater. | |
| DK126013B (da) | Insecticid genstand. | |
| DK127665B (da) | Fungicidt og baktericidt præparat. | |
| DK126002B (da) | 1,3,4-tiadiazoler til anvendelse i fungicide og nematodicide midler. | |
| DK126320C (da) | Herbicidt virksomme anilinopropionohydroxamsyrederivater. | |
| DK126995B (da) | Herbicidt virksomme cycloalkyl-imidazolidin-2-on-1-carboxylsyreamider. | |
| DK131777B (da) | Herbicidt og fungicidt virksomme phenylketoximderivater. | |
| DK124759B (da) | Nematodicidt, insecticidt, acaricidt og jordfungicidt virksomme 1-alkoxy- eller -aryloxy-1-thiono-3-halogen- eller -3-alkylphospholiner. | |
| DK125392B (da) | Basisk substituerede 1-cyano-0-carbamoyl-formoximer til anvendelse i insekticider, acaricider og nematodicider. | |
| DK128893B (da) | Herbicidt virksomme 6-nitroanilin-derivater. | |
| DK121368B (da) | Phosphorthiolater til anvendelse i insecticider, fungicider og acaricider. | |
| DK128930B (da) | Herbicidt aktive, 1,3,4-thiadiazolonylurinstoffer. | |
| DK121479B (da) | Insecticid og acaricid. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |