DK113288B - Fremgangsmåde til fremstilling af dicumylperoxid, bis-(p-chlorcumyl)-eller bis-(3,4-dichlorcumyl)-peroxid. - Google Patents
Fremgangsmåde til fremstilling af dicumylperoxid, bis-(p-chlorcumyl)-eller bis-(3,4-dichlorcumyl)-peroxid.Info
- Publication number
- DK113288B DK113288B DK287062A DK287062A DK113288B DK 113288 B DK113288 B DK 113288B DK 287062 A DK287062 A DK 287062A DK 287062 A DK287062 A DK 287062A DK 113288 B DK113288 B DK 113288B
- Authority
- DK
- Denmark
- Prior art keywords
- bis
- peroxide
- dichlorocumyl
- chlorocumyl
- preparation
- Prior art date
Links
- BKBZRVOIRZAIFK-UHFFFAOYSA-N 1,2-dichloro-4-[2-[2-(3,4-dichlorophenyl)propan-2-ylperoxy]propan-2-yl]benzene Chemical compound C=1C=C(Cl)C(Cl)=CC=1C(C)(C)OOC(C)(C)C1=CC=C(Cl)C(Cl)=C1 BKBZRVOIRZAIFK-UHFFFAOYSA-N 0.000 title 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 title 1
- -1 p-chlorocumyl Chemical group 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/16—Peroxy compounds the —O—O— group being bound between two carbon atoms not further substituted by oxygen atoms, i.e. peroxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL266607 | 1961-06-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK113288B true DK113288B (da) | 1969-03-10 |
Family
ID=19753131
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK287062A DK113288B (da) | 1961-06-30 | 1962-06-27 | Fremgangsmåde til fremstilling af dicumylperoxid, bis-(p-chlorcumyl)-eller bis-(3,4-dichlorcumyl)-peroxid. |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE619409A (enExample) |
| CH (1) | CH415626A (enExample) |
| DE (1) | DE1216305B (enExample) |
| DK (1) | DK113288B (enExample) |
| GB (1) | GB961481A (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1243313A (en) * | 1970-02-20 | 1971-08-18 | Pennwalt Corp | Organic peroxides |
| US4241222A (en) * | 1979-09-13 | 1980-12-23 | Pennwalt Corporation | Process for the preparation of cumyl peroxides |
| US4243821A (en) * | 1979-09-13 | 1981-01-06 | Pennwalt Corporation | Process for the preparation of symmetrical dicumyl peroxides |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1064514B (de) * | 1956-08-10 | 1959-09-03 | Elektrochem Werke Muenchen Ag | Verfahren zur Herstellung von organischen Hydroperoxyden |
| DE1082596B (de) * | 1958-08-23 | 1960-06-02 | Elektrochem Werke Muenchen Ag | Verfahren zur Herstellung von Alkylhydroperoxyden oder von Dialkylperoxyden |
-
0
- BE BE619409D patent/BE619409A/xx unknown
-
1962
- 1962-06-23 DE DEK47065A patent/DE1216305B/de active Pending
- 1962-06-27 DK DK287062A patent/DK113288B/da unknown
- 1962-06-27 CH CH773862A patent/CH415626A/de unknown
- 1962-06-27 GB GB2473162A patent/GB961481A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE619409A (enExample) | |
| DE1216305B (de) | 1966-05-12 |
| GB961481A (en) | 1964-06-24 |
| CH415626A (de) | 1966-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK108455C (da) | Fremgangsmåde til fremstilling af i 5-stillingen usubstituerede 2-amino-benzophenoner. | |
| DK113288B (da) | Fremgangsmåde til fremstilling af dicumylperoxid, bis-(p-chlorcumyl)-eller bis-(3,4-dichlorcumyl)-peroxid. | |
| DK108227C (da) | Fremgangsmåde til fremstilling af 3-carbonhydridoxy-17α-halogenethinyl-19-nor-3,5-androstadien-17β-oler. | |
| DK108971C (da) | Fremgangsmåde til fremstilling af 6,17α -dimethylprogesteronderivater. | |
| DK113988B (da) | Fremgangsmåde til fremstilling af 1,6-dibrom-1,6-didesoxy-D-mannitol. | |
| DK124753B (da) | Analogifremgangsmåde til fremstilling af 13-alkyl-gonen-3,17-dioler. | |
| DK131428B (da) | Fremgangsmåde til enzymatisk fremstilling af alfa-aminobenzylpenicillin. | |
| DK116280B (da) | Fremgangsmåde til fremstilling af 4,5-dehydro-3-keto-19-nor-steroider. | |
| DK103081C (da) | Fremgangsmåde til fremstilling af 2,6-diketo-8-thiapuriner. | |
| DK98885C (da) | Fremgangsmåde til fremstilling af 18,19-dinor-13-β-n-propyl-17α-ethinyl-testosteron. | |
| DK115852B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-6-hydroxymethyl-7,8-dihydropteridin. | |
| DK105155C (da) | Fremgangsmåde til fremstilling af natruimslatet af 3,5-disulfaminobenzheparid. | |
| DK103671C (da) | Fremgangsmåde til fremstilling af 2,2'4,4'-tetrabrom-N-alkyl-diphenylaminer. | |
| DK99013C (da) | Fremgangsmåde til fremstilling af 6,16-dimethyl-1,4,15-pregnatrienderivater. | |
| DK98242C (da) | Fremgangsmåde til fremstilling af 6,16-dimethyl-17α-hydroxy-3,20-diketo-4,6,15-pregnatrienderivater. | |
| DK105033C (da) | Fremgangsmåde til fremstilling af D-6-methyl- eller 1,6-dimethyl-8-aminomethylergolin-N-acylderivater. | |
| DK102964C (da) | Fremgangsmåde til fremstilling af 4-oxo-6-sulfamyl-1,2,3,4-tetrahyrdoquinazolinonderivater. | |
| DK101736C (da) | Fremgangsmåde til fremstilling af 3-brom-3-klor-1,1,2,2-tetrafluorpropan. | |
| DK98496C (da) | Fremgangsmåde til fremstilling af 6-halogen-1,2α-metylen-Δ<6>-17α-acyloksyprogesteroner. | |
| DK97939C (da) | Fremgangsmåde til fremstilling af 3,11,20-trioxo-18-nor-Δ<4>-pregnen. | |
| DK108858C (da) | Fremgangsmåde til fremstilling af 19-hydroxy- eller 19-acyloxy-Δ<4,6>-3-oxo-steroider. | |
| DK104404C (da) | Fremgangsmåde til fremstilling af 10-alkenyl-δ<1,4>-3-keto-steroider. | |
| DK112870B (da) | Fremgangsmåde til fremstilling af 17α-metyl-Δ<1,4>-androstadien-17β-ol-3-on. | |
| DK98328C (da) | Fremgangsmåde til fremstilling af 3α-acyloxy-11-oxo-20,20-bis-phosphatomethyl-21-hydroxy-5β-pregnaner. | |
| DK99508C (da) | Fremgangsmåde til fremstilling af 7-halogen-2-dimethylamino-5-phenyl-3H-1,4-benzodiazepin-4-oxider. |