DK108455C - Fremgangsmåde til fremstilling af i 5-stillingen usubstituerede 2-amino-benzophenoner. - Google Patents
Fremgangsmåde til fremstilling af i 5-stillingen usubstituerede 2-amino-benzophenoner.Info
- Publication number
- DK108455C DK108455C DK396762AA DK396762A DK108455C DK 108455 C DK108455 C DK 108455C DK 396762A A DK396762A A DK 396762AA DK 396762 A DK396762 A DK 396762A DK 108455 C DK108455 C DK 108455C
- Authority
- DK
- Denmark
- Prior art keywords
- amino
- benzophenones
- unsubstituted
- preparation
- Prior art date
Links
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/22—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US137046A US3213139A (en) | 1961-09-11 | 1961-09-11 | Method for the preparation of 2-aminobenzophenones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK108455C true DK108455C (da) | 1967-12-18 |
Family
ID=22475591
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK396762AA DK108455C (da) | 1961-09-11 | 1962-09-11 | Fremgangsmåde til fremstilling af i 5-stillingen usubstituerede 2-amino-benzophenoner. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3213139A (da) |
| BE (1) | BE622079A (da) |
| BR (1) | BR6242663D0 (da) |
| CH (1) | CH420186A (da) |
| DE (1) | DE1257790B (da) |
| DK (1) | DK108455C (da) |
| ES (1) | ES280672A1 (da) |
| GB (1) | GB951301A (da) |
| NL (1) | NL282761A (da) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3426137A (en) * | 1965-12-23 | 1969-02-04 | Olin Mathieson | Hair growth inhibiting by aminobenzophenones |
| US4556738A (en) * | 1982-01-12 | 1985-12-03 | Mitsui Toatsu Chemicals, Inc. | Process for preparation of 3,3'- or 3,4'-diamino benzophenone |
| JPS59172441A (ja) * | 1983-03-23 | 1984-09-29 | Mitsui Toatsu Chem Inc | 3,3′−または3,4′−ジアミノベンゾフエノンの製造方法 |
| US5741818A (en) | 1995-06-07 | 1998-04-21 | University Of Saskatchewan | Semicarbazones having CNS activity and pharmaceutical preparations containing same |
| BR9809288A (pt) | 1997-04-22 | 2001-08-07 | Cocensys Inc | Semicarbazonas e tiosemicarbazonas substituìdas carbocìclicas e heterocìclicas e utilização das mesmas |
| DE69914763T2 (de) * | 1998-07-23 | 2004-07-15 | Nissan Chemical Industries, Ltd. | Verfahren zur herstellung einer 2-aminobenzophenonverbindung |
-
0
- NL NL282761D patent/NL282761A/xx unknown
- BE BE622079D patent/BE622079A/xx unknown
-
1961
- 1961-09-11 US US137046A patent/US3213139A/en not_active Expired - Lifetime
-
1962
- 1962-08-23 CH CH1004762A patent/CH420186A/de unknown
- 1962-08-25 DE DEH46755A patent/DE1257790B/de active Pending
- 1962-09-04 BR BR142663/62A patent/BR6242663D0/pt unknown
- 1962-09-06 GB GB34201/62A patent/GB951301A/en not_active Expired
- 1962-09-10 ES ES280672A patent/ES280672A1/es not_active Expired
- 1962-09-11 DK DK396762AA patent/DK108455C/da active
Also Published As
| Publication number | Publication date |
|---|---|
| NL282761A (da) | |
| CH420186A (de) | 1966-09-15 |
| US3213139A (en) | 1965-10-19 |
| BE622079A (da) | |
| DE1257790B (de) | 1968-01-04 |
| BR6242663D0 (pt) | 1973-05-24 |
| ES280672A1 (es) | 1963-03-01 |
| GB951301A (en) | 1964-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK104168C (da) | Fremgangsmåde til fremstilling af mono-biguanider. | |
| DK120490B (da) | Fremgangsmåde til fremstilling af thiaxanthenderivater. | |
| DK118242B (da) | Fremgangsmåde til fremstilling af anhydropenicilliner. | |
| DK108976C (da) | Fremgangsmåde til fremstilling af hendecapeptider. | |
| DK107027C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-benzisoxazoler. | |
| DK105767C (da) | Fremgangsmåde til fremstilling af basiske dibenzotiepinderivater. | |
| DK108455C (da) | Fremgangsmåde til fremstilling af i 5-stillingen usubstituerede 2-amino-benzophenoner. | |
| DK104234C (da) | Fremgangsmåde til fremstilling af distilbazolforbindelser. | |
| DK98960C (da) | Fremgangsmåde til fremstilling af sulfanilamidopyrimidinforbindelser. | |
| DK106184C (da) | Fremgangsmåde til fremstilling af alkylaralkylftalater. | |
| DK118082B (da) | Fremgangsmåde til fremstilling af 4-cyanthiazol. | |
| DK104136C (da) | Fremgangsmåde til fremstilling af benzensulfonylsemicarbazider. | |
| DK104055C (da) | Fremgangsmåde til fremstilling af 6-methoxytetraloner. | |
| DK104347C (da) | Fremgangsmåde til fremstilling af 16α-hydroxysteroider. | |
| DK122391B (da) | Analogifremgangsmåde til fremstilling af 2-hydroxybenzopyridocolinderivater. | |
| DK99260C (da) | Fremgangsmåde til fremstilling af 17-hemiketaler af androsten-17-ol-3-oner. | |
| DK99144C (da) | Fremgangsmåde til fremstilling af 2-β-metoksyætylpyridin. | |
| DK98560C (da) | Fremgangsmåde til fremstilling af 2-chlor-4-azaphenthiazin. | |
| DK100051C (da) | Fremgangsmåde til fremstilling af 17α-acyloxy-21-hydroxysteroider. | |
| DK103126C (da) | Fremgangsmåde til fremstilling af 2-β-metoksyætylpyridin. | |
| DK105411C (da) | Fremgangsmåde til fremstilling af 5-alkoxy-2-sulfanilylaminopyrimidiner. | |
| DK105700C (da) | Fremgangsmåde til fremstilling af nitrofurfuralcarbohydrazoner. | |
| DK102738C (da) | Fremgangsmåde til fremstilling af 1-dehydro-testosteron-17-acylater. | |
| DK101067C (da) | Fremgangsmåde til fremstilling af 3-methylchromon. | |
| DK102679C (da) | Fremgangsmåde til fremstilling af aldehydalkylalkoxyalkylhydrazoner. |