DK108581A - 2-penem-3-carboxylsyre-derivater og fremgangsmaade til fremstiling heraf - Google Patents
2-penem-3-carboxylsyre-derivater og fremgangsmaade til fremstiling herafInfo
- Publication number
- DK108581A DK108581A DK108581A DK108581A DK108581A DK 108581 A DK108581 A DK 108581A DK 108581 A DK108581 A DK 108581A DK 108581 A DK108581 A DK 108581A DK 108581 A DK108581 A DK 108581A
- Authority
- DK
- Denmark
- Prior art keywords
- penem
- procedures
- preparing
- carboxylic acid
- acid derivatives
- Prior art date
Links
- DUNKKIRUWZSMPT-RXMQYKEDSA-N (5r)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical class OC(=O)C1=CS[C@@H]2CC(=O)N12 DUNKKIRUWZSMPT-RXMQYKEDSA-N 0.000 title 1
- 238000000034 method Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/06—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D205/08—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams
- C07D205/09—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with one oxygen atom directly attached in position 2, e.g. beta-lactams with a sulfur atom directly attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D499/88—Compounds with a double bond between positions 2 and 3 and a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3001380A JPS56142282A (en) | 1980-03-10 | 1980-03-10 | Penem-3-carboxylic acid derivative and its preparation |
| JP3352980A JPS56142283A (en) | 1980-03-17 | 1980-03-17 | Penem-3-carboxylic acid derivative and its preparation |
| JP7476180A JPS572289A (en) | 1980-06-03 | 1980-06-03 | Production of penem-3-carboxylic derivative |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK108581A true DK108581A (da) | 1981-09-11 |
Family
ID=27286805
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK108581A DK108581A (da) | 1980-03-10 | 1981-03-10 | 2-penem-3-carboxylsyre-derivater og fremgangsmaade til fremstiling heraf |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4639441A (OSRAM) |
| CH (1) | CH653034A5 (OSRAM) |
| DD (1) | DD157801A5 (OSRAM) |
| DE (1) | DE3109086A1 (OSRAM) |
| DK (1) | DK108581A (OSRAM) |
| ES (1) | ES8205808A1 (OSRAM) |
| FR (1) | FR2477547A1 (OSRAM) |
| GB (1) | GB2074563B (OSRAM) |
| IT (1) | IT1172228B (OSRAM) |
| NL (1) | NL8101167A (OSRAM) |
| PL (1) | PL230074A1 (OSRAM) |
| SE (1) | SE8101464L (OSRAM) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0176064A1 (en) * | 1980-11-06 | 1986-04-02 | Hoechst Uk Limited | Intermediates for the production of 7-oxo-4-thia-1-aza[3,2,0]heptane and 7-oxo-4-thia-1-aza[3,2,0]hept-2-ene derivatives |
| EP0069378B1 (en) * | 1981-07-08 | 1987-01-07 | Hoechst Uk Limited | Antibacterial penem derivatives |
| US4748162A (en) * | 1982-03-01 | 1988-05-31 | Merck & Co., Inc. | 6-substituted-2-carbaminidoyl-pen-2-em-3-carboxylic acids |
| EP0087792A1 (en) * | 1982-03-01 | 1983-09-07 | Merck & Co. Inc. | 6-Substituted-2-carbamimidoyl-pen-2-em-3-carboxylic acids, process for preparing them and antibiotic compositions comprising them |
| DE3372773D1 (de) * | 1982-03-26 | 1987-09-03 | Hoechst Uk Ltd | 7-oxo-4-thia-1-azabicyclo(3,2,0)heptane derivatives |
| GB2159519B (en) * | 1982-03-26 | 1986-08-20 | Hoechst Uk Ltd | 7-oxo-4-thia-1-azabicyclo3,2,0heptane derivatives; azetidinones |
| US4443373A (en) * | 1982-03-30 | 1984-04-17 | Schering Corporation | Process for the production of antibiotic penems |
| US4456609A (en) * | 1983-01-31 | 1984-06-26 | Schering Corporation | (5R, 6S, 8R-6-(1-Hydroxyethyl)-2-(2-[methylaminocarbonyl]-ethylthio)-penem-3-carboxylic acid |
| ATE112778T1 (de) * | 1982-11-29 | 1994-10-15 | Schering Corp | Verfahren zur herstellung von penem-verbindungen. |
| US4530793A (en) * | 1982-11-29 | 1985-07-23 | Schering Corporation | Processes for the production of penems |
| EP0115308A3 (en) * | 1983-01-25 | 1984-10-10 | Merck & Co. Inc. | 2-unsaturated alkylthio-pen-2-em-3-carboxylic acids and process for preparing substituted 2-thioxopenams and 2-substituted thiopenems |
| US4675317A (en) * | 1983-01-25 | 1987-06-23 | Merck & Co., Inc. | 2-unsaturated alkylthio-pen-2-em-3-carboxylic acids |
| US4610823A (en) * | 1983-01-25 | 1986-09-09 | Merck & Co., Inc. | Process for preparing substituted 2-thioxopenams and 2-substituted thiopenems |
| GB9421816D0 (en) * | 1994-10-29 | 1994-12-14 | Smithkline Beecham Plc | Novel compounds |
| JPH09202789A (ja) * | 1995-11-20 | 1997-08-05 | Suntory Ltd | ペネム誘導体およびこれを含有する抗菌剤 |
| USD1101041S1 (en) * | 2022-06-09 | 2025-11-04 | Sainstore Technology Co., Ltd | Silicone pad |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5466695A (en) * | 1977-11-08 | 1979-05-29 | Sankyo Co Ltd | Azetidinone derivative and its preparation |
| US4301074A (en) * | 1977-11-17 | 1981-11-17 | Merck & Co., Inc. | 6-(1'-Hydroxyethyl)-2-substituted-pen-2-em-3-carboxylic acid |
| US4168314A (en) * | 1977-11-17 | 1979-09-18 | Merck & Co., Inc. | 6-(1'-Hydroxyethyl)-2-aminoethylthio-pen-2-em-3-carboxylic acid |
| EP0003960B1 (de) * | 1978-02-02 | 1983-06-29 | Ciba-Geigy Ag | 6-Substituierte Thia-Azaverbindungen, ihre Herstellung und diese enthaltende pharmazeutische Präparate |
| JPS559034A (en) * | 1978-07-05 | 1980-01-22 | Sankyo Co Ltd | Penem derivative and its preparation |
| US4272437A (en) * | 1978-12-18 | 1981-06-09 | Bristol-Myers Company | Antibacterial agents, and 4-thio azetidinone intermediates |
| IL59081A0 (en) * | 1979-01-10 | 1980-05-30 | Schering Corp | 2-penem compounds and a method for preparing them |
| EP0176064A1 (en) * | 1980-11-06 | 1986-04-02 | Hoechst Uk Limited | Intermediates for the production of 7-oxo-4-thia-1-aza[3,2,0]heptane and 7-oxo-4-thia-1-aza[3,2,0]hept-2-ene derivatives |
-
1981
- 1981-03-09 SE SE8101464A patent/SE8101464L/xx not_active Application Discontinuation
- 1981-03-10 GB GB8107415A patent/GB2074563B/en not_active Expired
- 1981-03-10 DD DD81228171A patent/DD157801A5/de unknown
- 1981-03-10 FR FR8104709A patent/FR2477547A1/fr active Granted
- 1981-03-10 DK DK108581A patent/DK108581A/da unknown
- 1981-03-10 IT IT67330/81A patent/IT1172228B/it active
- 1981-03-10 DE DE19813109086 patent/DE3109086A1/de active Granted
- 1981-03-10 ES ES500253A patent/ES8205808A1/es not_active Expired
- 1981-03-10 PL PL23007481A patent/PL230074A1/xx unknown
- 1981-03-10 CH CH1634/81A patent/CH653034A5/de not_active IP Right Cessation
- 1981-03-10 NL NL8101167A patent/NL8101167A/nl not_active Application Discontinuation
-
1984
- 1984-02-24 US US06/582,152 patent/US4639441A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ES500253A0 (es) | 1982-08-01 |
| CH653034A5 (de) | 1985-12-13 |
| DE3109086A1 (de) | 1981-12-24 |
| GB2074563A (en) | 1981-11-04 |
| IT1172228B (it) | 1987-06-18 |
| US4639441A (en) | 1987-01-27 |
| FR2477547A1 (fr) | 1981-09-11 |
| NL8101167A (nl) | 1981-10-01 |
| SE8101464L (sv) | 1981-09-11 |
| IT8167330A0 (it) | 1981-03-10 |
| ES8205808A1 (es) | 1982-08-01 |
| DD157801A5 (de) | 1982-12-08 |
| FR2477547B1 (OSRAM) | 1983-11-25 |
| GB2074563B (en) | 1984-05-10 |
| PL230074A1 (OSRAM) | 1982-06-21 |
| DE3109086C2 (OSRAM) | 1991-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK224781A (da) | Imidazo-rifamycin-derivater og fremgangsmaade til fremstilling deraf | |
| DK493583D0 (da) | Azolderivater og fremgangsmade til fremstilling deraf | |
| DK99382A (da) | Dichlorquinolinderivater og fremgangsmaade til fremstilling heraf | |
| DK493882A (da) | Faeldningskiselsyre og fremgangsmaade til fremstilling deraf | |
| DK304781A (da) | Formdel og fremgansmaade til fremstolling heraf | |
| DK574581A (da) | Delta2-1,2,4-triazolin-5-on-derivater og fremgangsmaade til fremstilling heraf | |
| DK30083A (da) | Diphosphonsyrederivater og fremgangsmaade til fremstilling deraf | |
| DK130182A (da) | Antagonister for argininvasopressin og fremgangsmaade til fremstilling heraf | |
| DK330582A (da) | Herbicidt virksomme 5-amino-1-phenylpyrazol-4-carboxylsyrederivater og fremgangsmaade til fremstilling deraf | |
| DK108581A (da) | 2-penem-3-carboxylsyre-derivater og fremgangsmaade til fremstiling heraf | |
| DK157683D0 (da) | N-phosphonomethylglycinderivater og fremgangsmade til fremstilling og anvendelse deraf | |
| DK567781A (da) | Phenoxyalkoxysilaner og fremgangsmaade til fremstilling heraf | |
| DK163917C (da) | Gamma-substituerede beta-hydroxybutansyrederivater og fremgangsmaade til fremstilling heraf | |
| DK537481A (da) | 5-amino-1-phenyl-4-cyanpyrazoler og fremgangsmaade til fremstilling heraf | |
| DK160744C (da) | Oxychloreringskatalysator-praekursor til oxychlorering og fremgangsmaade til fremstilling heraf | |
| DK199183D0 (da) | Quinolinderivater og fremgangsmade til fremstilling deraf | |
| DK375085A (da) | Quinolon-carboxylsyre-derivater og fremgangsmaade til fremstilling deraf | |
| DK401679A (da) | Furanderivater og fremgangsmaade til fremstilling deraf | |
| DK250381A (da) | Carbostyrilderivater og fremgangsmaade til fremstilling deraf | |
| DK271281A (da) | Haardfeldt og fremgangsmaade til fremstilling deraf | |
| DK313785D0 (da) | Dihydroorotsyrederivat og fremgangsmaade til fremstilling deraf | |
| DK144281A (da) | Cisplatin-oploesning og fremgangsmaade til fremstilling deraf | |
| DK220982A (da) | 7-oxoprostacyklinderivater og fremgangsmaade til fremstilling deraf | |
| DK135684A (da) | 2-cyano-imidazopyridin-derivater og fremgangsmaade til fremstilling heraf | |
| DK412081A (da) | Bis-tetrazolmethyl-thioler og fremgangsmaade til fremstilling heraf |