DEN0010517MA - - Google Patents
Info
- Publication number
- DEN0010517MA DEN0010517MA DEN0010517MA DE N0010517M A DEN0010517M A DE N0010517MA DE N0010517M A DEN0010517M A DE N0010517MA
- Authority
- DE
- Germany
- Prior art keywords
- heated
- sintering
- oxide
- powder mixture
- barium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000000203 mixture Substances 0.000 claims description 27
- 239000000843 powder Substances 0.000 claims description 25
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 20
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 13
- 238000005245 sintering Methods 0.000 claims description 12
- 230000005291 magnetic effect Effects 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 9
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 7
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 150000002739 metals Chemical class 0.000 claims description 6
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 claims description 5
- 239000003607 modifier Substances 0.000 claims description 5
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 4
- 239000013078 crystal Substances 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052788 barium Inorganic materials 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 229910052712 strontium Inorganic materials 0.000 claims description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 2
- 150000002506 iron compounds Chemical class 0.000 claims 1
- 239000000047 product Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 238000000227 grinding Methods 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Chemical compound O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 238000003801 milling Methods 0.000 description 2
- HJTAZXHBEBIQQX-UHFFFAOYSA-N 1,5-bis(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1CCl HJTAZXHBEBIQQX-UHFFFAOYSA-N 0.000 description 1
- -1 SrCO 3 Chemical compound 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- GOLCXWYRSKYTSP-UHFFFAOYSA-N arsenic trioxide Inorganic materials O1[As]2O[As]1O2 GOLCXWYRSKYTSP-UHFFFAOYSA-N 0.000 description 1
- 229910000416 bismuth oxide Inorganic materials 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- WETINTNJFLGREW-UHFFFAOYSA-N calcium;iron;tetrahydrate Chemical compound O.O.O.O.[Ca].[Fe].[Fe] WETINTNJFLGREW-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- TYIXMATWDRGMPF-UHFFFAOYSA-N dibismuth;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Bi+3].[Bi+3] TYIXMATWDRGMPF-UHFFFAOYSA-N 0.000 description 1
- 230000005294 ferromagnetic effect Effects 0.000 description 1
- 239000003302 ferromagnetic material Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- BDAGIHXWWSANSR-NJFSPNSNSA-N hydroxyformaldehyde Chemical compound O[14CH]=O BDAGIHXWWSANSR-NJFSPNSNSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- AJCDFVKYMIUXCR-UHFFFAOYSA-N oxobarium;oxo(oxoferriooxy)iron Chemical compound [Ba]=O.O=[Fe]O[Fe]=O.O=[Fe]O[Fe]=O.O=[Fe]O[Fe]=O.O=[Fe]O[Fe]=O.O=[Fe]O[Fe]=O.O=[Fe]O[Fe]=O AJCDFVKYMIUXCR-UHFFFAOYSA-N 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910000018 strontium carbonate Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE954277C (de) | Verfahren zur Herstellung eines anisotropen Dauermagnets und durch dieses Verfahren hergestellter Dauermagnet | |
| DE977105C (de) | Verwendung von Polyoxyden auf Eisenoxydbasis als dauermagnetisches Material | |
| DE977209C (de) | Verfahren zur Herstellung eines Dauermagneten aus Polyoxyden auf Eisenoxydbasis | |
| DE1558550B2 (de) | Dauermagnet | |
| DE112012003472T5 (de) | Verfahren zur Herstellung von Seltenerdmagneten und Seltenerdmagnete | |
| DE112018008152T5 (de) | Seltenerdmagnet, Seltenerd-Sputtermagnet, Seltenerddiffusionsmagnet und Verfahren zur Herstellung | |
| DE112012004742T5 (de) | Seltenerdmagnet unf Verfahren zu dessen Herstellung | |
| DE3885980T2 (de) | Magnet für einen Motor und Herstellungsverfahren. | |
| DE1300052B (de) | Verfahren zur Herstellung eines Ferrit-Dauermagneten hoher Koerzitivkraft | |
| DE2110489C3 (de) | Verfahren zur Herstellung von anisotropen Metalloxid Magneten | |
| DE10150830A1 (de) | Weichmagnetismus-Legierungspulver, ein Behandlungsverfahren davon, ein Weichmagnetismus-Legierungsformling und das Herstellungsverfahren davon | |
| DE69108829T2 (de) | Permanent magnetisierbares Puder vom R-Fe-B Typ und Verbundmagnet daraus. | |
| CH638566A5 (de) | Material fuer permanente magneten und verfahren zu dessen herstellung. | |
| DE2148554A1 (de) | Verfahren zur Herstellung eines polykristallinen Ferritkoerpers | |
| DE60220773T2 (de) | Verfahren zur herstellung eines sinterprodukts | |
| DE3626406A1 (de) | Verfahren zur herstellung von dauermagneten auf der basis von seltenerdmetallen | |
| DE60010385T2 (de) | Dauermagnetmaterialien vom typ r-fe-b und herstellungsverfahren dafür | |
| DE2705384C3 (de) | Dauermagnet-Legierung und Verfahren zur Wärmebehandlung gesinterter Dauermagnete | |
| DEN0010517MA (Direct) | ||
| DE2431698A1 (de) | Ferrit fuer magnetostriktive schwinger | |
| DE1239606B (de) | Verfahren zur Herstellung von ferromagnetischen Kernen mit weitgehend rechteckfoermiger Hysteresisschleife | |
| EP0243641B1 (de) | Verfahren zur Herstellung eines Dauermagnetwerkstoffes aus pulverförmigen Ausgangskomponenten | |
| EP0502397A2 (de) | Verfahren zur Herstellung eines weichmagnetischen, Fe-haltigen Werkstoffes mit hoher Sättigungsmagnetisierung und ultrafeiner Kornstruktur | |
| DE1471046B1 (de) | Mehrphasiger permanentmagnetischer Werkstoff sowie Verfahren zu dessen Herstellung | |
| DE69300828T2 (de) | Verfahren zum Abgleichen der Remanenzinduktion eines Sintermagneten und damit hergestelltes Produkt. |