DEF0010545MA - - Google Patents
Info
- Publication number
- DEF0010545MA DEF0010545MA DEF0010545MA DE F0010545M A DEF0010545M A DE F0010545MA DE F0010545M A DEF0010545M A DE F0010545MA
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- plastic
- kneadable
- finely divided
- methacrylic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 229920003023 plastic Polymers 0.000 claims description 37
- 239000004033 plastic Substances 0.000 claims description 36
- 239000000178 monomer Substances 0.000 claims description 35
- 229920000642 polymer Polymers 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 29
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 27
- 229920001577 copolymer Polymers 0.000 claims description 15
- 239000007788 liquid Substances 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 8
- 239000011324 bead Substances 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 238000002156 mixing Methods 0.000 claims description 5
- 239000004801 Chlorinated PVC Substances 0.000 claims description 4
- 229920000457 chlorinated polyvinyl chloride Polymers 0.000 claims description 4
- 238000009826 distribution Methods 0.000 claims description 4
- 238000006116 polymerization reaction Methods 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 229920003145 methacrylic acid copolymer Polymers 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims 1
- 229920002959 polymer blend Polymers 0.000 claims 1
- 239000011049 pearl Substances 0.000 description 10
- 125000005396 acrylic acid ester group Chemical group 0.000 description 6
- 230000002349 favourable effect Effects 0.000 description 6
- 239000011505 plaster Substances 0.000 description 6
- 239000004342 Benzoyl peroxide Substances 0.000 description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 5
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 description 5
- 150000004702 methyl esters Chemical class 0.000 description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 4
- 229920000915 polyvinyl chloride Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 229920001875 Ebonite Polymers 0.000 description 3
- 239000004908 Emulsion polymer Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000007720 emulsion polymerization reaction Methods 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 150000003455 sulfinic acids Chemical class 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- -1 acrylic ester Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- ZOMBKNNSYQHRCA-UHFFFAOYSA-J calcium sulfate hemihydrate Chemical compound O.[Ca+2].[Ca+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZOMBKNNSYQHRCA-UHFFFAOYSA-J 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000011507 gypsum plaster Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000012463 white pigment Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1929832C3 (de) | Zahnfüllmassen | |
| DE2121480A1 (de) | In Monomerem lösliche rontgenstrah lenundurchlassigeMethacrylatteilchen | |
| DE737058C (de) | Verfahren zur Herstellung von Prothesen fuer zahnaerztliche oder andere Zwecke aus polymerisierten organischen Verbindungen | |
| DE940493C (de) | Verfahren zur Herstellung von geformten Koerpern, insbesondere Zahnprothesen | |
| DE2718017C3 (de) | Verwendung einer selbsthärtenden Masse zur direkten Unterfütterung von Prothesen im Mund | |
| DE4402100A1 (de) | Kalt-polymerisierende Zahnharzzusammensetzung | |
| DE1217063B (de) | Verfahren zum Herstellen von Zahnprothesen aus Acrylsaeureesterpolymerisaten | |
| DE2530900C3 (de) | Formmassen | |
| EP3090723B1 (de) | Verfahren zur herstellung von dentalprothesen | |
| DEF0010545MA (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE1544919C3 (de) | Verfahren zur Herstellung von Zahn prothesen nach dem Pulver Flussigkeits Verfahren | |
| DE19851038A1 (de) | Verfahren zur Verarbeitung von dentalen Acrylharzen | |
| DE2101889C2 (de) | Anmischkomponente für medizinische Silikatzemente | |
| EP0138232B1 (de) | Masse zur Herstellung von plastischen bzw. harten Massen für dentaltechnische, (dental)medizinische und verwandte Zwecke, Verfahren zu deren Herstellung und Verwendung derselben | |
| CH324883A (de) | Verfahren zur Herstellung von geformten Körpern, insbesondere Zahnprothesen | |
| DE869695C (de) | Verfahren zur Herstellung eines Verbundkoerpers aus Polymerisationskunstharzen | |
| DE1769840C3 (de) | Durch Zusatz von Peroxyden härtende Masse auf der Basis von Methylmethacrylat-Polymerisaten | |
| DE865203C (de) | Verfahren zur Herstellung eines Verbundpolymerisates, insbesondere fuer die zahnaerztliche Prothetik | |
| DE1494345A1 (de) | Formoasse und Verfahren zu deren Herstellung | |
| DE19706064A1 (de) | Plastische aushärtbare Einkomponentenmasse, insbesondere zur Herstellung von Zahnprothesen | |
| DE1077376B (de) | Werkstoff zur weichbleibenden Unterfuetterung von Prothesen und zur Herstellung von Ergaenzungs-stuecken am menschlichen Koerper | |
| DE1570855C3 (de) | Verfahren zur Herstellung eines Pfropfmischpolymerisats | |
| DE1912516B2 (de) | Formmassen auf der grundlage hitzehaertbarer allylpolymerisate mit einem zusatz von metallverbindungen | |
| DE1292850B (de) | Verfahren zur Herstellung von Pfropfpolymerisaten | |
| DE919430C (de) | Verfahren zur Herstellung von Formkoerpern, insbesondere von Zahnersatz |