DEB0035750MA - - Google Patents
Info
- Publication number
- DEB0035750MA DEB0035750MA DEB0035750MA DE B0035750M A DEB0035750M A DE B0035750MA DE B0035750M A DEB0035750M A DE B0035750MA
- Authority
- DE
- Germany
- Prior art keywords
- epichlorohydrin
- ether
- mol
- parts
- diol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 32
- 150000002009 diols Chemical class 0.000 claims description 17
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 claims description 16
- 239000003054 catalyst Substances 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- DEWLEGDTCGBNGU-UHFFFAOYSA-N 1,3-dichloropropan-2-ol Chemical compound ClCC(O)CCl DEWLEGDTCGBNGU-UHFFFAOYSA-N 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 150000002170 ethers Chemical class 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical class C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 6
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 229910015900 BF3 Inorganic materials 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 3
- -1 monochlorohydrin ethers Chemical class 0.000 description 3
- SSZWWUDQMAHNAQ-UHFFFAOYSA-N 3-chloropropane-1,2-diol Chemical compound OCC(O)CCl SSZWWUDQMAHNAQ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- XENVCRGQTABGKY-ZHACJKMWSA-N chlorohydrin Chemical compound CC#CC#CC#CC#C\C=C\C(Cl)CO XENVCRGQTABGKY-ZHACJKMWSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0046731B1 (de) | Verfahren zur Herstellung von Di- und Polyallyläthern | |
| DE2160613A1 (de) | Verfahren zur herstellung von halogenhydrinen | |
| DE2947469A1 (de) | Verfahren zur herstellung von glycidylaethern ein- oder mehrwertiger phenole | |
| DE1022793B (de) | Verfahren zur Herstellung eines Kunstharzes aus Glycidylaethern eines mehrwertigen Phenols | |
| DE2522745C2 (de) | Verfahren zur Herstellung von Glycidäthern | |
| DE69106751T2 (de) | Zweistufiges Herstellungsverfahren für Monoethylenglykol. | |
| EP0025961A1 (de) | Verfahren zur Herstellung von 1,2-Diolen höherer Kohlenstoffzahl | |
| DE2402359C3 (de) | Verfahren zur Herstellung von GlycidyUthern ein- oder mehrwertiger Phenole | |
| CH425814A (de) | Verfahren zur Herstellung von Glycidpolyäthern mehrwertiger Phenole | |
| EP0009797B1 (de) | Verfahren zur gleichzeitigen Herstellung von Trioxan und cyclischen Formalen | |
| DE960185C (de) | Verfahren zur Herstellung von Diglycidaethern aus Diolen | |
| DEB0035750MA (enExample) | ||
| DE2854665C2 (enExample) | ||
| DE2028136B2 (de) | Verfahren zur Herstellung von niedermolekularen Polyglycidylethern | |
| DE2828420A1 (de) | Verfahren zur herstellung von polyglycidylaethern von mehrwertigen phenolen | |
| DE2656867A1 (de) | Verfahren zum herstellen von novolak-epoxy-harzen | |
| DE69410754T2 (de) | Verfahren zur herstellung von 2-n-butyl-2-ethyl-1, 3-propandiol | |
| DE68920108T2 (de) | Verfahren zur Herstellung von Epoxyharzen, die aliphatisches, nicht hydrolysierbares Chlorid enthalten. | |
| EP0186048B1 (de) | Verfahren zur Herstellung von niedermolekularen Glycidylethern ein- und mehrwertiger Phenole | |
| CH347510A (de) | Verfahren zur Herstellung von Diglycidyläthern von Diolen | |
| DE1493849A1 (de) | Verfahren zur Herstellung von Epoxydgruppen enthaltenden haertbaren Verbindungen | |
| DE3721495A1 (de) | Verfahren zur herstellung von 1,2,4-butantriol | |
| DE2144182C3 (de) | Epoxydierte Ester und Verfahren zu ihrer Herstellung | |
| DE2402358B2 (de) | Verfahren zur Herstellung von Glycidyläthern ein- oder mehrwertiger Phenole | |
| AT221506B (de) | Verfahren zur Herstellung von neuen Epoxydverbindungen |