DEB0028558MA - - Google Patents
Info
- Publication number
- DEB0028558MA DEB0028558MA DEB0028558MA DE B0028558M A DEB0028558M A DE B0028558MA DE B0028558M A DEB0028558M A DE B0028558MA
- Authority
- DE
- Germany
- Prior art keywords
- vinylidene chloride
- vinyl chloride
- copolymers
- chloride
- mixtures
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 claims description 17
- 229920001577 copolymer Polymers 0.000 claims description 17
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 9
- 125000005397 methacrylic acid ester group Chemical group 0.000 claims description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 3
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 238000007334 copolymerization reaction Methods 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000000178 monomer Substances 0.000 description 4
- -1 vinyl- Chemical group 0.000 description 4
- 239000000725 suspension Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LGXVIGDEPROXKC-UHFFFAOYSA-N 1,1-dichloroethene Chemical group ClC(Cl)=C LGXVIGDEPROXKC-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 125000005396 acrylic acid ester group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1911882C3 (enExample) | ||
| DE663469C (de) | Verfahren zur Herstellung von Polymerisationsprodukten | |
| DE1720854C3 (de) | Verfahren zur Herstellung makromolekularer wasserlöslicher Polymerisate | |
| DE2256154C3 (de) | Verfahren zur Herstellung von wäßrigen Dispersionen von Polymerisaten monoolefinisch ungesättigter Carbonsäureester | |
| EP0106111A1 (de) | Verfahren einer kontinuierlichen Herstellung von Copolymerisaten aus monoethylenisch ungesättigten Mono- und Dicarbonsäuren | |
| CH487943A (de) | Verfahren zur Herstellung von Homo- oder Copolymeren des Methylmethacrylats | |
| DE1058739B (de) | Verfahren zur Herstellung von Mischpolymerisaten | |
| DE3233776A1 (de) | Verfahren zur herstellung von copolymerisaten aus monoethylenisch ungesaettigten mono- und dicarbonsaeuren | |
| DE929876C (de) | Verfahren zur Herstellung von Kopolymerisationsprodukten | |
| EP0264710A1 (de) | Wasserlösliche quartäre Polyammoniumsalze, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| CH631464A5 (de) | Emulsionspolymerisationsverfahren zur herstellung von vinylchlorid-homo- oder copolymeren unter verwendung eines vorhomogenisierten gemischten emulgatorsystems. | |
| EP0590468A2 (de) | Verfahren zur Verringerung des Restmonomerengehaltes bei der Herstellung von Perlpolymerisaten | |
| DE745031C (de) | Verfahren zur Herstellung von Kunststoffen | |
| DE3503584C1 (de) | Verfahren zur Herstellung von Suspensionspolymerisaten | |
| DE2107651A1 (de) | Verfahren zur Herstellung eines mechanisch stabilen Polymerenlatex | |
| DE3134222A1 (de) | Verfahren zur herstellung von acrylkunststoffdispersionen | |
| DE950813C (de) | Verfahren zur Herstellung von Mischpolymerisaten aus Vinylidenchlorid, Vinylchlorid und Acrylsaeure- bzw. Methacrylsaeureestern in waessriger Suspension | |
| DE3751160T2 (de) | Terpolymer-Emulsionen. | |
| DEB0028558MA (enExample) | ||
| DE2103438A1 (de) | Verfahren zur Herstellung von schlagfesten, transparenten Polymerisaten des Vinylchlorids | |
| DE1006159B (de) | Verfahren zur Suspensions-Polymerisierung von Vinylmonomeren | |
| DE2241914C3 (de) | Verfahren zur Herstellung von Mischpolymerisaten | |
| DE2361743C2 (de) | Styrol-Acrylnitrilcopolymerisate hoher Wärmeformbeständigkeit | |
| DE854851C (de) | Verfahren zur Herstellung von Interpolymeren | |
| DE2053243A1 (de) | Vernetzte Maleinsaureanhydndmisch polymere, Verfahren zu deren Herstellung und Verwendung |